diff --git a/Documentation/arm64/cpu-feature-registers.rst b/Documentation/arm64/cpu-feature-registers.rst index 2955287e9acc..a42b5712d726 100644 --- a/Documentation/arm64/cpu-feature-registers.rst +++ b/Documentation/arm64/cpu-feature-registers.rst @@ -92,7 +92,7 @@ operation if the source belongs to the supported system register space. The infrastructure emulates only the following system register space:: - Op0=3, Op1=0, CRn=0, CRm=0,4,5,6,7 + Op0=3, Op1=0, CRn=0, CRm=0,2,3,4,5,6,7 (See Table C5-6 'System instruction encodings for non-Debug System register accesses' in ARMv8 ARM DDI 0487A.h, for the list of @@ -167,6 +167,42 @@ infrastructure: | EL0 | [3-0] | n | +------------------------------+---------+---------+ + 10) MVFR0_EL1 - AArch32 Media and VFP Feature Register 0 + + +------------------------------+---------+---------+ + | Name | bits | visible | + +------------------------------+---------+---------+ + | FPDP | [11-8] | y | + +------------------------------+---------+---------+ + + 11) MVFR1_EL1 - AArch32 Media and VFP Feature Register 1 + + +------------------------------+---------+---------+ + | Name | bits | visible | + +------------------------------+---------+---------+ + | SIMDFMAC | [31-28] | y | + +------------------------------+---------+---------+ + | SIMDSP | [19-16] | y | + +------------------------------+---------+---------+ + | SIMDInt | [15-12] | y | + +------------------------------+---------+---------+ + | SIMDLS | [11-8] | y | + +------------------------------+---------+---------+ + + 12) ID_ISAR5_EL1 - AArch32 Instruction Set Attribute Register 5 + + +------------------------------+---------+---------+ + | Name | bits | visible | + +------------------------------+---------+---------+ + | CRC32 | [19-16] | y | + +------------------------------+---------+---------+ + | SHA2 | [15-12] | y | + +------------------------------+---------+---------+ + | SHA1 | [11-8] | y | + +------------------------------+---------+---------+ + | AES | [7-4] | y | + +------------------------------+---------+---------+ + 3) MIDR_EL1 - Main ID Register diff --git a/Documentation/arm64/silicon-errata.rst b/Documentation/arm64/silicon-errata.rst index 6b70b6aabcff..00755541a9c5 100644 --- a/Documentation/arm64/silicon-errata.rst +++ b/Documentation/arm64/silicon-errata.rst @@ -88,12 +88,48 @@ stable kernels. +----------------+-----------------+-----------------+-----------------------------+ | ARM | Cortex-A76 | #1463225 | ARM64_ERRATUM_1463225 | +----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-A76 | #3324349 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-A77 | #3324348 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-A78 | #3324344 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-A78C | #3324346,3324347| ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-A710 | #3324338 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-A720 | #3456091 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-A725 | #3456106 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-X1 | #3324344 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-X1C | #3324346 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-X2 | #3324338 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-X3 | #3324335 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-X4 | #3194386 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Cortex-X925 | #3324334 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ | ARM | Neoverse-N1 | #1188873,1418040| ARM64_ERRATUM_1418040 | +----------------+-----------------+-----------------+-----------------------------+ | ARM | Neoverse-N1 | #1349291 | N/A | +----------------+-----------------+-----------------+-----------------------------+ | ARM | Neoverse-N1 | #1542419 | ARM64_ERRATUM_1542419 | +----------------+-----------------+-----------------+-----------------------------+ +| ARM | Neoverse-N1 | #3324349 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Neoverse-N2 | #3324339 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Neoverse-V1 | #3324341 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Neoverse-V2 | #3324336 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ +| ARM | Neoverse-V3 | #3312417 | ARM64_ERRATUM_3194386 | ++----------------+-----------------+-----------------+-----------------------------+ | ARM | MMU-500 | #841119,826419 | N/A | +----------------+-----------------+-----------------+-----------------------------+ +----------------+-----------------+-----------------+-----------------------------+ diff --git a/Documentation/process/deprecated.rst b/Documentation/process/deprecated.rst index 179f2a5625a0..95a3e7a40414 100644 --- a/Documentation/process/deprecated.rst +++ b/Documentation/process/deprecated.rst @@ -48,6 +48,9 @@ Instead, the 2-factor form of the allocator should be used:: foo = kmalloc_array(count, size, GFP_KERNEL); +Specifically, kmalloc() can be replaced with kmalloc_array(), and +kzalloc() can be replaced with kcalloc(). + If no 2-factor form is available, the saturate-on-overflow helpers should be used:: @@ -63,9 +66,20 @@ Instead, use the helper:: header = kzalloc(struct_size(header, item, count), GFP_KERNEL); -See :c:func:`array_size`, :c:func:`array3_size`, and :c:func:`struct_size`, -for more details as well as the related :c:func:`check_add_overflow` and -:c:func:`check_mul_overflow` family of functions. +For other calculations, please compose the use of the size_mul(), +size_add(), and size_sub() helpers. For example, in the case of:: + + foo = krealloc(current_size + chunk_size * (count - 3), GFP_KERNEL); + +Instead, use the helpers:: + + foo = krealloc(size_add(current_size, + size_mul(chunk_size, + size_sub(count, 3))), GFP_KERNEL); + +For more details, also see array3_size() and flex_array_size(), +as well as the related check_mul_overflow(), check_add_overflow(), +check_sub_overflow(), and check_shl_overflow() family of functions. simple_strtol(), simple_strtoll(), simple_strtoul(), simple_strtoull() ---------------------------------------------------------------------- diff --git a/Makefile b/Makefile index c9774f23edd0..200442e98ea5 100644 --- a/Makefile +++ b/Makefile @@ -1,7 +1,7 @@ # SPDX-License-Identifier: GPL-2.0 VERSION = 5 PATCHLEVEL = 4 -SUBLEVEL = 281 +SUBLEVEL = 283 EXTRAVERSION = NAME = Kleptomaniac Octopus diff --git a/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi b/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi index 5e454a694b78..254b3edc2bc1 100644 --- a/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi +++ b/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi @@ -259,8 +259,20 @@ &fec { pinctrl-names = "default"; pinctrl-0 = <&pinctrl_enet>; - phy-mode = "rgmii"; - phy-reset-gpios = <&gpio1 25 GPIO_ACTIVE_LOW>; + phy-connection-type = "rgmii-id"; + phy-handle = <ðphy>; + + mdio { + #address-cells = <1>; + #size-cells = <0>; + + ethphy: ethernet-phy@1 { + compatible = "ethernet-phy-ieee802.3-c22"; + reg = <1>; + reset-gpios = <&gpio2 1 GPIO_ACTIVE_LOW>; + reset-assert-us = <1000>; + }; + }; }; &i2c_intern { @@ -500,7 +512,7 @@ MX6QDL_PAD_ENET_MDIO__ENET_MDIO 0x1b0b0 MX6QDL_PAD_ENET_MDC__ENET_MDC 0x1b0b0 MX6QDL_PAD_ENET_REF_CLK__ENET_TX_CLK 0x1b0b0 - MX6QDL_PAD_ENET_CRS_DV__GPIO1_IO25 0x1b0b0 /* RST_GBE0_PHY# */ + MX6QDL_PAD_NANDF_D1__GPIO2_IO01 0x1b0b0 /* RST_GBE0_PHY# */ >; }; @@ -713,7 +725,7 @@ pinctrl-names = "default"; pinctrl-0 = <&pinctrl_pcie>; wake-up-gpio = <&gpio6 18 GPIO_ACTIVE_HIGH>; - reset-gpio = <&gpio3 13 GPIO_ACTIVE_HIGH>; + reset-gpio = <&gpio3 13 GPIO_ACTIVE_LOW>; }; /* LCD_BKLT_PWM */ @@ -801,5 +813,6 @@ /* CPLD is feeded by watchdog (hardwired) */ pinctrl-names = "default"; pinctrl-0 = <&pinctrl_wdog1>; + fsl,ext-reset-output; status = "okay"; }; diff --git a/arch/arm64/Kconfig b/arch/arm64/Kconfig index b76da6aa2383..220cd9d965ac 100644 --- a/arch/arm64/Kconfig +++ b/arch/arm64/Kconfig @@ -593,6 +593,44 @@ config ARM64_ERRATUM_1742098 If unsure, say Y. +config ARM64_ERRATUM_3194386 + bool "Cortex-*/Neoverse-*: workaround for MSR SSBS not self-synchronizing" + default y + help + This option adds the workaround for the following errata: + + * ARM Cortex-A76 erratum 3324349 + * ARM Cortex-A77 erratum 3324348 + * ARM Cortex-A78 erratum 3324344 + * ARM Cortex-A78C erratum 3324346 + * ARM Cortex-A78C erratum 3324347 + * ARM Cortex-A710 erratam 3324338 + * ARM Cortex-A720 erratum 3456091 + * ARM Cortex-A725 erratum 3456106 + * ARM Cortex-X1 erratum 3324344 + * ARM Cortex-X1C erratum 3324346 + * ARM Cortex-X2 erratum 3324338 + * ARM Cortex-X3 erratum 3324335 + * ARM Cortex-X4 erratum 3194386 + * ARM Cortex-X925 erratum 3324334 + * ARM Neoverse-N1 erratum 3324349 + * ARM Neoverse N2 erratum 3324339 + * ARM Neoverse-V1 erratum 3324341 + * ARM Neoverse V2 erratum 3324336 + * ARM Neoverse-V3 erratum 3312417 + + On affected cores "MSR SSBS, #0" instructions may not affect + subsequent speculative instructions, which may permit unexepected + speculative store bypassing. + + Work around this problem by placing a Speculation Barrier (SB) or + Instruction Synchronization Barrier (ISB) after kernel changes to + SSBS. The presence of the SSBS special-purpose register is hidden + from hwcaps and EL0 reads of ID_AA64PFR1_EL1, such that userspace + will use the PR_SPEC_STORE_BYPASS prctl to change SSBS. + + If unsure, say Y. + config CAVIUM_ERRATUM_22375 bool "Cavium erratum 22375, 24313" default y diff --git a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi index 0cb40326b0d3..e54473f98b02 100644 --- a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi +++ b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi @@ -326,8 +326,8 @@ <&reset RESET_HDMI_SYSTEM_RESET>, <&reset RESET_HDMI_TX>; reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy"; - clocks = <&clkc CLKID_HDMI_PCLK>, - <&clkc CLKID_CLK81>, + clocks = <&clkc CLKID_HDMI>, + <&clkc CLKID_HDMI_PCLK>, <&clkc CLKID_GCLK_VENCI_INT0>; clock-names = "isfr", "iahb", "venci"; }; diff --git a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi index 6809f495a503..308db3bc417b 100644 --- a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi +++ b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi @@ -273,8 +273,8 @@ <&reset RESET_HDMI_SYSTEM_RESET>, <&reset RESET_HDMI_TX>; reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy"; - clocks = <&clkc CLKID_HDMI_PCLK>, - <&clkc CLKID_CLK81>, + clocks = <&clkc CLKID_HDMI>, + <&clkc CLKID_HDMI_PCLK>, <&clkc CLKID_GCLK_VENCI_INT0>; clock-names = "isfr", "iahb", "venci"; }; diff --git a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts index eec9ec1db682..cdfcaac93234 100644 --- a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts +++ b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts @@ -235,8 +235,8 @@ /* eMMC is shared pin with parallel NAND */ emmc_pins_default: emmc-pins-default { mux { - function = "emmc", "emmc_rst"; - groups = "emmc"; + function = "emmc"; + groups = "emmc", "emmc_rst"; }; /* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7", diff --git a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts index ee57fccd489a..03fbc802985d 100644 --- a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts +++ b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts @@ -198,8 +198,8 @@ /* eMMC is shared pin with parallel NAND */ emmc_pins_default: emmc-pins-default { mux { - function = "emmc", "emmc_rst"; - groups = "emmc"; + function = "emmc"; + groups = "emmc", "emmc_rst"; }; /* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7", diff --git a/arch/arm64/boot/dts/qcom/msm8996.dtsi b/arch/arm64/boot/dts/qcom/msm8996.dtsi index 8bfb897b0e81..f82f23a10fae 100644 --- a/arch/arm64/boot/dts/qcom/msm8996.dtsi +++ b/arch/arm64/boot/dts/qcom/msm8996.dtsi @@ -1386,7 +1386,7 @@ <&gcc GCC_UFS_RX_SYMBOL_0_CLK>; freq-table-hz = <100000000 200000000>, - <0 0>, + <100000000 200000000>, <0 0>, <0 0>, <0 0>, diff --git a/arch/arm64/boot/dts/qcom/sdm845.dtsi b/arch/arm64/boot/dts/qcom/sdm845.dtsi index 06a9ed5b538f..b3b0b9c3be08 100644 --- a/arch/arm64/boot/dts/qcom/sdm845.dtsi +++ b/arch/arm64/boot/dts/qcom/sdm845.dtsi @@ -1635,6 +1635,8 @@ clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>, <&gcc GCC_UFS_PHY_PHY_AUX_CLK>; + power-domains = <&gcc UFS_PHY_GDSC>; + resets = <&ufs_mem_hc 0>; reset-names = "ufsphy"; status = "disabled"; diff --git a/arch/arm64/boot/dts/rockchip/rk3328.dtsi b/arch/arm64/boot/dts/rockchip/rk3328.dtsi index ef45d5607ea1..9f300719a8fd 100644 --- a/arch/arm64/boot/dts/rockchip/rk3328.dtsi +++ b/arch/arm64/boot/dts/rockchip/rk3328.dtsi @@ -763,8 +763,8 @@ <0>, <24000000>, <24000000>, <24000000>, <15000000>, <15000000>, - <100000000>, <100000000>, - <100000000>, <100000000>, + <300000000>, <100000000>, + <400000000>, <100000000>, <50000000>, <100000000>, <100000000>, <100000000>, <50000000>, <50000000>, diff --git a/arch/arm64/include/asm/cpucaps.h b/arch/arm64/include/asm/cpucaps.h index 5cc8141e10e7..280610c6daaf 100644 --- a/arch/arm64/include/asm/cpucaps.h +++ b/arch/arm64/include/asm/cpucaps.h @@ -58,6 +58,7 @@ #define ARM64_HAS_AMU_EXTN 48 #define ARM64_SPECTRE_BHB 49 #define ARM64_WORKAROUND_1742098 50 +#define ARM64_WORKAROUND_SPECULATIVE_SSBS 51 /* kabi: reserve 51 - 62 for future cpu capabilities */ #define ARM64_NCAPS 62 diff --git a/arch/arm64/include/asm/cputype.h b/arch/arm64/include/asm/cputype.h index 892fc0ceccb8..18b5267ff48e 100644 --- a/arch/arm64/include/asm/cputype.h +++ b/arch/arm64/include/asm/cputype.h @@ -80,6 +80,14 @@ #define ARM_CPU_PART_CORTEX_X2 0xD48 #define ARM_CPU_PART_NEOVERSE_N2 0xD49 #define ARM_CPU_PART_CORTEX_A78C 0xD4B +#define ARM_CPU_PART_CORTEX_X1C 0xD4C +#define ARM_CPU_PART_CORTEX_X3 0xD4E +#define ARM_CPU_PART_NEOVERSE_V2 0xD4F +#define ARM_CPU_PART_CORTEX_A720 0xD81 +#define ARM_CPU_PART_CORTEX_X4 0xD82 +#define ARM_CPU_PART_NEOVERSE_V3 0xD84 +#define ARM_CPU_PART_CORTEX_X925 0xD85 +#define ARM_CPU_PART_CORTEX_A725 0xD87 #define APM_CPU_PART_POTENZA 0x000 @@ -121,6 +129,14 @@ #define MIDR_CORTEX_X2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X2) #define MIDR_NEOVERSE_N2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_N2) #define MIDR_CORTEX_A78C MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_A78C) +#define MIDR_CORTEX_X1C MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X1C) +#define MIDR_CORTEX_X3 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X3) +#define MIDR_NEOVERSE_V2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_V2) +#define MIDR_CORTEX_A720 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_A720) +#define MIDR_CORTEX_X4 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X4) +#define MIDR_NEOVERSE_V3 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_V3) +#define MIDR_CORTEX_X925 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X925) +#define MIDR_CORTEX_A725 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_A725) #define MIDR_THUNDERX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX) #define MIDR_THUNDERX_81XX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX_81XX) #define MIDR_THUNDERX_83XX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX_83XX) diff --git a/arch/arm64/kernel/acpi_numa.c b/arch/arm64/kernel/acpi_numa.c index 7ff800045434..048b75cadd2f 100644 --- a/arch/arm64/kernel/acpi_numa.c +++ b/arch/arm64/kernel/acpi_numa.c @@ -27,7 +27,7 @@ #include -static int acpi_early_node_map[NR_CPUS] __initdata = { NUMA_NO_NODE }; +static int acpi_early_node_map[NR_CPUS] __initdata = { [0 ... NR_CPUS - 1] = NUMA_NO_NODE }; int __init acpi_numa_get_nid(unsigned int cpu) { diff --git a/arch/arm64/kernel/cpu_errata.c b/arch/arm64/kernel/cpu_errata.c index 342cba2ae982..20c8d39b71cd 100644 --- a/arch/arm64/kernel/cpu_errata.c +++ b/arch/arm64/kernel/cpu_errata.c @@ -372,6 +372,19 @@ void arm64_set_ssbd_mitigation(bool state) asm volatile(SET_PSTATE_SSBS(0)); else asm volatile(SET_PSTATE_SSBS(1)); + + /* + * SSBS is self-synchronizing and is intended to affect + * subsequent speculative instructions, but some CPUs can + * speculate with a stale value of SSBS. + * + * Mitigate this with an unconditional speculation barrier, as + * CPUs could mis-speculate branches and bypass a conditional + * barrier. + */ + if (IS_ENABLED(CONFIG_ARM64_ERRATUM_3194386)) + spec_bar(); + return; } @@ -828,6 +841,30 @@ static struct midr_range broken_aarch32_aes[] = { }; #endif +#ifdef CONFIG_ARM64_ERRATUM_3194386 +static const struct midr_range erratum_spec_ssbs_list[] = { + MIDR_ALL_VERSIONS(MIDR_CORTEX_A76), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A77), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A78), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A78C), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A710), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A720), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A725), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X1), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X1C), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X2), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X3), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X4), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X925), + MIDR_ALL_VERSIONS(MIDR_NEOVERSE_N1), + MIDR_ALL_VERSIONS(MIDR_NEOVERSE_N2), + MIDR_ALL_VERSIONS(MIDR_NEOVERSE_V1), + MIDR_ALL_VERSIONS(MIDR_NEOVERSE_V2), + MIDR_ALL_VERSIONS(MIDR_NEOVERSE_V3), + {} +}; +#endif + const struct arm64_cpu_capabilities arm64_errata[] = { #ifdef CONFIG_ARM64_WORKAROUND_CLEAN_CACHE { @@ -1016,6 +1053,13 @@ const struct arm64_cpu_capabilities arm64_errata[] = { CAP_MIDR_RANGE_LIST(broken_aarch32_aes), .type = ARM64_CPUCAP_LOCAL_CPU_ERRATUM, }, +#endif +#ifdef CONFIG_ARM64_ERRATUM_3194386 + { + .desc = "SSBS not fully self-synchronizing", + .capability = ARM64_WORKAROUND_SPECULATIVE_SSBS, + ERRATA_MIDR_RANGE_LIST(erratum_spec_ssbs_list), + }, #endif { } diff --git a/arch/arm64/kernel/cpufeature.c b/arch/arm64/kernel/cpufeature.c index 4a646327e3b7..d6966f190956 100644 --- a/arch/arm64/kernel/cpufeature.c +++ b/arch/arm64/kernel/cpufeature.c @@ -293,6 +293,30 @@ static const struct arm64_ftr_bits ftr_id_aa64dfr0[] = { ARM64_FTR_END, }; +static const struct arm64_ftr_bits ftr_mvfr0[] = { + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPROUND_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPSHVEC_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPSQRT_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPDIVIDE_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPTRAP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPDP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPSP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_SIMD_SHIFT, 4, 0), + ARM64_FTR_END, +}; + +static const struct arm64_ftr_bits ftr_mvfr1[] = { + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDFMAC_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_FPHP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDHP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDSP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDINT_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDLS_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_FPDNAN_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_FPFTZ_SHIFT, 4, 0), + ARM64_FTR_END, +}; + static const struct arm64_ftr_bits ftr_mvfr2[] = { ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, 4, 4, 0), /* FPMisc */ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, 0, 4, 0), /* SIMDMisc */ @@ -308,10 +332,10 @@ static const struct arm64_ftr_bits ftr_dczid[] = { static const struct arm64_ftr_bits ftr_id_isar5[] = { ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_RDM_SHIFT, 4, 0), - ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_CRC32_SHIFT, 4, 0), - ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA2_SHIFT, 4, 0), - ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA1_SHIFT, 4, 0), - ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_AES_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_CRC32_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA2_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA1_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_AES_SHIFT, 4, 0), ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SEVL_SHIFT, 4, 0), ARM64_FTR_END, }; @@ -351,7 +375,7 @@ static const struct arm64_ftr_bits ftr_zcr[] = { * Common ftr bits for a 32bit register with all hidden, strict * attributes, with 4bit feature fields and a default safe value of * 0. Covers the following 32bit registers: - * id_isar[0-4], id_mmfr[1-3], id_pfr1, mvfr[0-1] + * id_isar[1-3], id_mmfr[1-3] */ static const struct arm64_ftr_bits ftr_generic_32bits[] = { ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, 28, 4, 0), @@ -406,8 +430,8 @@ static const struct __ftr_reg_entry { ARM64_FTR_REG(SYS_ID_MMFR4_EL1, ftr_id_mmfr4), /* Op1 = 0, CRn = 0, CRm = 3 */ - ARM64_FTR_REG(SYS_MVFR0_EL1, ftr_generic_32bits), - ARM64_FTR_REG(SYS_MVFR1_EL1, ftr_generic_32bits), + ARM64_FTR_REG(SYS_MVFR0_EL1, ftr_mvfr0), + ARM64_FTR_REG(SYS_MVFR1_EL1, ftr_mvfr1), ARM64_FTR_REG(SYS_MVFR2_EL1, ftr_mvfr2), /* Op1 = 0, CRn = 0, CRm = 4 */ @@ -876,17 +900,39 @@ feature_matches(u64 reg, const struct arm64_cpu_capabilities *entry) return val >= entry->min_field_value; } +static u64 +read_scoped_sysreg(const struct arm64_cpu_capabilities *entry, int scope) +{ + WARN_ON(scope == SCOPE_LOCAL_CPU && preemptible()); + if (scope == SCOPE_SYSTEM) + return read_sanitised_ftr_reg(entry->sys_reg); + else + return __read_sysreg_by_encoding(entry->sys_reg); +} + +static bool +has_user_cpuid_feature(const struct arm64_cpu_capabilities *entry, int scope) +{ + int mask; + struct arm64_ftr_reg *regp; + u64 val = read_scoped_sysreg(entry, scope); + + regp = get_arm64_ftr_reg(entry->sys_reg); + if (!regp) + return false; + + mask = cpuid_feature_extract_unsigned_field(regp->user_mask, + entry->field_pos); + if (!mask) + return false; + + return feature_matches(val, entry); +} + static bool has_cpuid_feature(const struct arm64_cpu_capabilities *entry, int scope) { - u64 val; - - WARN_ON(scope == SCOPE_LOCAL_CPU && preemptible()); - if (scope == SCOPE_SYSTEM) - val = read_sanitised_ftr_reg(entry->sys_reg); - else - val = __read_sysreg_by_encoding(entry->sys_reg); - + u64 val = read_scoped_sysreg(entry, scope); return feature_matches(val, entry); } @@ -1329,6 +1375,17 @@ static bool can_use_gic_priorities(const struct arm64_cpu_capabilities *entry, } #endif +static void user_feature_fixup(void) +{ + if (cpus_have_cap(ARM64_WORKAROUND_SPECULATIVE_SSBS)) { + struct arm64_ftr_reg *regp; + + regp = get_arm64_ftr_reg(SYS_ID_AA64PFR1_EL1); + if (regp) + regp->user_mask &= ~GENMASK(7, 4); /* SSBS */ + } +} + static void elf_hwcap_fixup(void) { #ifdef CONFIG_ARM64_ERRATUM_1742098 @@ -1659,7 +1716,7 @@ static const struct arm64_cpu_capabilities arm64_features[] = { }; #define HWCAP_CPUID_MATCH(reg, field, s, min_value) \ - .matches = has_cpuid_feature, \ + .matches = has_user_cpuid_feature, \ .sys_reg = reg, \ .field_pos = field, \ .sign = s, \ @@ -2176,6 +2233,7 @@ void __init setup_cpu_features(void) setup_system_capabilities(); mark_const_caps_ready(); + user_feature_fixup(); setup_elf_hwcaps(arm64_elf_hwcaps); if (system_supports_32bit_el0()) { @@ -2214,7 +2272,7 @@ static void __maybe_unused cpu_enable_cnp(struct arm64_cpu_capabilities const *c /* * We emulate only the following system register space. - * Op0 = 0x3, CRn = 0x0, Op1 = 0x0, CRm = [0, 4 - 7] + * Op0 = 0x3, CRn = 0x0, Op1 = 0x0, CRm = [0, 2 - 7] * See Table C5-6 System instruction encodings for System register accesses, * ARMv8 ARM(ARM DDI 0487A.f) for more details. */ @@ -2224,7 +2282,7 @@ static inline bool __attribute_const__ is_emulated(u32 id) sys_reg_CRn(id) == 0x0 && sys_reg_Op1(id) == 0x0 && (sys_reg_CRm(id) == 0 || - ((sys_reg_CRm(id) >= 4) && (sys_reg_CRm(id) <= 7)))); + ((sys_reg_CRm(id) >= 2) && (sys_reg_CRm(id) <= 7)))); } /* diff --git a/arch/m68k/amiga/config.c b/arch/m68k/amiga/config.c index c32ab8041cf6..eb2f0dcf8591 100644 --- a/arch/m68k/amiga/config.c +++ b/arch/m68k/amiga/config.c @@ -180,6 +180,15 @@ int __init amiga_parse_bootinfo(const struct bi_record *record) dev->slotsize = be16_to_cpu(cd->cd_SlotSize); dev->boardaddr = be32_to_cpu(cd->cd_BoardAddr); dev->boardsize = be32_to_cpu(cd->cd_BoardSize); + + /* CS-LAB Warp 1260 workaround */ + if (be16_to_cpu(dev->rom.er_Manufacturer) == ZORRO_MANUF(ZORRO_PROD_CSLAB_WARP_1260) && + dev->rom.er_Product == ZORRO_PROD(ZORRO_PROD_CSLAB_WARP_1260)) { + + /* turn off all interrupts */ + pr_info("Warp 1260 card detected: applying interrupt storm workaround\n"); + *(uint32_t *)(dev->boardaddr + 0x1000) = 0xfff; + } } else pr_warn("amiga_parse_bootinfo: too many AutoConfig devices\n"); #endif /* CONFIG_ZORRO */ diff --git a/arch/m68k/atari/ataints.c b/arch/m68k/atari/ataints.c index 56f02ea2c248..715d1e0d973e 100644 --- a/arch/m68k/atari/ataints.c +++ b/arch/m68k/atari/ataints.c @@ -302,11 +302,7 @@ void __init atari_init_IRQ(void) if (ATARIHW_PRESENT(SCU)) { /* init the SCU if present */ - tt_scu.sys_mask = 0x10; /* enable VBL (for the cursor) and - * disable HSYNC interrupts (who - * needs them?) MFP and SCC are - * enabled in VME mask - */ + tt_scu.sys_mask = 0x0; /* disable all interrupts */ tt_scu.vme_mask = 0x60; /* enable MFP and SCC ints */ } else { /* If no SCU and no Hades, the HSYNC interrupt needs to be diff --git a/arch/m68k/include/asm/cmpxchg.h b/arch/m68k/include/asm/cmpxchg.h index 38e1d7acc44d..1f996713ce87 100644 --- a/arch/m68k/include/asm/cmpxchg.h +++ b/arch/m68k/include/asm/cmpxchg.h @@ -33,7 +33,7 @@ static inline unsigned long __xchg(unsigned long x, volatile void * ptr, int siz x = tmp; break; default: - tmp = __invalid_xchg_size(x, ptr, size); + x = __invalid_xchg_size(x, ptr, size); break; } diff --git a/arch/mips/include/asm/mips-cm.h b/arch/mips/include/asm/mips-cm.h index 23c67c0871b1..696b40beb774 100644 --- a/arch/mips/include/asm/mips-cm.h +++ b/arch/mips/include/asm/mips-cm.h @@ -228,6 +228,10 @@ GCR_ACCESSOR_RO(32, 0x0d0, gic_status) GCR_ACCESSOR_RO(32, 0x0f0, cpc_status) #define CM_GCR_CPC_STATUS_EX BIT(0) +/* GCR_ACCESS - Controls core/IOCU access to GCRs */ +GCR_ACCESSOR_RW(32, 0x120, access_cm3) +#define CM_GCR_ACCESS_ACCESSEN GENMASK(7, 0) + /* GCR_L2_CONFIG - Indicates L2 cache configuration when Config5.L2C=1 */ GCR_ACCESSOR_RW(32, 0x130, l2_config) #define CM_GCR_L2_CONFIG_BYPASS BIT(20) diff --git a/arch/mips/kernel/smp-cps.c b/arch/mips/kernel/smp-cps.c index f659adb681bc..02ae0b29e688 100644 --- a/arch/mips/kernel/smp-cps.c +++ b/arch/mips/kernel/smp-cps.c @@ -229,7 +229,10 @@ static void boot_core(unsigned int core, unsigned int vpe_id) write_gcr_co_reset_ext_base(CM_GCR_Cx_RESET_EXT_BASE_UEB); /* Ensure the core can access the GCRs */ - set_gcr_access(1 << core); + if (mips_cm_revision() < CM_REV_CM3) + set_gcr_access(1 << core); + else + set_gcr_access_cm3(1 << core); if (mips_cpc_present()) { /* Reset the core */ diff --git a/arch/mips/pci/pcie-octeon.c b/arch/mips/pci/pcie-octeon.c old mode 100755 new mode 100644 diff --git a/arch/openrisc/kernel/setup.c b/arch/openrisc/kernel/setup.c index ae104eb4becc..bd0ba3157d51 100644 --- a/arch/openrisc/kernel/setup.c +++ b/arch/openrisc/kernel/setup.c @@ -280,6 +280,9 @@ void calibrate_delay(void) void __init setup_arch(char **cmdline_p) { + /* setup memblock allocator */ + setup_memory(); + unflatten_and_copy_device_tree(); setup_cpuinfo(); @@ -304,9 +307,6 @@ void __init setup_arch(char **cmdline_p) initrd_below_start_ok = 1; #endif - /* setup memblock allocator */ - setup_memory(); - /* paging_init() sets up the MMU and marks all pages as reserved */ paging_init(); diff --git a/arch/parisc/kernel/irq.c b/arch/parisc/kernel/irq.c index b4aa5af943ba..c4c06bcd0483 100644 --- a/arch/parisc/kernel/irq.c +++ b/arch/parisc/kernel/irq.c @@ -520,7 +520,7 @@ void do_cpu_irq_mask(struct pt_regs *regs) old_regs = set_irq_regs(regs); local_irq_disable(); - irq_enter(); + irq_enter_rcu(); eirr_val = mfctl(23) & cpu_eiem & per_cpu(local_ack_eiem, cpu); if (!eirr_val) @@ -555,7 +555,7 @@ void do_cpu_irq_mask(struct pt_regs *regs) #endif /* CONFIG_IRQSTACKS */ out: - irq_exit(); + irq_exit_rcu(); set_irq_regs(old_regs); return; diff --git a/arch/powerpc/boot/simple_alloc.c b/arch/powerpc/boot/simple_alloc.c index 65ec135d0157..bc99f75b8582 100644 --- a/arch/powerpc/boot/simple_alloc.c +++ b/arch/powerpc/boot/simple_alloc.c @@ -114,8 +114,11 @@ static void *simple_realloc(void *ptr, unsigned long size) return ptr; new = simple_malloc(size); - memcpy(new, ptr, p->size); - simple_free(ptr); + if (new) { + memcpy(new, ptr, p->size); + simple_free(ptr); + } + return new; } diff --git a/arch/powerpc/kvm/powerpc.c b/arch/powerpc/kvm/powerpc.c index eb8c72846b7f..7c5986aec64e 100644 --- a/arch/powerpc/kvm/powerpc.c +++ b/arch/powerpc/kvm/powerpc.c @@ -1950,8 +1950,10 @@ static int kvm_vcpu_ioctl_enable_cap(struct kvm_vcpu *vcpu, break; r = -ENXIO; - if (!xive_enabled()) + if (!xive_enabled()) { + fdput(f); break; + } r = -EPERM; dev = kvm_device_from_filp(f.file); diff --git a/arch/powerpc/sysdev/xics/icp-native.c b/arch/powerpc/sysdev/xics/icp-native.c index 7d13d2ef5a90..66de291b27d0 100644 --- a/arch/powerpc/sysdev/xics/icp-native.c +++ b/arch/powerpc/sysdev/xics/icp-native.c @@ -235,6 +235,8 @@ static int __init icp_native_map_one_cpu(int hw_id, unsigned long addr, rname = kasprintf(GFP_KERNEL, "CPU %d [0x%x] Interrupt Presentation", cpu, hw_id); + if (!rname) + return -ENOMEM; if (!request_mem_region(addr, size, rname)) { pr_warn("icp_native: Could not reserve ICP MMIO for CPU %d, interrupt server #0x%x\n", cpu, hw_id); diff --git a/arch/powerpc/xmon/ppc-dis.c b/arch/powerpc/xmon/ppc-dis.c index 75fa98221d48..af105e1bc3fc 100644 --- a/arch/powerpc/xmon/ppc-dis.c +++ b/arch/powerpc/xmon/ppc-dis.c @@ -122,32 +122,21 @@ int print_insn_powerpc (unsigned long insn, unsigned long memaddr) bool insn_is_short; ppc_cpu_t dialect; - dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON - | PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_ALTIVEC; + dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON; - if (cpu_has_feature(CPU_FTRS_POWER5)) - dialect |= PPC_OPCODE_POWER5; + if (IS_ENABLED(CONFIG_PPC64)) + dialect |= PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_CELL | + PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 | PPC_OPCODE_POWER8 | + PPC_OPCODE_POWER9; - if (cpu_has_feature(CPU_FTRS_CELL)) - dialect |= (PPC_OPCODE_CELL | PPC_OPCODE_ALTIVEC); + if (cpu_has_feature(CPU_FTR_TM)) + dialect |= PPC_OPCODE_HTM; - if (cpu_has_feature(CPU_FTRS_POWER6)) - dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_ALTIVEC); + if (cpu_has_feature(CPU_FTR_ALTIVEC)) + dialect |= PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2; - if (cpu_has_feature(CPU_FTRS_POWER7)) - dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 - | PPC_OPCODE_ALTIVEC | PPC_OPCODE_VSX); - - if (cpu_has_feature(CPU_FTRS_POWER8)) - dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 - | PPC_OPCODE_POWER8 | PPC_OPCODE_HTM - | PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2 | PPC_OPCODE_VSX); - - if (cpu_has_feature(CPU_FTRS_POWER9)) - dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 - | PPC_OPCODE_POWER8 | PPC_OPCODE_POWER9 | PPC_OPCODE_HTM - | PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2 - | PPC_OPCODE_VSX | PPC_OPCODE_VSX3); + if (cpu_has_feature(CPU_FTR_VSX)) + dialect |= PPC_OPCODE_VSX | PPC_OPCODE_VSX3; /* Get the major opcode of the insn. */ opcode = NULL; diff --git a/arch/s390/include/asm/uv.h b/arch/s390/include/asm/uv.h index ef3c00b049ab..67f63b76dc18 100644 --- a/arch/s390/include/asm/uv.h +++ b/arch/s390/include/asm/uv.h @@ -97,7 +97,10 @@ static inline int share(unsigned long addr, u16 cmd) if (!uv_call(0, (u64)&uvcb)) return 0; - return -EINVAL; + pr_err("%s UVC failed (rc: 0x%x, rrc: 0x%x), possible hypervisor bug.\n", + uvcb.header.cmd == UVC_CMD_SET_SHARED_ACCESS ? "Share" : "Unshare", + uvcb.header.rc, uvcb.header.rrc); + panic("System security cannot be guaranteed unless the system panics now.\n"); } /* diff --git a/arch/sparc/include/asm/oplib_64.h b/arch/sparc/include/asm/oplib_64.h index a67abebd4359..1b86d02a8455 100644 --- a/arch/sparc/include/asm/oplib_64.h +++ b/arch/sparc/include/asm/oplib_64.h @@ -247,6 +247,7 @@ void prom_sun4v_guest_soft_state(void); int prom_ihandle2path(int handle, char *buffer, int bufsize); /* Client interface level routines. */ +void prom_cif_init(void *cif_handler); void p1275_cmd_direct(unsigned long *); #endif /* !(__SPARC64_OPLIB_H) */ diff --git a/arch/sparc/prom/init_64.c b/arch/sparc/prom/init_64.c index 103aa9104318..f7b8a1a865b8 100644 --- a/arch/sparc/prom/init_64.c +++ b/arch/sparc/prom/init_64.c @@ -26,9 +26,6 @@ phandle prom_chosen_node; * routines in the prom library. * It gets passed the pointer to the PROM vector. */ - -extern void prom_cif_init(void *); - void __init prom_init(void *cif_handler) { phandle node; diff --git a/arch/sparc/prom/p1275.c b/arch/sparc/prom/p1275.c index 889aa602f8d8..51c3f984bbf7 100644 --- a/arch/sparc/prom/p1275.c +++ b/arch/sparc/prom/p1275.c @@ -49,7 +49,7 @@ void p1275_cmd_direct(unsigned long *args) local_irq_restore(flags); } -void prom_cif_init(void *cif_handler, void *cif_stack) +void prom_cif_init(void *cif_handler) { p1275buf.prom_cif_handler = (void (*)(long *))cif_handler; } diff --git a/arch/um/kernel/time.c b/arch/um/kernel/time.c index 94ea87bd231c..3ccbb42c171c 100644 --- a/arch/um/kernel/time.c +++ b/arch/um/kernel/time.c @@ -256,9 +256,9 @@ int setup_time_travel_start(char *str) return 1; } -__setup("time-travel-start", setup_time_travel_start); +__setup("time-travel-start=", setup_time_travel_start); __uml_help(setup_time_travel_start, -"time-travel-start=\n" +"time-travel-start=\n" "Configure the UML instance's wall clock to start at this value rather than\n" "the host's wall clock at the time of UML boot.\n"); #endif diff --git a/arch/x86/events/intel/pt.c b/arch/x86/events/intel/pt.c index f4d2322f4c62..99b286b6c200 100644 --- a/arch/x86/events/intel/pt.c +++ b/arch/x86/events/intel/pt.c @@ -827,7 +827,7 @@ static void pt_update_head(struct pt *pt) */ static void *pt_buffer_region(struct pt_buffer *buf) { - return phys_to_virt(TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT); + return phys_to_virt((phys_addr_t)TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT); } /** @@ -935,7 +935,7 @@ pt_topa_entry_for_page(struct pt_buffer *buf, unsigned int pg) * order allocations, there shouldn't be many of these. */ list_for_each_entry(topa, &buf->tables, list) { - if (topa->offset + topa->size > pg << PAGE_SHIFT) + if (topa->offset + topa->size > (unsigned long)pg << PAGE_SHIFT) goto found; } diff --git a/arch/x86/events/intel/pt.h b/arch/x86/events/intel/pt.h index 1d2bb7572374..c2d00a072952 100644 --- a/arch/x86/events/intel/pt.h +++ b/arch/x86/events/intel/pt.h @@ -33,8 +33,8 @@ struct topa_entry { u64 rsvd2 : 1; u64 size : 4; u64 rsvd3 : 2; - u64 base : 36; - u64 rsvd4 : 16; + u64 base : 40; + u64 rsvd4 : 12; }; /* TSC to Core Crystal Clock Ratio */ diff --git a/arch/x86/kernel/cpu/mtrr/mtrr.c b/arch/x86/kernel/cpu/mtrr/mtrr.c index 4482819bb13c..d967305c163b 100644 --- a/arch/x86/kernel/cpu/mtrr/mtrr.c +++ b/arch/x86/kernel/cpu/mtrr/mtrr.c @@ -817,7 +817,7 @@ void mtrr_save_state(void) { int first_cpu; - if (!mtrr_enabled()) + if (!mtrr_enabled() || !mtrr_state.have_fixed) return; first_cpu = cpumask_first(cpu_online_mask); diff --git a/arch/x86/kernel/devicetree.c b/arch/x86/kernel/devicetree.c index 8d85e00bb40a..04c5f2587799 100644 --- a/arch/x86/kernel/devicetree.c +++ b/arch/x86/kernel/devicetree.c @@ -91,7 +91,7 @@ static int x86_of_pci_irq_enable(struct pci_dev *dev) ret = pci_read_config_byte(dev, PCI_INTERRUPT_PIN, &pin); if (ret) - return ret; + return pcibios_err_to_errno(ret); if (!pin) return 0; diff --git a/arch/x86/kernel/process.c b/arch/x86/kernel/process.c index b8de27bb6e09..c402b079b74e 100644 --- a/arch/x86/kernel/process.c +++ b/arch/x86/kernel/process.c @@ -793,7 +793,10 @@ unsigned long arch_align_stack(unsigned long sp) unsigned long arch_randomize_brk(struct mm_struct *mm) { - return randomize_page(mm->brk, 0x02000000); + if (mmap_is_ia32()) + return randomize_page(mm->brk, SZ_32M); + + return randomize_page(mm->brk, SZ_1G); } /* diff --git a/arch/x86/mm/pti.c b/arch/x86/mm/pti.c index 6b68c19208c9..b23474735798 100644 --- a/arch/x86/mm/pti.c +++ b/arch/x86/mm/pti.c @@ -375,14 +375,14 @@ pti_clone_pgtable(unsigned long start, unsigned long end, */ *target_pmd = *pmd; - addr += PMD_SIZE; + addr = round_up(addr + 1, PMD_SIZE); } else if (level == PTI_CLONE_PTE) { /* Walk the page-table down to the pte level */ pte = pte_offset_kernel(pmd, addr); if (pte_none(*pte)) { - addr += PAGE_SIZE; + addr = round_up(addr + 1, PAGE_SIZE); continue; } @@ -402,7 +402,7 @@ pti_clone_pgtable(unsigned long start, unsigned long end, /* Clone the PTE */ *target_pte = *pte; - addr += PAGE_SIZE; + addr = round_up(addr + 1, PAGE_SIZE); } else { BUG(); diff --git a/arch/x86/pci/intel_mid_pci.c b/arch/x86/pci/intel_mid_pci.c index eea5a0f3b959..63513968f561 100644 --- a/arch/x86/pci/intel_mid_pci.c +++ b/arch/x86/pci/intel_mid_pci.c @@ -223,9 +223,9 @@ static int intel_mid_pci_irq_enable(struct pci_dev *dev) return 0; ret = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi); - if (ret < 0) { + if (ret) { dev_warn(&dev->dev, "Failed to read interrupt line: %d\n", ret); - return ret; + return pcibios_err_to_errno(ret); } switch (intel_mid_identify_cpu()) { diff --git a/arch/x86/pci/xen.c b/arch/x86/pci/xen.c index 9cf8f5417e7f..f93e03b23645 100644 --- a/arch/x86/pci/xen.c +++ b/arch/x86/pci/xen.c @@ -37,10 +37,10 @@ static int xen_pcifront_enable_irq(struct pci_dev *dev) u8 gsi; rc = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi); - if (rc < 0) { + if (rc) { dev_warn(&dev->dev, "Xen PCI: failed to read interrupt line: %d\n", rc); - return rc; + return pcibios_err_to_errno(rc); } /* In PV DomU the Xen PCI backend puts the PIRQ in the interrupt line.*/ pirq = gsi; diff --git a/arch/x86/platform/intel/iosf_mbi.c b/arch/x86/platform/intel/iosf_mbi.c index 9e2444500428..117cabcfe29d 100644 --- a/arch/x86/platform/intel/iosf_mbi.c +++ b/arch/x86/platform/intel/iosf_mbi.c @@ -62,7 +62,7 @@ static int iosf_mbi_pci_read_mdr(u32 mcrx, u32 mcr, u32 *mdr) fail_read: dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result); - return result; + return pcibios_err_to_errno(result); } static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr) @@ -91,7 +91,7 @@ static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr) fail_write: dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result); - return result; + return pcibios_err_to_errno(result); } int iosf_mbi_read(u8 port, u8 opcode, u32 offset, u32 *mdr) diff --git a/arch/x86/xen/p2m.c b/arch/x86/xen/p2m.c index 8b1e40ec58f6..bfe6e862e13e 100644 --- a/arch/x86/xen/p2m.c +++ b/arch/x86/xen/p2m.c @@ -741,7 +741,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops, * immediate unmapping. */ map_ops[i].status = GNTST_general_error; - unmap[0].host_addr = map_ops[i].host_addr, + unmap[0].host_addr = map_ops[i].host_addr; unmap[0].handle = map_ops[i].handle; map_ops[i].handle = ~0; if (map_ops[i].flags & GNTMAP_device_map) @@ -751,7 +751,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops, if (kmap_ops) { kmap_ops[i].status = GNTST_general_error; - unmap[1].host_addr = kmap_ops[i].host_addr, + unmap[1].host_addr = kmap_ops[i].host_addr; unmap[1].handle = kmap_ops[i].handle; kmap_ops[i].handle = ~0; if (kmap_ops[i].flags & GNTMAP_device_map) diff --git a/drivers/acpi/battery.c b/drivers/acpi/battery.c index a49a09e3de1b..af78f76a2872 100644 --- a/drivers/acpi/battery.c +++ b/drivers/acpi/battery.c @@ -681,12 +681,18 @@ static ssize_t acpi_battery_alarm_store(struct device *dev, return count; } -static const struct device_attribute alarm_attr = { +static struct device_attribute alarm_attr = { .attr = {.name = "alarm", .mode = 0644}, .show = acpi_battery_alarm_show, .store = acpi_battery_alarm_store, }; +static struct attribute *acpi_battery_attrs[] = { + &alarm_attr.attr, + NULL +}; +ATTRIBUTE_GROUPS(acpi_battery); + /* * The Battery Hooking API * @@ -823,7 +829,10 @@ static void __exit battery_hook_exit(void) static int sysfs_add_battery(struct acpi_battery *battery) { - struct power_supply_config psy_cfg = { .drv_data = battery, }; + struct power_supply_config psy_cfg = { + .drv_data = battery, + .attr_grp = acpi_battery_groups, + }; bool full_cap_broken = false; if (!ACPI_BATTERY_CAPACITY_VALID(battery->full_charge_capacity) && @@ -868,7 +877,7 @@ static int sysfs_add_battery(struct acpi_battery *battery) return result; } battery_hook_add_battery(battery); - return device_create_file(&battery->bat->dev, &alarm_attr); + return 0; } static void sysfs_remove_battery(struct acpi_battery *battery) @@ -879,7 +888,6 @@ static void sysfs_remove_battery(struct acpi_battery *battery) return; } battery_hook_remove_battery(battery); - device_remove_file(&battery->bat->dev, &alarm_attr); power_supply_unregister(battery->bat); battery->bat = NULL; mutex_unlock(&battery->sysfs_lock); diff --git a/drivers/acpi/sbs.c b/drivers/acpi/sbs.c index 6e88224f60f0..4aa55d8d4385 100644 --- a/drivers/acpi/sbs.c +++ b/drivers/acpi/sbs.c @@ -80,7 +80,6 @@ struct acpi_battery { u16 spec; u8 id; u8 present:1; - u8 have_sysfs_alarm:1; }; #define to_acpi_battery(x) power_supply_get_drvdata(x) @@ -465,12 +464,18 @@ static ssize_t acpi_battery_alarm_store(struct device *dev, return count; } -static const struct device_attribute alarm_attr = { +static struct device_attribute alarm_attr = { .attr = {.name = "alarm", .mode = 0644}, .show = acpi_battery_alarm_show, .store = acpi_battery_alarm_store, }; +static struct attribute *acpi_battery_attrs[] = { + &alarm_attr.attr, + NULL +}; +ATTRIBUTE_GROUPS(acpi_battery); + /* -------------------------------------------------------------------------- Driver Interface -------------------------------------------------------------------------- */ @@ -512,7 +517,10 @@ static int acpi_battery_read(struct acpi_battery *battery) static int acpi_battery_add(struct acpi_sbs *sbs, int id) { struct acpi_battery *battery = &sbs->battery[id]; - struct power_supply_config psy_cfg = { .drv_data = battery, }; + struct power_supply_config psy_cfg = { + .drv_data = battery, + .attr_grp = acpi_battery_groups, + }; int result; battery->id = id; @@ -542,10 +550,6 @@ static int acpi_battery_add(struct acpi_sbs *sbs, int id) goto end; } - result = device_create_file(&battery->bat->dev, &alarm_attr); - if (result) - goto end; - battery->have_sysfs_alarm = 1; end: printk(KERN_INFO PREFIX "%s [%s]: Battery Slot [%s] (battery %s)\n", ACPI_SBS_DEVICE_NAME, acpi_device_bid(sbs->device), @@ -557,11 +561,8 @@ static void acpi_battery_remove(struct acpi_sbs *sbs, int id) { struct acpi_battery *battery = &sbs->battery[id]; - if (battery->bat) { - if (battery->have_sysfs_alarm) - device_remove_file(&battery->bat->dev, &alarm_attr); + if (battery->bat) power_supply_unregister(battery->bat); - } } static int acpi_charger_add(struct acpi_sbs *sbs) diff --git a/drivers/android/binder.c b/drivers/android/binder.c index 43fb1c0c9034..5489e2b349ef 100644 --- a/drivers/android/binder.c +++ b/drivers/android/binder.c @@ -525,9 +525,7 @@ static bool binder_has_work(struct binder_thread *thread, bool do_proc_work) static bool binder_available_for_proc_work_ilocked(struct binder_thread *thread) { return !thread->transaction_stack && - binder_worklist_empty_ilocked(&thread->todo) && - (thread->looper & (BINDER_LOOPER_STATE_ENTERED | - BINDER_LOOPER_STATE_REGISTERED)); + binder_worklist_empty_ilocked(&thread->todo); } static void binder_wakeup_poll_threads_ilocked(struct binder_proc *proc, diff --git a/drivers/ata/libata-core.c b/drivers/ata/libata-core.c index d1d279107a72..2ee0ee2b4752 100644 --- a/drivers/ata/libata-core.c +++ b/drivers/ata/libata-core.c @@ -6141,6 +6141,9 @@ static void ata_host_release(struct kref *kref) for (i = 0; i < host->n_ports; i++) { struct ata_port *ap = host->ports[i]; + if (!ap) + continue; + kfree(ap->pmp_link); kfree(ap->slave_link); kfree(ap); diff --git a/drivers/atm/idt77252.c b/drivers/atm/idt77252.c index 605e992d25df..06e2fea1ffa9 100644 --- a/drivers/atm/idt77252.c +++ b/drivers/atm/idt77252.c @@ -1117,8 +1117,8 @@ dequeue_rx(struct idt77252_dev *card, struct rsq_entry *rsqe) rpp->len += skb->len; if (stat & SAR_RSQE_EPDU) { + unsigned int len, truesize; unsigned char *l1l2; - unsigned int len; l1l2 = (unsigned char *) ((unsigned long) skb->data + skb->len - 6); @@ -1188,14 +1188,15 @@ dequeue_rx(struct idt77252_dev *card, struct rsq_entry *rsqe) ATM_SKB(skb)->vcc = vcc; __net_timestamp(skb); + truesize = skb->truesize; vcc->push(vcc, skb); atomic_inc(&vcc->stats->rx); - if (skb->truesize > SAR_FB_SIZE_3) + if (truesize > SAR_FB_SIZE_3) add_rx_skb(card, 3, SAR_FB_SIZE_3, 1); - else if (skb->truesize > SAR_FB_SIZE_2) + else if (truesize > SAR_FB_SIZE_2) add_rx_skb(card, 2, SAR_FB_SIZE_2, 1); - else if (skb->truesize > SAR_FB_SIZE_1) + else if (truesize > SAR_FB_SIZE_1) add_rx_skb(card, 1, SAR_FB_SIZE_1, 1); else add_rx_skb(card, 0, SAR_FB_SIZE_0, 1); diff --git a/drivers/base/core.c b/drivers/base/core.c index c1cf15fdf395..410ac543a0a3 100644 --- a/drivers/base/core.c +++ b/drivers/base/core.c @@ -25,6 +25,7 @@ #include #include #include +#include #include #include @@ -1831,6 +1832,7 @@ static int dev_uevent(struct kset *kset, struct kobject *kobj, struct kobj_uevent_env *env) { struct device *dev = kobj_to_dev(kobj); + struct device_driver *driver; int retval = 0; /* add device node properties if present */ @@ -1859,8 +1861,12 @@ static int dev_uevent(struct kset *kset, struct kobject *kobj, if (dev->type && dev->type->name) add_uevent_var(env, "DEVTYPE=%s", dev->type->name); - if (dev->driver) - add_uevent_var(env, "DRIVER=%s", dev->driver->name); + /* Synchronize with module_remove_driver() */ + rcu_read_lock(); + driver = READ_ONCE(dev->driver); + if (driver) + add_uevent_var(env, "DRIVER=%s", driver->name); + rcu_read_unlock(); /* Add common DT information about the device */ of_device_uevent(dev, env); @@ -1930,11 +1936,8 @@ static ssize_t uevent_show(struct device *dev, struct device_attribute *attr, if (!env) return -ENOMEM; - /* Synchronize with really_probe() */ - device_lock(dev); /* let the kset specific function add its keys */ retval = kset->uevent_ops->uevent(kset, &dev->kobj, env); - device_unlock(dev); if (retval) goto out; diff --git a/drivers/base/devres.c b/drivers/base/devres.c index 0bbb328bd17f..5a84bafae328 100644 --- a/drivers/base/devres.c +++ b/drivers/base/devres.c @@ -1111,7 +1111,11 @@ EXPORT_SYMBOL_GPL(__devm_alloc_percpu); */ void devm_free_percpu(struct device *dev, void __percpu *pdata) { - WARN_ON(devres_destroy(dev, devm_percpu_release, devm_percpu_match, - (void *)pdata)); + /* + * Use devres_release() to prevent memory leakage as + * devm_free_pages() does. + */ + WARN_ON(devres_release(dev, devm_percpu_release, devm_percpu_match, + (__force void *)pdata)); } EXPORT_SYMBOL_GPL(devm_free_percpu); diff --git a/drivers/base/module.c b/drivers/base/module.c index 46ad4d636731..851cc5367c04 100644 --- a/drivers/base/module.c +++ b/drivers/base/module.c @@ -7,6 +7,7 @@ #include #include #include +#include #include "base.h" static char *make_driver_name(struct device_driver *drv) @@ -77,6 +78,9 @@ void module_remove_driver(struct device_driver *drv) if (!drv) return; + /* Synchronize with dev_uevent() */ + synchronize_rcu(); + sysfs_remove_link(&drv->p->kobj, "module"); if (drv->owner) diff --git a/drivers/block/rbd.c b/drivers/block/rbd.c index fd0cdced8024..996b4e10a29e 100644 --- a/drivers/block/rbd.c +++ b/drivers/block/rbd.c @@ -366,7 +366,7 @@ enum rbd_watch_state { enum rbd_lock_state { RBD_LOCK_STATE_UNLOCKED, RBD_LOCK_STATE_LOCKED, - RBD_LOCK_STATE_RELEASING, + RBD_LOCK_STATE_QUIESCING, }; /* WatchNotify::ClientId */ @@ -427,7 +427,7 @@ struct rbd_device { struct list_head running_list; struct completion acquire_wait; int acquire_err; - struct completion releasing_wait; + struct completion quiescing_wait; spinlock_t object_map_lock; u8 *object_map; @@ -519,7 +519,7 @@ static bool __rbd_is_lock_owner(struct rbd_device *rbd_dev) lockdep_assert_held(&rbd_dev->lock_rwsem); return rbd_dev->lock_state == RBD_LOCK_STATE_LOCKED || - rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING; + rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING; } static bool rbd_is_lock_owner(struct rbd_device *rbd_dev) @@ -3608,13 +3608,14 @@ static void rbd_lock_del_request(struct rbd_img_request *img_req) lockdep_assert_held(&rbd_dev->lock_rwsem); spin_lock(&rbd_dev->lock_lists_lock); if (!list_empty(&img_req->lock_item)) { + rbd_assert(!list_empty(&rbd_dev->running_list)); list_del_init(&img_req->lock_item); - need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING && + need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING && list_empty(&rbd_dev->running_list)); } spin_unlock(&rbd_dev->lock_lists_lock); if (need_wakeup) - complete(&rbd_dev->releasing_wait); + complete(&rbd_dev->quiescing_wait); } static int rbd_img_exclusive_lock(struct rbd_img_request *img_req) @@ -3627,11 +3628,6 @@ static int rbd_img_exclusive_lock(struct rbd_img_request *img_req) if (rbd_lock_add_request(img_req)) return 1; - if (rbd_dev->opts->exclusive) { - WARN_ON(1); /* lock got released? */ - return -EROFS; - } - /* * Note the use of mod_delayed_work() in rbd_acquire_lock() * and cancel_delayed_work() in wake_lock_waiters(). @@ -4281,16 +4277,16 @@ static bool rbd_quiesce_lock(struct rbd_device *rbd_dev) /* * Ensure that all in-flight IO is flushed. */ - rbd_dev->lock_state = RBD_LOCK_STATE_RELEASING; - rbd_assert(!completion_done(&rbd_dev->releasing_wait)); + rbd_dev->lock_state = RBD_LOCK_STATE_QUIESCING; + rbd_assert(!completion_done(&rbd_dev->quiescing_wait)); if (list_empty(&rbd_dev->running_list)) return true; up_write(&rbd_dev->lock_rwsem); - wait_for_completion(&rbd_dev->releasing_wait); + wait_for_completion(&rbd_dev->quiescing_wait); down_write(&rbd_dev->lock_rwsem); - if (rbd_dev->lock_state != RBD_LOCK_STATE_RELEASING) + if (rbd_dev->lock_state != RBD_LOCK_STATE_QUIESCING) return false; rbd_assert(list_empty(&rbd_dev->running_list)); @@ -4701,6 +4697,10 @@ static void rbd_reacquire_lock(struct rbd_device *rbd_dev) rbd_warn(rbd_dev, "failed to update lock cookie: %d", ret); + if (rbd_dev->opts->exclusive) + rbd_warn(rbd_dev, + "temporarily releasing lock on exclusive mapping"); + /* * Lock cookie cannot be updated on older OSDs, so do * a manual release and queue an acquire. @@ -5556,7 +5556,7 @@ static struct rbd_device *__rbd_dev_create(struct rbd_spec *spec) INIT_LIST_HEAD(&rbd_dev->acquiring_list); INIT_LIST_HEAD(&rbd_dev->running_list); init_completion(&rbd_dev->acquire_wait); - init_completion(&rbd_dev->releasing_wait); + init_completion(&rbd_dev->quiescing_wait); spin_lock_init(&rbd_dev->object_map_lock); @@ -6618,11 +6618,6 @@ static int rbd_add_acquire_lock(struct rbd_device *rbd_dev) return ret; } - /* - * The lock may have been released by now, unless automatic lock - * transitions are disabled. - */ - rbd_assert(!rbd_dev->opts->exclusive || rbd_is_lock_owner(rbd_dev)); return 0; } diff --git a/drivers/bluetooth/btusb.c b/drivers/bluetooth/btusb.c index 10408df38c52..b9752625c88b 100644 --- a/drivers/bluetooth/btusb.c +++ b/drivers/bluetooth/btusb.c @@ -370,6 +370,10 @@ static const struct usb_device_id blacklist_table[] = { BTUSB_WIDEBAND_SPEECH }, { USB_DEVICE(0x13d3, 0x3571), .driver_info = BTUSB_REALTEK | BTUSB_WIDEBAND_SPEECH }, + { USB_DEVICE(0x13d3, 0x3591), .driver_info = BTUSB_REALTEK | + BTUSB_WIDEBAND_SPEECH }, + { USB_DEVICE(0x0489, 0xe125), .driver_info = BTUSB_REALTEK | + BTUSB_WIDEBAND_SPEECH }, /* Realtek Bluetooth devices */ { USB_VENDOR_AND_INTERFACE_INFO(0x0bda, 0xe0, 0x01, 0x01), diff --git a/drivers/bluetooth/hci_ldisc.c b/drivers/bluetooth/hci_ldisc.c index 8be4d807d137..600c88fc3145 100644 --- a/drivers/bluetooth/hci_ldisc.c +++ b/drivers/bluetooth/hci_ldisc.c @@ -765,7 +765,8 @@ static int hci_uart_tty_ioctl(struct tty_struct *tty, struct file *file, break; case HCIUARTGETPROTO: - if (test_bit(HCI_UART_PROTO_SET, &hu->flags)) + if (test_bit(HCI_UART_PROTO_SET, &hu->flags) && + test_bit(HCI_UART_PROTO_READY, &hu->flags)) err = hu->proto->id; else err = -EUNATCH; diff --git a/drivers/char/hw_random/amd-rng.c b/drivers/char/hw_random/amd-rng.c index db3dd467194c..3f3fdf6ee3d5 100644 --- a/drivers/char/hw_random/amd-rng.c +++ b/drivers/char/hw_random/amd-rng.c @@ -142,8 +142,10 @@ static int __init mod_init(void) found: err = pci_read_config_dword(pdev, 0x58, &pmbase); - if (err) + if (err) { + err = pcibios_err_to_errno(err); goto put_dev; + } pmbase &= 0x0000FF00; if (pmbase == 0) { diff --git a/drivers/char/tpm/eventlog/common.c b/drivers/char/tpm/eventlog/common.c index 8512ec76d526..4a6186f9f889 100644 --- a/drivers/char/tpm/eventlog/common.c +++ b/drivers/char/tpm/eventlog/common.c @@ -47,6 +47,8 @@ static int tpm_bios_measurements_open(struct inode *inode, if (!err) { seq = file->private_data; seq->private = chip; + } else { + put_device(&chip->dev); } return err; diff --git a/drivers/clk/davinci/da8xx-cfgchip.c b/drivers/clk/davinci/da8xx-cfgchip.c index bdc52364b421..b558276112b8 100644 --- a/drivers/clk/davinci/da8xx-cfgchip.c +++ b/drivers/clk/davinci/da8xx-cfgchip.c @@ -505,7 +505,7 @@ da8xx_cfgchip_register_usb0_clk48(struct device *dev, const char * const parent_names[] = { "usb_refclkin", "pll0_auxclk" }; struct clk *fck_clk; struct da8xx_usb0_clk48 *usb0; - struct clk_init_data init; + struct clk_init_data init = {}; int ret; fck_clk = devm_clk_get(dev, "fck"); @@ -579,7 +579,7 @@ da8xx_cfgchip_register_usb1_clk48(struct device *dev, { const char * const parent_names[] = { "usb0_clk48", "usb_refclkin" }; struct da8xx_usb1_clk48 *usb1; - struct clk_init_data init; + struct clk_init_data init = {}; int ret; usb1 = devm_kzalloc(dev, sizeof(*usb1), GFP_KERNEL); diff --git a/drivers/clocksource/sh_cmt.c b/drivers/clocksource/sh_cmt.c index b1ec79ddb7f2..66789b3838d0 100644 --- a/drivers/clocksource/sh_cmt.c +++ b/drivers/clocksource/sh_cmt.c @@ -510,6 +510,7 @@ static void sh_cmt_set_next(struct sh_cmt_channel *ch, unsigned long delta) static irqreturn_t sh_cmt_interrupt(int irq, void *dev_id) { struct sh_cmt_channel *ch = dev_id; + unsigned long flags; /* clear flags */ sh_cmt_write_cmcsr(ch, sh_cmt_read_cmcsr(ch) & @@ -540,6 +541,8 @@ static irqreturn_t sh_cmt_interrupt(int irq, void *dev_id) ch->flags &= ~FLAG_SKIPEVENT; + raw_spin_lock_irqsave(&ch->lock, flags); + if (ch->flags & FLAG_REPROGRAM) { ch->flags &= ~FLAG_REPROGRAM; sh_cmt_clock_event_program_verify(ch, 1); @@ -552,6 +555,8 @@ static irqreturn_t sh_cmt_interrupt(int irq, void *dev_id) ch->flags &= ~FLAG_IRQCONTEXT; + raw_spin_unlock_irqrestore(&ch->lock, flags); + return IRQ_HANDLED; } @@ -750,12 +755,18 @@ static int sh_cmt_clock_event_next(unsigned long delta, struct clock_event_device *ced) { struct sh_cmt_channel *ch = ced_to_sh_cmt(ced); + unsigned long flags; BUG_ON(!clockevent_state_oneshot(ced)); + + raw_spin_lock_irqsave(&ch->lock, flags); + if (likely(ch->flags & FLAG_IRQCONTEXT)) ch->next_match_value = delta - 1; else - sh_cmt_set_next(ch, delta - 1); + __sh_cmt_set_next(ch, delta - 1); + + raw_spin_unlock_irqrestore(&ch->lock, flags); return 0; } diff --git a/drivers/edac/Makefile b/drivers/edac/Makefile index d77200c9680b..32cc22ed5295 100644 --- a/drivers/edac/Makefile +++ b/drivers/edac/Makefile @@ -57,11 +57,13 @@ obj-$(CONFIG_EDAC_MPC85XX) += mpc85xx_edac_mod.o layerscape_edac_mod-y := fsl_ddr_edac.o layerscape_edac.o obj-$(CONFIG_EDAC_LAYERSCAPE) += layerscape_edac_mod.o -skx_edac-y := skx_common.o skx_base.o -obj-$(CONFIG_EDAC_SKX) += skx_edac.o +skx_edac_common-y := skx_common.o -i10nm_edac-y := skx_common.o i10nm_base.o -obj-$(CONFIG_EDAC_I10NM) += i10nm_edac.o +skx_edac-y := skx_base.o +obj-$(CONFIG_EDAC_SKX) += skx_edac.o skx_edac_common.o + +i10nm_edac-y := i10nm_base.o +obj-$(CONFIG_EDAC_I10NM) += i10nm_edac.o skx_edac_common.o obj-$(CONFIG_EDAC_MV64X60) += mv64x60_edac.o obj-$(CONFIG_EDAC_CELL) += cell_edac.o diff --git a/drivers/edac/skx_base.c b/drivers/edac/skx_base.c index f382cc70f9aa..fb0a9369bc1a 100644 --- a/drivers/edac/skx_base.c +++ b/drivers/edac/skx_base.c @@ -46,7 +46,8 @@ static struct skx_dev *get_skx_dev(struct pci_bus *bus, u8 idx) } enum munittype { - CHAN0, CHAN1, CHAN2, SAD_ALL, UTIL_ALL, SAD + CHAN0, CHAN1, CHAN2, SAD_ALL, UTIL_ALL, SAD, + ERRCHAN0, ERRCHAN1, ERRCHAN2, }; struct munit { @@ -68,6 +69,9 @@ static const struct munit skx_all_munits[] = { { 0x2040, { PCI_DEVFN(10, 0), PCI_DEVFN(12, 0) }, 2, 2, CHAN0 }, { 0x2044, { PCI_DEVFN(10, 4), PCI_DEVFN(12, 4) }, 2, 2, CHAN1 }, { 0x2048, { PCI_DEVFN(11, 0), PCI_DEVFN(13, 0) }, 2, 2, CHAN2 }, + { 0x2043, { PCI_DEVFN(10, 3), PCI_DEVFN(12, 3) }, 2, 2, ERRCHAN0 }, + { 0x2047, { PCI_DEVFN(10, 7), PCI_DEVFN(12, 7) }, 2, 2, ERRCHAN1 }, + { 0x204b, { PCI_DEVFN(11, 3), PCI_DEVFN(13, 3) }, 2, 2, ERRCHAN2 }, { 0x208e, { }, 1, 0, SAD }, { } }; @@ -104,10 +108,18 @@ static int get_all_munits(const struct munit *m) } switch (m->mtype) { - case CHAN0: case CHAN1: case CHAN2: + case CHAN0: + case CHAN1: + case CHAN2: pci_dev_get(pdev); d->imc[i].chan[m->mtype].cdev = pdev; break; + case ERRCHAN0: + case ERRCHAN1: + case ERRCHAN2: + pci_dev_get(pdev); + d->imc[i].chan[m->mtype - ERRCHAN0].edev = pdev; + break; case SAD_ALL: pci_dev_get(pdev); d->sad_all = pdev; @@ -212,6 +224,39 @@ static int skx_get_dimm_config(struct mem_ctl_info *mci) #define SKX_ILV_REMOTE(tgt) (((tgt) & 8) == 0) #define SKX_ILV_TARGET(tgt) ((tgt) & 7) +static void skx_show_retry_rd_err_log(struct decoded_addr *res, + char *msg, int len) +{ + u32 log0, log1, log2, log3, log4; + u32 corr0, corr1, corr2, corr3; + struct pci_dev *edev; + int n; + + edev = res->dev->imc[res->imc].chan[res->channel].edev; + + pci_read_config_dword(edev, 0x154, &log0); + pci_read_config_dword(edev, 0x148, &log1); + pci_read_config_dword(edev, 0x150, &log2); + pci_read_config_dword(edev, 0x15c, &log3); + pci_read_config_dword(edev, 0x114, &log4); + + n = snprintf(msg, len, " retry_rd_err_log[%.8x %.8x %.8x %.8x %.8x]", + log0, log1, log2, log3, log4); + + pci_read_config_dword(edev, 0x104, &corr0); + pci_read_config_dword(edev, 0x108, &corr1); + pci_read_config_dword(edev, 0x10c, &corr2); + pci_read_config_dword(edev, 0x110, &corr3); + + if (len - n > 0) + snprintf(msg + n, len - n, + " correrrcnt[%.4x %.4x %.4x %.4x %.4x %.4x %.4x %.4x]", + corr0 & 0xffff, corr0 >> 16, + corr1 & 0xffff, corr1 >> 16, + corr2 & 0xffff, corr2 >> 16, + corr3 & 0xffff, corr3 >> 16); +} + static bool skx_sad_decode(struct decoded_addr *res) { struct skx_dev *d = list_first_entry(skx_edac_list, typeof(*d), list); @@ -658,7 +703,7 @@ static int __init skx_init(void) } } - skx_set_decode(skx_decode); + skx_set_decode(skx_decode, skx_show_retry_rd_err_log); if (nvdimm_count && skx_adxl_get() == -ENODEV) skx_printk(KERN_NOTICE, "Only decoding DDR4 address!\n"); diff --git a/drivers/edac/skx_common.c b/drivers/edac/skx_common.c index 99dea4f66b5e..b298b189bdf3 100644 --- a/drivers/edac/skx_common.c +++ b/drivers/edac/skx_common.c @@ -23,10 +23,13 @@ #include "skx_common.h" static const char * const component_names[] = { - [INDEX_SOCKET] = "ProcessorSocketId", - [INDEX_MEMCTRL] = "MemoryControllerId", - [INDEX_CHANNEL] = "ChannelId", - [INDEX_DIMM] = "DimmSlotId", + [INDEX_SOCKET] = "ProcessorSocketId", + [INDEX_MEMCTRL] = "MemoryControllerId", + [INDEX_CHANNEL] = "ChannelId", + [INDEX_DIMM] = "DimmSlotId", + [INDEX_NM_MEMCTRL] = "NmMemoryControllerId", + [INDEX_NM_CHANNEL] = "NmChannelId", + [INDEX_NM_DIMM] = "NmDimmSlotId", }; static int component_indices[ARRAY_SIZE(component_names)]; @@ -34,13 +37,16 @@ static int adxl_component_count; static const char * const *adxl_component_names; static u64 *adxl_values; static char *adxl_msg; +static unsigned long adxl_nm_bitmap; static char skx_msg[MSG_SIZE]; static skx_decode_f skx_decode; +static skx_show_retry_log_f skx_show_retry_rd_err_log; static u64 skx_tolm, skx_tohm; static LIST_HEAD(dev_edac_list); +static bool skx_mem_cfg_2lm; -int __init skx_adxl_get(void) +int skx_adxl_get(void) { const char * const *names; int i, j; @@ -55,14 +61,25 @@ int __init skx_adxl_get(void) for (j = 0; names[j]; j++) { if (!strcmp(component_names[i], names[j])) { component_indices[i] = j; + + if (i >= INDEX_NM_FIRST) + adxl_nm_bitmap |= 1 << i; + break; } } - if (!names[j]) + if (!names[j] && i < INDEX_NM_FIRST) goto err; } + if (skx_mem_cfg_2lm) { + if (!adxl_nm_bitmap) + skx_printk(KERN_NOTICE, "Not enough ADXL components for 2-level memory.\n"); + else + edac_dbg(2, "adxl_nm_bitmap: 0x%lx\n", adxl_nm_bitmap); + } + adxl_component_names = names; while (*names++) adxl_component_count++; @@ -91,15 +108,18 @@ err: return -ENODEV; } +EXPORT_SYMBOL_GPL(skx_adxl_get); -void __exit skx_adxl_put(void) +void skx_adxl_put(void) { kfree(adxl_values); kfree(adxl_msg); } +EXPORT_SYMBOL_GPL(skx_adxl_put); -static bool skx_adxl_decode(struct decoded_addr *res) +static bool skx_adxl_decode(struct decoded_addr *res, bool error_in_1st_level_mem) { + struct skx_dev *d; int i, len = 0; if (res->addr >= skx_tohm || (res->addr >= skx_tolm && @@ -114,9 +134,36 @@ static bool skx_adxl_decode(struct decoded_addr *res) } res->socket = (int)adxl_values[component_indices[INDEX_SOCKET]]; - res->imc = (int)adxl_values[component_indices[INDEX_MEMCTRL]]; - res->channel = (int)adxl_values[component_indices[INDEX_CHANNEL]]; - res->dimm = (int)adxl_values[component_indices[INDEX_DIMM]]; + if (error_in_1st_level_mem) { + res->imc = (adxl_nm_bitmap & BIT_NM_MEMCTRL) ? + (int)adxl_values[component_indices[INDEX_NM_MEMCTRL]] : -1; + res->channel = (adxl_nm_bitmap & BIT_NM_CHANNEL) ? + (int)adxl_values[component_indices[INDEX_NM_CHANNEL]] : -1; + res->dimm = (adxl_nm_bitmap & BIT_NM_DIMM) ? + (int)adxl_values[component_indices[INDEX_NM_DIMM]] : -1; + } else { + res->imc = (int)adxl_values[component_indices[INDEX_MEMCTRL]]; + res->channel = (int)adxl_values[component_indices[INDEX_CHANNEL]]; + res->dimm = (int)adxl_values[component_indices[INDEX_DIMM]]; + } + + if (res->imc > NUM_IMC - 1 || res->imc < 0) { + skx_printk(KERN_ERR, "Bad imc %d\n", res->imc); + return false; + } + + list_for_each_entry(d, &dev_edac_list, list) { + if (d->imc[0].src_id == res->socket) { + res->dev = d; + break; + } + } + + if (!res->dev) { + skx_printk(KERN_ERR, "No device for src_id %d imc %d\n", + res->socket, res->imc); + return false; + } for (i = 0; i < adxl_component_count; i++) { if (adxl_values[i] == ~0x0ull) @@ -131,10 +178,18 @@ static bool skx_adxl_decode(struct decoded_addr *res) return true; } -void skx_set_decode(skx_decode_f decode) +void skx_set_mem_cfg(bool mem_cfg_2lm) +{ + skx_mem_cfg_2lm = mem_cfg_2lm; +} +EXPORT_SYMBOL_GPL(skx_set_mem_cfg); + +void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log) { skx_decode = decode; + skx_show_retry_rd_err_log = show_retry_log; } +EXPORT_SYMBOL_GPL(skx_set_decode); int skx_get_src_id(struct skx_dev *d, int off, u8 *id) { @@ -148,6 +203,7 @@ int skx_get_src_id(struct skx_dev *d, int off, u8 *id) *id = GET_BITFIELD(reg, 12, 14); return 0; } +EXPORT_SYMBOL_GPL(skx_get_src_id); int skx_get_node_id(struct skx_dev *d, u8 *id) { @@ -161,6 +217,7 @@ int skx_get_node_id(struct skx_dev *d, u8 *id) *id = GET_BITFIELD(reg, 0, 2); return 0; } +EXPORT_SYMBOL_GPL(skx_get_node_id); static int get_width(u32 mtr) { @@ -227,6 +284,7 @@ int skx_get_all_bus_mappings(unsigned int did, int off, enum type type, *list = &dev_edac_list; return ndev; } +EXPORT_SYMBOL_GPL(skx_get_all_bus_mappings); int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm) { @@ -266,6 +324,7 @@ fail: pci_dev_put(pdev); return -ENODEV; } +EXPORT_SYMBOL_GPL(skx_get_hi_lo); static int skx_get_dimm_attr(u32 reg, int lobit, int hibit, int add, int minval, int maxval, const char *name) @@ -319,6 +378,7 @@ int skx_get_dimm_info(u32 mtr, u32 mcmtr, u32 amap, struct dimm_info *dimm, return 1; } +EXPORT_SYMBOL_GPL(skx_get_dimm_info); int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc, int chan, int dimmno, const char *mod_str) @@ -367,6 +427,7 @@ unknown_size: return (size == 0 || size == ~0ull) ? 0 : 1; } +EXPORT_SYMBOL_GPL(skx_get_nvdimm_info); int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev, const char *ctl_name, const char *mod_str, @@ -434,6 +495,7 @@ fail0: imc->mci = NULL; return rc; } +EXPORT_SYMBOL_GPL(skx_register_mci); static void skx_unregister_mci(struct skx_imc *imc) { @@ -452,24 +514,6 @@ static void skx_unregister_mci(struct skx_imc *imc) edac_mc_free(mci); } -static struct mem_ctl_info *get_mci(int src_id, int lmc) -{ - struct skx_dev *d; - - if (lmc > NUM_IMC - 1) { - skx_printk(KERN_ERR, "Bad lmc %d\n", lmc); - return NULL; - } - - list_for_each_entry(d, &dev_edac_list, list) { - if (d->imc[0].src_id == src_id) - return d->imc[lmc].mci; - } - - skx_printk(KERN_ERR, "No mci for src_id %d lmc %d\n", src_id, lmc); - return NULL; -} - static void skx_mce_output_error(struct mem_ctl_info *mci, const struct mce *m, struct decoded_addr *res) @@ -480,6 +524,7 @@ static void skx_mce_output_error(struct mem_ctl_info *mci, bool overflow = GET_BITFIELD(m->status, 62, 62); bool uncorrected_error = GET_BITFIELD(m->status, 61, 61); bool recoverable; + int len; u32 core_err_cnt = GET_BITFIELD(m->status, 38, 52); u32 mscod = GET_BITFIELD(m->status, 16, 31); u32 errcode = GET_BITFIELD(m->status, 0, 15); @@ -536,12 +581,12 @@ static void skx_mce_output_error(struct mem_ctl_info *mci, } } if (adxl_component_count) { - snprintf(skx_msg, MSG_SIZE, "%s%s err_code:0x%04x:0x%04x %s", + len = snprintf(skx_msg, MSG_SIZE, "%s%s err_code:0x%04x:0x%04x %s", overflow ? " OVERFLOW" : "", (uncorrected_error && recoverable) ? " recoverable" : "", mscod, errcode, adxl_msg); } else { - snprintf(skx_msg, MSG_SIZE, + len = snprintf(skx_msg, MSG_SIZE, "%s%s err_code:0x%04x:0x%04x socket:%d imc:%d rank:%d bg:%d ba:%d row:0x%x col:0x%x", overflow ? " OVERFLOW" : "", (uncorrected_error && recoverable) ? " recoverable" : "", @@ -550,6 +595,9 @@ static void skx_mce_output_error(struct mem_ctl_info *mci, res->bank_group, res->bank_address, res->row, res->column); } + if (skx_show_retry_rd_err_log) + skx_show_retry_rd_err_log(res, skx_msg + len, MSG_SIZE - len); + edac_dbg(0, "%s\n", skx_msg); /* Call the helper to output message */ @@ -559,6 +607,21 @@ static void skx_mce_output_error(struct mem_ctl_info *mci, optype, skx_msg); } +static bool skx_error_in_1st_level_mem(const struct mce *m) +{ + u32 errcode; + + if (!skx_mem_cfg_2lm) + return false; + + errcode = GET_BITFIELD(m->status, 0, 15); + + if ((errcode & 0xef80) != 0x280) + return false; + + return true; +} + int skx_mce_check_error(struct notifier_block *nb, unsigned long val, void *data) { @@ -578,17 +641,14 @@ int skx_mce_check_error(struct notifier_block *nb, unsigned long val, res.addr = mce->addr; if (adxl_component_count) { - if (!skx_adxl_decode(&res)) + if (!skx_adxl_decode(&res, skx_error_in_1st_level_mem(mce))) return NOTIFY_DONE; - - mci = get_mci(res.socket, res.imc); - } else { - if (!skx_decode || !skx_decode(&res)) - return NOTIFY_DONE; - - mci = res.dev->imc[res.imc].mci; + } else if (!skx_decode || !skx_decode(&res)) { + return NOTIFY_DONE; } + mci = res.dev->imc[res.imc].mci; + if (!mci) return NOTIFY_DONE; @@ -614,6 +674,7 @@ int skx_mce_check_error(struct notifier_block *nb, unsigned long val, return NOTIFY_DONE; } +EXPORT_SYMBOL_GPL(skx_mce_check_error); void skx_remove(void) { @@ -649,3 +710,8 @@ void skx_remove(void) kfree(d); } } +EXPORT_SYMBOL_GPL(skx_remove); + +MODULE_LICENSE("GPL v2"); +MODULE_AUTHOR("Tony Luck"); +MODULE_DESCRIPTION("MC Driver for Intel server processors"); diff --git a/drivers/edac/skx_common.h b/drivers/edac/skx_common.h index fed337c12954..929cfcffcb50 100644 --- a/drivers/edac/skx_common.h +++ b/drivers/edac/skx_common.h @@ -9,6 +9,8 @@ #ifndef _SKX_COMM_EDAC_H #define _SKX_COMM_EDAC_H +#include + #define MSG_SIZE 1024 /* @@ -64,6 +66,7 @@ struct skx_dev { u8 src_id, node_id; struct skx_channel { struct pci_dev *cdev; + struct pci_dev *edev; struct skx_dimm { u8 close_pg; u8 bank_xor_enable; @@ -89,9 +92,17 @@ enum { INDEX_MEMCTRL, INDEX_CHANNEL, INDEX_DIMM, + INDEX_NM_FIRST, + INDEX_NM_MEMCTRL = INDEX_NM_FIRST, + INDEX_NM_CHANNEL, + INDEX_NM_DIMM, INDEX_MAX }; +#define BIT_NM_MEMCTRL BIT_ULL(INDEX_NM_MEMCTRL) +#define BIT_NM_CHANNEL BIT_ULL(INDEX_NM_CHANNEL) +#define BIT_NM_DIMM BIT_ULL(INDEX_NM_DIMM) + struct decoded_addr { struct skx_dev *dev; u64 addr; @@ -113,10 +124,12 @@ struct decoded_addr { typedef int (*get_dimm_config_f)(struct mem_ctl_info *mci); typedef bool (*skx_decode_f)(struct decoded_addr *res); +typedef void (*skx_show_retry_log_f)(struct decoded_addr *res, char *msg, int len); -int __init skx_adxl_get(void); -void __exit skx_adxl_put(void); -void skx_set_decode(skx_decode_f decode); +int skx_adxl_get(void); +void skx_adxl_put(void); +void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log); +void skx_set_mem_cfg(bool mem_cfg_2lm); int skx_get_src_id(struct skx_dev *d, int off, u8 *id); int skx_get_node_id(struct skx_dev *d, u8 *id); diff --git a/drivers/firmware/turris-mox-rwtm.c b/drivers/firmware/turris-mox-rwtm.c index 0779513ac8d4..212a46397373 100644 --- a/drivers/firmware/turris-mox-rwtm.c +++ b/drivers/firmware/turris-mox-rwtm.c @@ -186,9 +186,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm) if (ret < 0) return ret; - ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2); - if (ret < 0) - return ret; + if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2)) + return -ETIMEDOUT; ret = mox_get_status(MBOX_CMD_BOARD_INFO, reply->retval); if (ret == -ENODATA) { @@ -222,9 +221,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm) if (ret < 0) return ret; - ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2); - if (ret < 0) - return ret; + if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2)) + return -ETIMEDOUT; ret = mox_get_status(MBOX_CMD_ECDSA_PUB_KEY, reply->retval); if (ret == -ENODATA) { @@ -261,9 +259,8 @@ static int check_get_random_support(struct mox_rwtm *rwtm) if (ret < 0) return ret; - ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2); - if (ret < 0) - return ret; + if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2)) + return -ETIMEDOUT; return mox_get_status(MBOX_CMD_GET_RANDOM, rwtm->reply.retval); } @@ -340,6 +337,7 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev) platform_set_drvdata(pdev, rwtm); mutex_init(&rwtm->busy); + init_completion(&rwtm->cmd_done); rwtm->mbox_client.dev = dev; rwtm->mbox_client.rx_callback = mox_rwtm_rx_callback; @@ -353,8 +351,6 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev) goto remove_files; } - init_completion(&rwtm->cmd_done); - ret = mox_get_board_info(rwtm); if (ret < 0) dev_warn(dev, "Cannot read board information: %i\n", ret); diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_ctx.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_ctx.c index 39ca0718ced0..863c3a14d309 100644 --- a/drivers/gpu/drm/amd/amdgpu/amdgpu_ctx.c +++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_ctx.c @@ -401,16 +401,24 @@ int amdgpu_ctx_ioctl(struct drm_device *dev, void *data, switch (args->in.op) { case AMDGPU_CTX_OP_ALLOC_CTX: + if (args->in.flags) + return -EINVAL; r = amdgpu_ctx_alloc(adev, fpriv, filp, priority, &id); args->out.alloc.ctx_id = id; break; case AMDGPU_CTX_OP_FREE_CTX: + if (args->in.flags) + return -EINVAL; r = amdgpu_ctx_free(fpriv, id); break; case AMDGPU_CTX_OP_QUERY_STATE: + if (args->in.flags) + return -EINVAL; r = amdgpu_ctx_query(adev, fpriv, id, &args->out); break; case AMDGPU_CTX_OP_QUERY_STATE2: + if (args->in.flags) + return -EINVAL; r = amdgpu_ctx_query2(adev, fpriv, id, &args->out); break; default: diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c index b6fc191c353a..96aad6cc83b1 100644 --- a/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c +++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_ras.c @@ -1053,12 +1053,15 @@ static void amdgpu_ras_interrupt_process_handler(struct work_struct *work) int amdgpu_ras_interrupt_dispatch(struct amdgpu_device *adev, struct ras_dispatch_if *info) { - struct ras_manager *obj = amdgpu_ras_find_obj(adev, &info->head); - struct ras_ih_data *data = &obj->ih_data; + struct ras_manager *obj; + struct ras_ih_data *data; + obj = amdgpu_ras_find_obj(adev, &info->head); if (!obj) return -EINVAL; + data = &obj->ih_data; + if (data->inuse == 0) return 0; diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_vce.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_vce.c index 65044b1b3d4c..eac1997844e6 100644 --- a/drivers/gpu/drm/amd/amdgpu/amdgpu_vce.c +++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_vce.c @@ -715,7 +715,8 @@ int amdgpu_vce_ring_parse_cs(struct amdgpu_cs_parser *p, uint32_t ib_idx) uint32_t created = 0; uint32_t allocated = 0; uint32_t tmp, handle = 0; - uint32_t *size = &tmp; + uint32_t dummy = 0xffffffff; + uint32_t *size = &dummy; unsigned idx; int i, r = 0; diff --git a/drivers/gpu/drm/amd/amdkfd/kfd_chardev.c b/drivers/gpu/drm/amd/amdkfd/kfd_chardev.c index 990ffc0eeb6b..b99e6b2e0aca 100644 --- a/drivers/gpu/drm/amd/amdkfd/kfd_chardev.c +++ b/drivers/gpu/drm/amd/amdkfd/kfd_chardev.c @@ -1278,7 +1278,7 @@ static int kfd_ioctl_alloc_memory_of_gpu(struct file *filep, if (args->size != PAGE_SIZE) return -EINVAL; offset = amdgpu_amdkfd_get_mmio_remap_phys_addr(dev->kgd); - if (!offset) + if (!offset || (PAGE_SIZE > 4096)) return -ENOMEM; } @@ -1872,6 +1872,9 @@ static int kfd_mmio_mmap(struct kfd_dev *dev, struct kfd_process *process, if (vma->vm_end - vma->vm_start != PAGE_SIZE) return -EINVAL; + if (PAGE_SIZE > 4096) + return -EINVAL; + address = amdgpu_amdkfd_get_mmio_remap_phys_addr(dev->kgd); vma->vm_flags |= VM_IO | VM_DONTCOPY | VM_DONTEXPAND | VM_NORESERVE | diff --git a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c index b9d6a5bd8522..47e31a282926 100644 --- a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c +++ b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c @@ -165,7 +165,8 @@ const struct dc_plane_status *dc_plane_get_status( if (pipe_ctx->plane_state != plane_state) continue; - pipe_ctx->plane_state->status.is_flip_pending = false; + if (pipe_ctx->plane_state) + pipe_ctx->plane_state->status.is_flip_pending = false; break; } diff --git a/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c b/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c index cab3f5c4e2fc..37c62794e213 100644 --- a/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c +++ b/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c @@ -1115,7 +1115,6 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, u32 status_reg; u8 *buffer = msg->buffer; unsigned int i; - int num_transferred = 0; int ret; /* Buffer size of AUX CH is 16 bytes */ @@ -1167,7 +1166,6 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, reg = buffer[i]; writel(reg, dp->reg_base + ANALOGIX_DP_BUF_DATA_0 + 4 * i); - num_transferred++; } } @@ -1215,7 +1213,6 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, reg = readl(dp->reg_base + ANALOGIX_DP_BUF_DATA_0 + 4 * i); buffer[i] = (unsigned char)reg; - num_transferred++; } } @@ -1232,7 +1229,7 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, (msg->request & ~DP_AUX_I2C_MOT) == DP_AUX_NATIVE_READ) msg->reply = DP_AUX_NATIVE_REPLY_ACK; - return num_transferred > 0 ? num_transferred : -EBUSY; + return msg->size; aux_error: /* if aux err happen, reset aux */ diff --git a/drivers/gpu/drm/drm_client_modeset.c b/drivers/gpu/drm/drm_client_modeset.c index 827622d18fa8..283cb573a133 100644 --- a/drivers/gpu/drm/drm_client_modeset.c +++ b/drivers/gpu/drm/drm_client_modeset.c @@ -792,6 +792,11 @@ int drm_client_modeset_probe(struct drm_client_dev *client, unsigned int width, kfree(modeset->mode); modeset->mode = drm_mode_duplicate(dev, mode); + if (!modeset->mode) { + ret = -ENOMEM; + break; + } + drm_connector_get(connector); modeset->connectors[modeset->num_connectors++] = connector; modeset->x = offset->x; diff --git a/drivers/gpu/drm/etnaviv/etnaviv_gem.c b/drivers/gpu/drm/etnaviv/etnaviv_gem.c index 5107a0f5bc7f..2aabe8433cee 100644 --- a/drivers/gpu/drm/etnaviv/etnaviv_gem.c +++ b/drivers/gpu/drm/etnaviv/etnaviv_gem.c @@ -363,9 +363,11 @@ static void *etnaviv_gem_vmap_impl(struct etnaviv_gem_object *obj) static inline enum dma_data_direction etnaviv_op_to_dma_dir(u32 op) { - if (op & ETNA_PREP_READ) + op &= ETNA_PREP_READ | ETNA_PREP_WRITE; + + if (op == ETNA_PREP_READ) return DMA_FROM_DEVICE; - else if (op & ETNA_PREP_WRITE) + else if (op == ETNA_PREP_WRITE) return DMA_TO_DEVICE; else return DMA_BIDIRECTIONAL; diff --git a/drivers/gpu/drm/gma500/cdv_intel_lvds.c b/drivers/gpu/drm/gma500/cdv_intel_lvds.c index ea0a5d9a0acc..1793da6c7cb4 100644 --- a/drivers/gpu/drm/gma500/cdv_intel_lvds.c +++ b/drivers/gpu/drm/gma500/cdv_intel_lvds.c @@ -391,6 +391,9 @@ static int cdv_intel_lvds_get_modes(struct drm_connector *connector) if (mode_dev->panel_fixed_mode != NULL) { struct drm_display_mode *mode = drm_mode_duplicate(dev, mode_dev->panel_fixed_mode); + if (!mode) + return 0; + drm_mode_probed_add(connector, mode); return 1; } diff --git a/drivers/gpu/drm/gma500/psb_intel_lvds.c b/drivers/gpu/drm/gma500/psb_intel_lvds.c index afaebab7bc17..39f2d72ba07a 100644 --- a/drivers/gpu/drm/gma500/psb_intel_lvds.c +++ b/drivers/gpu/drm/gma500/psb_intel_lvds.c @@ -506,6 +506,9 @@ static int psb_intel_lvds_get_modes(struct drm_connector *connector) if (mode_dev->panel_fixed_mode != NULL) { struct drm_display_mode *mode = drm_mode_duplicate(dev, mode_dev->panel_fixed_mode); + if (!mode) + return 0; + drm_mode_probed_add(connector, mode); return 1; } diff --git a/drivers/gpu/drm/i915/gem/i915_gem_mman.c b/drivers/gpu/drm/i915/gem/i915_gem_mman.c index 876f59098f7e..b6cc358adc2c 100644 --- a/drivers/gpu/drm/i915/gem/i915_gem_mman.c +++ b/drivers/gpu/drm/i915/gem/i915_gem_mman.c @@ -196,6 +196,39 @@ compute_partial_view(const struct drm_i915_gem_object *obj, return view; } +static void set_address_limits(struct vm_area_struct *area, + struct i915_vma *vma, + unsigned long *start_vaddr, + unsigned long *end_vaddr) +{ + unsigned long vm_start, vm_end, vma_size; /* user's memory parameters */ + long start, end; /* memory boundaries */ + + /* + * Let's move into the ">> PAGE_SHIFT" + * domain to be sure not to lose bits + */ + vm_start = area->vm_start >> PAGE_SHIFT; + vm_end = area->vm_end >> PAGE_SHIFT; + vma_size = vma->size >> PAGE_SHIFT; + + /* + * Calculate the memory boundaries by considering the offset + * provided by the user during memory mapping and the offset + * provided for the partial mapping. + */ + start = vm_start; + start += vma->ggtt_view.partial.offset; + end = start + vma_size; + + start = max_t(long, start, vm_start); + end = min_t(long, end, vm_end); + + /* Let's move back into the "<< PAGE_SHIFT" domain */ + *start_vaddr = (unsigned long)start << PAGE_SHIFT; + *end_vaddr = (unsigned long)end << PAGE_SHIFT; +} + /** * i915_gem_fault - fault a page into the GTT * @vmf: fault info @@ -224,9 +257,11 @@ vm_fault_t i915_gem_fault(struct vm_fault *vmf) struct intel_runtime_pm *rpm = &i915->runtime_pm; struct i915_ggtt *ggtt = &i915->ggtt; bool write = area->vm_flags & VM_WRITE; + unsigned long start, end; /* memory boundaries */ intel_wakeref_t wakeref; struct i915_vma *vma; pgoff_t page_offset; + unsigned long pfn; int srcu; int ret; @@ -295,12 +330,14 @@ vm_fault_t i915_gem_fault(struct vm_fault *vmf) if (ret) goto err_unpin; + set_address_limits(area, vma, &start, &end); + + pfn = (ggtt->gmadr.start + i915_ggtt_offset(vma)) >> PAGE_SHIFT; + pfn += (start - area->vm_start) >> PAGE_SHIFT; + pfn -= vma->ggtt_view.partial.offset; + /* Finally, remap it using the new GTT offset */ - ret = remap_io_mapping(area, - area->vm_start + (vma->ggtt_view.partial.offset << PAGE_SHIFT), - (ggtt->gmadr.start + vma->node.start) >> PAGE_SHIFT, - min_t(u64, vma->size, area->vm_end - area->vm_start), - &ggtt->iomap); + ret = remap_io_mapping(area, start, pfn, end - start, &ggtt->iomap); if (ret) goto err_fence; diff --git a/drivers/gpu/drm/lima/lima_gp.c b/drivers/gpu/drm/lima/lima_gp.c index 3fca560087c9..4bf216cb3303 100644 --- a/drivers/gpu/drm/lima/lima_gp.c +++ b/drivers/gpu/drm/lima/lima_gp.c @@ -138,6 +138,11 @@ static void lima_gp_task_run(struct lima_sched_pipe *pipe, gp_write(LIMA_GP_CMD, cmd); } +static int lima_gp_bus_stop_poll(struct lima_ip *ip) +{ + return !!(gp_read(LIMA_GP_STATUS) & LIMA_GP_STATUS_BUS_STOPPED); +} + static int lima_gp_hard_reset_poll(struct lima_ip *ip) { gp_write(LIMA_GP_PERF_CNT_0_LIMIT, 0xC01A0000); @@ -151,6 +156,13 @@ static int lima_gp_hard_reset(struct lima_ip *ip) gp_write(LIMA_GP_PERF_CNT_0_LIMIT, 0xC0FFE000); gp_write(LIMA_GP_INT_MASK, 0); + + gp_write(LIMA_GP_CMD, LIMA_GP_CMD_STOP_BUS); + ret = lima_poll_timeout(ip, lima_gp_bus_stop_poll, 10, 100); + if (ret) { + dev_err(dev->dev, "%s bus stop timeout\n", lima_ip_name(ip)); + return ret; + } gp_write(LIMA_GP_CMD, LIMA_GP_CMD_RESET); ret = lima_poll_timeout(ip, lima_gp_hard_reset_poll, 10, 100); if (ret) { diff --git a/drivers/gpu/drm/mgag200/mgag200_i2c.c b/drivers/gpu/drm/mgag200/mgag200_i2c.c index 51d4037f00d4..cd3ca63962b8 100644 --- a/drivers/gpu/drm/mgag200/mgag200_i2c.c +++ b/drivers/gpu/drm/mgag200/mgag200_i2c.c @@ -135,7 +135,7 @@ struct mga_i2c_chan *mgag200_i2c_create(struct drm_device *dev) i2c->adapter.algo_data = &i2c->bit; i2c->bit.udelay = 10; - i2c->bit.timeout = 2; + i2c->bit.timeout = usecs_to_jiffies(2200); i2c->bit.data = i2c; i2c->bit.setsda = mga_gpio_setsda; i2c->bit.setscl = mga_gpio_setscl; diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h b/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h index 6a4813505c33..c1b9a0500fa2 100644 --- a/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h +++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h @@ -30,24 +30,14 @@ * @fmt: Pointer to format string */ #define DPU_DEBUG(fmt, ...) \ - do { \ - if (unlikely(drm_debug & DRM_UT_KMS)) \ - DRM_DEBUG(fmt, ##__VA_ARGS__); \ - else \ - pr_debug(fmt, ##__VA_ARGS__); \ - } while (0) + DRM_DEBUG_DRIVER(fmt, ##__VA_ARGS__) /** * DPU_DEBUG_DRIVER - macro for hardware driver logging * @fmt: Pointer to format string */ #define DPU_DEBUG_DRIVER(fmt, ...) \ - do { \ - if (unlikely(drm_debug & DRM_UT_DRIVER)) \ - DRM_ERROR(fmt, ##__VA_ARGS__); \ - else \ - pr_debug(fmt, ##__VA_ARGS__); \ - } while (0) + DRM_DEBUG_DRIVER(fmt, ##__VA_ARGS__) #define DPU_ERROR(fmt, ...) pr_err("[dpu error]" fmt, ##__VA_ARGS__) #define DPU_ERROR_RATELIMITED(fmt, ...) pr_err_ratelimited("[dpu error]" fmt, ##__VA_ARGS__) diff --git a/drivers/gpu/drm/nouveau/nouveau_prime.c b/drivers/gpu/drm/nouveau/nouveau_prime.c index 25cbe4ef383b..ea7cd8aee68f 100644 --- a/drivers/gpu/drm/nouveau/nouveau_prime.c +++ b/drivers/gpu/drm/nouveau/nouveau_prime.c @@ -83,7 +83,8 @@ struct drm_gem_object *nouveau_gem_prime_import_sg_table(struct drm_device *dev, * to the caller, instead of a normal nouveau_bo ttm reference. */ ret = drm_gem_object_init(dev, &nvbo->bo.base, size); if (ret) { - nouveau_bo_ref(NULL, &nvbo); + drm_gem_object_release(&nvbo->bo.base); + kfree(nvbo); obj = ERR_PTR(-ENOMEM); goto unlock; } diff --git a/drivers/gpu/drm/panfrost/panfrost_drv.c b/drivers/gpu/drm/panfrost/panfrost_drv.c index b4bab8647f76..5ad233603cf9 100644 --- a/drivers/gpu/drm/panfrost/panfrost_drv.c +++ b/drivers/gpu/drm/panfrost/panfrost_drv.c @@ -692,3 +692,4 @@ module_platform_driver(panfrost_driver); MODULE_AUTHOR("Panfrost Project Developers"); MODULE_DESCRIPTION("Panfrost DRM Driver"); MODULE_LICENSE("GPL v2"); +MODULE_SOFTDEP("pre: governor_simpleondemand"); diff --git a/drivers/gpu/drm/qxl/qxl_display.c b/drivers/gpu/drm/qxl/qxl_display.c index a6ee10cbcfdd..677dd560c066 100644 --- a/drivers/gpu/drm/qxl/qxl_display.c +++ b/drivers/gpu/drm/qxl/qxl_display.c @@ -230,6 +230,9 @@ static int qxl_add_mode(struct drm_connector *connector, return 0; mode = drm_cvt_mode(dev, width, height, 60, false, false, false); + if (!mode) + return 0; + if (preferred) mode->type |= DRM_MODE_TYPE_PREFERRED; mode->hdisplay = width; diff --git a/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c b/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c index fdb52f6d29fb..395614f2b7bd 100644 --- a/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c +++ b/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c @@ -98,7 +98,7 @@ static int vmw_overlay_send_put(struct vmw_private *dev_priv, { struct vmw_escape_video_flush *flush; size_t fifo_size; - bool have_so = (dev_priv->active_display_unit == vmw_du_screen_object); + bool have_so = (dev_priv->active_display_unit != vmw_du_legacy); int i, num_items; SVGAGuestPtr ptr; diff --git a/drivers/hid/hid-ids.h b/drivers/hid/hid-ids.h index 6547d14c47ca..66a3c9548494 100644 --- a/drivers/hid/hid-ids.h +++ b/drivers/hid/hid-ids.h @@ -866,7 +866,15 @@ #define USB_DEVICE_ID_MS_TYPE_COVER_2 0x07a9 #define USB_DEVICE_ID_MS_POWER_COVER 0x07da #define USB_DEVICE_ID_MS_SURFACE3_COVER 0x07de -#define USB_DEVICE_ID_MS_XBOX_ONE_S_CONTROLLER 0x02fd +/* + * For a description of the Xbox controller models, refer to: + * https://en.wikipedia.org/wiki/Xbox_Wireless_Controller#Summary + */ +#define USB_DEVICE_ID_MS_XBOX_CONTROLLER_MODEL_1708 0x02fd +#define USB_DEVICE_ID_MS_XBOX_CONTROLLER_MODEL_1708_BLE 0x0b20 +#define USB_DEVICE_ID_MS_XBOX_CONTROLLER_MODEL_1914 0x0b13 +#define USB_DEVICE_ID_MS_XBOX_CONTROLLER_MODEL_1797 0x0b05 +#define USB_DEVICE_ID_MS_XBOX_CONTROLLER_MODEL_1797_BLE 0x0b22 #define USB_DEVICE_ID_MS_PIXART_MOUSE 0x00cb #define SPI_DEVICE_ID_MS_SURFACE_D6_0 0x0c1d #define SPI_DEVICE_ID_MS_SURFACE_D6_1 0x0c42 diff --git a/drivers/hid/hid-microsoft.c b/drivers/hid/hid-microsoft.c index e449ee9cc04c..0c587f6a2a67 100644 --- a/drivers/hid/hid-microsoft.c +++ b/drivers/hid/hid-microsoft.c @@ -456,7 +456,16 @@ static const struct hid_device_id ms_devices[] = { .driver_data = MS_PRESENTER }, { HID_BLUETOOTH_DEVICE(USB_VENDOR_ID_MICROSOFT, 0x091B), .driver_data = MS_SURFACE_DIAL }, - { HID_BLUETOOTH_DEVICE(USB_VENDOR_ID_MICROSOFT, USB_DEVICE_ID_MS_XBOX_ONE_S_CONTROLLER), + + { HID_BLUETOOTH_DEVICE(USB_VENDOR_ID_MICROSOFT, USB_DEVICE_ID_MS_XBOX_CONTROLLER_MODEL_1708), + .driver_data = MS_QUIRK_FF }, + { HID_BLUETOOTH_DEVICE(USB_VENDOR_ID_MICROSOFT, USB_DEVICE_ID_MS_XBOX_CONTROLLER_MODEL_1708_BLE), + .driver_data = MS_QUIRK_FF }, + { HID_BLUETOOTH_DEVICE(USB_VENDOR_ID_MICROSOFT, USB_DEVICE_ID_MS_XBOX_CONTROLLER_MODEL_1914), + .driver_data = MS_QUIRK_FF }, + { HID_BLUETOOTH_DEVICE(USB_VENDOR_ID_MICROSOFT, USB_DEVICE_ID_MS_XBOX_CONTROLLER_MODEL_1797), + .driver_data = MS_QUIRK_FF }, + { HID_BLUETOOTH_DEVICE(USB_VENDOR_ID_MICROSOFT, USB_DEVICE_ID_MS_XBOX_CONTROLLER_MODEL_1797_BLE), .driver_data = MS_QUIRK_FF }, { HID_SPI_DEVICE(USB_VENDOR_ID_MICROSOFT, SPI_DEVICE_ID_MS_SURFACE_D6_0), .driver_data = MS_NOHIDINPUT }, diff --git a/drivers/hid/wacom_wac.c b/drivers/hid/wacom_wac.c index 18f3d220aaad..e083e21fe742 100644 --- a/drivers/hid/wacom_wac.c +++ b/drivers/hid/wacom_wac.c @@ -714,13 +714,12 @@ static int wacom_intuos_get_tool_type(int tool_id) case 0x8e2: /* IntuosHT2 pen */ case 0x022: case 0x200: /* Pro Pen 3 */ - case 0x04200: /* Pro Pen 3 */ case 0x10842: /* MobileStudio Pro Pro Pen slim */ case 0x14802: /* Intuos4/5 13HD/24HD Classic Pen */ case 0x16802: /* Cintiq 13HD Pro Pen */ case 0x18802: /* DTH2242 Pen */ case 0x10802: /* Intuos4/5 13HD/24HD General Pen */ - case 0x80842: /* Intuos Pro and Cintiq Pro 3D Pen */ + case 0x8842: /* Intuos Pro and Cintiq Pro 3D Pen */ tool_type = BTN_TOOL_PEN; break; @@ -1921,12 +1920,14 @@ static void wacom_map_usage(struct input_dev *input, struct hid_usage *usage, int fmax = field->logical_maximum; unsigned int equivalent_usage = wacom_equivalent_usage(usage->hid); int resolution_code = code; - int resolution = hidinput_calc_abs_res(field, resolution_code); + int resolution; if (equivalent_usage == HID_DG_TWIST) { resolution_code = ABS_RZ; } + resolution = hidinput_calc_abs_res(field, resolution_code); + if (equivalent_usage == HID_GD_X) { fmin += features->offset_left; fmax -= features->offset_right; diff --git a/drivers/hwmon/adt7475.c b/drivers/hwmon/adt7475.c index 5af7226657ab..cd771285a5cb 100644 --- a/drivers/hwmon/adt7475.c +++ b/drivers/hwmon/adt7475.c @@ -1681,7 +1681,7 @@ static void adt7475_read_pwm(struct i2c_client *client, int index) data->pwm[CONTROL][index] &= ~0xE0; data->pwm[CONTROL][index] |= (7 << 5); - i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index), + i2c_smbus_write_byte_data(client, PWM_REG(index), data->pwm[INPUT][index]); i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index), diff --git a/drivers/hwmon/max6697.c b/drivers/hwmon/max6697.c index 64122eb38060..6804d840351a 100644 --- a/drivers/hwmon/max6697.c +++ b/drivers/hwmon/max6697.c @@ -305,6 +305,7 @@ static ssize_t temp_store(struct device *dev, return ret; mutex_lock(&data->update_lock); + temp = clamp_val(temp, -1000000, 1000000); /* prevent underflow */ temp = DIV_ROUND_CLOSEST(temp, 1000) + data->temp_offset; temp = clamp_val(temp, 0, data->type == max6581 ? 255 : 127); data->temp[nr][index] = temp; @@ -358,14 +359,14 @@ static SENSOR_DEVICE_ATTR_RO(temp6_max_alarm, alarm, 20); static SENSOR_DEVICE_ATTR_RO(temp7_max_alarm, alarm, 21); static SENSOR_DEVICE_ATTR_RO(temp8_max_alarm, alarm, 23); -static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 14); +static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 15); static SENSOR_DEVICE_ATTR_RO(temp2_crit_alarm, alarm, 8); static SENSOR_DEVICE_ATTR_RO(temp3_crit_alarm, alarm, 9); static SENSOR_DEVICE_ATTR_RO(temp4_crit_alarm, alarm, 10); static SENSOR_DEVICE_ATTR_RO(temp5_crit_alarm, alarm, 11); static SENSOR_DEVICE_ATTR_RO(temp6_crit_alarm, alarm, 12); static SENSOR_DEVICE_ATTR_RO(temp7_crit_alarm, alarm, 13); -static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 15); +static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 14); static SENSOR_DEVICE_ATTR_RO(temp2_fault, alarm, 1); static SENSOR_DEVICE_ATTR_RO(temp3_fault, alarm, 2); diff --git a/drivers/i2c/busses/i2c-riic.c b/drivers/i2c/busses/i2c-riic.c index 800414886f6b..588a3efb09c2 100644 --- a/drivers/i2c/busses/i2c-riic.c +++ b/drivers/i2c/busses/i2c-riic.c @@ -312,7 +312,7 @@ static int riic_init_hw(struct riic_dev *riic, struct i2c_timings *t) * frequency with only 62 clock ticks max (31 high, 31 low). * Aim for a duty of 60% LOW, 40% HIGH. */ - total_ticks = DIV_ROUND_UP(rate, t->bus_freq_hz); + total_ticks = DIV_ROUND_UP(rate, t->bus_freq_hz ?: 1); for (cks = 0; cks < 7; cks++) { /* diff --git a/drivers/i2c/i2c-smbus.c b/drivers/i2c/i2c-smbus.c index 03096f47e6ab..85b17c71ce84 100644 --- a/drivers/i2c/i2c-smbus.c +++ b/drivers/i2c/i2c-smbus.c @@ -33,6 +33,7 @@ static int smbus_do_alert(struct device *dev, void *addrp) struct i2c_client *client = i2c_verify_client(dev); struct alert_data *data = addrp; struct i2c_driver *driver; + int ret; if (!client || client->addr != data->addr) return 0; @@ -46,16 +47,47 @@ static int smbus_do_alert(struct device *dev, void *addrp) device_lock(dev); if (client->dev.driver) { driver = to_i2c_driver(client->dev.driver); - if (driver->alert) + if (driver->alert) { + /* Stop iterating after we find the device */ driver->alert(client, data->type, data->data); - else + ret = -EBUSY; + } else { dev_warn(&client->dev, "no driver alert()!\n"); - } else + ret = -EOPNOTSUPP; + } + } else { dev_dbg(&client->dev, "alert with no driver\n"); + ret = -ENODEV; + } device_unlock(dev); - /* Stop iterating after we find the device */ - return -EBUSY; + return ret; +} + +/* Same as above, but call back all drivers with alert handler */ + +static int smbus_do_alert_force(struct device *dev, void *addrp) +{ + struct i2c_client *client = i2c_verify_client(dev); + struct alert_data *data = addrp; + struct i2c_driver *driver; + + if (!client || (client->flags & I2C_CLIENT_TEN)) + return 0; + + /* + * Drivers should either disable alerts, or provide at least + * a minimal handler. Lock so the driver won't change. + */ + device_lock(dev); + if (client->dev.driver) { + driver = to_i2c_driver(client->dev.driver); + if (driver->alert) + driver->alert(client, data->type, data->data); + } + device_unlock(dev); + + return 0; } /* @@ -66,7 +98,7 @@ static irqreturn_t smbus_alert(int irq, void *d) { struct i2c_smbus_alert *alert = d; struct i2c_client *ara; - unsigned short prev_addr = 0; /* Not a valid address */ + unsigned short prev_addr = I2C_CLIENT_END; /* Not a valid address */ ara = alert->ara; @@ -90,17 +122,28 @@ static irqreturn_t smbus_alert(int irq, void *d) data.addr = status >> 1; data.type = I2C_PROTOCOL_SMBUS_ALERT; - if (data.addr == prev_addr) { - dev_warn(&ara->dev, "Duplicate SMBALERT# from dev " - "0x%02x, skipping\n", data.addr); - break; - } dev_dbg(&ara->dev, "SMBALERT# from dev 0x%02x, flag %d\n", data.addr, data.data); /* Notify driver for the device which issued the alert */ - device_for_each_child(&ara->adapter->dev, &data, - smbus_do_alert); + status = device_for_each_child(&ara->adapter->dev, &data, + smbus_do_alert); + /* + * If we read the same address more than once, and the alert + * was not handled by a driver, it won't do any good to repeat + * the loop because it will never terminate. Try again, this + * time calling the alert handlers of all devices connected to + * the bus, and abort the loop afterwards. If this helps, we + * are all set. If it doesn't, there is nothing else we can do, + * so we might as well abort the loop. + * Note: This assumes that a driver with alert handler handles + * the alert properly and clears it if necessary. + */ + if (data.addr == prev_addr && status != -EBUSY) { + device_for_each_child(&ara->adapter->dev, &data, + smbus_do_alert_force); + break; + } prev_addr = data.addr; } diff --git a/drivers/infiniband/core/device.c b/drivers/infiniband/core/device.c index c7c3b9bae938..c46d68e6ccd0 100644 --- a/drivers/infiniband/core/device.c +++ b/drivers/infiniband/core/device.c @@ -2125,6 +2125,9 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev, unsigned long flags; int ret; + if (!rdma_is_port_valid(ib_dev, port)) + return -EINVAL; + /* * Drivers wish to call this before ib_register_driver, so we have to * setup the port data early. @@ -2133,9 +2136,6 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev, if (ret) return ret; - if (!rdma_is_port_valid(ib_dev, port)) - return -EINVAL; - pdata = &ib_dev->port_data[port]; spin_lock_irqsave(&pdata->netdev_lock, flags); old_ndev = rcu_dereference_protected( diff --git a/drivers/infiniband/core/iwcm.c b/drivers/infiniband/core/iwcm.c index 75b6da00065a..7a6747850aea 100644 --- a/drivers/infiniband/core/iwcm.c +++ b/drivers/infiniband/core/iwcm.c @@ -370,8 +370,10 @@ EXPORT_SYMBOL(iw_cm_disconnect); * * Clean up all resources associated with the connection and release * the initial reference taken by iw_create_cm_id. + * + * Returns true if and only if the last cm_id_priv reference has been dropped. */ -static void destroy_cm_id(struct iw_cm_id *cm_id) +static bool destroy_cm_id(struct iw_cm_id *cm_id) { struct iwcm_id_private *cm_id_priv; struct ib_qp *qp; @@ -441,7 +443,7 @@ static void destroy_cm_id(struct iw_cm_id *cm_id) iwpm_remove_mapping(&cm_id->local_addr, RDMA_NL_IWCM); } - (void)iwcm_deref_id(cm_id_priv); + return iwcm_deref_id(cm_id_priv); } /* @@ -452,7 +454,8 @@ static void destroy_cm_id(struct iw_cm_id *cm_id) */ void iw_destroy_cm_id(struct iw_cm_id *cm_id) { - destroy_cm_id(cm_id); + if (!destroy_cm_id(cm_id)) + flush_workqueue(iwcm_wq); } EXPORT_SYMBOL(iw_destroy_cm_id); @@ -1036,7 +1039,7 @@ static void cm_work_handler(struct work_struct *_work) if (!test_bit(IWCM_F_DROP_EVENTS, &cm_id_priv->flags)) { ret = process_event(cm_id_priv, &levent); if (ret) - destroy_cm_id(&cm_id_priv->id); + WARN_ON_ONCE(destroy_cm_id(&cm_id_priv->id)); } else pr_debug("dropping event %d\n", levent.event); if (iwcm_deref_id(cm_id_priv)) diff --git a/drivers/infiniband/hw/bnxt_re/ib_verbs.c b/drivers/infiniband/hw/bnxt_re/ib_verbs.c index c9a7c03403ac..4a1c11bdc4ad 100644 --- a/drivers/infiniband/hw/bnxt_re/ib_verbs.c +++ b/drivers/infiniband/hw/bnxt_re/ib_verbs.c @@ -2271,7 +2271,7 @@ static int bnxt_re_build_send_wqe(struct bnxt_re_qp *qp, break; case IB_WR_SEND_WITH_IMM: wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_IMM; - wqe->send.imm_data = wr->ex.imm_data; + wqe->send.imm_data = be32_to_cpu(wr->ex.imm_data); break; case IB_WR_SEND_WITH_INV: wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_INV; @@ -2301,7 +2301,7 @@ static int bnxt_re_build_rdma_wqe(const struct ib_send_wr *wr, break; case IB_WR_RDMA_WRITE_WITH_IMM: wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_WRITE_WITH_IMM; - wqe->rdma.imm_data = wr->ex.imm_data; + wqe->rdma.imm_data = be32_to_cpu(wr->ex.imm_data); break; case IB_WR_RDMA_READ: wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_READ; @@ -3250,7 +3250,7 @@ static void bnxt_re_process_res_shadow_qp_wc(struct bnxt_re_qp *gsi_sqp, wc->byte_len = orig_cqe->length; wc->qp = &gsi_qp->ib_qp; - wc->ex.imm_data = orig_cqe->immdata; + wc->ex.imm_data = cpu_to_be32(le32_to_cpu(orig_cqe->immdata)); wc->src_qp = orig_cqe->src_qp; memcpy(wc->smac, orig_cqe->smac, ETH_ALEN); if (bnxt_re_is_vlan_pkt(orig_cqe, &vlan_id, &sl)) { @@ -3391,7 +3391,7 @@ int bnxt_re_poll_cq(struct ib_cq *ib_cq, int num_entries, struct ib_wc *wc) continue; } wc->qp = &qp->ib_qp; - wc->ex.imm_data = cqe->immdata; + wc->ex.imm_data = cpu_to_be32(le32_to_cpu(cqe->immdata)); wc->src_qp = cqe->src_qp; memcpy(wc->smac, cqe->smac, ETH_ALEN); wc->port_num = 1; diff --git a/drivers/infiniband/hw/bnxt_re/qplib_fp.h b/drivers/infiniband/hw/bnxt_re/qplib_fp.h index 99e0a13cbefa..ff0f7b109507 100644 --- a/drivers/infiniband/hw/bnxt_re/qplib_fp.h +++ b/drivers/infiniband/hw/bnxt_re/qplib_fp.h @@ -145,7 +145,7 @@ struct bnxt_qplib_swqe { /* Send, with imm, inval key */ struct { union { - __be32 imm_data; + u32 imm_data; u32 inv_key; }; u32 q_key; @@ -163,7 +163,7 @@ struct bnxt_qplib_swqe { /* RDMA write, with imm, read */ struct { union { - __be32 imm_data; + u32 imm_data; u32 inv_key; }; u64 remote_va; @@ -350,7 +350,7 @@ struct bnxt_qplib_cqe { u16 cfa_meta; u64 wr_id; union { - __be32 immdata; + __le32 immdata; u32 invrkey; }; u64 qp_handle; diff --git a/drivers/infiniband/hw/hfi1/chip.c b/drivers/infiniband/hw/hfi1/chip.c index 65d6bf34614c..6cf87fcfc4eb 100644 --- a/drivers/infiniband/hw/hfi1/chip.c +++ b/drivers/infiniband/hw/hfi1/chip.c @@ -13067,15 +13067,16 @@ static void read_mod_write(struct hfi1_devdata *dd, u16 src, u64 bits, { u64 reg; u16 idx = src / BITS_PER_REGISTER; + unsigned long flags; - spin_lock(&dd->irq_src_lock); + spin_lock_irqsave(&dd->irq_src_lock, flags); reg = read_csr(dd, CCE_INT_MASK + (8 * idx)); if (set) reg |= bits; else reg &= ~bits; write_csr(dd, CCE_INT_MASK + (8 * idx), reg); - spin_unlock(&dd->irq_src_lock); + spin_unlock_irqrestore(&dd->irq_src_lock, flags); } /** diff --git a/drivers/infiniband/hw/mlx4/alias_GUID.c b/drivers/infiniband/hw/mlx4/alias_GUID.c index cca414ecfcd5..05420e189ca9 100644 --- a/drivers/infiniband/hw/mlx4/alias_GUID.c +++ b/drivers/infiniband/hw/mlx4/alias_GUID.c @@ -832,7 +832,7 @@ void mlx4_ib_destroy_alias_guid_service(struct mlx4_ib_dev *dev) int mlx4_ib_init_alias_guid_service(struct mlx4_ib_dev *dev) { - char alias_wq_name[15]; + char alias_wq_name[22]; int ret = 0; int i, j; union ib_gid gid; diff --git a/drivers/infiniband/hw/mlx4/mad.c b/drivers/infiniband/hw/mlx4/mad.c index 08eccf2b6967..511e095aa556 100644 --- a/drivers/infiniband/hw/mlx4/mad.c +++ b/drivers/infiniband/hw/mlx4/mad.c @@ -2167,7 +2167,7 @@ static int mlx4_ib_alloc_demux_ctx(struct mlx4_ib_dev *dev, struct mlx4_ib_demux_ctx *ctx, int port) { - char name[12]; + char name[21]; int ret = 0; int i; diff --git a/drivers/infiniband/sw/rxe/rxe_req.c b/drivers/infiniband/sw/rxe/rxe_req.c index 87702478eb99..85b382507f60 100644 --- a/drivers/infiniband/sw/rxe/rxe_req.c +++ b/drivers/infiniband/sw/rxe/rxe_req.c @@ -390,7 +390,7 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp, int solicited; u16 pkey; u32 qp_num; - int ack_req; + int ack_req = 0; /* length from start of bth to end of icrc */ paylen = rxe_opcode[opcode].length + payload + pad + RXE_ICRC_SIZE; @@ -426,8 +426,9 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp, qp_num = (pkt->mask & RXE_DETH_MASK) ? ibwr->wr.ud.remote_qpn : qp->attr.dest_qp_num; - ack_req = ((pkt->mask & RXE_END_MASK) || - (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK)); + if (qp_type(qp) != IB_QPT_UD && qp_type(qp) != IB_QPT_UC) + ack_req = ((pkt->mask & RXE_END_MASK) || + (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK)); if (ack_req) qp->req.noack_pkts = 0; diff --git a/drivers/input/input-mt.c b/drivers/input/input-mt.c index a81e14148407..dd457403a1a0 100644 --- a/drivers/input/input-mt.c +++ b/drivers/input/input-mt.c @@ -45,6 +45,9 @@ int input_mt_init_slots(struct input_dev *dev, unsigned int num_slots, return 0; if (mt) return mt->num_slots != num_slots ? -EINVAL : 0; + /* Arbitrary limit for avoiding too large memory allocation. */ + if (num_slots > 1024) + return -EINVAL; mt = kzalloc(struct_size(mt, slots, num_slots), GFP_KERNEL); if (!mt) diff --git a/drivers/input/keyboard/qt1050.c b/drivers/input/keyboard/qt1050.c index 403060d05c3b..7193a4198e21 100644 --- a/drivers/input/keyboard/qt1050.c +++ b/drivers/input/keyboard/qt1050.c @@ -226,7 +226,12 @@ static bool qt1050_identify(struct qt1050_priv *ts) int err; /* Read Chip ID */ - regmap_read(ts->regmap, QT1050_CHIP_ID, &val); + err = regmap_read(ts->regmap, QT1050_CHIP_ID, &val); + if (err) { + dev_err(&ts->client->dev, "Failed to read chip ID: %d\n", err); + return false; + } + if (val != QT1050_CHIP_ID_VER) { dev_err(&ts->client->dev, "ID %d not supported\n", val); return false; diff --git a/drivers/input/mouse/elan_i2c_core.c b/drivers/input/mouse/elan_i2c_core.c index aaef8847f886..5fc4edbb70a9 100644 --- a/drivers/input/mouse/elan_i2c_core.c +++ b/drivers/input/mouse/elan_i2c_core.c @@ -1295,6 +1295,8 @@ static int __maybe_unused elan_suspend(struct device *dev) } err: + if (ret) + enable_irq(client->irq); mutex_unlock(&data->sysfs_mutex); return ret; } diff --git a/drivers/irqchip/irq-gic-v3-its.c b/drivers/irqchip/irq-gic-v3-its.c index d16776c6dee7..ae3378ef469b 100644 --- a/drivers/irqchip/irq-gic-v3-its.c +++ b/drivers/irqchip/irq-gic-v3-its.c @@ -3085,8 +3085,6 @@ static int its_vpe_irq_domain_alloc(struct irq_domain *domain, unsigned int virq struct page *vprop_page; int base, nr_ids, i, err = 0; - BUG_ON(!vm); - bitmap = its_lpi_alloc(roundup_pow_of_two(nr_irqs), &base, &nr_ids); if (!bitmap) return -ENOMEM; diff --git a/drivers/irqchip/irq-mbigen.c b/drivers/irqchip/irq-mbigen.c index ff7627b57772..192950e9909b 100644 --- a/drivers/irqchip/irq-mbigen.c +++ b/drivers/irqchip/irq-mbigen.c @@ -64,6 +64,20 @@ struct mbigen_device { void __iomem *base; }; +static inline unsigned int get_mbigen_node_offset(unsigned int nid) +{ + unsigned int offset = nid * MBIGEN_NODE_OFFSET; + + /* + * To avoid touched clear register in unexpected way, we need to directly + * skip clear register when access to more than 10 mbigen nodes. + */ + if (nid >= (REG_MBIGEN_CLEAR_OFFSET / MBIGEN_NODE_OFFSET)) + offset += MBIGEN_NODE_OFFSET; + + return offset; +} + static inline unsigned int get_mbigen_vec_reg(irq_hw_number_t hwirq) { unsigned int nid, pin; @@ -72,8 +86,7 @@ static inline unsigned int get_mbigen_vec_reg(irq_hw_number_t hwirq) nid = hwirq / IRQS_PER_MBIGEN_NODE + 1; pin = hwirq % IRQS_PER_MBIGEN_NODE; - return pin * 4 + nid * MBIGEN_NODE_OFFSET - + REG_MBIGEN_VEC_OFFSET; + return pin * 4 + get_mbigen_node_offset(nid) + REG_MBIGEN_VEC_OFFSET; } static inline void get_mbigen_type_reg(irq_hw_number_t hwirq, @@ -88,8 +101,7 @@ static inline void get_mbigen_type_reg(irq_hw_number_t hwirq, *mask = 1 << (irq_ofst % 32); ofst = irq_ofst / 32 * 4; - *addr = ofst + nid * MBIGEN_NODE_OFFSET - + REG_MBIGEN_TYPE_OFFSET; + *addr = ofst + get_mbigen_node_offset(nid) + REG_MBIGEN_TYPE_OFFSET; } static inline void get_mbigen_clear_reg(irq_hw_number_t hwirq, diff --git a/drivers/isdn/hardware/mISDN/hfcmulti.c b/drivers/isdn/hardware/mISDN/hfcmulti.c index 2c7406465233..6e0997561330 100644 --- a/drivers/isdn/hardware/mISDN/hfcmulti.c +++ b/drivers/isdn/hardware/mISDN/hfcmulti.c @@ -1931,7 +1931,7 @@ hfcmulti_dtmf(struct hfc_multi *hc) static void hfcmulti_tx(struct hfc_multi *hc, int ch) { - int i, ii, temp, len = 0; + int i, ii, temp, tmp_len, len = 0; int Zspace, z1, z2; /* must be int for calculation */ int Fspace, f1, f2; u_char *d; @@ -2152,14 +2152,15 @@ next_frame: HFC_wait_nodebug(hc); } + tmp_len = (*sp)->len; dev_kfree_skb(*sp); /* check for next frame */ if (bch && get_next_bframe(bch)) { - len = (*sp)->len; + len = tmp_len; goto next_frame; } if (dch && get_next_dframe(dch)) { - len = (*sp)->len; + len = tmp_len; goto next_frame; } diff --git a/drivers/leds/led-triggers.c b/drivers/leds/led-triggers.c index 0d59763e40de..3ec9629a1b00 100644 --- a/drivers/leds/led-triggers.c +++ b/drivers/leds/led-triggers.c @@ -121,9 +121,9 @@ int led_trigger_set(struct led_classdev *led_cdev, struct led_trigger *trig) flags); cancel_work_sync(&led_cdev->set_brightness_work); led_stop_software_blink(led_cdev); + device_remove_groups(led_cdev->dev, led_cdev->trigger->groups); if (led_cdev->trigger->deactivate) led_cdev->trigger->deactivate(led_cdev); - device_remove_groups(led_cdev->dev, led_cdev->trigger->groups); led_cdev->trigger = NULL; led_cdev->trigger_data = NULL; led_cdev->activated = false; diff --git a/drivers/leds/leds-ss4200.c b/drivers/leds/leds-ss4200.c index 245de443fe9c..833bb721a8e0 100644 --- a/drivers/leds/leds-ss4200.c +++ b/drivers/leds/leds-ss4200.c @@ -356,8 +356,10 @@ static int ich7_lpc_probe(struct pci_dev *dev, nas_gpio_pci_dev = dev; status = pci_read_config_dword(dev, PMBASE, &g_pm_io_base); - if (status) + if (status) { + status = pcibios_err_to_errno(status); goto out; + } g_pm_io_base &= 0x00000ff80; status = pci_read_config_dword(dev, GPIO_CTRL, &gc); @@ -369,8 +371,9 @@ static int ich7_lpc_probe(struct pci_dev *dev, } status = pci_read_config_dword(dev, GPIO_BASE, &nas_gpio_io_base); - if (0 > status) { + if (status) { dev_info(&dev->dev, "Unable to read GPIOBASE.\n"); + status = pcibios_err_to_errno(status); goto out; } dev_dbg(&dev->dev, ": GPIOBASE = 0x%08x\n", nas_gpio_io_base); diff --git a/drivers/macintosh/therm_windtunnel.c b/drivers/macintosh/therm_windtunnel.c index a0d87ed9da69..63e99762a165 100644 --- a/drivers/macintosh/therm_windtunnel.c +++ b/drivers/macintosh/therm_windtunnel.c @@ -549,7 +549,7 @@ g4fan_exit( void ) platform_driver_unregister( &therm_of_driver ); if( x.of_dev ) - of_device_unregister( x.of_dev ); + of_platform_device_destroy(&x.of_dev->dev, NULL); } module_init(g4fan_init); diff --git a/drivers/md/dm-clone-metadata.c b/drivers/md/dm-clone-metadata.c index 17712456fa63..383258eae750 100644 --- a/drivers/md/dm-clone-metadata.c +++ b/drivers/md/dm-clone-metadata.c @@ -471,11 +471,6 @@ static void __destroy_persistent_data_structures(struct dm_clone_metadata *cmd) /*---------------------------------------------------------------------------*/ -static size_t bitmap_size(unsigned long nr_bits) -{ - return BITS_TO_LONGS(nr_bits) * sizeof(long); -} - static int __dirty_map_init(struct dirty_map *dmap, unsigned long nr_words, unsigned long nr_regions) { diff --git a/drivers/md/dm-ioctl.c b/drivers/md/dm-ioctl.c index e89e710dd292..83727fa05c16 100644 --- a/drivers/md/dm-ioctl.c +++ b/drivers/md/dm-ioctl.c @@ -1064,8 +1064,26 @@ static int do_resume(struct dm_ioctl *param) suspend_flags &= ~DM_SUSPEND_LOCKFS_FLAG; if (param->flags & DM_NOFLUSH_FLAG) suspend_flags |= DM_SUSPEND_NOFLUSH_FLAG; - if (!dm_suspended_md(md)) - dm_suspend(md, suspend_flags); + if (!dm_suspended_md(md)) { + r = dm_suspend(md, suspend_flags); + if (r) { + down_write(&_hash_lock); + hc = dm_get_mdptr(md); + if (hc && !hc->new_map) { + hc->new_map = new_map; + new_map = NULL; + } else { + r = -ENXIO; + } + up_write(&_hash_lock); + if (new_map) { + dm_sync_table(md); + dm_table_destroy(new_map); + } + dm_put(md); + return r; + } + } old_map = dm_swap_table(md, new_map); if (IS_ERR(old_map)) { diff --git a/drivers/md/dm-mpath.c b/drivers/md/dm-mpath.c index 54ecfea2cf47..4f6a54452b1c 100644 --- a/drivers/md/dm-mpath.c +++ b/drivers/md/dm-mpath.c @@ -558,7 +558,8 @@ static void multipath_release_clone(struct request *clone, if (pgpath && pgpath->pg->ps.type->end_io) pgpath->pg->ps.type->end_io(&pgpath->pg->ps, &pgpath->path, - mpio->nr_bytes); + mpio->nr_bytes, + clone->io_start_time_ns); } blk_put_request(clone); @@ -1568,7 +1569,8 @@ static int multipath_end_io(struct dm_target *ti, struct request *clone, struct path_selector *ps = &pgpath->pg->ps; if (ps->type->end_io) - ps->type->end_io(ps, &pgpath->path, mpio->nr_bytes); + ps->type->end_io(ps, &pgpath->path, mpio->nr_bytes, + clone->io_start_time_ns); } return r; @@ -1612,7 +1614,8 @@ done: struct path_selector *ps = &pgpath->pg->ps; if (ps->type->end_io) - ps->type->end_io(ps, &pgpath->path, mpio->nr_bytes); + ps->type->end_io(ps, &pgpath->path, mpio->nr_bytes, + dm_start_time_ns_from_clone(clone)); } return r; diff --git a/drivers/md/dm-path-selector.h b/drivers/md/dm-path-selector.h index b6eb5365b1a4..c47bc0e20275 100644 --- a/drivers/md/dm-path-selector.h +++ b/drivers/md/dm-path-selector.h @@ -74,7 +74,7 @@ struct path_selector_type { int (*start_io) (struct path_selector *ps, struct dm_path *path, size_t nr_bytes); int (*end_io) (struct path_selector *ps, struct dm_path *path, - size_t nr_bytes); + size_t nr_bytes, u64 start_time); }; /* Register a path selector */ diff --git a/drivers/md/dm-queue-length.c b/drivers/md/dm-queue-length.c index 969c4f1a3633..5fd018d18418 100644 --- a/drivers/md/dm-queue-length.c +++ b/drivers/md/dm-queue-length.c @@ -227,7 +227,7 @@ static int ql_start_io(struct path_selector *ps, struct dm_path *path, } static int ql_end_io(struct path_selector *ps, struct dm_path *path, - size_t nr_bytes) + size_t nr_bytes, u64 start_time) { struct path_info *pi = path->pscontext; diff --git a/drivers/md/dm-rq.c b/drivers/md/dm-rq.c index 6bc61927d320..3d6ac63ee85a 100644 --- a/drivers/md/dm-rq.c +++ b/drivers/md/dm-rq.c @@ -143,10 +143,6 @@ static void rq_end_stats(struct mapped_device *md, struct request *orig) */ static void rq_completed(struct mapped_device *md) { - /* nudge anyone waiting on suspend queue */ - if (unlikely(wq_has_sleeper(&md->wait))) - wake_up(&md->wait); - /* * dm_put() must be at the end of this function. See the comment above */ diff --git a/drivers/md/dm-service-time.c b/drivers/md/dm-service-time.c index f006a9005593..9cfda665e9eb 100644 --- a/drivers/md/dm-service-time.c +++ b/drivers/md/dm-service-time.c @@ -309,7 +309,7 @@ static int st_start_io(struct path_selector *ps, struct dm_path *path, } static int st_end_io(struct path_selector *ps, struct dm_path *path, - size_t nr_bytes) + size_t nr_bytes, u64 start_time) { struct path_info *pi = path->pscontext; diff --git a/drivers/md/dm.c b/drivers/md/dm.c index a851d9183ff9..454c29f7ede3 100644 --- a/drivers/md/dm.c +++ b/drivers/md/dm.c @@ -665,27 +665,14 @@ static void free_tio(struct dm_target_io *tio) bio_put(&tio->clone); } -static bool md_in_flight_bios(struct mapped_device *md) +u64 dm_start_time_ns_from_clone(struct bio *bio) { - int cpu; - struct hd_struct *part = &dm_disk(md)->part0; - long sum = 0; + struct dm_target_io *tio = container_of(bio, struct dm_target_io, clone); + struct dm_io *io = tio->io; - for_each_possible_cpu(cpu) { - sum += part_stat_local_read_cpu(part, in_flight[0], cpu); - sum += part_stat_local_read_cpu(part, in_flight[1], cpu); - } - - return sum != 0; -} - -static bool md_in_flight(struct mapped_device *md) -{ - if (queue_is_mq(md->queue)) - return blk_mq_queue_inflight(md->queue); - else - return md_in_flight_bios(md); + return jiffies_to_nsecs(io->start_time); } +EXPORT_SYMBOL_GPL(dm_start_time_ns_from_clone); static void start_io_acct(struct dm_io *io) { @@ -2571,19 +2558,33 @@ void dm_put(struct mapped_device *md) } EXPORT_SYMBOL_GPL(dm_put); -static int dm_wait_for_completion(struct mapped_device *md, long task_state) +static bool md_in_flight_bios(struct mapped_device *md) +{ + int cpu; + struct hd_struct *part = &dm_disk(md)->part0; + long sum = 0; + + for_each_possible_cpu(cpu) { + sum += part_stat_local_read_cpu(part, in_flight[0], cpu); + sum += part_stat_local_read_cpu(part, in_flight[1], cpu); + } + + return sum != 0; +} + +static int dm_wait_for_bios_completion(struct mapped_device *md, long task_state) { int r = 0; DEFINE_WAIT(wait); - while (1) { + while (true) { prepare_to_wait(&md->wait, &wait, task_state); - if (!md_in_flight(md)) + if (!md_in_flight_bios(md)) break; if (signal_pending_state(task_state, current)) { - r = -EINTR; + r = -ERESTARTSYS; break; } @@ -2596,6 +2597,28 @@ static int dm_wait_for_completion(struct mapped_device *md, long task_state) return r; } +static int dm_wait_for_completion(struct mapped_device *md, long task_state) +{ + int r = 0; + + if (!queue_is_mq(md->queue)) + return dm_wait_for_bios_completion(md, task_state); + + while (true) { + if (!blk_mq_queue_inflight(md->queue)) + break; + + if (signal_pending_state(task_state, current)) { + r = -ERESTARTSYS; + break; + } + + msleep(5); + } + + return r; +} + /* * Process the deferred bios */ diff --git a/drivers/md/md.c b/drivers/md/md.c index 61c3e8df1b55..e5f3010debb8 100644 --- a/drivers/md/md.c +++ b/drivers/md/md.c @@ -7396,11 +7396,6 @@ static int md_ioctl(struct block_device *bdev, fmode_t mode, mddev = bdev->bd_disk->private_data; - if (!mddev) { - BUG(); - goto out; - } - /* Some actions do not requires the mutex */ switch (cmd) { case GET_ARRAY_INFO: diff --git a/drivers/md/persistent-data/dm-space-map-metadata.c b/drivers/md/persistent-data/dm-space-map-metadata.c index da439ac85796..25ce7fb7fd9d 100644 --- a/drivers/md/persistent-data/dm-space-map-metadata.c +++ b/drivers/md/persistent-data/dm-space-map-metadata.c @@ -275,7 +275,7 @@ static void sm_metadata_destroy(struct dm_space_map *sm) { struct sm_metadata *smm = container_of(sm, struct sm_metadata, sm); - kfree(smm); + kvfree(smm); } static int sm_metadata_get_nr_blocks(struct dm_space_map *sm, dm_block_t *count) @@ -759,7 +759,7 @@ struct dm_space_map *dm_sm_metadata_init(void) { struct sm_metadata *smm; - smm = kmalloc(sizeof(*smm), GFP_KERNEL); + smm = kvmalloc(sizeof(*smm), GFP_KERNEL); if (!smm) return ERR_PTR(-ENOMEM); diff --git a/drivers/md/raid5.c b/drivers/md/raid5.c index bba5e61cc145..41556f5d4dcb 100644 --- a/drivers/md/raid5.c +++ b/drivers/md/raid5.c @@ -5821,7 +5821,9 @@ static sector_t reshape_request(struct mddev *mddev, sector_t sector_nr, int *sk safepos = conf->reshape_safe; sector_div(safepos, data_disks); if (mddev->reshape_backwards) { - BUG_ON(writepos < reshape_sectors); + if (WARN_ON(writepos < reshape_sectors)) + return MaxSector; + writepos -= reshape_sectors; readpos += reshape_sectors; safepos += reshape_sectors; @@ -5839,14 +5841,18 @@ static sector_t reshape_request(struct mddev *mddev, sector_t sector_nr, int *sk * to set 'stripe_addr' which is where we will write to. */ if (mddev->reshape_backwards) { - BUG_ON(conf->reshape_progress == 0); + if (WARN_ON(conf->reshape_progress == 0)) + return MaxSector; + stripe_addr = writepos; - BUG_ON((mddev->dev_sectors & - ~((sector_t)reshape_sectors - 1)) - - reshape_sectors - stripe_addr - != sector_nr); + if (WARN_ON((mddev->dev_sectors & + ~((sector_t)reshape_sectors - 1)) - + reshape_sectors - stripe_addr != sector_nr)) + return MaxSector; } else { - BUG_ON(writepos != sector_nr + reshape_sectors); + if (WARN_ON(writepos != sector_nr + reshape_sectors)) + return MaxSector; + stripe_addr = sector_nr; } diff --git a/drivers/media/pci/cx23885/cx23885-video.c b/drivers/media/pci/cx23885/cx23885-video.c index f56b271db8be..10fde1ec3609 100644 --- a/drivers/media/pci/cx23885/cx23885-video.c +++ b/drivers/media/pci/cx23885/cx23885-video.c @@ -1299,6 +1299,10 @@ int cx23885_video_register(struct cx23885_dev *dev) /* register Video device */ dev->video_dev = cx23885_vdev_init(dev, dev->pci, &cx23885_video_template, "video"); + if (!dev->video_dev) { + err = -ENOMEM; + goto fail_unreg; + } dev->video_dev->queue = &dev->vb2_vidq; dev->video_dev->device_caps = V4L2_CAP_READWRITE | V4L2_CAP_STREAMING | V4L2_CAP_AUDIO | V4L2_CAP_VIDEO_CAPTURE; @@ -1317,6 +1321,10 @@ int cx23885_video_register(struct cx23885_dev *dev) /* register VBI device */ dev->vbi_dev = cx23885_vdev_init(dev, dev->pci, &cx23885_vbi_template, "vbi"); + if (!dev->vbi_dev) { + err = -ENOMEM; + goto fail_unreg; + } dev->vbi_dev->queue = &dev->vb2_vbiq; dev->vbi_dev->device_caps = V4L2_CAP_READWRITE | V4L2_CAP_STREAMING | V4L2_CAP_AUDIO | V4L2_CAP_VBI_CAPTURE; diff --git a/drivers/media/pci/saa7134/saa7134-dvb.c b/drivers/media/pci/saa7134/saa7134-dvb.c index f359cd5c006a..c786b83a69d2 100644 --- a/drivers/media/pci/saa7134/saa7134-dvb.c +++ b/drivers/media/pci/saa7134/saa7134-dvb.c @@ -466,7 +466,9 @@ static int philips_europa_tuner_sleep(struct dvb_frontend *fe) /* switch the board to analog mode */ if (fe->ops.i2c_gate_ctrl) fe->ops.i2c_gate_ctrl(fe, 1); - i2c_transfer(&dev->i2c_adap, &analog_msg, 1); + if (i2c_transfer(&dev->i2c_adap, &analog_msg, 1) != 1) + return -EIO; + return 0; } @@ -1018,7 +1020,9 @@ static int md8800_set_voltage2(struct dvb_frontend *fe, else wbuf[1] = rbuf & 0xef; msg[0].len = 2; - i2c_transfer(&dev->i2c_adap, msg, 1); + if (i2c_transfer(&dev->i2c_adap, msg, 1) != 1) + return -EIO; + return 0; } diff --git a/drivers/media/pci/solo6x10/solo6x10-offsets.h b/drivers/media/pci/solo6x10/solo6x10-offsets.h index e3ae6a02dbb9..244837395f02 100644 --- a/drivers/media/pci/solo6x10/solo6x10-offsets.h +++ b/drivers/media/pci/solo6x10/solo6x10-offsets.h @@ -57,16 +57,16 @@ #define SOLO_MP4E_EXT_ADDR(__solo) \ (SOLO_EREF_EXT_ADDR(__solo) + SOLO_EREF_EXT_AREA(__solo)) #define SOLO_MP4E_EXT_SIZE(__solo) \ - max((__solo->nr_chans * 0x00080000), \ - min(((__solo->sdram_size - SOLO_MP4E_EXT_ADDR(__solo)) - \ - __SOLO_JPEG_MIN_SIZE(__solo)), 0x00ff0000)) + clamp(__solo->sdram_size - SOLO_MP4E_EXT_ADDR(__solo) - \ + __SOLO_JPEG_MIN_SIZE(__solo), \ + __solo->nr_chans * 0x00080000, 0x00ff0000) #define __SOLO_JPEG_MIN_SIZE(__solo) (__solo->nr_chans * 0x00080000) #define SOLO_JPEG_EXT_ADDR(__solo) \ (SOLO_MP4E_EXT_ADDR(__solo) + SOLO_MP4E_EXT_SIZE(__solo)) #define SOLO_JPEG_EXT_SIZE(__solo) \ - max(__SOLO_JPEG_MIN_SIZE(__solo), \ - min((__solo->sdram_size - SOLO_JPEG_EXT_ADDR(__solo)), 0x00ff0000)) + clamp(__solo->sdram_size - SOLO_JPEG_EXT_ADDR(__solo), \ + __SOLO_JPEG_MIN_SIZE(__solo), 0x00ff0000) #define SOLO_SDRAM_END(__solo) \ (SOLO_JPEG_EXT_ADDR(__solo) + SOLO_JPEG_EXT_SIZE(__solo)) diff --git a/drivers/media/platform/qcom/venus/vdec.c b/drivers/media/platform/qcom/venus/vdec.c index d1ac1d78c08f..a0a67b7132b8 100644 --- a/drivers/media/platform/qcom/venus/vdec.c +++ b/drivers/media/platform/qcom/venus/vdec.c @@ -1400,6 +1400,7 @@ static int vdec_close(struct file *file) { struct venus_inst *inst = to_inst(file); + cancel_work_sync(&inst->delayed_process_work); v4l2_m2m_ctx_release(inst->m2m_ctx); v4l2_m2m_release(inst->m2m_dev); vdec_ctrl_deinit(inst); diff --git a/drivers/media/platform/vsp1/vsp1_histo.c b/drivers/media/platform/vsp1/vsp1_histo.c index 30d751f2cccf..83c50628926b 100644 --- a/drivers/media/platform/vsp1/vsp1_histo.c +++ b/drivers/media/platform/vsp1/vsp1_histo.c @@ -36,9 +36,8 @@ struct vsp1_histogram_buffer * vsp1_histogram_buffer_get(struct vsp1_histogram *histo) { struct vsp1_histogram_buffer *buf = NULL; - unsigned long flags; - spin_lock_irqsave(&histo->irqlock, flags); + spin_lock(&histo->irqlock); if (list_empty(&histo->irqqueue)) goto done; @@ -49,7 +48,7 @@ vsp1_histogram_buffer_get(struct vsp1_histogram *histo) histo->readout = true; done: - spin_unlock_irqrestore(&histo->irqlock, flags); + spin_unlock(&histo->irqlock); return buf; } @@ -58,7 +57,6 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo, size_t size) { struct vsp1_pipeline *pipe = histo->entity.pipe; - unsigned long flags; /* * The pipeline pointer is guaranteed to be valid as this function is @@ -70,10 +68,10 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo, vb2_set_plane_payload(&buf->buf.vb2_buf, 0, size); vb2_buffer_done(&buf->buf.vb2_buf, VB2_BUF_STATE_DONE); - spin_lock_irqsave(&histo->irqlock, flags); + spin_lock(&histo->irqlock); histo->readout = false; wake_up(&histo->wait_queue); - spin_unlock_irqrestore(&histo->irqlock, flags); + spin_unlock(&histo->irqlock); } /* ----------------------------------------------------------------------------- @@ -124,11 +122,10 @@ static void histo_buffer_queue(struct vb2_buffer *vb) struct vb2_v4l2_buffer *vbuf = to_vb2_v4l2_buffer(vb); struct vsp1_histogram *histo = vb2_get_drv_priv(vb->vb2_queue); struct vsp1_histogram_buffer *buf = to_vsp1_histogram_buffer(vbuf); - unsigned long flags; - spin_lock_irqsave(&histo->irqlock, flags); + spin_lock_irq(&histo->irqlock); list_add_tail(&buf->queue, &histo->irqqueue); - spin_unlock_irqrestore(&histo->irqlock, flags); + spin_unlock_irq(&histo->irqlock); } static int histo_start_streaming(struct vb2_queue *vq, unsigned int count) @@ -140,9 +137,8 @@ static void histo_stop_streaming(struct vb2_queue *vq) { struct vsp1_histogram *histo = vb2_get_drv_priv(vq); struct vsp1_histogram_buffer *buffer; - unsigned long flags; - spin_lock_irqsave(&histo->irqlock, flags); + spin_lock_irq(&histo->irqlock); /* Remove all buffers from the IRQ queue. */ list_for_each_entry(buffer, &histo->irqqueue, queue) @@ -152,7 +148,7 @@ static void histo_stop_streaming(struct vb2_queue *vq) /* Wait for the buffer being read out (if any) to complete. */ wait_event_lock_irq(histo->wait_queue, !histo->readout, histo->irqlock); - spin_unlock_irqrestore(&histo->irqlock, flags); + spin_unlock_irq(&histo->irqlock); } static const struct vb2_ops histo_video_queue_qops = { diff --git a/drivers/media/platform/vsp1/vsp1_pipe.h b/drivers/media/platform/vsp1/vsp1_pipe.h index ae646c9ef337..15daf35bda21 100644 --- a/drivers/media/platform/vsp1/vsp1_pipe.h +++ b/drivers/media/platform/vsp1/vsp1_pipe.h @@ -73,7 +73,7 @@ struct vsp1_partition_window { * @wpf: The WPF partition window configuration */ struct vsp1_partition { - struct vsp1_partition_window rpf; + struct vsp1_partition_window rpf[VSP1_MAX_RPF]; struct vsp1_partition_window uds_sink; struct vsp1_partition_window uds_source; struct vsp1_partition_window sru; diff --git a/drivers/media/platform/vsp1/vsp1_rpf.c b/drivers/media/platform/vsp1/vsp1_rpf.c index 75083cb234fe..996a3058d5b7 100644 --- a/drivers/media/platform/vsp1/vsp1_rpf.c +++ b/drivers/media/platform/vsp1/vsp1_rpf.c @@ -271,8 +271,8 @@ static void rpf_configure_partition(struct vsp1_entity *entity, * 'width' need to be adjusted. */ if (pipe->partitions > 1) { - crop.width = pipe->partition->rpf.width; - crop.left += pipe->partition->rpf.left; + crop.width = pipe->partition->rpf[rpf->entity.index].width; + crop.left += pipe->partition->rpf[rpf->entity.index].left; } if (pipe->interlaced) { @@ -327,7 +327,9 @@ static void rpf_partition(struct vsp1_entity *entity, unsigned int partition_idx, struct vsp1_partition_window *window) { - partition->rpf = *window; + struct vsp1_rwpf *rpf = to_rwpf(&entity->subdev); + + partition->rpf[rpf->entity.index] = *window; } static const struct vsp1_entity_operations rpf_entity_ops = { diff --git a/drivers/media/radio/radio-isa.c b/drivers/media/radio/radio-isa.c index ad2ac16ff12d..610d3e326951 100644 --- a/drivers/media/radio/radio-isa.c +++ b/drivers/media/radio/radio-isa.c @@ -36,7 +36,7 @@ static int radio_isa_querycap(struct file *file, void *priv, strscpy(v->driver, isa->drv->driver.driver.name, sizeof(v->driver)); strscpy(v->card, isa->drv->card, sizeof(v->card)); - snprintf(v->bus_info, sizeof(v->bus_info), "ISA:%s", isa->v4l2_dev.name); + snprintf(v->bus_info, sizeof(v->bus_info), "ISA:%s", dev_name(isa->v4l2_dev.dev)); return 0; } diff --git a/drivers/media/rc/imon.c b/drivers/media/rc/imon.c index d8401ef9b0a7..38f6dd12d870 100644 --- a/drivers/media/rc/imon.c +++ b/drivers/media/rc/imon.c @@ -1117,10 +1117,7 @@ static int imon_ir_change_protocol(struct rc_dev *rc, u64 *rc_proto) memcpy(ictx->usb_tx_buf, &ir_proto_packet, sizeof(ir_proto_packet)); - if (!mutex_is_locked(&ictx->lock)) { - unlock = true; - mutex_lock(&ictx->lock); - } + unlock = mutex_trylock(&ictx->lock); retval = send_packet(ictx); if (retval) diff --git a/drivers/media/usb/uvc/uvc_ctrl.c b/drivers/media/usb/uvc/uvc_ctrl.c index e0d894c61f4b..e3457449faae 100644 --- a/drivers/media/usb/uvc/uvc_ctrl.c +++ b/drivers/media/usb/uvc/uvc_ctrl.c @@ -992,25 +992,55 @@ static s32 __uvc_ctrl_get_value(struct uvc_control_mapping *mapping, return value; } +static int __uvc_ctrl_load_cur(struct uvc_video_chain *chain, + struct uvc_control *ctrl) +{ + u8 *data; + int ret; + + if (ctrl->loaded) + return 0; + + data = uvc_ctrl_data(ctrl, UVC_CTRL_DATA_CURRENT); + + if ((ctrl->info.flags & UVC_CTRL_FLAG_GET_CUR) == 0) { + memset(data, 0, ctrl->info.size); + ctrl->loaded = 1; + + return 0; + } + + if (ctrl->entity->get_cur) + ret = ctrl->entity->get_cur(chain->dev, ctrl->entity, + ctrl->info.selector, data, + ctrl->info.size); + else + ret = uvc_query_ctrl(chain->dev, UVC_GET_CUR, + ctrl->entity->id, chain->dev->intfnum, + ctrl->info.selector, data, + ctrl->info.size); + + if (ret < 0) + return ret; + + ctrl->loaded = 1; + + return ret; +} + static int __uvc_ctrl_get(struct uvc_video_chain *chain, - struct uvc_control *ctrl, struct uvc_control_mapping *mapping, - s32 *value) + struct uvc_control *ctrl, + struct uvc_control_mapping *mapping, + s32 *value) { int ret; if ((ctrl->info.flags & UVC_CTRL_FLAG_GET_CUR) == 0) return -EACCES; - if (!ctrl->loaded) { - ret = uvc_query_ctrl(chain->dev, UVC_GET_CUR, ctrl->entity->id, - chain->dev->intfnum, ctrl->info.selector, - uvc_ctrl_data(ctrl, UVC_CTRL_DATA_CURRENT), - ctrl->info.size); - if (ret < 0) - return ret; - - ctrl->loaded = 1; - } + ret = __uvc_ctrl_load_cur(chain, ctrl); + if (ret < 0) + return ret; *value = __uvc_ctrl_get_value(mapping, uvc_ctrl_data(ctrl, UVC_CTRL_DATA_CURRENT)); @@ -1665,21 +1695,10 @@ int uvc_ctrl_set(struct uvc_fh *handle, * needs to be loaded from the device to perform the read-modify-write * operation. */ - if (!ctrl->loaded && (ctrl->info.size * 8) != mapping->size) { - if ((ctrl->info.flags & UVC_CTRL_FLAG_GET_CUR) == 0) { - memset(uvc_ctrl_data(ctrl, UVC_CTRL_DATA_CURRENT), - 0, ctrl->info.size); - } else { - ret = uvc_query_ctrl(chain->dev, UVC_GET_CUR, - ctrl->entity->id, chain->dev->intfnum, - ctrl->info.selector, - uvc_ctrl_data(ctrl, UVC_CTRL_DATA_CURRENT), - ctrl->info.size); - if (ret < 0) - return ret; - } - - ctrl->loaded = 1; + if ((ctrl->info.size * 8) != mapping->size) { + ret = __uvc_ctrl_load_cur(chain, ctrl); + if (ret < 0) + return ret; } /* Backup the current value in case we need to rollback later. */ @@ -1718,9 +1737,19 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev, if (data == NULL) return -ENOMEM; - ret = uvc_query_ctrl(dev, UVC_GET_INFO, ctrl->entity->id, dev->intfnum, - info->selector, data, 1); - if (!ret) + if (ctrl->entity->get_info) + ret = ctrl->entity->get_info(dev, ctrl->entity, + ctrl->info.selector, data); + else + ret = uvc_query_ctrl(dev, UVC_GET_INFO, ctrl->entity->id, + dev->intfnum, info->selector, data, 1); + + if (!ret) { + info->flags &= ~(UVC_CTRL_FLAG_GET_CUR | + UVC_CTRL_FLAG_SET_CUR | + UVC_CTRL_FLAG_AUTO_UPDATE | + UVC_CTRL_FLAG_ASYNCHRONOUS); + info->flags |= (data[0] & UVC_CONTROL_CAP_GET ? UVC_CTRL_FLAG_GET_CUR : 0) | (data[0] & UVC_CONTROL_CAP_SET ? @@ -1729,6 +1758,7 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev, UVC_CTRL_FLAG_AUTO_UPDATE : 0) | (data[0] & UVC_CONTROL_CAP_ASYNCHRONOUS ? UVC_CTRL_FLAG_ASYNCHRONOUS : 0); + } kfree(data); return ret; diff --git a/drivers/media/usb/uvc/uvc_video.c b/drivers/media/usb/uvc/uvc_video.c index 6dff8e2fadba..e62afdee20db 100644 --- a/drivers/media/usb/uvc/uvc_video.c +++ b/drivers/media/usb/uvc/uvc_video.c @@ -207,13 +207,13 @@ static void uvc_fixup_video_ctrl(struct uvc_streaming *stream, /* Compute a bandwidth estimation by multiplying the frame * size by the number of video frames per second, divide the * result by the number of USB frames (or micro-frames for - * high-speed devices) per second and add the UVC header size - * (assumed to be 12 bytes long). + * high- and super-speed devices) per second and add the UVC + * header size (assumed to be 12 bytes long). */ bandwidth = frame->wWidth * frame->wHeight / 8 * format->bpp; bandwidth *= 10000000 / interval + 1; bandwidth /= 1000; - if (stream->dev->udev->speed == USB_SPEED_HIGH) + if (stream->dev->udev->speed >= USB_SPEED_HIGH) bandwidth /= 8; bandwidth += 12; @@ -468,6 +468,7 @@ uvc_video_clock_decode(struct uvc_streaming *stream, struct uvc_buffer *buf, ktime_t time; u16 host_sof; u16 dev_sof; + u32 dev_stc; switch (data[1] & (UVC_STREAM_PTS | UVC_STREAM_SCR)) { case UVC_STREAM_PTS | UVC_STREAM_SCR: @@ -512,6 +513,34 @@ uvc_video_clock_decode(struct uvc_streaming *stream, struct uvc_buffer *buf, if (dev_sof == stream->clock.last_sof) return; + dev_stc = get_unaligned_le32(&data[header_size - 6]); + + /* + * STC (Source Time Clock) is the clock used by the camera. The UVC 1.5 + * standard states that it "must be captured when the first video data + * of a video frame is put on the USB bus". This is generally understood + * as requiring devices to clear the payload header's SCR bit before + * the first packet containing video data. + * + * Most vendors follow that interpretation, but some (namely SunplusIT + * on some devices) always set the `UVC_STREAM_SCR` bit, fill the SCR + * field with 0's,and expect that the driver only processes the SCR if + * there is data in the packet. + * + * Ignore all the hardware timestamp information if we haven't received + * any data for this frame yet, the packet contains no data, and both + * STC and SOF are zero. This heuristics should be safe on compliant + * devices. This should be safe with compliant devices, as in the very + * unlikely case where a UVC 1.1 device would send timing information + * only before the first packet containing data, and both STC and SOF + * happen to be zero for a particular frame, we would only miss one + * clock sample from many and the clock recovery algorithm wouldn't + * suffer from this condition. + */ + if (buf && buf->bytesused == 0 && len == header_size && + dev_stc == 0 && dev_sof == 0) + return; + stream->clock.last_sof = dev_sof; host_sof = usb_get_current_frame_number(stream->dev->udev); @@ -549,7 +578,7 @@ uvc_video_clock_decode(struct uvc_streaming *stream, struct uvc_buffer *buf, spin_lock_irqsave(&stream->clock.lock, flags); sample = &stream->clock.samples[stream->clock.head]; - sample->dev_stc = get_unaligned_le32(&data[header_size - 6]); + sample->dev_stc = dev_stc; sample->dev_sof = dev_sof; sample->host_sof = host_sof; sample->host_time = time; @@ -694,11 +723,11 @@ void uvc_video_clock_update(struct uvc_streaming *stream, unsigned long flags; u64 timestamp; u32 delta_stc; - u32 y1, y2; + u32 y1; u32 x1, x2; u32 mean; u32 sof; - u64 y; + u64 y, y2; if (!uvc_hw_timestamps_param) return; @@ -738,7 +767,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream, sof = y; uvc_trace(UVC_TRACE_CLOCK, "%s: PTS %u y %llu.%06llu SOF %u.%06llu " - "(x1 %u x2 %u y1 %u y2 %u SOF offset %u)\n", + "(x1 %u x2 %u y1 %u y2 %llu SOF offset %u)\n", stream->dev->name, buf->pts, y >> 16, div_u64((y & 0xffff) * 1000000, 65536), sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536), @@ -753,7 +782,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream, goto done; y1 = NSEC_PER_SEC; - y2 = (u32)ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1; + y2 = ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1; /* Interpolated and host SOF timestamps can wrap around at slightly * different times. Handle this by adding or removing 2048 to or from @@ -773,7 +802,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream, timestamp = ktime_to_ns(first->host_time) + y - y1; uvc_trace(UVC_TRACE_CLOCK, "%s: SOF %u.%06llu y %llu ts %llu " - "buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %u)\n", + "buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %llu)\n", stream->dev->name, sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536), y, timestamp, vbuf->vb2_buf.timestamp, diff --git a/drivers/media/usb/uvc/uvcvideo.h b/drivers/media/usb/uvc/uvcvideo.h index 9f5b9601eadc..97817b350f98 100644 --- a/drivers/media/usb/uvc/uvcvideo.h +++ b/drivers/media/usb/uvc/uvcvideo.h @@ -350,6 +350,11 @@ struct uvc_entity { u8 bNrInPins; u8 *baSourceID; + int (*get_info)(struct uvc_device *dev, struct uvc_entity *entity, + u8 cs, u8 *caps); + int (*get_cur)(struct uvc_device *dev, struct uvc_entity *entity, + u8 cs, void *data, u16 size); + unsigned int ncontrols; struct uvc_control *controls; }; diff --git a/drivers/mfd/omap-usb-tll.c b/drivers/mfd/omap-usb-tll.c index 265f5e350e1c..17648dd83d66 100644 --- a/drivers/mfd/omap-usb-tll.c +++ b/drivers/mfd/omap-usb-tll.c @@ -235,8 +235,7 @@ static int usbtll_omap_probe(struct platform_device *pdev) break; } - tll = devm_kzalloc(dev, sizeof(*tll) + sizeof(tll->ch_clk[nch]), - GFP_KERNEL); + tll = devm_kzalloc(dev, struct_size(tll, ch_clk, nch), GFP_KERNEL); if (!tll) { pm_runtime_put_sync(dev); pm_runtime_disable(dev); diff --git a/drivers/mmc/core/mmc_test.c b/drivers/mmc/core/mmc_test.c index cd64e0f23ae5..8fcaec5544ff 100644 --- a/drivers/mmc/core/mmc_test.c +++ b/drivers/mmc/core/mmc_test.c @@ -3097,13 +3097,13 @@ static ssize_t mtf_test_write(struct file *file, const char __user *buf, test->buffer = kzalloc(BUFFER_SIZE, GFP_KERNEL); #ifdef CONFIG_HIGHMEM test->highmem = alloc_pages(GFP_KERNEL | __GFP_HIGHMEM, BUFFER_ORDER); + if (!test->highmem) { + count = -ENOMEM; + goto free_test_buffer; + } #endif -#ifdef CONFIG_HIGHMEM - if (test->buffer && test->highmem) { -#else if (test->buffer) { -#endif mutex_lock(&mmc_test_lock); mmc_test_run(test, testcase); mutex_unlock(&mmc_test_lock); @@ -3111,6 +3111,7 @@ static ssize_t mtf_test_write(struct file *file, const char __user *buf, #ifdef CONFIG_HIGHMEM __free_pages(test->highmem, BUFFER_ORDER); +free_test_buffer: #endif kfree(test->buffer); kfree(test); diff --git a/drivers/mmc/host/dw_mmc.c b/drivers/mmc/host/dw_mmc.c index ba37be8e423c..78e20327828a 100644 --- a/drivers/mmc/host/dw_mmc.c +++ b/drivers/mmc/host/dw_mmc.c @@ -3179,6 +3179,10 @@ int dw_mci_probe(struct dw_mci *host) host->biu_clk = devm_clk_get(host->dev, "biu"); if (IS_ERR(host->biu_clk)) { dev_dbg(host->dev, "biu clock not available\n"); + ret = PTR_ERR(host->biu_clk); + if (ret == -EPROBE_DEFER) + return ret; + } else { ret = clk_prepare_enable(host->biu_clk); if (ret) { @@ -3190,6 +3194,10 @@ int dw_mci_probe(struct dw_mci *host) host->ciu_clk = devm_clk_get(host->dev, "ciu"); if (IS_ERR(host->ciu_clk)) { dev_dbg(host->dev, "ciu clock not available\n"); + ret = PTR_ERR(host->ciu_clk); + if (ret == -EPROBE_DEFER) + goto err_clk_biu; + host->bus_hz = host->pdata->bus_hz; } else { ret = clk_prepare_enable(host->ciu_clk); diff --git a/drivers/mtd/tests/Makefile b/drivers/mtd/tests/Makefile index 5de0378f90db..7dae831ee8b6 100644 --- a/drivers/mtd/tests/Makefile +++ b/drivers/mtd/tests/Makefile @@ -1,19 +1,19 @@ # SPDX-License-Identifier: GPL-2.0 -obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o -obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o -obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o -obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o -obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o -obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o -obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o -obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o -obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o +obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o mtd_test.o -mtd_oobtest-objs := oobtest.o mtd_test.o -mtd_pagetest-objs := pagetest.o mtd_test.o -mtd_readtest-objs := readtest.o mtd_test.o -mtd_speedtest-objs := speedtest.o mtd_test.o -mtd_stresstest-objs := stresstest.o mtd_test.o -mtd_subpagetest-objs := subpagetest.o mtd_test.o -mtd_torturetest-objs := torturetest.o mtd_test.o -mtd_nandbiterrs-objs := nandbiterrs.o mtd_test.o +mtd_oobtest-objs := oobtest.o +mtd_pagetest-objs := pagetest.o +mtd_readtest-objs := readtest.o +mtd_speedtest-objs := speedtest.o +mtd_stresstest-objs := stresstest.o +mtd_subpagetest-objs := subpagetest.o +mtd_torturetest-objs := torturetest.o +mtd_nandbiterrs-objs := nandbiterrs.o diff --git a/drivers/mtd/tests/mtd_test.c b/drivers/mtd/tests/mtd_test.c index c84250beffdc..f391e0300cdc 100644 --- a/drivers/mtd/tests/mtd_test.c +++ b/drivers/mtd/tests/mtd_test.c @@ -25,6 +25,7 @@ int mtdtest_erase_eraseblock(struct mtd_info *mtd, unsigned int ebnum) return 0; } +EXPORT_SYMBOL_GPL(mtdtest_erase_eraseblock); static int is_block_bad(struct mtd_info *mtd, unsigned int ebnum) { @@ -57,6 +58,7 @@ int mtdtest_scan_for_bad_eraseblocks(struct mtd_info *mtd, unsigned char *bbt, return 0; } +EXPORT_SYMBOL_GPL(mtdtest_scan_for_bad_eraseblocks); int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt, unsigned int eb, int ebcnt) @@ -75,6 +77,7 @@ int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt, return 0; } +EXPORT_SYMBOL_GPL(mtdtest_erase_good_eraseblocks); int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf) { @@ -92,6 +95,7 @@ int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf) return err; } +EXPORT_SYMBOL_GPL(mtdtest_read); int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size, const void *buf) @@ -107,3 +111,8 @@ int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size, return err; } +EXPORT_SYMBOL_GPL(mtdtest_write); + +MODULE_LICENSE("GPL"); +MODULE_DESCRIPTION("MTD function test helpers"); +MODULE_AUTHOR("Akinobu Mita"); diff --git a/drivers/mtd/ubi/eba.c b/drivers/mtd/ubi/eba.c index b4cdf2351cac..d33deb84b6ec 100644 --- a/drivers/mtd/ubi/eba.c +++ b/drivers/mtd/ubi/eba.c @@ -1560,6 +1560,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap, GFP_KERNEL); if (!fm_eba[i]) { ret = -ENOMEM; + kfree(scan_eba[i]); goto out_free; } @@ -1595,7 +1596,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap, } out_free: - for (i = 0; i < num_volumes; i++) { + while (--i >= 0) { if (!ubi->volumes[i]) continue; diff --git a/drivers/net/bonding/bond_main.c b/drivers/net/bonding/bond_main.c index bb1c6743222e..89797b257573 100644 --- a/drivers/net/bonding/bond_main.c +++ b/drivers/net/bonding/bond_main.c @@ -784,13 +784,10 @@ static struct slave *bond_find_best_slave(struct bonding *bond) return bestslave; } +/* must be called in RCU critical section or with RTNL held */ static bool bond_should_notify_peers(struct bonding *bond) { - struct slave *slave; - - rcu_read_lock(); - slave = rcu_dereference(bond->curr_active_slave); - rcu_read_unlock(); + struct slave *slave = rcu_dereference_rtnl(bond->curr_active_slave); if (!slave || !bond->send_peer_notif || bond->send_peer_notif % diff --git a/drivers/net/dsa/mv88e6xxx/Makefile b/drivers/net/dsa/mv88e6xxx/Makefile index aa645ff86f64..2347d56c7155 100644 --- a/drivers/net/dsa/mv88e6xxx/Makefile +++ b/drivers/net/dsa/mv88e6xxx/Makefile @@ -14,3 +14,7 @@ mv88e6xxx-objs += port_hidden.o mv88e6xxx-$(CONFIG_NET_DSA_MV88E6XXX_PTP) += ptp.o mv88e6xxx-objs += serdes.o mv88e6xxx-objs += smi.o +mv88e6xxx-objs += trace.o + +# for tracing framework to find trace.h +CFLAGS_trace.o := -I$(src) diff --git a/drivers/net/dsa/mv88e6xxx/global1.h b/drivers/net/dsa/mv88e6xxx/global1.h index 0ae96a1e919b..dc44e197817a 100644 --- a/drivers/net/dsa/mv88e6xxx/global1.h +++ b/drivers/net/dsa/mv88e6xxx/global1.h @@ -339,5 +339,6 @@ int mv88e6390_g1_vtu_loadpurge(struct mv88e6xxx_chip *chip, int mv88e6xxx_g1_vtu_flush(struct mv88e6xxx_chip *chip); int mv88e6xxx_g1_vtu_prob_irq_setup(struct mv88e6xxx_chip *chip); void mv88e6xxx_g1_vtu_prob_irq_free(struct mv88e6xxx_chip *chip); +int mv88e6xxx_g1_atu_get_next(struct mv88e6xxx_chip *chip, u16 fid); #endif /* _MV88E6XXX_GLOBAL1_H */ diff --git a/drivers/net/dsa/mv88e6xxx/global1_atu.c b/drivers/net/dsa/mv88e6xxx/global1_atu.c index 792a96ef418f..f2e07d903aa7 100644 --- a/drivers/net/dsa/mv88e6xxx/global1_atu.c +++ b/drivers/net/dsa/mv88e6xxx/global1_atu.c @@ -12,6 +12,7 @@ #include "chip.h" #include "global1.h" +#include "trace.h" /* Offset 0x01: ATU FID Register */ @@ -82,6 +83,19 @@ static int mv88e6xxx_g1_atu_op_wait(struct mv88e6xxx_chip *chip) return mv88e6xxx_g1_wait_bit(chip, MV88E6XXX_G1_ATU_OP, bit, 0); } +static int mv88e6xxx_g1_read_atu_violation(struct mv88e6xxx_chip *chip) +{ + int err; + + err = mv88e6xxx_g1_write(chip, MV88E6XXX_G1_ATU_OP, + MV88E6XXX_G1_ATU_OP_BUSY | + MV88E6XXX_G1_ATU_OP_GET_CLR_VIOLATION); + if (err) + return err; + + return mv88e6xxx_g1_atu_op_wait(chip); +} + static int mv88e6xxx_g1_atu_op(struct mv88e6xxx_chip *chip, u16 fid, u16 op) { u16 val; @@ -122,6 +136,46 @@ static int mv88e6xxx_g1_atu_op(struct mv88e6xxx_chip *chip, u16 fid, u16 op) return mv88e6xxx_g1_atu_op_wait(chip); } +int mv88e6xxx_g1_atu_get_next(struct mv88e6xxx_chip *chip, u16 fid) +{ + return mv88e6xxx_g1_atu_op(chip, fid, MV88E6XXX_G1_ATU_OP_GET_NEXT_DB); +} + +static int mv88e6xxx_g1_atu_fid_read(struct mv88e6xxx_chip *chip, u16 *fid) +{ + u16 val = 0, upper = 0, op = 0; + int err = -EOPNOTSUPP; + + if (mv88e6xxx_num_databases(chip) > 256) { + err = mv88e6xxx_g1_read(chip, MV88E6352_G1_ATU_FID, &val); + val &= 0xfff; + if (err) + return err; + } else { + err = mv88e6xxx_g1_read(chip, MV88E6XXX_G1_ATU_OP, &op); + if (err) + return err; + if (mv88e6xxx_num_databases(chip) > 64) { + /* ATU DBNum[7:4] are located in ATU Control 15:12 */ + err = mv88e6xxx_g1_read(chip, MV88E6XXX_G1_ATU_CTL, + &upper); + if (err) + return err; + + upper = (upper >> 8) & 0x00f0; + } else if (mv88e6xxx_num_databases(chip) > 16) { + /* ATU DBNum[5:4] are located in ATU Operation 9:8 */ + upper = (op >> 4) & 0x30; + } + + /* ATU DBNum[3:0] are located in ATU Operation 3:0 */ + val = (op & 0xf) | upper; + } + *fid = val; + + return err; +} + /* Offset 0x0C: ATU Data Register */ static int mv88e6xxx_g1_atu_data_read(struct mv88e6xxx_chip *chip, @@ -316,14 +370,12 @@ static irqreturn_t mv88e6xxx_g1_atu_prob_irq_thread_fn(int irq, void *dev_id) { struct mv88e6xxx_chip *chip = dev_id; struct mv88e6xxx_atu_entry entry; - int spid; - int err; - u16 val; + int err, spid; + u16 val, fid; mv88e6xxx_reg_lock(chip); - err = mv88e6xxx_g1_atu_op(chip, 0, - MV88E6XXX_G1_ATU_OP_GET_CLR_VIOLATION); + err = mv88e6xxx_g1_read_atu_violation(chip); if (err) goto out; @@ -331,6 +383,10 @@ static irqreturn_t mv88e6xxx_g1_atu_prob_irq_thread_fn(int irq, void *dev_id) if (err) goto out; + err = mv88e6xxx_g1_atu_fid_read(chip, &fid); + if (err) + goto out; + err = mv88e6xxx_g1_atu_data_read(chip, &entry); if (err) goto out; @@ -348,24 +404,25 @@ static irqreturn_t mv88e6xxx_g1_atu_prob_irq_thread_fn(int irq, void *dev_id) } if (val & MV88E6XXX_G1_ATU_OP_MEMBER_VIOLATION) { - dev_err_ratelimited(chip->dev, - "ATU member violation for %pM portvec %x spid %d\n", - entry.mac, entry.portvec, spid); + trace_mv88e6xxx_atu_member_violation(chip->dev, spid, + entry.portvec, entry.mac, + fid); chip->ports[spid].atu_member_violation++; } if (val & MV88E6XXX_G1_ATU_OP_MISS_VIOLATION) { - dev_err_ratelimited(chip->dev, - "ATU miss violation for %pM portvec %x spid %d\n", - entry.mac, entry.portvec, spid); + trace_mv88e6xxx_atu_miss_violation(chip->dev, spid, + entry.portvec, entry.mac, + fid); chip->ports[spid].atu_miss_violation++; } if (val & MV88E6XXX_G1_ATU_OP_FULL_VIOLATION) { - dev_err_ratelimited(chip->dev, - "ATU full violation for %pM portvec %x spid %d\n", - entry.mac, entry.portvec, spid); - chip->ports[spid].atu_full_violation++; + trace_mv88e6xxx_atu_full_violation(chip->dev, spid, + entry.portvec, entry.mac, + fid); + if (spid < ARRAY_SIZE(chip->ports)) + chip->ports[spid].atu_full_violation++; } mv88e6xxx_reg_unlock(chip); diff --git a/drivers/net/dsa/mv88e6xxx/global2.c b/drivers/net/dsa/mv88e6xxx/global2.c index 7674b0b8cc70..4d4bd4a16281 100644 --- a/drivers/net/dsa/mv88e6xxx/global2.c +++ b/drivers/net/dsa/mv88e6xxx/global2.c @@ -280,6 +280,19 @@ int mv88e6xxx_g2_set_switch_mac(struct mv88e6xxx_chip *chip, u8 *addr) return err; } +/* Offset 0x0E: ATU Statistics */ + +int mv88e6xxx_g2_atu_stats_set(struct mv88e6xxx_chip *chip, u16 kind, u16 bin) +{ + return mv88e6xxx_g2_write(chip, MV88E6XXX_G2_ATU_STATS, + kind | bin); +} + +int mv88e6xxx_g2_atu_stats_get(struct mv88e6xxx_chip *chip, u16 *stats) +{ + return mv88e6xxx_g2_read(chip, MV88E6XXX_G2_ATU_STATS, stats); +} + /* Offset 0x0F: Priority Override Table */ static int mv88e6xxx_g2_pot_write(struct mv88e6xxx_chip *chip, int pointer, diff --git a/drivers/net/dsa/mv88e6xxx/global2.h b/drivers/net/dsa/mv88e6xxx/global2.h index 12807e52ecea..de63e3f08e5c 100644 --- a/drivers/net/dsa/mv88e6xxx/global2.h +++ b/drivers/net/dsa/mv88e6xxx/global2.h @@ -113,7 +113,16 @@ #define MV88E6XXX_G2_SWITCH_MAC_DATA_MASK 0x00ff /* Offset 0x0E: ATU Stats Register */ -#define MV88E6XXX_G2_ATU_STATS 0x0e +#define MV88E6XXX_G2_ATU_STATS 0x0e +#define MV88E6XXX_G2_ATU_STATS_BIN_0 (0x0 << 14) +#define MV88E6XXX_G2_ATU_STATS_BIN_1 (0x1 << 14) +#define MV88E6XXX_G2_ATU_STATS_BIN_2 (0x2 << 14) +#define MV88E6XXX_G2_ATU_STATS_BIN_3 (0x3 << 14) +#define MV88E6XXX_G2_ATU_STATS_MODE_ALL (0x0 << 12) +#define MV88E6XXX_G2_ATU_STATS_MODE_ALL_DYNAMIC (0x1 << 12) +#define MV88E6XXX_G2_ATU_STATS_MODE_FID_ALL (0x2 << 12) +#define MV88E6XXX_G2_ATU_STATS_MODE_FID_ALL_DYNAMIC (0x3 << 12) +#define MV88E6XXX_G2_ATU_STATS_MASK 0x0fff /* Offset 0x0F: Priority Override Table */ #define MV88E6XXX_G2_PRIO_OVERRIDE 0x0f @@ -354,6 +363,8 @@ extern const struct mv88e6xxx_gpio_ops mv88e6352_gpio_ops; int mv88e6xxx_g2_scratch_gpio_set_smi(struct mv88e6xxx_chip *chip, bool external); +int mv88e6xxx_g2_atu_stats_set(struct mv88e6xxx_chip *chip, u16 kind, u16 bin); +int mv88e6xxx_g2_atu_stats_get(struct mv88e6xxx_chip *chip, u16 *stats); #else /* !CONFIG_NET_DSA_MV88E6XXX_GLOBAL2 */ @@ -516,6 +527,18 @@ static inline int mv88e6xxx_g2_device_mapping_write(struct mv88e6xxx_chip *chip, return -EOPNOTSUPP; } +static inline int mv88e6xxx_g2_atu_stats_set(struct mv88e6xxx_chip *chip, + u16 kind, u16 bin) +{ + return -EOPNOTSUPP; +} + +static inline int mv88e6xxx_g2_atu_stats_get(struct mv88e6xxx_chip *chip, + u16 *stats) +{ + return -EOPNOTSUPP; +} + #endif /* CONFIG_NET_DSA_MV88E6XXX_GLOBAL2 */ #endif /* _MV88E6XXX_GLOBAL2_H */ diff --git a/drivers/net/dsa/mv88e6xxx/trace.c b/drivers/net/dsa/mv88e6xxx/trace.c new file mode 100644 index 000000000000..7833cb50ca5d --- /dev/null +++ b/drivers/net/dsa/mv88e6xxx/trace.c @@ -0,0 +1,6 @@ +// SPDX-License-Identifier: GPL-2.0-or-later +/* Copyright 2022 NXP + */ + +#define CREATE_TRACE_POINTS +#include "trace.h" diff --git a/drivers/net/dsa/mv88e6xxx/trace.h b/drivers/net/dsa/mv88e6xxx/trace.h new file mode 100644 index 000000000000..d9ab5c8dee55 --- /dev/null +++ b/drivers/net/dsa/mv88e6xxx/trace.h @@ -0,0 +1,66 @@ +/* SPDX-License-Identifier: GPL-2.0-or-later */ +/* Copyright 2022 NXP + */ + +#undef TRACE_SYSTEM +#define TRACE_SYSTEM mv88e6xxx + +#if !defined(_MV88E6XXX_TRACE_H) || defined(TRACE_HEADER_MULTI_READ) +#define _MV88E6XXX_TRACE_H + +#include +#include +#include + +DECLARE_EVENT_CLASS(mv88e6xxx_atu_violation, + + TP_PROTO(const struct device *dev, int spid, u16 portvec, + const unsigned char *addr, u16 fid), + + TP_ARGS(dev, spid, portvec, addr, fid), + + TP_STRUCT__entry( + __string(name, dev_name(dev)) + __field(int, spid) + __field(u16, portvec) + __array(unsigned char, addr, ETH_ALEN) + __field(u16, fid) + ), + + TP_fast_assign( + __assign_str(name, dev_name(dev)); + __entry->spid = spid; + __entry->portvec = portvec; + memcpy(__entry->addr, addr, ETH_ALEN); + __entry->fid = fid; + ), + + TP_printk("dev %s spid %d portvec 0x%x addr %pM fid %u", + __get_str(name), __entry->spid, __entry->portvec, + __entry->addr, __entry->fid) +); + +DEFINE_EVENT(mv88e6xxx_atu_violation, mv88e6xxx_atu_member_violation, + TP_PROTO(const struct device *dev, int spid, u16 portvec, + const unsigned char *addr, u16 fid), + TP_ARGS(dev, spid, portvec, addr, fid)); + +DEFINE_EVENT(mv88e6xxx_atu_violation, mv88e6xxx_atu_miss_violation, + TP_PROTO(const struct device *dev, int spid, u16 portvec, + const unsigned char *addr, u16 fid), + TP_ARGS(dev, spid, portvec, addr, fid)); + +DEFINE_EVENT(mv88e6xxx_atu_violation, mv88e6xxx_atu_full_violation, + TP_PROTO(const struct device *dev, int spid, u16 portvec, + const unsigned char *addr, u16 fid), + TP_ARGS(dev, spid, portvec, addr, fid)); + +#endif /* _MV88E6XXX_TRACE_H */ + +/* We don't want to use include/trace/events */ +#undef TRACE_INCLUDE_PATH +#define TRACE_INCLUDE_PATH . +#undef TRACE_INCLUDE_FILE +#define TRACE_INCLUDE_FILE trace +/* This part must be outside protection */ +#include diff --git a/drivers/net/dsa/vitesse-vsc73xx-core.c b/drivers/net/dsa/vitesse-vsc73xx-core.c index c7ff98c26ee3..a1dd82d25ce3 100644 --- a/drivers/net/dsa/vitesse-vsc73xx-core.c +++ b/drivers/net/dsa/vitesse-vsc73xx-core.c @@ -531,7 +531,7 @@ static int vsc73xx_phy_write(struct dsa_switch *ds, int phy, int regnum, return 0; } - cmd = (phy << 21) | (regnum << 16); + cmd = (phy << 21) | (regnum << 16) | val; ret = vsc73xx_write(vsc, VSC73XX_BLOCK_MII, 0, 1, cmd); if (ret) return ret; diff --git a/drivers/net/ethernet/brocade/bna/bna_types.h b/drivers/net/ethernet/brocade/bna/bna_types.h index 666b6922e24d..ebf54d74c2bb 100644 --- a/drivers/net/ethernet/brocade/bna/bna_types.h +++ b/drivers/net/ethernet/brocade/bna/bna_types.h @@ -410,7 +410,7 @@ struct bna_ib { /* Tx object */ /* Tx datapath control structure */ -#define BNA_Q_NAME_SIZE 16 +#define BNA_Q_NAME_SIZE (IFNAMSIZ + 6) struct bna_tcb { /* Fast path */ void **sw_qpt; diff --git a/drivers/net/ethernet/brocade/bna/bnad.c b/drivers/net/ethernet/brocade/bna/bnad.c index 94e87e7f277b..838fa3a2700a 100644 --- a/drivers/net/ethernet/brocade/bna/bnad.c +++ b/drivers/net/ethernet/brocade/bna/bnad.c @@ -1535,8 +1535,9 @@ bnad_tx_msix_register(struct bnad *bnad, struct bnad_tx_info *tx_info, for (i = 0; i < num_txqs; i++) { vector_num = tx_info->tcb[i]->intr_vector; - sprintf(tx_info->tcb[i]->name, "%s TXQ %d", bnad->netdev->name, - tx_id + tx_info->tcb[i]->id); + snprintf(tx_info->tcb[i]->name, BNA_Q_NAME_SIZE, "%s TXQ %d", + bnad->netdev->name, + tx_id + tx_info->tcb[i]->id); err = request_irq(bnad->msix_table[vector_num].vector, (irq_handler_t)bnad_msix_tx, 0, tx_info->tcb[i]->name, @@ -1586,9 +1587,9 @@ bnad_rx_msix_register(struct bnad *bnad, struct bnad_rx_info *rx_info, for (i = 0; i < num_rxps; i++) { vector_num = rx_info->rx_ctrl[i].ccb->intr_vector; - sprintf(rx_info->rx_ctrl[i].ccb->name, "%s CQ %d", - bnad->netdev->name, - rx_id + rx_info->rx_ctrl[i].ccb->id); + snprintf(rx_info->rx_ctrl[i].ccb->name, BNA_Q_NAME_SIZE, + "%s CQ %d", bnad->netdev->name, + rx_id + rx_info->rx_ctrl[i].ccb->id); err = request_irq(bnad->msix_table[vector_num].vector, (irq_handler_t)bnad_msix_rx, 0, rx_info->rx_ctrl[i].ccb->name, diff --git a/drivers/net/ethernet/chelsio/cxgb4/cxgb4_filter.c b/drivers/net/ethernet/chelsio/cxgb4/cxgb4_filter.c index 44f86a33ef62..75ed4723070f 100644 --- a/drivers/net/ethernet/chelsio/cxgb4/cxgb4_filter.c +++ b/drivers/net/ethernet/chelsio/cxgb4/cxgb4_filter.c @@ -969,7 +969,8 @@ static u64 hash_filter_ntuple(struct ch_filter_specification *fs, * in the Compressed Filter Tuple. */ if (tp->vlan_shift >= 0 && fs->mask.ivlan) - ntuple |= (FT_VLAN_VLD_F | fs->val.ivlan) << tp->vlan_shift; + ntuple |= (u64)(FT_VLAN_VLD_F | + fs->val.ivlan) << tp->vlan_shift; if (tp->port_shift >= 0 && fs->mask.iport) ntuple |= (u64)fs->val.iport << tp->port_shift; diff --git a/drivers/net/ethernet/freescale/fec_main.c b/drivers/net/ethernet/freescale/fec_main.c index fb7039b001ef..f11824a078e9 100644 --- a/drivers/net/ethernet/freescale/fec_main.c +++ b/drivers/net/ethernet/freescale/fec_main.c @@ -223,8 +223,8 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address"); #define PKT_MINBUF_SIZE 64 /* FEC receive acceleration */ -#define FEC_RACC_IPDIS (1 << 1) -#define FEC_RACC_PRODIS (1 << 2) +#define FEC_RACC_IPDIS BIT(1) +#define FEC_RACC_PRODIS BIT(2) #define FEC_RACC_SHIFT16 BIT(7) #define FEC_RACC_OPTIONS (FEC_RACC_IPDIS | FEC_RACC_PRODIS) @@ -256,8 +256,23 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address"); #define FEC_MMFR_TA (2 << 16) #define FEC_MMFR_DATA(v) (v & 0xffff) /* FEC ECR bits definition */ -#define FEC_ECR_MAGICEN (1 << 2) -#define FEC_ECR_SLEEP (1 << 3) +#define FEC_ECR_RESET BIT(0) +#define FEC_ECR_ETHEREN BIT(1) +#define FEC_ECR_MAGICEN BIT(2) +#define FEC_ECR_SLEEP BIT(3) +#define FEC_ECR_EN1588 BIT(4) +#define FEC_ECR_BYTESWP BIT(8) +/* FEC RCR bits definition */ +#define FEC_RCR_LOOP BIT(0) +#define FEC_RCR_HALFDPX BIT(1) +#define FEC_RCR_MII BIT(2) +#define FEC_RCR_PROMISC BIT(3) +#define FEC_RCR_BC_REJ BIT(4) +#define FEC_RCR_FLOWCTL BIT(5) +#define FEC_RCR_RMII BIT(8) +#define FEC_RCR_10BASET BIT(9) +/* TX WMARK bits */ +#define FEC_TXWMRK_STRFWD BIT(8) #define FEC_MII_TIMEOUT 30000 /* us */ @@ -953,7 +968,7 @@ fec_restart(struct net_device *ndev) u32 val; u32 temp_mac[2]; u32 rcntl = OPT_FRAME_SIZE | 0x04; - u32 ecntl = 0x2; /* ETHEREN */ + u32 ecntl = FEC_ECR_ETHEREN; /* Whack a reset. We should wait for this. * For i.MX6SX SOC, enet use AXI bus, we use disable MAC @@ -1029,18 +1044,18 @@ fec_restart(struct net_device *ndev) fep->phy_interface == PHY_INTERFACE_MODE_RGMII_TXID) rcntl |= (1 << 6); else if (fep->phy_interface == PHY_INTERFACE_MODE_RMII) - rcntl |= (1 << 8); + rcntl |= FEC_RCR_RMII; else - rcntl &= ~(1 << 8); + rcntl &= ~FEC_RCR_RMII; /* 1G, 100M or 10M */ if (ndev->phydev) { if (ndev->phydev->speed == SPEED_1000) ecntl |= (1 << 5); else if (ndev->phydev->speed == SPEED_100) - rcntl &= ~(1 << 9); + rcntl &= ~FEC_RCR_10BASET; else - rcntl |= (1 << 9); + rcntl |= FEC_RCR_10BASET; } } else { #ifdef FEC_MIIGSK_ENR @@ -1099,13 +1114,13 @@ fec_restart(struct net_device *ndev) if (fep->quirks & FEC_QUIRK_ENET_MAC) { /* enable ENET endian swap */ - ecntl |= (1 << 8); + ecntl |= FEC_ECR_BYTESWP; /* enable ENET store and forward mode */ - writel(1 << 8, fep->hwp + FEC_X_WMRK); + writel(FEC_TXWMRK_STRFWD, fep->hwp + FEC_X_WMRK); } if (fep->bufdesc_ex) - ecntl |= (1 << 4); + ecntl |= FEC_ECR_EN1588; #ifndef CONFIG_M5272 /* Enable the MIB statistic event counters */ @@ -1152,7 +1167,7 @@ static void fec_stop(struct net_device *ndev) { struct fec_enet_private *fep = netdev_priv(ndev); - u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & (1 << 8); + u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & FEC_RCR_RMII; u32 val; /* We cannot expect a graceful transmit stop without link !!! */ @@ -1171,7 +1186,7 @@ fec_stop(struct net_device *ndev) if (fep->quirks & FEC_QUIRK_HAS_AVB) { writel(0, fep->hwp + FEC_ECNTRL); } else { - writel(1, fep->hwp + FEC_ECNTRL); + writel(FEC_ECR_RESET, fep->hwp + FEC_ECNTRL); udelay(10); } writel(FEC_DEFAULT_IMASK, fep->hwp + FEC_IMASK); @@ -1187,11 +1202,16 @@ fec_stop(struct net_device *ndev) /* We have to keep ENET enabled to have MII interrupt stay working */ if (fep->quirks & FEC_QUIRK_ENET_MAC && !(fep->wol_flag & FEC_WOL_FLAG_SLEEP_ON)) { - writel(2, fep->hwp + FEC_ECNTRL); + writel(FEC_ECR_ETHEREN, fep->hwp + FEC_ECNTRL); writel(rmii_mode, fep->hwp + FEC_R_CNTRL); } -} + if (fep->bufdesc_ex) { + val = readl(fep->hwp + FEC_ECNTRL); + val |= FEC_ECR_EN1588; + writel(val, fep->hwp + FEC_ECNTRL); + } +} static void fec_timeout(struct net_device *ndev) diff --git a/drivers/net/ethernet/freescale/fec_ptp.c b/drivers/net/ethernet/freescale/fec_ptp.c index 37b8ad29b5b3..c5af845b1b25 100644 --- a/drivers/net/ethernet/freescale/fec_ptp.c +++ b/drivers/net/ethernet/freescale/fec_ptp.c @@ -635,6 +635,9 @@ void fec_ptp_stop(struct platform_device *pdev) struct net_device *ndev = platform_get_drvdata(pdev); struct fec_enet_private *fep = netdev_priv(ndev); + if (fep->pps_enable) + fec_ptp_enable_pps(fep, 0); + cancel_delayed_work_sync(&fep->time_keep); if (fep->ptp_clock) ptp_clock_unregister(fep->ptp_clock); diff --git a/drivers/net/ethernet/hisilicon/hns3/hns3_enet.c b/drivers/net/ethernet/hisilicon/hns3/hns3_enet.c index d09cc10b3517..8736e254f098 100644 --- a/drivers/net/ethernet/hisilicon/hns3/hns3_enet.c +++ b/drivers/net/ethernet/hisilicon/hns3/hns3_enet.c @@ -4388,6 +4388,9 @@ static int hns3_reset_notify_uninit_enet(struct hnae3_handle *handle) struct hns3_nic_priv *priv = netdev_priv(netdev); int ret; + if (!test_bit(HNS3_NIC_STATE_DOWN, &priv->state)) + hns3_nic_net_stop(netdev); + if (!test_and_clear_bit(HNS3_NIC_STATE_INITED, &priv->state)) { netdev_warn(netdev, "already uninitialized\n"); return 0; diff --git a/drivers/net/ethernet/i825xx/sun3_82586.c b/drivers/net/ethernet/i825xx/sun3_82586.c index 1a86184d44c0..e0c9fee4e1e6 100644 --- a/drivers/net/ethernet/i825xx/sun3_82586.c +++ b/drivers/net/ethernet/i825xx/sun3_82586.c @@ -990,7 +990,7 @@ static void sun3_82586_timeout(struct net_device *dev) { #ifdef DEBUG printk("%s: xmitter timed out, try to restart! stat: %02x\n",dev->name,p->scb->cus); - printk("%s: command-stats: %04x %04x\n",dev->name,swab16(p->xmit_cmds[0]->cmd_status),swab16(p->xmit_cmds[1]->cmd_status)); + printk("%s: command-stats: %04x\n", dev->name, swab16(p->xmit_cmds[0]->cmd_status)); printk("%s: check, whether you set the right interrupt number!\n",dev->name); #endif sun3_82586_close(dev); diff --git a/drivers/net/ethernet/mellanox/mlx5/core/en_ethtool.c b/drivers/net/ethernet/mellanox/mlx5/core/en_ethtool.c index 18e0cb02aee1..10411ab89e1c 100644 --- a/drivers/net/ethernet/mellanox/mlx5/core/en_ethtool.c +++ b/drivers/net/ethernet/mellanox/mlx5/core/en_ethtool.c @@ -1104,7 +1104,12 @@ int mlx5e_ethtool_set_link_ksettings(struct mlx5e_priv *priv, if (!an_changes && link_modes == eproto.admin) goto out; - mlx5_port_set_eth_ptys(mdev, an_disable, link_modes, ext); + err = mlx5_port_set_eth_ptys(mdev, an_disable, link_modes, ext); + if (err) { + netdev_err(priv->netdev, "%s: failed to set ptys reg: %d\n", __func__, err); + goto out; + } + mlx5_toggle_port_link(mdev); out: diff --git a/drivers/net/ethernet/mellanox/mlx5/core/en_fs_ethtool.c b/drivers/net/ethernet/mellanox/mlx5/core/en_fs_ethtool.c index acd946f2ddbe..be49a2a53f29 100644 --- a/drivers/net/ethernet/mellanox/mlx5/core/en_fs_ethtool.c +++ b/drivers/net/ethernet/mellanox/mlx5/core/en_fs_ethtool.c @@ -676,7 +676,7 @@ mlx5e_ethtool_flow_replace(struct mlx5e_priv *priv, if (num_tuples <= 0) { netdev_warn(priv->netdev, "%s: flow is not valid %d\n", __func__, num_tuples); - return num_tuples; + return num_tuples < 0 ? num_tuples : -EINVAL; } eth_ft = get_flow_table(priv, fs, num_tuples); diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c index d231f4d2888b..9eee229303cc 100644 --- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c +++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c @@ -1217,18 +1217,6 @@ static bool mlxsw_sp_acl_erp_delta_check(void *priv, const void *parent_obj, return err ? false : true; } -static int mlxsw_sp_acl_erp_hints_obj_cmp(const void *obj1, const void *obj2) -{ - const struct mlxsw_sp_acl_erp_key *key1 = obj1; - const struct mlxsw_sp_acl_erp_key *key2 = obj2; - - /* For hints purposes, two objects are considered equal - * in case the masks are the same. Does not matter what - * the "ctcam" value is. - */ - return memcmp(key1->mask, key2->mask, sizeof(key1->mask)); -} - static void *mlxsw_sp_acl_erp_delta_create(void *priv, void *parent_obj, void *obj) { @@ -1308,7 +1296,6 @@ static void mlxsw_sp_acl_erp_root_destroy(void *priv, void *root_priv) static const struct objagg_ops mlxsw_sp_acl_erp_objagg_ops = { .obj_size = sizeof(struct mlxsw_sp_acl_erp_key), .delta_check = mlxsw_sp_acl_erp_delta_check, - .hints_obj_cmp = mlxsw_sp_acl_erp_hints_obj_cmp, .delta_create = mlxsw_sp_acl_erp_delta_create, .delta_destroy = mlxsw_sp_acl_erp_delta_destroy, .root_create = mlxsw_sp_acl_erp_root_create, diff --git a/drivers/net/ethernet/qlogic/qed/qed_l2.c b/drivers/net/ethernet/qlogic/qed/qed_l2.c index 8a73482cb7a8..b21acc07f755 100644 --- a/drivers/net/ethernet/qlogic/qed/qed_l2.c +++ b/drivers/net/ethernet/qlogic/qed/qed_l2.c @@ -2781,25 +2781,6 @@ static int qed_configure_filter_mcast(struct qed_dev *cdev, return qed_filter_mcast_cmd(cdev, &mcast, QED_SPQ_MODE_CB, NULL); } -static int qed_configure_filter(struct qed_dev *cdev, - struct qed_filter_params *params) -{ - enum qed_filter_rx_mode_type accept_flags; - - switch (params->type) { - case QED_FILTER_TYPE_UCAST: - return qed_configure_filter_ucast(cdev, ¶ms->filter.ucast); - case QED_FILTER_TYPE_MCAST: - return qed_configure_filter_mcast(cdev, ¶ms->filter.mcast); - case QED_FILTER_TYPE_RX_MODE: - accept_flags = params->filter.accept_flags; - return qed_configure_filter_rx_mode(cdev, accept_flags); - default: - DP_NOTICE(cdev, "Unknown filter type %d\n", (int)params->type); - return -EINVAL; - } -} - static int qed_configure_arfs_searcher(struct qed_dev *cdev, enum qed_filter_config_mode mode) { @@ -2932,7 +2913,9 @@ static const struct qed_eth_ops qed_eth_ops_pass = { .q_rx_stop = &qed_stop_rxq, .q_tx_start = &qed_start_txq, .q_tx_stop = &qed_stop_txq, - .filter_config = &qed_configure_filter, + .filter_config_rx_mode = &qed_configure_filter_rx_mode, + .filter_config_ucast = &qed_configure_filter_ucast, + .filter_config_mcast = &qed_configure_filter_mcast, .fastpath_stop = &qed_fastpath_stop, .eth_cqe_completion = &qed_fp_cqe_completion, .get_vport_stats = &qed_get_vport_stats, diff --git a/drivers/net/ethernet/qlogic/qede/qede_filter.c b/drivers/net/ethernet/qlogic/qede/qede_filter.c index 3142d92a98f0..616608e496f7 100644 --- a/drivers/net/ethernet/qlogic/qede/qede_filter.c +++ b/drivers/net/ethernet/qlogic/qede/qede_filter.c @@ -644,30 +644,28 @@ static int qede_set_ucast_rx_mac(struct qede_dev *edev, enum qed_filter_xcast_params_type opcode, unsigned char mac[ETH_ALEN]) { - struct qed_filter_params filter_cmd; + struct qed_filter_ucast_params ucast; - memset(&filter_cmd, 0, sizeof(filter_cmd)); - filter_cmd.type = QED_FILTER_TYPE_UCAST; - filter_cmd.filter.ucast.type = opcode; - filter_cmd.filter.ucast.mac_valid = 1; - ether_addr_copy(filter_cmd.filter.ucast.mac, mac); + memset(&ucast, 0, sizeof(ucast)); + ucast.type = opcode; + ucast.mac_valid = 1; + ether_addr_copy(ucast.mac, mac); - return edev->ops->filter_config(edev->cdev, &filter_cmd); + return edev->ops->filter_config_ucast(edev->cdev, &ucast); } static int qede_set_ucast_rx_vlan(struct qede_dev *edev, enum qed_filter_xcast_params_type opcode, u16 vid) { - struct qed_filter_params filter_cmd; + struct qed_filter_ucast_params ucast; - memset(&filter_cmd, 0, sizeof(filter_cmd)); - filter_cmd.type = QED_FILTER_TYPE_UCAST; - filter_cmd.filter.ucast.type = opcode; - filter_cmd.filter.ucast.vlan_valid = 1; - filter_cmd.filter.ucast.vlan = vid; + memset(&ucast, 0, sizeof(ucast)); + ucast.type = opcode; + ucast.vlan_valid = 1; + ucast.vlan = vid; - return edev->ops->filter_config(edev->cdev, &filter_cmd); + return edev->ops->filter_config_ucast(edev->cdev, &ucast); } static int qede_config_accept_any_vlan(struct qede_dev *edev, bool action) @@ -1133,18 +1131,17 @@ static int qede_set_mcast_rx_mac(struct qede_dev *edev, enum qed_filter_xcast_params_type opcode, unsigned char *mac, int num_macs) { - struct qed_filter_params filter_cmd; + struct qed_filter_mcast_params mcast; int i; - memset(&filter_cmd, 0, sizeof(filter_cmd)); - filter_cmd.type = QED_FILTER_TYPE_MCAST; - filter_cmd.filter.mcast.type = opcode; - filter_cmd.filter.mcast.num = num_macs; + memset(&mcast, 0, sizeof(mcast)); + mcast.type = opcode; + mcast.num = num_macs; for (i = 0; i < num_macs; i++, mac += ETH_ALEN) - ether_addr_copy(filter_cmd.filter.mcast.mac[i], mac); + ether_addr_copy(mcast.mac[i], mac); - return edev->ops->filter_config(edev->cdev, &filter_cmd); + return edev->ops->filter_config_mcast(edev->cdev, &mcast); } int qede_set_mac_addr(struct net_device *ndev, void *p) @@ -1270,7 +1267,6 @@ void qede_config_rx_mode(struct net_device *ndev) { enum qed_filter_rx_mode_type accept_flags; struct qede_dev *edev = netdev_priv(ndev); - struct qed_filter_params rx_mode; unsigned char *uc_macs, *temp; struct netdev_hw_addr *ha; int rc, uc_count; @@ -1296,10 +1292,6 @@ void qede_config_rx_mode(struct net_device *ndev) netif_addr_unlock_bh(ndev); - /* Configure the struct for the Rx mode */ - memset(&rx_mode, 0, sizeof(struct qed_filter_params)); - rx_mode.type = QED_FILTER_TYPE_RX_MODE; - /* Remove all previous unicast secondary macs and multicast macs * (configrue / leave the primary mac) */ @@ -1347,8 +1339,7 @@ void qede_config_rx_mode(struct net_device *ndev) qede_config_accept_any_vlan(edev, false); } - rx_mode.filter.accept_flags = accept_flags; - edev->ops->filter_config(edev->cdev, &rx_mode); + edev->ops->filter_config_rx_mode(edev->cdev, accept_flags); out: kfree(uc_macs); } diff --git a/drivers/net/ethernet/xilinx/xilinx_axienet.h b/drivers/net/ethernet/xilinx/xilinx_axienet.h index 04e51af32178..c43d437f22bd 100644 --- a/drivers/net/ethernet/xilinx/xilinx_axienet.h +++ b/drivers/net/ethernet/xilinx/xilinx_axienet.h @@ -159,22 +159,17 @@ #define XAE_RCW1_OFFSET 0x00000404 /* Rx Configuration Word 1 */ #define XAE_TC_OFFSET 0x00000408 /* Tx Configuration */ #define XAE_FCC_OFFSET 0x0000040C /* Flow Control Configuration */ -#define XAE_EMMC_OFFSET 0x00000410 /* EMAC mode configuration */ -#define XAE_PHYC_OFFSET 0x00000414 /* RGMII/SGMII configuration */ -#define XAE_MDIO_MC_OFFSET 0x00000500 /* MII Management Config */ -#define XAE_MDIO_MCR_OFFSET 0x00000504 /* MII Management Control */ -#define XAE_MDIO_MWD_OFFSET 0x00000508 /* MII Management Write Data */ -#define XAE_MDIO_MRD_OFFSET 0x0000050C /* MII Management Read Data */ -#define XAE_MDIO_MIS_OFFSET 0x00000600 /* MII Management Interrupt Status */ -/* MII Mgmt Interrupt Pending register offset */ -#define XAE_MDIO_MIP_OFFSET 0x00000620 -/* MII Management Interrupt Enable register offset */ -#define XAE_MDIO_MIE_OFFSET 0x00000640 -/* MII Management Interrupt Clear register offset. */ -#define XAE_MDIO_MIC_OFFSET 0x00000660 +#define XAE_EMMC_OFFSET 0x00000410 /* MAC speed configuration */ +#define XAE_PHYC_OFFSET 0x00000414 /* RX Max Frame Configuration */ +#define XAE_ID_OFFSET 0x000004F8 /* Identification register */ +#define XAE_MDIO_MC_OFFSET 0x00000500 /* MDIO Setup */ +#define XAE_MDIO_MCR_OFFSET 0x00000504 /* MDIO Control */ +#define XAE_MDIO_MWD_OFFSET 0x00000508 /* MDIO Write Data */ +#define XAE_MDIO_MRD_OFFSET 0x0000050C /* MDIO Read Data */ #define XAE_UAW0_OFFSET 0x00000700 /* Unicast address word 0 */ #define XAE_UAW1_OFFSET 0x00000704 /* Unicast address word 1 */ -#define XAE_FMI_OFFSET 0x00000708 /* Filter Mask Index */ +#define XAE_FMI_OFFSET 0x00000708 /* Frame Filter Control */ +#define XAE_FFE_OFFSET 0x0000070C /* Frame Filter Enable */ #define XAE_AF0_OFFSET 0x00000710 /* Address Filter 0 */ #define XAE_AF1_OFFSET 0x00000714 /* Address Filter 1 */ @@ -313,7 +308,7 @@ */ #define XAE_UAW1_UNICASTADDR_MASK 0x0000FFFF -/* Bit masks for Axi Ethernet FMI register */ +/* Bit masks for Axi Ethernet FMC register */ #define XAE_FMI_PM_MASK 0x80000000 /* Promis. mode enable */ #define XAE_FMI_IND_MASK 0x00000003 /* Index Mask */ @@ -335,6 +330,7 @@ #define XAE_FEATURE_PARTIAL_TX_CSUM (1 << 1) #define XAE_FEATURE_FULL_RX_CSUM (1 << 2) #define XAE_FEATURE_FULL_TX_CSUM (1 << 3) +#define XAE_FEATURE_DMA_64BIT (1 << 4) #define XAE_NO_CSUM_OFFLOAD 0 @@ -347,9 +343,9 @@ /** * struct axidma_bd - Axi Dma buffer descriptor layout * @next: MM2S/S2MM Next Descriptor Pointer - * @reserved1: Reserved and not used + * @next_msb: MM2S/S2MM Next Descriptor Pointer (high 32 bits) * @phys: MM2S/S2MM Buffer Address - * @reserved2: Reserved and not used + * @phys_msb: MM2S/S2MM Buffer Address (high 32 bits) * @reserved3: Reserved and not used * @reserved4: Reserved and not used * @cntrl: MM2S/S2MM Control value @@ -362,9 +358,9 @@ */ struct axidma_bd { u32 next; /* Physical address of next buffer descriptor */ - u32 reserved1; + u32 next_msb; /* high 32 bits for IP >= v7.1, reserved on older IP */ u32 phys; - u32 reserved2; + u32 phys_msb; /* for IP >= v7.1, reserved for older IP */ u32 reserved3; u32 reserved4; u32 cntrl; diff --git a/drivers/net/ethernet/xilinx/xilinx_axienet_main.c b/drivers/net/ethernet/xilinx/xilinx_axienet_main.c index bbc1cf288d25..2aacc077ee2b 100644 --- a/drivers/net/ethernet/xilinx/xilinx_axienet_main.c +++ b/drivers/net/ethernet/xilinx/xilinx_axienet_main.c @@ -148,6 +148,34 @@ static inline void axienet_dma_out32(struct axienet_local *lp, iowrite32(value, lp->dma_regs + reg); } +static void axienet_dma_out_addr(struct axienet_local *lp, off_t reg, + dma_addr_t addr) +{ + axienet_dma_out32(lp, reg, lower_32_bits(addr)); + + if (lp->features & XAE_FEATURE_DMA_64BIT) + axienet_dma_out32(lp, reg + 4, upper_32_bits(addr)); +} + +static void desc_set_phys_addr(struct axienet_local *lp, dma_addr_t addr, + struct axidma_bd *desc) +{ + desc->phys = lower_32_bits(addr); + if (lp->features & XAE_FEATURE_DMA_64BIT) + desc->phys_msb = upper_32_bits(addr); +} + +static dma_addr_t desc_get_phys_addr(struct axienet_local *lp, + struct axidma_bd *desc) +{ + dma_addr_t ret = desc->phys; + + if (lp->features & XAE_FEATURE_DMA_64BIT) + ret |= ((dma_addr_t)desc->phys_msb << 16) << 16; + + return ret; +} + /** * axienet_dma_bd_release - Release buffer descriptor rings * @ndev: Pointer to the net_device structure @@ -161,24 +189,41 @@ static void axienet_dma_bd_release(struct net_device *ndev) int i; struct axienet_local *lp = netdev_priv(ndev); + /* If we end up here, tx_bd_v must have been DMA allocated. */ + dma_free_coherent(ndev->dev.parent, + sizeof(*lp->tx_bd_v) * lp->tx_bd_num, + lp->tx_bd_v, + lp->tx_bd_p); + + if (!lp->rx_bd_v) + return; + for (i = 0; i < lp->rx_bd_num; i++) { - dma_unmap_single(ndev->dev.parent, lp->rx_bd_v[i].phys, - lp->max_frm_size, DMA_FROM_DEVICE); + dma_addr_t phys; + + /* A NULL skb means this descriptor has not been initialised + * at all. + */ + if (!lp->rx_bd_v[i].skb) + break; + dev_kfree_skb(lp->rx_bd_v[i].skb); + + /* For each descriptor, we programmed cntrl with the (non-zero) + * descriptor size, after it had been successfully allocated. + * So a non-zero value in there means we need to unmap it. + */ + if (lp->rx_bd_v[i].cntrl) { + phys = desc_get_phys_addr(lp, &lp->rx_bd_v[i]); + dma_unmap_single(ndev->dev.parent, phys, + lp->max_frm_size, DMA_FROM_DEVICE); + } } - if (lp->rx_bd_v) { - dma_free_coherent(ndev->dev.parent, - sizeof(*lp->rx_bd_v) * lp->rx_bd_num, - lp->rx_bd_v, - lp->rx_bd_p); - } - if (lp->tx_bd_v) { - dma_free_coherent(ndev->dev.parent, - sizeof(*lp->tx_bd_v) * lp->tx_bd_num, - lp->tx_bd_v, - lp->tx_bd_p); - } + dma_free_coherent(ndev->dev.parent, + sizeof(*lp->rx_bd_v) * lp->rx_bd_num, + lp->rx_bd_v, + lp->rx_bd_p); } /** @@ -208,7 +253,7 @@ static int axienet_dma_bd_init(struct net_device *ndev) sizeof(*lp->tx_bd_v) * lp->tx_bd_num, &lp->tx_bd_p, GFP_KERNEL); if (!lp->tx_bd_v) - goto out; + return -ENOMEM; lp->rx_bd_v = dma_alloc_coherent(ndev->dev.parent, sizeof(*lp->rx_bd_v) * lp->rx_bd_num, @@ -217,25 +262,37 @@ static int axienet_dma_bd_init(struct net_device *ndev) goto out; for (i = 0; i < lp->tx_bd_num; i++) { - lp->tx_bd_v[i].next = lp->tx_bd_p + - sizeof(*lp->tx_bd_v) * - ((i + 1) % lp->tx_bd_num); + dma_addr_t addr = lp->tx_bd_p + + sizeof(*lp->tx_bd_v) * + ((i + 1) % lp->tx_bd_num); + + lp->tx_bd_v[i].next = lower_32_bits(addr); + if (lp->features & XAE_FEATURE_DMA_64BIT) + lp->tx_bd_v[i].next_msb = upper_32_bits(addr); } for (i = 0; i < lp->rx_bd_num; i++) { - lp->rx_bd_v[i].next = lp->rx_bd_p + - sizeof(*lp->rx_bd_v) * - ((i + 1) % lp->rx_bd_num); + dma_addr_t addr; + + addr = lp->rx_bd_p + sizeof(*lp->rx_bd_v) * + ((i + 1) % lp->rx_bd_num); + lp->rx_bd_v[i].next = lower_32_bits(addr); + if (lp->features & XAE_FEATURE_DMA_64BIT) + lp->rx_bd_v[i].next_msb = upper_32_bits(addr); skb = netdev_alloc_skb_ip_align(ndev, lp->max_frm_size); if (!skb) goto out; lp->rx_bd_v[i].skb = skb; - lp->rx_bd_v[i].phys = dma_map_single(ndev->dev.parent, - skb->data, - lp->max_frm_size, - DMA_FROM_DEVICE); + addr = dma_map_single(ndev->dev.parent, skb->data, + lp->max_frm_size, DMA_FROM_DEVICE); + if (dma_mapping_error(ndev->dev.parent, addr)) { + netdev_err(ndev, "DMA mapping error\n"); + goto out; + } + desc_set_phys_addr(lp, addr, &lp->rx_bd_v[i]); + lp->rx_bd_v[i].cntrl = lp->max_frm_size; } @@ -268,18 +325,18 @@ static int axienet_dma_bd_init(struct net_device *ndev) /* Populate the tail pointer and bring the Rx Axi DMA engine out of * halted state. This will make the Rx side ready for reception. */ - axienet_dma_out32(lp, XAXIDMA_RX_CDESC_OFFSET, lp->rx_bd_p); + axienet_dma_out_addr(lp, XAXIDMA_RX_CDESC_OFFSET, lp->rx_bd_p); cr = axienet_dma_in32(lp, XAXIDMA_RX_CR_OFFSET); axienet_dma_out32(lp, XAXIDMA_RX_CR_OFFSET, cr | XAXIDMA_CR_RUNSTOP_MASK); - axienet_dma_out32(lp, XAXIDMA_RX_TDESC_OFFSET, lp->rx_bd_p + - (sizeof(*lp->rx_bd_v) * (lp->rx_bd_num - 1))); + axienet_dma_out_addr(lp, XAXIDMA_RX_TDESC_OFFSET, lp->rx_bd_p + + (sizeof(*lp->rx_bd_v) * (lp->rx_bd_num - 1))); /* Write to the RS (Run-stop) bit in the Tx channel control register. * Tx channel is now ready to run. But only after we write to the * tail pointer register that the Tx channel will start transmitting. */ - axienet_dma_out32(lp, XAXIDMA_TX_CDESC_OFFSET, lp->tx_bd_p); + axienet_dma_out_addr(lp, XAXIDMA_TX_CDESC_OFFSET, lp->tx_bd_p); cr = axienet_dma_in32(lp, XAXIDMA_TX_CR_OFFSET); axienet_dma_out32(lp, XAXIDMA_TX_CR_OFFSET, cr | XAXIDMA_CR_RUNSTOP_MASK); @@ -352,7 +409,7 @@ static int netdev_set_mac_address(struct net_device *ndev, void *p) */ static void axienet_set_multicast_list(struct net_device *ndev) { - int i; + int i = 0; u32 reg, af0reg, af1reg; struct axienet_local *lp = netdev_priv(ndev); @@ -370,7 +427,10 @@ static void axienet_set_multicast_list(struct net_device *ndev) } else if (!netdev_mc_empty(ndev)) { struct netdev_hw_addr *ha; - i = 0; + reg = axienet_ior(lp, XAE_FMI_OFFSET); + reg &= ~XAE_FMI_PM_MASK; + axienet_iow(lp, XAE_FMI_OFFSET, reg); + netdev_for_each_mc_addr(ha, ndev) { if (i >= XAE_MULTICAST_CAM_TABLE_NUM) break; @@ -389,6 +449,7 @@ static void axienet_set_multicast_list(struct net_device *ndev) axienet_iow(lp, XAE_FMI_OFFSET, reg); axienet_iow(lp, XAE_AF0_OFFSET, af0reg); axienet_iow(lp, XAE_AF1_OFFSET, af1reg); + axienet_iow(lp, XAE_FFE_OFFSET, 1); i++; } } else { @@ -396,18 +457,15 @@ static void axienet_set_multicast_list(struct net_device *ndev) reg &= ~XAE_FMI_PM_MASK; axienet_iow(lp, XAE_FMI_OFFSET, reg); - - for (i = 0; i < XAE_MULTICAST_CAM_TABLE_NUM; i++) { - reg = axienet_ior(lp, XAE_FMI_OFFSET) & 0xFFFFFF00; - reg |= i; - - axienet_iow(lp, XAE_FMI_OFFSET, reg); - axienet_iow(lp, XAE_AF0_OFFSET, 0); - axienet_iow(lp, XAE_AF1_OFFSET, 0); - } - dev_info(&ndev->dev, "Promiscuous mode disabled.\n"); } + + for (; i < XAE_MULTICAST_CAM_TABLE_NUM; i++) { + reg = axienet_ior(lp, XAE_FMI_OFFSET) & 0xFFFFFF00; + reg |= i; + axienet_iow(lp, XAE_FMI_OFFSET, reg); + axienet_iow(lp, XAE_FFE_OFFSET, 0); + } } /** @@ -532,6 +590,64 @@ static int axienet_device_reset(struct net_device *ndev) return 0; } +/** + * axienet_free_tx_chain - Clean up a series of linked TX descriptors. + * @ndev: Pointer to the net_device structure + * @first_bd: Index of first descriptor to clean up + * @nr_bds: Number of descriptors to clean up, can be -1 if unknown. + * @sizep: Pointer to a u32 filled with the total sum of all bytes + * in all cleaned-up descriptors. Ignored if NULL. + * + * Would either be called after a successful transmit operation, or after + * there was an error when setting up the chain. + * Returns the number of descriptors handled. + */ +static int axienet_free_tx_chain(struct net_device *ndev, u32 first_bd, + int nr_bds, u32 *sizep) +{ + struct axienet_local *lp = netdev_priv(ndev); + struct axidma_bd *cur_p; + int max_bds = nr_bds; + unsigned int status; + dma_addr_t phys; + int i; + + if (max_bds == -1) + max_bds = lp->tx_bd_num; + + for (i = 0; i < max_bds; i++) { + cur_p = &lp->tx_bd_v[(first_bd + i) % lp->tx_bd_num]; + status = cur_p->status; + + /* If no number is given, clean up *all* descriptors that have + * been completed by the MAC. + */ + if (nr_bds == -1 && !(status & XAXIDMA_BD_STS_COMPLETE_MASK)) + break; + + phys = desc_get_phys_addr(lp, cur_p); + dma_unmap_single(ndev->dev.parent, phys, + (cur_p->cntrl & XAXIDMA_BD_CTRL_LENGTH_MASK), + DMA_TO_DEVICE); + + if (cur_p->skb && (status & XAXIDMA_BD_STS_COMPLETE_MASK)) + dev_consume_skb_irq(cur_p->skb); + + cur_p->cntrl = 0; + cur_p->app0 = 0; + cur_p->app1 = 0; + cur_p->app2 = 0; + cur_p->app4 = 0; + cur_p->status = 0; + cur_p->skb = NULL; + + if (sizep) + *sizep += status & XAXIDMA_BD_STS_ACTUAL_LEN_MASK; + } + + return i; +} + /** * axienet_start_xmit_done - Invoked once a transmit is completed by the * Axi DMA Tx channel. @@ -545,36 +661,15 @@ static int axienet_device_reset(struct net_device *ndev) */ static void axienet_start_xmit_done(struct net_device *ndev) { - u32 size = 0; - u32 packets = 0; struct axienet_local *lp = netdev_priv(ndev); - struct axidma_bd *cur_p; - unsigned int status = 0; + u32 packets = 0; + u32 size = 0; - cur_p = &lp->tx_bd_v[lp->tx_bd_ci]; - status = cur_p->status; - while (status & XAXIDMA_BD_STS_COMPLETE_MASK) { - dma_unmap_single(ndev->dev.parent, cur_p->phys, - (cur_p->cntrl & XAXIDMA_BD_CTRL_LENGTH_MASK), - DMA_TO_DEVICE); - if (cur_p->skb) - dev_consume_skb_irq(cur_p->skb); - /*cur_p->phys = 0;*/ - cur_p->app0 = 0; - cur_p->app1 = 0; - cur_p->app2 = 0; - cur_p->app4 = 0; - cur_p->status = 0; - cur_p->skb = NULL; + packets = axienet_free_tx_chain(ndev, lp->tx_bd_ci, -1, &size); - size += status & XAXIDMA_BD_STS_ACTUAL_LEN_MASK; - packets++; - - if (++lp->tx_bd_ci >= lp->tx_bd_num) - lp->tx_bd_ci = 0; - cur_p = &lp->tx_bd_v[lp->tx_bd_ci]; - status = cur_p->status; - } + lp->tx_bd_ci += packets; + if (lp->tx_bd_ci >= lp->tx_bd_num) + lp->tx_bd_ci -= lp->tx_bd_num; ndev->stats.tx_packets += packets; ndev->stats.tx_bytes += size; @@ -629,9 +724,10 @@ axienet_start_xmit(struct sk_buff *skb, struct net_device *ndev) u32 csum_start_off; u32 csum_index_off; skb_frag_t *frag; - dma_addr_t tail_p; + dma_addr_t tail_p, phys; struct axienet_local *lp = netdev_priv(ndev); struct axidma_bd *cur_p; + u32 orig_tail_ptr = lp->tx_bd_tail; num_frag = skb_shinfo(skb)->nr_frags; cur_p = &lp->tx_bd_v[lp->tx_bd_tail]; @@ -667,19 +763,37 @@ axienet_start_xmit(struct sk_buff *skb, struct net_device *ndev) cur_p->app0 |= 2; /* Tx Full Checksum Offload Enabled */ } + phys = dma_map_single(ndev->dev.parent, skb->data, + skb_headlen(skb), DMA_TO_DEVICE); + if (unlikely(dma_mapping_error(ndev->dev.parent, phys))) { + if (net_ratelimit()) + netdev_err(ndev, "TX DMA mapping error\n"); + ndev->stats.tx_dropped++; + return NETDEV_TX_OK; + } + desc_set_phys_addr(lp, phys, cur_p); cur_p->cntrl = skb_headlen(skb) | XAXIDMA_BD_CTRL_TXSOF_MASK; - cur_p->phys = dma_map_single(ndev->dev.parent, skb->data, - skb_headlen(skb), DMA_TO_DEVICE); for (ii = 0; ii < num_frag; ii++) { if (++lp->tx_bd_tail >= lp->tx_bd_num) lp->tx_bd_tail = 0; cur_p = &lp->tx_bd_v[lp->tx_bd_tail]; frag = &skb_shinfo(skb)->frags[ii]; - cur_p->phys = dma_map_single(ndev->dev.parent, - skb_frag_address(frag), - skb_frag_size(frag), - DMA_TO_DEVICE); + phys = dma_map_single(ndev->dev.parent, + skb_frag_address(frag), + skb_frag_size(frag), + DMA_TO_DEVICE); + if (unlikely(dma_mapping_error(ndev->dev.parent, phys))) { + if (net_ratelimit()) + netdev_err(ndev, "TX DMA mapping error\n"); + ndev->stats.tx_dropped++; + axienet_free_tx_chain(ndev, orig_tail_ptr, ii + 1, + NULL); + lp->tx_bd_tail = orig_tail_ptr; + + return NETDEV_TX_OK; + } + desc_set_phys_addr(lp, phys, cur_p); cur_p->cntrl = skb_frag_size(frag); } @@ -688,7 +802,7 @@ axienet_start_xmit(struct sk_buff *skb, struct net_device *ndev) tail_p = lp->tx_bd_p + sizeof(*lp->tx_bd_v) * lp->tx_bd_tail; /* Start the transfer */ - axienet_dma_out32(lp, XAXIDMA_TX_TDESC_OFFSET, tail_p); + axienet_dma_out_addr(lp, XAXIDMA_TX_TDESC_OFFSET, tail_p); if (++lp->tx_bd_tail >= lp->tx_bd_num) lp->tx_bd_tail = 0; @@ -718,10 +832,12 @@ static void axienet_recv(struct net_device *ndev) cur_p = &lp->rx_bd_v[lp->rx_bd_ci]; while ((cur_p->status & XAXIDMA_BD_STS_COMPLETE_MASK)) { + dma_addr_t phys; + tail_p = lp->rx_bd_p + sizeof(*lp->rx_bd_v) * lp->rx_bd_ci; - dma_unmap_single(ndev->dev.parent, cur_p->phys, - lp->max_frm_size, + phys = desc_get_phys_addr(lp, cur_p); + dma_unmap_single(ndev->dev.parent, phys, lp->max_frm_size, DMA_FROM_DEVICE); skb = cur_p->skb; @@ -757,9 +873,17 @@ static void axienet_recv(struct net_device *ndev) if (!new_skb) return; - cur_p->phys = dma_map_single(ndev->dev.parent, new_skb->data, - lp->max_frm_size, - DMA_FROM_DEVICE); + phys = dma_map_single(ndev->dev.parent, new_skb->data, + lp->max_frm_size, + DMA_FROM_DEVICE); + if (unlikely(dma_mapping_error(ndev->dev.parent, phys))) { + if (net_ratelimit()) + netdev_err(ndev, "RX DMA mapping error\n"); + dev_kfree_skb(new_skb); + return; + } + desc_set_phys_addr(lp, phys, cur_p); + cur_p->cntrl = lp->max_frm_size; cur_p->status = 0; cur_p->skb = new_skb; @@ -773,7 +897,7 @@ static void axienet_recv(struct net_device *ndev) ndev->stats.rx_bytes += size; if (tail_p) - axienet_dma_out32(lp, XAXIDMA_RX_TDESC_OFFSET, tail_p); + axienet_dma_out_addr(lp, XAXIDMA_RX_TDESC_OFFSET, tail_p); } /** @@ -803,7 +927,8 @@ static irqreturn_t axienet_tx_irq(int irq, void *_ndev) return IRQ_NONE; if (status & XAXIDMA_IRQ_ERROR_MASK) { dev_err(&ndev->dev, "DMA Tx error 0x%x\n", status); - dev_err(&ndev->dev, "Current BD is at: 0x%x\n", + dev_err(&ndev->dev, "Current BD is at: 0x%x%08x\n", + (lp->tx_bd_v[lp->tx_bd_ci]).phys_msb, (lp->tx_bd_v[lp->tx_bd_ci]).phys); cr = axienet_dma_in32(lp, XAXIDMA_TX_CR_OFFSET); @@ -852,7 +977,8 @@ static irqreturn_t axienet_rx_irq(int irq, void *_ndev) return IRQ_NONE; if (status & XAXIDMA_IRQ_ERROR_MASK) { dev_err(&ndev->dev, "DMA Rx error 0x%x\n", status); - dev_err(&ndev->dev, "Current BD is at: 0x%x\n", + dev_err(&ndev->dev, "Current BD is at: 0x%x%08x\n", + (lp->rx_bd_v[lp->rx_bd_ci]).phys_msb, (lp->rx_bd_v[lp->rx_bd_ci]).phys); cr = axienet_dma_in32(lp, XAXIDMA_TX_CR_OFFSET); @@ -1182,10 +1308,6 @@ static void axienet_ethtools_get_regs(struct net_device *ndev, data[20] = axienet_ior(lp, XAE_MDIO_MCR_OFFSET); data[21] = axienet_ior(lp, XAE_MDIO_MWD_OFFSET); data[22] = axienet_ior(lp, XAE_MDIO_MRD_OFFSET); - data[23] = axienet_ior(lp, XAE_MDIO_MIS_OFFSET); - data[24] = axienet_ior(lp, XAE_MDIO_MIP_OFFSET); - data[25] = axienet_ior(lp, XAE_MDIO_MIE_OFFSET); - data[26] = axienet_ior(lp, XAE_MDIO_MIC_OFFSET); data[27] = axienet_ior(lp, XAE_UAW0_OFFSET); data[28] = axienet_ior(lp, XAE_UAW1_OFFSET); data[29] = axienet_ior(lp, XAE_FMI_OFFSET); @@ -1549,14 +1671,18 @@ static void axienet_dma_err_handler(struct work_struct *work) for (i = 0; i < lp->tx_bd_num; i++) { cur_p = &lp->tx_bd_v[i]; - if (cur_p->phys) - dma_unmap_single(ndev->dev.parent, cur_p->phys, + if (cur_p->cntrl) { + dma_addr_t addr = desc_get_phys_addr(lp, cur_p); + + dma_unmap_single(ndev->dev.parent, addr, (cur_p->cntrl & XAXIDMA_BD_CTRL_LENGTH_MASK), DMA_TO_DEVICE); + } if (cur_p->skb) dev_kfree_skb_irq(cur_p->skb); cur_p->phys = 0; + cur_p->phys_msb = 0; cur_p->cntrl = 0; cur_p->status = 0; cur_p->app0 = 0; @@ -1610,18 +1736,18 @@ static void axienet_dma_err_handler(struct work_struct *work) /* Populate the tail pointer and bring the Rx Axi DMA engine out of * halted state. This will make the Rx side ready for reception. */ - axienet_dma_out32(lp, XAXIDMA_RX_CDESC_OFFSET, lp->rx_bd_p); + axienet_dma_out_addr(lp, XAXIDMA_RX_CDESC_OFFSET, lp->rx_bd_p); cr = axienet_dma_in32(lp, XAXIDMA_RX_CR_OFFSET); axienet_dma_out32(lp, XAXIDMA_RX_CR_OFFSET, cr | XAXIDMA_CR_RUNSTOP_MASK); - axienet_dma_out32(lp, XAXIDMA_RX_TDESC_OFFSET, lp->rx_bd_p + - (sizeof(*lp->rx_bd_v) * (lp->rx_bd_num - 1))); + axienet_dma_out_addr(lp, XAXIDMA_RX_TDESC_OFFSET, lp->rx_bd_p + + (sizeof(*lp->rx_bd_v) * (lp->rx_bd_num - 1))); /* Write to the RS (Run-stop) bit in the Tx channel control register. * Tx channel is now ready to run. But only after we write to the * tail pointer register that the Tx channel will start transmitting */ - axienet_dma_out32(lp, XAXIDMA_TX_CDESC_OFFSET, lp->tx_bd_p); + axienet_dma_out_addr(lp, XAXIDMA_TX_CDESC_OFFSET, lp->tx_bd_p); cr = axienet_dma_in32(lp, XAXIDMA_TX_CR_OFFSET); axienet_dma_out32(lp, XAXIDMA_TX_CR_OFFSET, cr | XAXIDMA_CR_RUNSTOP_MASK); @@ -1832,6 +1958,29 @@ static int axienet_probe(struct platform_device *pdev) goto free_netdev; } + /* Autodetect the need for 64-bit DMA pointers. + * When the IP is configured for a bus width bigger than 32 bits, + * writing the MSB registers is mandatory, even if they are all 0. + * We can detect this case by writing all 1's to one such register + * and see if that sticks: when the IP is configured for 32 bits + * only, those registers are RES0. + * Those MSB registers were introduced in IP v7.1, which we check first. + */ + if ((axienet_ior(lp, XAE_ID_OFFSET) >> 24) >= 0x9) { + void __iomem *desc = lp->dma_regs + XAXIDMA_TX_CDESC_OFFSET + 4; + + iowrite32(0x0, desc); + if (ioread32(desc) == 0) { /* sanity check */ + iowrite32(0xffffffff, desc); + if (ioread32(desc) > 0) { + lp->features |= XAE_FEATURE_DMA_64BIT; + dev_info(&pdev->dev, + "autodetected 64-bit DMA range\n"); + } + iowrite32(0x0, desc); + } + } + /* Check for Ethernet core IRQ (optional) */ if (lp->eth_irq <= 0) dev_info(&pdev->dev, "Ethernet core IRQ not defined\n"); diff --git a/drivers/net/gtp.c b/drivers/net/gtp.c index 0d6d2fe9eabd..c868f4ffa240 100644 --- a/drivers/net/gtp.c +++ b/drivers/net/gtp.c @@ -573,6 +573,9 @@ static netdev_tx_t gtp_dev_xmit(struct sk_buff *skb, struct net_device *dev) if (skb_cow_head(skb, dev->needed_headroom)) goto tx_err; + if (!pskb_inet_may_pull(skb)) + goto tx_err; + skb_reset_inner_headers(skb); /* PDP context lookups in gtp_build_skb_*() need rcu read-side lock. */ @@ -804,7 +807,7 @@ static struct sock *gtp_encap_enable_socket(int fd, int type, sock = sockfd_lookup(fd, &err); if (!sock) { pr_debug("gtp socket fd=%d not found\n", fd); - return NULL; + return ERR_PTR(err); } sk = sock->sk; diff --git a/drivers/net/netconsole.c b/drivers/net/netconsole.c index 92001f7af380..924370e53003 100644 --- a/drivers/net/netconsole.c +++ b/drivers/net/netconsole.c @@ -715,6 +715,7 @@ restart: /* rtnl_lock already held * we might sleep in __netpoll_cleanup() */ + nt->enabled = false; spin_unlock_irqrestore(&target_list_lock, flags); __netpoll_cleanup(&nt->np); @@ -722,7 +723,6 @@ restart: spin_lock_irqsave(&target_list_lock, flags); dev_put(nt->np.dev); nt->np.dev = NULL; - nt->enabled = false; stopped = true; netconsole_target_put(nt); goto restart; diff --git a/drivers/net/usb/qmi_wwan.c b/drivers/net/usb/qmi_wwan.c index 17aa52ed892b..3e219cf4dd85 100644 --- a/drivers/net/usb/qmi_wwan.c +++ b/drivers/net/usb/qmi_wwan.c @@ -238,6 +238,7 @@ static int qmimux_rx_fixup(struct usbnet *dev, struct sk_buff *skb) break; default: /* not ip - do not know what to do */ + kfree_skb(skbn); goto skip; } diff --git a/drivers/net/usb/r8152.c b/drivers/net/usb/r8152.c index 472b02bcfcbf..92b51c4c46f5 100644 --- a/drivers/net/usb/r8152.c +++ b/drivers/net/usb/r8152.c @@ -3372,11 +3372,23 @@ static void r8152b_hw_phy_cfg(struct r8152 *tp) set_bit(PHY_RESET, &tp->flags); } -static void r8152b_exit_oob(struct r8152 *tp) +static void wait_oob_link_list_ready(struct r8152 *tp) { u32 ocp_data; int i; + for (i = 0; i < 1000; i++) { + ocp_data = ocp_read_byte(tp, MCU_TYPE_PLA, PLA_OOB_CTRL); + if (ocp_data & LINK_LIST_READY) + break; + usleep_range(1000, 2000); + } +} + +static void r8152b_exit_oob(struct r8152 *tp) +{ + u32 ocp_data; + ocp_data = ocp_read_dword(tp, MCU_TYPE_PLA, PLA_RCR); ocp_data &= ~RCR_ACPT_ALL; ocp_write_dword(tp, MCU_TYPE_PLA, PLA_RCR, ocp_data); @@ -3394,23 +3406,13 @@ static void r8152b_exit_oob(struct r8152 *tp) ocp_data &= ~MCU_BORW_EN; ocp_write_word(tp, MCU_TYPE_PLA, PLA_SFF_STS_7, ocp_data); - for (i = 0; i < 1000; i++) { - ocp_data = ocp_read_byte(tp, MCU_TYPE_PLA, PLA_OOB_CTRL); - if (ocp_data & LINK_LIST_READY) - break; - usleep_range(1000, 2000); - } + wait_oob_link_list_ready(tp); ocp_data = ocp_read_word(tp, MCU_TYPE_PLA, PLA_SFF_STS_7); ocp_data |= RE_INIT_LL; ocp_write_word(tp, MCU_TYPE_PLA, PLA_SFF_STS_7, ocp_data); - for (i = 0; i < 1000; i++) { - ocp_data = ocp_read_byte(tp, MCU_TYPE_PLA, PLA_OOB_CTRL); - if (ocp_data & LINK_LIST_READY) - break; - usleep_range(1000, 2000); - } + wait_oob_link_list_ready(tp); rtl8152_nic_reset(tp); @@ -3452,7 +3454,6 @@ static void r8152b_exit_oob(struct r8152 *tp) static void r8152b_enter_oob(struct r8152 *tp) { u32 ocp_data; - int i; ocp_data = ocp_read_byte(tp, MCU_TYPE_PLA, PLA_OOB_CTRL); ocp_data &= ~NOW_IS_OOB; @@ -3464,23 +3465,13 @@ static void r8152b_enter_oob(struct r8152 *tp) rtl_disable(tp); - for (i = 0; i < 1000; i++) { - ocp_data = ocp_read_byte(tp, MCU_TYPE_PLA, PLA_OOB_CTRL); - if (ocp_data & LINK_LIST_READY) - break; - usleep_range(1000, 2000); - } + wait_oob_link_list_ready(tp); ocp_data = ocp_read_word(tp, MCU_TYPE_PLA, PLA_SFF_STS_7); ocp_data |= RE_INIT_LL; ocp_write_word(tp, MCU_TYPE_PLA, PLA_SFF_STS_7, ocp_data); - for (i = 0; i < 1000; i++) { - ocp_data = ocp_read_byte(tp, MCU_TYPE_PLA, PLA_OOB_CTRL); - if (ocp_data & LINK_LIST_READY) - break; - usleep_range(1000, 2000); - } + wait_oob_link_list_ready(tp); ocp_write_word(tp, MCU_TYPE_PLA, PLA_RMS, RTL8152_RMS); @@ -3705,7 +3696,6 @@ static void r8153b_hw_phy_cfg(struct r8152 *tp) static void r8153_first_init(struct r8152 *tp) { u32 ocp_data; - int i; rxdy_gated_en(tp, true); r8153_teredo_off(tp); @@ -3725,23 +3715,13 @@ static void r8153_first_init(struct r8152 *tp) ocp_data &= ~MCU_BORW_EN; ocp_write_word(tp, MCU_TYPE_PLA, PLA_SFF_STS_7, ocp_data); - for (i = 0; i < 1000; i++) { - ocp_data = ocp_read_byte(tp, MCU_TYPE_PLA, PLA_OOB_CTRL); - if (ocp_data & LINK_LIST_READY) - break; - usleep_range(1000, 2000); - } + wait_oob_link_list_ready(tp); ocp_data = ocp_read_word(tp, MCU_TYPE_PLA, PLA_SFF_STS_7); ocp_data |= RE_INIT_LL; ocp_write_word(tp, MCU_TYPE_PLA, PLA_SFF_STS_7, ocp_data); - for (i = 0; i < 1000; i++) { - ocp_data = ocp_read_byte(tp, MCU_TYPE_PLA, PLA_OOB_CTRL); - if (ocp_data & LINK_LIST_READY) - break; - usleep_range(1000, 2000); - } + wait_oob_link_list_ready(tp); rtl_rx_vlan_en(tp, tp->netdev->features & NETIF_F_HW_VLAN_CTAG_RX); @@ -3766,7 +3746,6 @@ static void r8153_first_init(struct r8152 *tp) static void r8153_enter_oob(struct r8152 *tp) { u32 ocp_data; - int i; ocp_data = ocp_read_byte(tp, MCU_TYPE_PLA, PLA_OOB_CTRL); ocp_data &= ~NOW_IS_OOB; @@ -3775,23 +3754,13 @@ static void r8153_enter_oob(struct r8152 *tp) rtl_disable(tp); rtl_reset_bmu(tp); - for (i = 0; i < 1000; i++) { - ocp_data = ocp_read_byte(tp, MCU_TYPE_PLA, PLA_OOB_CTRL); - if (ocp_data & LINK_LIST_READY) - break; - usleep_range(1000, 2000); - } + wait_oob_link_list_ready(tp); ocp_data = ocp_read_word(tp, MCU_TYPE_PLA, PLA_SFF_STS_7); ocp_data |= RE_INIT_LL; ocp_write_word(tp, MCU_TYPE_PLA, PLA_SFF_STS_7, ocp_data); - for (i = 0; i < 1000; i++) { - ocp_data = ocp_read_byte(tp, MCU_TYPE_PLA, PLA_OOB_CTRL); - if (ocp_data & LINK_LIST_READY) - break; - usleep_range(1000, 2000); - } + wait_oob_link_list_ready(tp); ocp_data = tp->netdev->mtu + VLAN_ETH_HLEN + ETH_FCS_LEN; ocp_write_word(tp, MCU_TYPE_PLA, PLA_RMS, ocp_data); diff --git a/drivers/net/usb/sr9700.c b/drivers/net/usb/sr9700.c index 3fac642bec77..8d2e3daf03cf 100644 --- a/drivers/net/usb/sr9700.c +++ b/drivers/net/usb/sr9700.c @@ -178,6 +178,7 @@ static int sr_mdio_read(struct net_device *netdev, int phy_id, int loc) struct usbnet *dev = netdev_priv(netdev); __le16 res; int rc = 0; + int err; if (phy_id) { netdev_dbg(netdev, "Only internal phy supported\n"); @@ -188,11 +189,17 @@ static int sr_mdio_read(struct net_device *netdev, int phy_id, int loc) if (loc == MII_BMSR) { u8 value; - sr_read_reg(dev, SR_NSR, &value); + err = sr_read_reg(dev, SR_NSR, &value); + if (err < 0) + return err; + if (value & NSR_LINKST) rc = 1; } - sr_share_read_word(dev, 1, loc, &res); + err = sr_share_read_word(dev, 1, loc, &res); + if (err < 0) + return err; + if (rc == 1) res = le16_to_cpu(res) | BMSR_LSTATUS; else diff --git a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c index 66797dc5e90d..1e597e5de5f1 100644 --- a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c +++ b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c @@ -2625,7 +2625,6 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi, struct lcnphy_txgains cal_gains, temp_gains; u16 hash; - u8 band_idx; int j; u16 ncorr_override[5]; u16 syst_coeffs[] = { 0x0000, 0x0000, 0x0000, 0x0000, 0x0000, 0x0000, @@ -2657,6 +2656,9 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi, u16 *values_to_save; struct brcms_phy_lcnphy *pi_lcn = pi->u.pi_lcnphy; + if (WARN_ON(CHSPEC_IS5G(pi->radio_chanspec))) + return; + values_to_save = kmalloc_array(20, sizeof(u16), GFP_ATOMIC); if (NULL == values_to_save) return; @@ -2720,20 +2722,18 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi, hash = (target_gains->gm_gain << 8) | (target_gains->pga_gain << 4) | (target_gains->pad_gain); - band_idx = (CHSPEC_IS5G(pi->radio_chanspec) ? 1 : 0); - cal_gains = *target_gains; memset(ncorr_override, 0, sizeof(ncorr_override)); - for (j = 0; j < iqcal_gainparams_numgains_lcnphy[band_idx]; j++) { - if (hash == tbl_iqcal_gainparams_lcnphy[band_idx][j][0]) { + for (j = 0; j < iqcal_gainparams_numgains_lcnphy[0]; j++) { + if (hash == tbl_iqcal_gainparams_lcnphy[0][j][0]) { cal_gains.gm_gain = - tbl_iqcal_gainparams_lcnphy[band_idx][j][1]; + tbl_iqcal_gainparams_lcnphy[0][j][1]; cal_gains.pga_gain = - tbl_iqcal_gainparams_lcnphy[band_idx][j][2]; + tbl_iqcal_gainparams_lcnphy[0][j][2]; cal_gains.pad_gain = - tbl_iqcal_gainparams_lcnphy[band_idx][j][3]; + tbl_iqcal_gainparams_lcnphy[0][j][3]; memcpy(ncorr_override, - &tbl_iqcal_gainparams_lcnphy[band_idx][j][3], + &tbl_iqcal_gainparams_lcnphy[0][j][3], sizeof(ncorr_override)); break; } diff --git a/drivers/net/wireless/intel/iwlwifi/mvm/scan.c b/drivers/net/wireless/intel/iwlwifi/mvm/scan.c index 3a58267d3d71..3bce3b59a12b 100644 --- a/drivers/net/wireless/intel/iwlwifi/mvm/scan.c +++ b/drivers/net/wireless/intel/iwlwifi/mvm/scan.c @@ -2140,7 +2140,7 @@ int iwl_mvm_scan_stop(struct iwl_mvm *mvm, int type, bool notify) if (!(mvm->scan_status & type)) return 0; - if (iwl_mvm_is_radio_killed(mvm)) { + if (!test_bit(STATUS_DEVICE_ENABLED, &mvm->trans->status)) { ret = 0; goto out; } diff --git a/drivers/net/wireless/marvell/mwifiex/cfg80211.c b/drivers/net/wireless/marvell/mwifiex/cfg80211.c index 857b61db9d2c..e40f727547ec 100644 --- a/drivers/net/wireless/marvell/mwifiex/cfg80211.c +++ b/drivers/net/wireless/marvell/mwifiex/cfg80211.c @@ -934,6 +934,8 @@ mwifiex_init_new_priv_params(struct mwifiex_private *priv, return -EOPNOTSUPP; } + priv->bss_num = mwifiex_get_unused_bss_num(adapter, priv->bss_type); + spin_lock_irqsave(&adapter->main_proc_lock, flags); adapter->main_locked = false; spin_unlock_irqrestore(&adapter->main_proc_lock, flags); @@ -4317,11 +4319,27 @@ int mwifiex_register_cfg80211(struct mwifiex_adapter *adapter) if (ISSUPP_ADHOC_ENABLED(adapter->fw_cap_info)) wiphy->interface_modes |= BIT(NL80211_IFTYPE_ADHOC); - wiphy->bands[NL80211_BAND_2GHZ] = &mwifiex_band_2ghz; - if (adapter->config_bands & BAND_A) - wiphy->bands[NL80211_BAND_5GHZ] = &mwifiex_band_5ghz; - else + wiphy->bands[NL80211_BAND_2GHZ] = devm_kmemdup(adapter->dev, + &mwifiex_band_2ghz, + sizeof(mwifiex_band_2ghz), + GFP_KERNEL); + if (!wiphy->bands[NL80211_BAND_2GHZ]) { + ret = -ENOMEM; + goto err; + } + + if (adapter->config_bands & BAND_A) { + wiphy->bands[NL80211_BAND_5GHZ] = devm_kmemdup(adapter->dev, + &mwifiex_band_5ghz, + sizeof(mwifiex_band_5ghz), + GFP_KERNEL); + if (!wiphy->bands[NL80211_BAND_5GHZ]) { + ret = -ENOMEM; + goto err; + } + } else { wiphy->bands[NL80211_BAND_5GHZ] = NULL; + } if (adapter->drcs_enabled && ISSUPP_DRCS_ENABLED(adapter->fw_cap_info)) wiphy->iface_combinations = &mwifiex_iface_comb_ap_sta_drcs; @@ -4409,8 +4427,7 @@ int mwifiex_register_cfg80211(struct mwifiex_adapter *adapter) if (ret < 0) { mwifiex_dbg(adapter, ERROR, "%s: wiphy_register failed: %d\n", __func__, ret); - wiphy_free(wiphy); - return ret; + goto err; } if (!adapter->regd) { @@ -4452,4 +4469,9 @@ int mwifiex_register_cfg80211(struct mwifiex_adapter *adapter) adapter->wiphy = wiphy; return ret; + +err: + wiphy_free(wiphy); + + return ret; } diff --git a/drivers/net/wireless/st/cw1200/txrx.c b/drivers/net/wireless/st/cw1200/txrx.c index 2dfcdb145944..31f5b2d8f519 100644 --- a/drivers/net/wireless/st/cw1200/txrx.c +++ b/drivers/net/wireless/st/cw1200/txrx.c @@ -1170,7 +1170,7 @@ void cw1200_rx_cb(struct cw1200_common *priv, size_t ies_len = skb->len - (ies - (u8 *)(skb->data)); tim_ie = cfg80211_find_ie(WLAN_EID_TIM, ies, ies_len); - if (tim_ie) { + if (tim_ie && tim_ie[1] >= sizeof(struct ieee80211_tim_ie)) { struct ieee80211_tim_ie *tim = (struct ieee80211_tim_ie *)&tim_ie[2]; diff --git a/drivers/net/wireless/virt_wifi.c b/drivers/net/wireless/virt_wifi.c index 6168c0b21a71..00becf5c666b 100644 --- a/drivers/net/wireless/virt_wifi.c +++ b/drivers/net/wireless/virt_wifi.c @@ -138,6 +138,9 @@ static struct ieee80211_supported_band band_5ghz = { /* Assigned at module init. Guaranteed locally-administered and unicast. */ static u8 fake_router_bssid[ETH_ALEN] __ro_after_init = {}; +#define VIRT_WIFI_SSID "VirtWifi" +#define VIRT_WIFI_SSID_LEN 8 + static void virt_wifi_inform_bss(struct wiphy *wiphy) { u64 tsf = div_u64(ktime_get_boottime_ns(), 1000); @@ -148,8 +151,8 @@ static void virt_wifi_inform_bss(struct wiphy *wiphy) u8 ssid[8]; } __packed ssid = { .tag = WLAN_EID_SSID, - .len = 8, - .ssid = "VirtWifi", + .len = VIRT_WIFI_SSID_LEN, + .ssid = VIRT_WIFI_SSID, }; informed_bss = cfg80211_inform_bss(wiphy, &channel_5ghz, @@ -224,6 +227,8 @@ struct virt_wifi_netdev_priv { struct net_device *upperdev; u32 tx_packets; u32 tx_failed; + u32 connect_requested_ssid_len; + u8 connect_requested_ssid[IEEE80211_MAX_SSID_LEN]; u8 connect_requested_bss[ETH_ALEN]; bool is_up; bool is_connected; @@ -240,6 +245,12 @@ static int virt_wifi_connect(struct wiphy *wiphy, struct net_device *netdev, if (priv->being_deleted || !priv->is_up) return -EBUSY; + if (!sme->ssid) + return -EINVAL; + + priv->connect_requested_ssid_len = sme->ssid_len; + memcpy(priv->connect_requested_ssid, sme->ssid, sme->ssid_len); + could_schedule = schedule_delayed_work(&priv->connect, HZ * 2); if (!could_schedule) return -EBUSY; @@ -263,12 +274,15 @@ static void virt_wifi_connect_complete(struct work_struct *work) container_of(work, struct virt_wifi_netdev_priv, connect.work); u8 *requested_bss = priv->connect_requested_bss; bool right_addr = ether_addr_equal(requested_bss, fake_router_bssid); + bool right_ssid = priv->connect_requested_ssid_len == VIRT_WIFI_SSID_LEN && + !memcmp(priv->connect_requested_ssid, VIRT_WIFI_SSID, + priv->connect_requested_ssid_len); u16 status = WLAN_STATUS_SUCCESS; if (is_zero_ether_addr(requested_bss)) requested_bss = NULL; - if (!priv->is_up || (requested_bss && !right_addr)) + if (!priv->is_up || (requested_bss && !right_addr) || !right_ssid) status = WLAN_STATUS_UNSPECIFIED_FAILURE; else priv->is_connected = true; diff --git a/drivers/nfc/pn533/pn533.c b/drivers/nfc/pn533/pn533.c index 1e90ff17f87d..9610a9b1929f 100644 --- a/drivers/nfc/pn533/pn533.c +++ b/drivers/nfc/pn533/pn533.c @@ -185,6 +185,32 @@ struct pn533_cmd_jump_dep_response { u8 gt[]; } __packed; +struct pn532_autopoll_resp { + u8 type; + u8 ln; + u8 tg; + u8 tgdata[]; +}; + +/* PN532_CMD_IN_AUTOPOLL */ +#define PN532_AUTOPOLL_POLLNR_INFINITE 0xff +#define PN532_AUTOPOLL_PERIOD 0x03 /* in units of 150 ms */ + +#define PN532_AUTOPOLL_TYPE_GENERIC_106 0x00 +#define PN532_AUTOPOLL_TYPE_GENERIC_212 0x01 +#define PN532_AUTOPOLL_TYPE_GENERIC_424 0x02 +#define PN532_AUTOPOLL_TYPE_JEWEL 0x04 +#define PN532_AUTOPOLL_TYPE_MIFARE 0x10 +#define PN532_AUTOPOLL_TYPE_FELICA212 0x11 +#define PN532_AUTOPOLL_TYPE_FELICA424 0x12 +#define PN532_AUTOPOLL_TYPE_ISOA 0x20 +#define PN532_AUTOPOLL_TYPE_ISOB 0x23 +#define PN532_AUTOPOLL_TYPE_DEP_PASSIVE_106 0x40 +#define PN532_AUTOPOLL_TYPE_DEP_PASSIVE_212 0x41 +#define PN532_AUTOPOLL_TYPE_DEP_PASSIVE_424 0x42 +#define PN532_AUTOPOLL_TYPE_DEP_ACTIVE_106 0x80 +#define PN532_AUTOPOLL_TYPE_DEP_ACTIVE_212 0x81 +#define PN532_AUTOPOLL_TYPE_DEP_ACTIVE_424 0x82 /* PN533_TG_INIT_AS_TARGET */ #define PN533_INIT_TARGET_PASSIVE 0x1 @@ -1394,6 +1420,101 @@ static int pn533_poll_dep(struct nfc_dev *nfc_dev) return rc; } +static int pn533_autopoll_complete(struct pn533 *dev, void *arg, + struct sk_buff *resp) +{ + struct pn532_autopoll_resp *apr; + struct nfc_target nfc_tgt; + u8 nbtg; + int rc; + + if (IS_ERR(resp)) { + rc = PTR_ERR(resp); + + nfc_err(dev->dev, "%s autopoll complete error %d\n", + __func__, rc); + + if (rc == -ENOENT) { + if (dev->poll_mod_count != 0) + return rc; + goto stop_poll; + } else if (rc < 0) { + nfc_err(dev->dev, + "Error %d when running autopoll\n", rc); + goto stop_poll; + } + } + + nbtg = resp->data[0]; + if ((nbtg > 2) || (nbtg <= 0)) + return -EAGAIN; + + apr = (struct pn532_autopoll_resp *)&resp->data[1]; + while (nbtg--) { + memset(&nfc_tgt, 0, sizeof(struct nfc_target)); + switch (apr->type) { + case PN532_AUTOPOLL_TYPE_ISOA: + dev_dbg(dev->dev, "ISOA\n"); + rc = pn533_target_found_type_a(&nfc_tgt, apr->tgdata, + apr->ln - 1); + break; + case PN532_AUTOPOLL_TYPE_FELICA212: + case PN532_AUTOPOLL_TYPE_FELICA424: + dev_dbg(dev->dev, "FELICA\n"); + rc = pn533_target_found_felica(&nfc_tgt, apr->tgdata, + apr->ln - 1); + break; + case PN532_AUTOPOLL_TYPE_JEWEL: + dev_dbg(dev->dev, "JEWEL\n"); + rc = pn533_target_found_jewel(&nfc_tgt, apr->tgdata, + apr->ln - 1); + break; + case PN532_AUTOPOLL_TYPE_ISOB: + dev_dbg(dev->dev, "ISOB\n"); + rc = pn533_target_found_type_b(&nfc_tgt, apr->tgdata, + apr->ln - 1); + break; + case PN532_AUTOPOLL_TYPE_MIFARE: + dev_dbg(dev->dev, "Mifare\n"); + rc = pn533_target_found_type_a(&nfc_tgt, apr->tgdata, + apr->ln - 1); + break; + default: + nfc_err(dev->dev, + "Unknown current poll modulation\n"); + rc = -EPROTO; + } + + if (rc) + goto done; + + if (!(nfc_tgt.supported_protocols & dev->poll_protocols)) { + nfc_err(dev->dev, + "The Tg found doesn't have the desired protocol\n"); + rc = -EAGAIN; + goto done; + } + + dev->tgt_available_prots = nfc_tgt.supported_protocols; + apr = (struct pn532_autopoll_resp *) + (apr->tgdata + (apr->ln - 1)); + } + + pn533_poll_reset_mod_list(dev); + nfc_targets_found(dev->nfc_dev, &nfc_tgt, 1); + +done: + dev_kfree_skb(resp); + return rc; + +stop_poll: + nfc_err(dev->dev, "autopoll operation has been stopped\n"); + + pn533_poll_reset_mod_list(dev); + dev->poll_protocols = 0; + return rc; +} + static int pn533_poll_complete(struct pn533 *dev, void *arg, struct sk_buff *resp) { @@ -1537,6 +1658,7 @@ static int pn533_start_poll(struct nfc_dev *nfc_dev, { struct pn533 *dev = nfc_get_drvdata(nfc_dev); struct pn533_poll_modulations *cur_mod; + struct sk_buff *skb; u8 rand_mod; int rc; @@ -1562,9 +1684,78 @@ static int pn533_start_poll(struct nfc_dev *nfc_dev, tm_protocols = 0; } - pn533_poll_create_mod_list(dev, im_protocols, tm_protocols); dev->poll_protocols = im_protocols; dev->listen_protocols = tm_protocols; + if (dev->device_type == PN533_DEVICE_PN532_AUTOPOLL) { + skb = pn533_alloc_skb(dev, 4 + 6); + if (!skb) + return -ENOMEM; + + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_POLLNR_INFINITE; + *((u8 *)skb_put(skb, sizeof(u8))) = PN532_AUTOPOLL_PERIOD; + + if ((im_protocols & NFC_PROTO_MIFARE_MASK) && + (im_protocols & NFC_PROTO_ISO14443_MASK) && + (im_protocols & NFC_PROTO_NFC_DEP_MASK)) + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_TYPE_GENERIC_106; + else { + if (im_protocols & NFC_PROTO_MIFARE_MASK) + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_TYPE_MIFARE; + + if (im_protocols & NFC_PROTO_ISO14443_MASK) + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_TYPE_ISOA; + + if (im_protocols & NFC_PROTO_NFC_DEP_MASK) { + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_TYPE_DEP_PASSIVE_106; + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_TYPE_DEP_PASSIVE_212; + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_TYPE_DEP_PASSIVE_424; + } + } + + if (im_protocols & NFC_PROTO_FELICA_MASK || + im_protocols & NFC_PROTO_NFC_DEP_MASK) { + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_TYPE_FELICA212; + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_TYPE_FELICA424; + } + + if (im_protocols & NFC_PROTO_JEWEL_MASK) + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_TYPE_JEWEL; + + if (im_protocols & NFC_PROTO_ISO14443_B_MASK) + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_TYPE_ISOB; + + if (tm_protocols) + *((u8 *)skb_put(skb, sizeof(u8))) = + PN532_AUTOPOLL_TYPE_DEP_ACTIVE_106; + + rc = pn533_send_cmd_async(dev, PN533_CMD_IN_AUTOPOLL, skb, + pn533_autopoll_complete, NULL); + + if (rc < 0) + dev_kfree_skb(skb); + else + dev->poll_mod_count++; + + return rc; + } + + pn533_poll_create_mod_list(dev, im_protocols, tm_protocols); + if (!dev->poll_mod_count) { + nfc_err(dev->dev, + "Poll mod list is empty\n"); + return -EINVAL; + } /* Do not always start polling from the same modulation */ get_random_bytes(&rand_mod, sizeof(rand_mod)); @@ -2465,7 +2656,11 @@ static int pn533_dev_up(struct nfc_dev *nfc_dev) { struct pn533 *dev = nfc_get_drvdata(nfc_dev); - if (dev->device_type == PN533_DEVICE_PN532) { + if (dev->phy_ops->dev_up) + dev->phy_ops->dev_up(dev); + + if ((dev->device_type == PN533_DEVICE_PN532) || + (dev->device_type == PN533_DEVICE_PN532_AUTOPOLL)) { int rc = pn532_sam_configuration(nfc_dev); if (rc) @@ -2477,7 +2672,14 @@ static int pn533_dev_up(struct nfc_dev *nfc_dev) static int pn533_dev_down(struct nfc_dev *nfc_dev) { - return pn533_rf_field(nfc_dev, 0); + struct pn533 *dev = nfc_get_drvdata(nfc_dev); + int ret; + + ret = pn533_rf_field(nfc_dev, 0); + if (dev->phy_ops->dev_down && !ret) + dev->phy_ops->dev_down(dev); + + return ret; } static struct nfc_ops pn533_nfc_ops = { @@ -2505,6 +2707,7 @@ static int pn533_setup(struct pn533 *dev) case PN533_DEVICE_PASORI: case PN533_DEVICE_ACR122U: case PN533_DEVICE_PN532: + case PN533_DEVICE_PN532_AUTOPOLL: max_retries.mx_rty_atr = 0x2; max_retries.mx_rty_psl = 0x1; max_retries.mx_rty_passive_act = @@ -2541,6 +2744,7 @@ static int pn533_setup(struct pn533 *dev) switch (dev->device_type) { case PN533_DEVICE_STD: case PN533_DEVICE_PN532: + case PN533_DEVICE_PN532_AUTOPOLL: break; case PN533_DEVICE_PASORI: diff --git a/drivers/nfc/pn533/pn533.h b/drivers/nfc/pn533/pn533.h index 8bf9d6ece0f5..f9256e5485ac 100644 --- a/drivers/nfc/pn533/pn533.h +++ b/drivers/nfc/pn533/pn533.h @@ -6,10 +6,11 @@ * Copyright (C) 2012-2013 Tieto Poland */ -#define PN533_DEVICE_STD 0x1 -#define PN533_DEVICE_PASORI 0x2 -#define PN533_DEVICE_ACR122U 0x3 -#define PN533_DEVICE_PN532 0x4 +#define PN533_DEVICE_STD 0x1 +#define PN533_DEVICE_PASORI 0x2 +#define PN533_DEVICE_ACR122U 0x3 +#define PN533_DEVICE_PN532 0x4 +#define PN533_DEVICE_PN532_AUTOPOLL 0x5 #define PN533_ALL_PROTOCOLS (NFC_PROTO_JEWEL_MASK | NFC_PROTO_MIFARE_MASK |\ NFC_PROTO_FELICA_MASK | NFC_PROTO_ISO14443_MASK |\ @@ -70,6 +71,7 @@ #define PN533_CMD_IN_ATR 0x50 #define PN533_CMD_IN_RELEASE 0x52 #define PN533_CMD_IN_JUMP_FOR_DEP 0x56 +#define PN533_CMD_IN_AUTOPOLL 0x60 #define PN533_CMD_TG_INIT_AS_TARGET 0x8c #define PN533_CMD_TG_GET_DATA 0x86 @@ -207,6 +209,15 @@ struct pn533_phy_ops { struct sk_buff *out); int (*send_ack)(struct pn533 *dev, gfp_t flags); void (*abort_cmd)(struct pn533 *priv, gfp_t flags); + /* + * dev_up and dev_down are optional. + * They are used to inform the phy layer that the nfc chip + * is going to be really used very soon. The phy layer can then + * bring up it's interface to the chip and have it suspended for power + * saving reasons otherwise. + */ + void (*dev_up)(struct pn533 *priv); + void (*dev_down)(struct pn533 *priv); }; diff --git a/drivers/nvme/host/core.c b/drivers/nvme/host/core.c index 9144ed14b074..0676637e1eab 100644 --- a/drivers/nvme/host/core.c +++ b/drivers/nvme/host/core.c @@ -1080,8 +1080,10 @@ static int nvme_identify_ctrl(struct nvme_ctrl *dev, struct nvme_id_ctrl **id) error = nvme_submit_sync_cmd(dev->admin_q, &c, *id, sizeof(struct nvme_id_ctrl)); - if (error) + if (error) { kfree(*id); + *id = NULL; + } return error; } @@ -1193,6 +1195,7 @@ static int nvme_identify_ns(struct nvme_ctrl *ctrl, if (error) { dev_warn(ctrl->device, "Identify namespace failed (%d)\n", error); kfree(*id); + *id = NULL; } return error; diff --git a/drivers/nvme/host/pci.c b/drivers/nvme/host/pci.c index 486e44d20b43..20f5616fd518 100644 --- a/drivers/nvme/host/pci.c +++ b/drivers/nvme/host/pci.c @@ -938,7 +938,8 @@ static blk_status_t nvme_queue_rq(struct blk_mq_hw_ctx *hctx, nvme_submit_cmd(nvmeq, &cmnd, bd->last); return BLK_STS_OK; out_unmap_data: - nvme_unmap_data(dev, req); + if (blk_rq_nr_phys_segments(req)) + nvme_unmap_data(dev, req); out_free_cmd: nvme_cleanup_cmd(req); return ret; @@ -2821,6 +2822,13 @@ static unsigned long check_vendor_combination_bug(struct pci_dev *pdev) return NVME_QUIRK_SIMPLE_SUSPEND; } + /* + * NVMe SSD drops off the PCIe bus after system idle + * for 10 hours on a Lenovo N60z board. + */ + if (dmi_match(DMI_BOARD_NAME, "LXKT-ZXEG-N6")) + return NVME_QUIRK_NO_APST; + return 0; } diff --git a/drivers/nvme/target/rdma.c b/drivers/nvme/target/rdma.c index 50e2007092bc..ae41b6001c7e 100644 --- a/drivers/nvme/target/rdma.c +++ b/drivers/nvme/target/rdma.c @@ -428,12 +428,8 @@ nvmet_rdma_alloc_rsps(struct nvmet_rdma_queue *queue) return 0; out_free: - while (--i >= 0) { - struct nvmet_rdma_rsp *rsp = &queue->rsps[i]; - - list_del(&rsp->free_list); - nvmet_rdma_free_rsp(ndev, rsp); - } + while (--i >= 0) + nvmet_rdma_free_rsp(ndev, &queue->rsps[i]); kfree(queue->rsps); out: return ret; @@ -444,12 +440,8 @@ static void nvmet_rdma_free_rsps(struct nvmet_rdma_queue *queue) struct nvmet_rdma_device *ndev = queue->dev; int i, nr_rsps = queue->recv_queue_size * 2; - for (i = 0; i < nr_rsps; i++) { - struct nvmet_rdma_rsp *rsp = &queue->rsps[i]; - - list_del(&rsp->free_list); - nvmet_rdma_free_rsp(ndev, rsp); - } + for (i = 0; i < nr_rsps; i++) + nvmet_rdma_free_rsp(ndev, &queue->rsps[i]); kfree(queue->rsps); } diff --git a/drivers/nvme/target/tcp.c b/drivers/nvme/target/tcp.c index d40bd57537ba..fa6e7fbf356e 100644 --- a/drivers/nvme/target/tcp.c +++ b/drivers/nvme/target/tcp.c @@ -792,6 +792,7 @@ static int nvmet_tcp_handle_icreq(struct nvmet_tcp_queue *queue) pr_err("bad nvme-tcp pdu length (%d)\n", le32_to_cpu(icreq->hdr.plen)); nvmet_tcp_fatal_error(queue); + return -EPROTO; } if (icreq->pfv != NVME_TCP_PFV_1_0) { diff --git a/drivers/nvme/target/trace.c b/drivers/nvme/target/trace.c index 1373a3c67962..a3564e12927b 100644 --- a/drivers/nvme/target/trace.c +++ b/drivers/nvme/target/trace.c @@ -195,7 +195,7 @@ const char *nvmet_trace_disk_name(struct trace_seq *p, char *name) return ret; } -const char *nvmet_trace_ctrl_name(struct trace_seq *p, struct nvmet_ctrl *ctrl) +const char *nvmet_trace_ctrl_id(struct trace_seq *p, u16 ctrl_id) { const char *ret = trace_seq_buffer_ptr(p); @@ -208,8 +208,8 @@ const char *nvmet_trace_ctrl_name(struct trace_seq *p, struct nvmet_ctrl *ctrl) * If we can know the extra data of the connect command in this stage, * we can update this print statement later. */ - if (ctrl) - trace_seq_printf(p, "%d", ctrl->cntlid); + if (ctrl_id) + trace_seq_printf(p, "%d", ctrl_id); else trace_seq_printf(p, "_"); trace_seq_putc(p, 0); diff --git a/drivers/nvme/target/trace.h b/drivers/nvme/target/trace.h index 3f61b6657175..5b00a338d52c 100644 --- a/drivers/nvme/target/trace.h +++ b/drivers/nvme/target/trace.h @@ -32,18 +32,24 @@ const char *nvmet_trace_parse_fabrics_cmd(struct trace_seq *p, u8 fctype, nvmet_trace_parse_nvm_cmd(p, opcode, cdw10) : \ nvmet_trace_parse_admin_cmd(p, opcode, cdw10))) -const char *nvmet_trace_ctrl_name(struct trace_seq *p, struct nvmet_ctrl *ctrl); -#define __print_ctrl_name(ctrl) \ - nvmet_trace_ctrl_name(p, ctrl) +const char *nvmet_trace_ctrl_id(struct trace_seq *p, u16 ctrl_id); +#define __print_ctrl_id(ctrl_id) \ + nvmet_trace_ctrl_id(p, ctrl_id) const char *nvmet_trace_disk_name(struct trace_seq *p, char *name); #define __print_disk_name(name) \ nvmet_trace_disk_name(p, name) #ifndef TRACE_HEADER_MULTI_READ -static inline struct nvmet_ctrl *nvmet_req_to_ctrl(struct nvmet_req *req) +static inline u16 nvmet_req_to_ctrl_id(struct nvmet_req *req) { - return req->sq->ctrl; + /* + * The queue and controller pointers are not valid until an association + * has been established. + */ + if (!req->sq || !req->sq->ctrl) + return 0; + return req->sq->ctrl->cntlid; } static inline void __assign_req_name(char *name, struct nvmet_req *req) @@ -60,7 +66,7 @@ TRACE_EVENT(nvmet_req_init, TP_ARGS(req, cmd), TP_STRUCT__entry( __field(struct nvme_command *, cmd) - __field(struct nvmet_ctrl *, ctrl) + __field(u16, ctrl_id) __array(char, disk, DISK_NAME_LEN) __field(int, qid) __field(u16, cid) @@ -73,7 +79,7 @@ TRACE_EVENT(nvmet_req_init, ), TP_fast_assign( __entry->cmd = cmd; - __entry->ctrl = nvmet_req_to_ctrl(req); + __entry->ctrl_id = nvmet_req_to_ctrl_id(req); __assign_req_name(__entry->disk, req); __entry->qid = req->sq->qid; __entry->cid = cmd->common.command_id; @@ -87,7 +93,7 @@ TRACE_EVENT(nvmet_req_init, ), TP_printk("nvmet%s: %sqid=%d, cmdid=%u, nsid=%u, flags=%#x, " "meta=%#llx, cmd=(%s, %s)", - __print_ctrl_name(__entry->ctrl), + __print_ctrl_id(__entry->ctrl_id), __print_disk_name(__entry->disk), __entry->qid, __entry->cid, __entry->nsid, __entry->flags, __entry->metadata, @@ -101,7 +107,7 @@ TRACE_EVENT(nvmet_req_complete, TP_PROTO(struct nvmet_req *req), TP_ARGS(req), TP_STRUCT__entry( - __field(struct nvmet_ctrl *, ctrl) + __field(u16, ctrl_id) __array(char, disk, DISK_NAME_LEN) __field(int, qid) __field(int, cid) @@ -109,7 +115,7 @@ TRACE_EVENT(nvmet_req_complete, __field(u16, status) ), TP_fast_assign( - __entry->ctrl = nvmet_req_to_ctrl(req); + __entry->ctrl_id = nvmet_req_to_ctrl_id(req); __entry->qid = req->cq->qid; __entry->cid = req->cqe->command_id; __entry->result = le64_to_cpu(req->cqe->result.u64); @@ -117,7 +123,7 @@ TRACE_EVENT(nvmet_req_complete, __assign_req_name(__entry->disk, req); ), TP_printk("nvmet%s: %sqid=%d, cmdid=%u, res=%#llx, status=%#x", - __print_ctrl_name(__entry->ctrl), + __print_ctrl_id(__entry->ctrl_id), __print_disk_name(__entry->disk), __entry->qid, __entry->cid, __entry->result, __entry->status) diff --git a/drivers/parport/daisy.c b/drivers/parport/daisy.c index 5484a46dafda..465acebd6438 100644 --- a/drivers/parport/daisy.c +++ b/drivers/parport/daisy.c @@ -109,8 +109,7 @@ again: ((num_ports = num_mux_ports(port)) == 2 || num_ports == 4)) { /* Leave original as port zero. */ port->muxport = 0; - printk(KERN_INFO - "%s: 1st (default) port of %d-way multiplexor\n", + pr_info("%s: 1st (default) port of %d-way multiplexor\n", port->name, num_ports); for (i = 1; i < num_ports; i++) { /* Clone the port. */ @@ -123,8 +122,7 @@ again: continue; } - printk(KERN_INFO - "%s: %d%s port of %d-way multiplexor on %s\n", + pr_info("%s: %d%s port of %d-way multiplexor on %s\n", extra->name, i + 1, th[i + 1], num_ports, port->name); diff --git a/drivers/parport/ieee1284.c b/drivers/parport/ieee1284.c index 90fb73575495..5c0c9613e03b 100644 --- a/drivers/parport/ieee1284.c +++ b/drivers/parport/ieee1284.c @@ -329,7 +329,7 @@ int parport_negotiate (struct parport *port, int mode) #ifndef CONFIG_PARPORT_1284 if (mode == IEEE1284_MODE_COMPAT) return 0; - printk (KERN_ERR "parport: IEEE1284 not supported in this kernel\n"); + pr_err("parport: IEEE1284 not supported in this kernel\n"); return -1; #else int m = mode & ~IEEE1284_ADDR; @@ -694,7 +694,7 @@ ssize_t parport_write (struct parport *port, const void *buffer, size_t len) ssize_t parport_read (struct parport *port, void *buffer, size_t len) { #ifndef CONFIG_PARPORT_1284 - printk (KERN_ERR "parport: IEEE1284 not supported in this kernel\n"); + pr_err("parport: IEEE1284 not supported in this kernel\n"); return -ENODEV; #else int mode = port->physport->ieee1284.mode; diff --git a/drivers/parport/ieee1284_ops.c b/drivers/parport/ieee1284_ops.c index 75daa16f38b7..58ec484c7305 100644 --- a/drivers/parport/ieee1284_ops.c +++ b/drivers/parport/ieee1284_ops.c @@ -599,8 +599,7 @@ size_t parport_ieee1284_ecp_read_data (struct parport *port, DPRINTK (KERN_DEBUG "ECP read timed out at 45\n"); if (command) - printk (KERN_WARNING - "%s: command ignored (%02x)\n", + pr_warn("%s: command ignored (%02x)\n", port->name, byte); break; diff --git a/drivers/parport/parport_amiga.c b/drivers/parport/parport_amiga.c index 3301861f69fa..8c7a598abcff 100644 --- a/drivers/parport/parport_amiga.c +++ b/drivers/parport/parport_amiga.c @@ -212,7 +212,7 @@ static int __init amiga_parallel_probe(struct platform_device *pdev) if (err) goto out_irq; - printk(KERN_INFO "%s: Amiga built-in port using irq\n", p->name); + pr_info("%s: Amiga built-in port using irq\n", p->name); /* XXX: set operating mode */ parport_announce_port(p); diff --git a/drivers/parport/parport_atari.c b/drivers/parport/parport_atari.c index f8dd368bfdbb..2ff0fe053e6e 100644 --- a/drivers/parport/parport_atari.c +++ b/drivers/parport/parport_atari.c @@ -200,7 +200,7 @@ static int __init parport_atari_init(void) } this_port = p; - printk(KERN_INFO "%s: Atari built-in port using irq\n", p->name); + pr_info("%s: Atari built-in port using irq\n", p->name); parport_announce_port (p); return 0; diff --git a/drivers/parport/parport_cs.c b/drivers/parport/parport_cs.c index e77044c2bf62..8e7e3ac4bb87 100644 --- a/drivers/parport/parport_cs.c +++ b/drivers/parport/parport_cs.c @@ -142,10 +142,8 @@ static int parport_config(struct pcmcia_device *link) link->irq, PARPORT_DMA_NONE, &link->dev, IRQF_SHARED); if (p == NULL) { - printk(KERN_NOTICE "parport_cs: parport_pc_probe_port() at " - "0x%3x, irq %u failed\n", - (unsigned int) link->resource[0]->start, - link->irq); + pr_notice("parport_cs: parport_pc_probe_port() at 0x%3x, irq %u failed\n", + (unsigned int)link->resource[0]->start, link->irq); goto failed; } diff --git a/drivers/parport/parport_gsc.c b/drivers/parport/parport_gsc.c index 922535a118ba..54963f5033fa 100644 --- a/drivers/parport/parport_gsc.c +++ b/drivers/parport/parport_gsc.c @@ -282,7 +282,7 @@ struct parport *parport_gsc_probe_port(unsigned long base, p->size = (p->modes & PARPORT_MODE_EPP)?8:3; p->private_data = priv; - printk(KERN_INFO "%s: PC-style at 0x%lx", p->name, p->base); + pr_info("%s: PC-style at 0x%lx", p->name, p->base); p->irq = irq; if (p->irq == PARPORT_IRQ_AUTO) { p->irq = PARPORT_IRQ_NONE; @@ -299,12 +299,16 @@ struct parport *parport_gsc_probe_port(unsigned long base, p->dma = PARPORT_DMA_NONE; pr_cont(" ["); -#define printmode(x) {if(p->modes&PARPORT_MODE_##x){pr_cont("%s%s",f?",":"",#x);f++;}} +#define printmode(x) \ +do { \ + if (p->modes & PARPORT_MODE_##x) \ + pr_cont("%s%s", f++ ? "," : "", #x); \ +} while (0) { int f = 0; printmode(PCSPP); printmode(TRISTATE); - printmode(COMPAT) + printmode(COMPAT); printmode(EPP); // printmode(ECP); // printmode(DMA); @@ -315,8 +319,7 @@ struct parport *parport_gsc_probe_port(unsigned long base, if (p->irq != PARPORT_IRQ_NONE) { if (request_irq (p->irq, parport_irq_handler, 0, p->name, p)) { - printk (KERN_WARNING "%s: irq %d in use, " - "resorting to polled operation\n", + pr_warn("%s: irq %d in use, resorting to polled operation\n", p->name, p->irq); p->irq = PARPORT_IRQ_NONE; p->dma = PARPORT_DMA_NONE; @@ -347,7 +350,7 @@ static int __init parport_init_chip(struct parisc_device *dev) unsigned long port; if (!dev->irq) { - printk(KERN_WARNING "IRQ not found for parallel device at 0x%llx\n", + pr_warn("IRQ not found for parallel device at 0x%llx\n", (unsigned long long)dev->hpa.start); return -ENODEV; } diff --git a/drivers/parport/parport_ip32.c b/drivers/parport/parport_ip32.c index ab215b650f41..4f76e4f4f6cf 100644 --- a/drivers/parport/parport_ip32.c +++ b/drivers/parport/parport_ip32.c @@ -1337,9 +1337,8 @@ static unsigned int parport_ip32_fwp_wait_interrupt(struct parport *p) ecr = parport_ip32_read_econtrol(p); if ((ecr & ECR_F_EMPTY) && !(ecr & ECR_SERVINTR) && !lost_interrupt) { - printk(KERN_WARNING PPIP32 - "%s: lost interrupt in %s\n", - p->name, __func__); + pr_warn(PPIP32 "%s: lost interrupt in %s\n", + p->name, __func__); lost_interrupt = 1; } } @@ -1643,8 +1642,8 @@ static size_t parport_ip32_compat_write_data(struct parport *p, DSR_nBUSY | DSR_nFAULT)) { /* Avoid to flood the logs */ if (ready_before) - printk(KERN_INFO PPIP32 "%s: not ready in %s\n", - p->name, __func__); + pr_info(PPIP32 "%s: not ready in %s\n", + p->name, __func__); ready_before = 0; goto stop; } @@ -1724,8 +1723,8 @@ static size_t parport_ip32_ecp_write_data(struct parport *p, DSR_nBUSY | DSR_nFAULT)) { /* Avoid to flood the logs */ if (ready_before) - printk(KERN_INFO PPIP32 "%s: not ready in %s\n", - p->name, __func__); + pr_info(PPIP32 "%s: not ready in %s\n", + p->name, __func__); ready_before = 0; goto stop; } @@ -2064,8 +2063,7 @@ static __init struct parport *parport_ip32_probe_port(void) p->modes |= PARPORT_MODE_TRISTATE; if (!parport_ip32_fifo_supported(p)) { - printk(KERN_WARNING PPIP32 - "%s: error: FIFO disabled\n", p->name); + pr_warn(PPIP32 "%s: error: FIFO disabled\n", p->name); /* Disable hardware modes depending on a working FIFO. */ features &= ~PARPORT_IP32_ENABLE_SPP; features &= ~PARPORT_IP32_ENABLE_ECP; @@ -2077,8 +2075,7 @@ static __init struct parport *parport_ip32_probe_port(void) if (features & PARPORT_IP32_ENABLE_IRQ) { int irq = MACEISA_PARALLEL_IRQ; if (request_irq(irq, parport_ip32_interrupt, 0, p->name, p)) { - printk(KERN_WARNING PPIP32 - "%s: error: IRQ disabled\n", p->name); + pr_warn(PPIP32 "%s: error: IRQ disabled\n", p->name); /* DMA cannot work without interrupts. */ features &= ~PARPORT_IP32_ENABLE_DMA; } else { @@ -2091,8 +2088,7 @@ static __init struct parport *parport_ip32_probe_port(void) /* Allocate DMA resources */ if (features & PARPORT_IP32_ENABLE_DMA) { if (parport_ip32_dma_register()) - printk(KERN_WARNING PPIP32 - "%s: error: DMA disabled\n", p->name); + pr_warn(PPIP32 "%s: error: DMA disabled\n", p->name); else { pr_probe(p, "DMA support enabled\n"); p->dma = 0; /* arbitrary value != PARPORT_DMA_NONE */ @@ -2134,8 +2130,7 @@ static __init struct parport *parport_ip32_probe_port(void) parport_ip32_dump_state(p, "end init", 0); /* Print out what we found */ - printk(KERN_INFO "%s: SGI IP32 at 0x%lx (0x%lx)", - p->name, p->base, p->base_hi); + pr_info("%s: SGI IP32 at 0x%lx (0x%lx)", p->name, p->base, p->base_hi); if (p->irq != PARPORT_IRQ_NONE) printk(", irq %d", p->irq); printk(" ["); diff --git a/drivers/parport/parport_mfc3.c b/drivers/parport/parport_mfc3.c index 9f87faf939e3..3190ef0f3c81 100644 --- a/drivers/parport/parport_mfc3.c +++ b/drivers/parport/parport_mfc3.c @@ -325,7 +325,7 @@ static int __init parport_mfc3_init(void) p->dev = &z->dev; this_port[pias++] = p; - printk(KERN_INFO "%s: Multiface III port using irq\n", p->name); + pr_info("%s: Multiface III port using irq\n", p->name); /* XXX: set operating mode */ p->private_data = (void *)piabase; diff --git a/drivers/parport/parport_pc.c b/drivers/parport/parport_pc.c index 23aced808242..bf9fe2c02549 100644 --- a/drivers/parport/parport_pc.c +++ b/drivers/parport/parport_pc.c @@ -982,28 +982,24 @@ static void show_parconfig_smsc37c669(int io, int key) outb(0xaa, io); if (verbose_probing) { - printk(KERN_INFO - "SMSC 37c669 LPT Config: cr_1=0x%02x, 4=0x%02x, " - "A=0x%2x, 23=0x%02x, 26=0x%02x, 27=0x%02x\n", + pr_info("SMSC 37c669 LPT Config: cr_1=0x%02x, 4=0x%02x, A=0x%2x, 23=0x%02x, 26=0x%02x, 27=0x%02x\n", cr1, cr4, cra, cr23, cr26, cr27); /* The documentation calls DMA and IRQ-Lines by letters, so the board maker can/will wire them appropriately/randomly... G=reserved H=IDE-irq, */ - printk(KERN_INFO - "SMSC LPT Config: io=0x%04x, irq=%c, dma=%c, fifo threshold=%d\n", - cr23 * 4, - (cr27 & 0x0f) ? 'A' - 1 + (cr27 & 0x0f) : '-', - (cr26 & 0x0f) ? 'A' - 1 + (cr26 & 0x0f) : '-', - cra & 0x0f); - printk(KERN_INFO "SMSC LPT Config: enabled=%s power=%s\n", - (cr23 * 4 >= 0x100) ? "yes" : "no", - (cr1 & 4) ? "yes" : "no"); - printk(KERN_INFO - "SMSC LPT Config: Port mode=%s, EPP version =%s\n", - (cr1 & 0x08) ? "Standard mode only (SPP)" - : modes[cr4 & 0x03], - (cr4 & 0x40) ? "1.7" : "1.9"); + pr_info("SMSC LPT Config: io=0x%04x, irq=%c, dma=%c, fifo threshold=%d\n", + cr23 * 4, + (cr27 & 0x0f) ? 'A' - 1 + (cr27 & 0x0f) : '-', + (cr26 & 0x0f) ? 'A' - 1 + (cr26 & 0x0f) : '-', + cra & 0x0f); + pr_info("SMSC LPT Config: enabled=%s power=%s\n", + (cr23 * 4 >= 0x100) ? "yes" : "no", + (cr1 & 4) ? "yes" : "no"); + pr_info("SMSC LPT Config: Port mode=%s, EPP version =%s\n", + (cr1 & 0x08) ? "Standard mode only (SPP)" + : modes[cr4 & 0x03], + (cr4 & 0x40) ? "1.7" : "1.9"); } /* Heuristics ! BIOS setup for this mainboard device limits @@ -1013,7 +1009,7 @@ static void show_parconfig_smsc37c669(int io, int key) if (cr23 * 4 >= 0x100) { /* if active */ s = find_free_superio(); if (s == NULL) - printk(KERN_INFO "Super-IO: too many chips!\n"); + pr_info("Super-IO: too many chips!\n"); else { int d; switch (cr23 * 4) { @@ -1078,26 +1074,24 @@ static void show_parconfig_winbond(int io, int key) outb(0xaa, io); if (verbose_probing) { - printk(KERN_INFO - "Winbond LPT Config: cr_30=%02x 60,61=%02x%02x 70=%02x 74=%02x, f0=%02x\n", - cr30, cr60, cr61, cr70, cr74, crf0); - printk(KERN_INFO "Winbond LPT Config: active=%s, io=0x%02x%02x irq=%d, ", - (cr30 & 0x01) ? "yes" : "no", cr60, cr61, cr70 & 0x0f); + pr_info("Winbond LPT Config: cr_30=%02x 60,61=%02x%02x 70=%02x 74=%02x, f0=%02x\n", + cr30, cr60, cr61, cr70, cr74, crf0); + pr_info("Winbond LPT Config: active=%s, io=0x%02x%02x irq=%d, ", + (cr30 & 0x01) ? "yes" : "no", cr60, cr61, cr70 & 0x0f); if ((cr74 & 0x07) > 3) pr_cont("dma=none\n"); else pr_cont("dma=%d\n", cr74 & 0x07); - printk(KERN_INFO - "Winbond LPT Config: irqtype=%s, ECP fifo threshold=%d\n", - irqtypes[crf0>>7], (crf0>>3)&0x0f); - printk(KERN_INFO "Winbond LPT Config: Port mode=%s\n", - modes[crf0 & 0x07]); + pr_info("Winbond LPT Config: irqtype=%s, ECP fifo threshold=%d\n", + irqtypes[crf0 >> 7], (crf0 >> 3) & 0x0f); + pr_info("Winbond LPT Config: Port mode=%s\n", + modes[crf0 & 0x07]); } if (cr30 & 0x01) { /* the settings can be interrogated later ... */ s = find_free_superio(); if (s == NULL) - printk(KERN_INFO "Super-IO: too many chips!\n"); + pr_info("Super-IO: too many chips!\n"); else { s->io = (cr60 << 8) | cr61; s->irq = cr70 & 0x0f; @@ -1151,9 +1145,8 @@ static void decode_winbond(int efer, int key, int devid, int devrev, int oldid) progif = 0; if (verbose_probing) - printk(KERN_INFO "Winbond chip at EFER=0x%x key=0x%02x " - "devid=%02x devrev=%02x oldid=%02x type=%s\n", - efer, key, devid, devrev, oldid, type); + pr_info("Winbond chip at EFER=0x%x key=0x%02x devid=%02x devrev=%02x oldid=%02x type=%s\n", + efer, key, devid, devrev, oldid, type); if (progif == 2) show_parconfig_winbond(efer, key); @@ -1184,9 +1177,8 @@ static void decode_smsc(int efer, int key, int devid, int devrev) type = "37c666GT"; if (verbose_probing) - printk(KERN_INFO "SMSC chip at EFER=0x%x " - "key=0x%02x devid=%02x devrev=%02x type=%s\n", - efer, key, devid, devrev, type); + pr_info("SMSC chip at EFER=0x%x key=0x%02x devid=%02x devrev=%02x type=%s\n", + efer, key, devid, devrev, type); if (func) func(efer, key); @@ -1358,7 +1350,7 @@ static void detect_and_report_it87(void) dev |= inb(0x2f); if (dev == 0x8712 || dev == 0x8705 || dev == 0x8715 || dev == 0x8716 || dev == 0x8718 || dev == 0x8726) { - printk(KERN_INFO "IT%04X SuperIO detected.\n", dev); + pr_info("IT%04X SuperIO detected\n", dev); outb(0x07, 0x2E); /* Parallel Port */ outb(0x03, 0x2F); outb(0xF0, 0x2E); /* BOOT 0x80 off */ @@ -1445,8 +1437,8 @@ static int parport_SPP_supported(struct parport *pb) if (user_specified) /* That didn't work, but the user thinks there's a * port here. */ - printk(KERN_INFO "parport 0x%lx (WARNING): CTR: " - "wrote 0x%02x, read 0x%02x\n", pb->base, w, r); + pr_info("parport 0x%lx (WARNING): CTR: wrote 0x%02x, read 0x%02x\n", + pb->base, w, r); /* Try the data register. The data lines aren't tri-stated at * this stage, so we expect back what we wrote. */ @@ -1464,10 +1456,9 @@ static int parport_SPP_supported(struct parport *pb) if (user_specified) { /* Didn't work, but the user is convinced this is the * place. */ - printk(KERN_INFO "parport 0x%lx (WARNING): DATA: " - "wrote 0x%02x, read 0x%02x\n", pb->base, w, r); - printk(KERN_INFO "parport 0x%lx: You gave this address, " - "but there is probably no parallel port there!\n", + pr_info("parport 0x%lx (WARNING): DATA: wrote 0x%02x, read 0x%02x\n", + pb->base, w, r); + pr_info("parport 0x%lx: You gave this address, but there is probably no parallel port there!\n", pb->base); } @@ -1642,7 +1633,7 @@ static int parport_ECP_supported(struct parport *pb) if (i <= priv->fifo_depth) { if (verbose_probing) - printk(KERN_INFO "0x%lx: readIntrThreshold is %d\n", + pr_info("0x%lx: readIntrThreshold is %d\n", pb->base, i); } else /* Number of bytes we can read if we get an interrupt. */ @@ -1657,17 +1648,14 @@ static int parport_ECP_supported(struct parport *pb) switch (pword) { case 0: pword = 2; - printk(KERN_WARNING "0x%lx: Unsupported pword size!\n", - pb->base); + pr_warn("0x%lx: Unsupported pword size!\n", pb->base); break; case 2: pword = 4; - printk(KERN_WARNING "0x%lx: Unsupported pword size!\n", - pb->base); + pr_warn("0x%lx: Unsupported pword size!\n", pb->base); break; default: - printk(KERN_WARNING "0x%lx: Unknown implementation ID\n", - pb->base); + pr_warn("0x%lx: Unknown implementation ID\n", pb->base); /* Fall through - Assume 1 */ case 1: pword = 1; @@ -2107,9 +2095,9 @@ struct parport *parport_pc_probe_port(unsigned long int base, p->size = (p->modes & PARPORT_MODE_EPP) ? 8 : 3; - printk(KERN_INFO "%s: PC-style at 0x%lx", p->name, p->base); + pr_info("%s: PC-style at 0x%lx", p->name, p->base); if (p->base_hi && priv->ecr) - printk(KERN_CONT " (0x%lx)", p->base_hi); + pr_cont(" (0x%lx)", p->base_hi); if (p->irq == PARPORT_IRQ_AUTO) { p->irq = PARPORT_IRQ_NONE; parport_irq_probe(p); @@ -2120,7 +2108,7 @@ struct parport *parport_pc_probe_port(unsigned long int base, p->irq = PARPORT_IRQ_NONE; } if (p->irq != PARPORT_IRQ_NONE) { - printk(KERN_CONT ", irq %d", p->irq); + pr_cont(", irq %d", p->irq); priv->ctr_writable |= 0x10; if (p->dma == PARPORT_DMA_AUTO) { @@ -2144,41 +2132,39 @@ struct parport *parport_pc_probe_port(unsigned long int base, /* p->ops->ecp_read_data = parport_pc_ecp_read_block_pio; */ #endif /* IEEE 1284 support */ if (p->dma != PARPORT_DMA_NONE) { - printk(KERN_CONT ", dma %d", p->dma); + pr_cont(", dma %d", p->dma); p->modes |= PARPORT_MODE_DMA; } else - printk(KERN_CONT ", using FIFO"); + pr_cont(", using FIFO"); } else /* We can't use the DMA channel after all. */ p->dma = PARPORT_DMA_NONE; #endif /* Allowed to use FIFO/DMA */ - printk(KERN_CONT " ["); + pr_cont(" ["); -#define printmode(x) \ - {\ - if (p->modes & PARPORT_MODE_##x) {\ - printk(KERN_CONT "%s%s", f ? "," : "", #x);\ - f++;\ - } \ - } +#define printmode(x) \ +do { \ + if (p->modes & PARPORT_MODE_##x) \ + pr_cont("%s%s", f++ ? "," : "", #x); \ +} while (0) { int f = 0; printmode(PCSPP); printmode(TRISTATE); - printmode(COMPAT) + printmode(COMPAT); printmode(EPP); printmode(ECP); printmode(DMA); } #undef printmode #ifndef CONFIG_PARPORT_1284 - printk(KERN_CONT "(,...)"); + pr_cont("(,...)"); #endif /* CONFIG_PARPORT_1284 */ - printk(KERN_CONT "]\n"); + pr_cont("]\n"); if (probedirq != PARPORT_IRQ_NONE) - printk(KERN_INFO "%s: irq %d detected\n", p->name, probedirq); + pr_info("%s: irq %d detected\n", p->name, probedirq); /* If No ECP release the ports grabbed above. */ if (ECR_res && (p->modes & PARPORT_MODE_ECP) == 0) { @@ -2193,8 +2179,7 @@ struct parport *parport_pc_probe_port(unsigned long int base, if (p->irq != PARPORT_IRQ_NONE) { if (request_irq(p->irq, parport_irq_handler, irqflags, p->name, p)) { - printk(KERN_WARNING "%s: irq %d in use, " - "resorting to polled operation\n", + pr_warn("%s: irq %d in use, resorting to polled operation\n", p->name, p->irq); p->irq = PARPORT_IRQ_NONE; p->dma = PARPORT_DMA_NONE; @@ -2204,8 +2189,7 @@ struct parport *parport_pc_probe_port(unsigned long int base, #ifdef HAS_DMA if (p->dma != PARPORT_DMA_NONE) { if (request_dma(p->dma, p->name)) { - printk(KERN_WARNING "%s: dma %d in use, " - "resorting to PIO operation\n", + pr_warn("%s: dma %d in use, resorting to PIO operation\n", p->name, p->dma); p->dma = PARPORT_DMA_NONE; } else { @@ -2215,9 +2199,7 @@ struct parport *parport_pc_probe_port(unsigned long int base, &priv->dma_handle, GFP_KERNEL); if (!priv->dma_buf) { - printk(KERN_WARNING "%s: " - "cannot get buffer for DMA, " - "resorting to PIO operation\n", + pr_warn("%s: cannot get buffer for DMA, resorting to PIO operation\n", p->name); free_dma(p->dma); p->dma = PARPORT_DMA_NONE; @@ -2330,7 +2312,7 @@ static int sio_ite_8872_probe(struct pci_dev *pdev, int autoirq, int autodma, } } if (i >= 5) { - printk(KERN_INFO "parport_pc: cannot find ITE8872 INTA\n"); + pr_info("parport_pc: cannot find ITE8872 INTA\n"); return 0; } @@ -2339,29 +2321,28 @@ static int sio_ite_8872_probe(struct pci_dev *pdev, int autoirq, int autodma, switch (type) { case 0x2: - printk(KERN_INFO "parport_pc: ITE8871 found (1P)\n"); + pr_info("parport_pc: ITE8871 found (1P)\n"); ite8872set = 0x64200000; break; case 0xa: - printk(KERN_INFO "parport_pc: ITE8875 found (1P)\n"); + pr_info("parport_pc: ITE8875 found (1P)\n"); ite8872set = 0x64200000; break; case 0xe: - printk(KERN_INFO "parport_pc: ITE8872 found (2S1P)\n"); + pr_info("parport_pc: ITE8872 found (2S1P)\n"); ite8872set = 0x64e00000; break; case 0x6: - printk(KERN_INFO "parport_pc: ITE8873 found (1S)\n"); + pr_info("parport_pc: ITE8873 found (1S)\n"); release_region(inta_addr[i], 32); return 0; case 0x8: - printk(KERN_INFO "parport_pc: ITE8874 found (2S)\n"); + pr_info("parport_pc: ITE8874 found (2S)\n"); release_region(inta_addr[i], 32); return 0; default: - printk(KERN_INFO "parport_pc: unknown ITE887x\n"); - printk(KERN_INFO "parport_pc: please mail 'lspci -nvv' " - "output to Rich.Liu@ite.com.tw\n"); + pr_info("parport_pc: unknown ITE887x\n"); + pr_info("parport_pc: please mail 'lspci -nvv' output to Rich.Liu@ite.com.tw\n"); release_region(inta_addr[i], 32); return 0; } @@ -2396,9 +2377,8 @@ static int sio_ite_8872_probe(struct pci_dev *pdev, int autoirq, int autodma, release_region(inta_addr[i], 32); if (parport_pc_probe_port(ite8872_lpt, ite8872_lpthi, irq, PARPORT_DMA_NONE, &pdev->dev, 0)) { - printk(KERN_INFO - "parport_pc: ITE 8872 parallel port: io=0x%X", - ite8872_lpt); + pr_info("parport_pc: ITE 8872 parallel port: io=0x%X", + ite8872_lpt); if (irq != PARPORT_IRQ_NONE) pr_cont(", irq=%d", irq); pr_cont("\n"); @@ -2525,7 +2505,7 @@ static int sio_via_probe(struct pci_dev *pdev, int autoirq, int autodma, pci_write_config_byte(pdev, via->via_pci_superio_config_reg, tmp); if (siofunc == VIA_FUNCTION_PARPORT_DISABLE) { - printk(KERN_INFO "parport_pc: VIA parallel port disabled in BIOS\n"); + pr_info("parport_pc: VIA parallel port disabled in BIOS\n"); return 0; } @@ -2558,9 +2538,8 @@ static int sio_via_probe(struct pci_dev *pdev, int autoirq, int autodma, case 0x278: port2 = 0x678; break; default: - printk(KERN_INFO - "parport_pc: Weird VIA parport base 0x%X, ignoring\n", - port1); + pr_info("parport_pc: Weird VIA parport base 0x%X, ignoring\n", + port1); return 0; } @@ -2579,8 +2558,7 @@ static int sio_via_probe(struct pci_dev *pdev, int autoirq, int autodma, /* finally, do the probe with values obtained */ if (parport_pc_probe_port(port1, port2, irq, dma, &pdev->dev, 0)) { - printk(KERN_INFO - "parport_pc: VIA parallel port: io=0x%X", port1); + pr_info("parport_pc: VIA parallel port: io=0x%X", port1); if (irq != PARPORT_IRQ_NONE) pr_cont(", irq=%d", irq); if (dma != PARPORT_DMA_NONE) @@ -2589,7 +2567,7 @@ static int sio_via_probe(struct pci_dev *pdev, int autoirq, int autodma, return 1; } - printk(KERN_WARNING "parport_pc: Strange, can't probe VIA parallel port: io=0x%X, irq=%d, dma=%d\n", + pr_warn("parport_pc: Strange, can't probe VIA parallel port: io=0x%X, irq=%d, dma=%d\n", port1, irq, dma); return 0; } @@ -3132,7 +3110,7 @@ static int __init parport_parse_param(const char *s, int *val, if (ep != s) *val = r; else { - printk(KERN_ERR "parport: bad specifier `%s'\n", s); + pr_err("parport: bad specifier `%s'\n", s); return -1; } } @@ -3222,10 +3200,7 @@ static int __init parse_parport_params(void) irqval[0] = val; break; default: - printk(KERN_WARNING - "parport_pc: irq specified " - "without base address. Use 'io=' " - "to specify one\n"); + pr_warn("parport_pc: irq specified without base address. Use 'io=' to specify one\n"); } if (dma[0] && !parport_parse_dma(dma[0], &val)) @@ -3235,10 +3210,7 @@ static int __init parse_parport_params(void) dmaval[0] = val; break; default: - printk(KERN_WARNING - "parport_pc: dma specified " - "without base address. Use 'io=' " - "to specify one\n"); + pr_warn("parport_pc: dma specified without base address. Use 'io=' to specify one\n"); } } return 0; @@ -3277,12 +3249,12 @@ static int __init parport_setup(char *str) val = simple_strtoul(str, &endptr, 0); if (endptr == str) { - printk(KERN_WARNING "parport=%s not understood\n", str); + pr_warn("parport=%s not understood\n", str); return 1; } if (parport_setup_ptr == PARPORT_PC_MAX_PORTS) { - printk(KERN_ERR "parport=%s ignored, too many ports\n", str); + pr_err("parport=%s ignored, too many ports\n", str); return 1; } diff --git a/drivers/parport/parport_sunbpp.c b/drivers/parport/parport_sunbpp.c index d5a669b60c27..e840c1b5ab90 100644 --- a/drivers/parport/parport_sunbpp.c +++ b/drivers/parport/parport_sunbpp.c @@ -314,7 +314,7 @@ static int bpp_probe(struct platform_device *op) value_tcr &= ~P_TCR_DIR; sbus_writeb(value_tcr, ®s->p_tcr); - printk(KERN_INFO "%s: sunbpp at 0x%lx\n", p->name, p->base); + pr_info("%s: sunbpp at 0x%lx\n", p->name, p->base); dev_set_drvdata(&op->dev, p); diff --git a/drivers/parport/probe.c b/drivers/parport/probe.c index e035174ba205..650206c71875 100644 --- a/drivers/parport/probe.c +++ b/drivers/parport/probe.c @@ -38,7 +38,7 @@ static void pretty_print(struct parport *port, int device) { struct parport_device_info *info = &port->probe_info[device + 1]; - printk(KERN_INFO "%s", port->name); + pr_info("%s", port->name); if (device >= 0) printk (" (addr %d)", device); @@ -58,7 +58,7 @@ static void parse_data(struct parport *port, int device, char *str) struct parport_device_info *info = &port->probe_info[device + 1]; if (!txt) { - printk(KERN_WARNING "%s probe: memory squeeze\n", port->name); + pr_warn("%s probe: memory squeeze\n", port->name); return; } strcpy(txt, str); @@ -98,7 +98,8 @@ static void parse_data(struct parport *port, int device, char *str) goto rock_on; } } - printk(KERN_WARNING "%s probe: warning, class '%s' not understood.\n", port->name, sep); + pr_warn("%s probe: warning, class '%s' not understood\n", + port->name, sep); info->class = PARPORT_CLASS_OTHER; } else if (!strcmp(p, "CMD") || !strcmp(p, "COMMAND SET")) { diff --git a/drivers/parport/procfs.c b/drivers/parport/procfs.c index 48804049d697..595e23e6859b 100644 --- a/drivers/parport/procfs.c +++ b/drivers/parport/procfs.c @@ -51,12 +51,12 @@ static int do_active_device(struct ctl_table *table, int write, for (dev = port->devices; dev ; dev = dev->next) { if(dev == port->cad) { - len += sprintf(buffer, "%s\n", dev->name); + len += snprintf(buffer, sizeof(buffer), "%s\n", dev->name); } } if(!len) { - len += sprintf(buffer, "%s\n", "none"); + len += snprintf(buffer, sizeof(buffer), "%s\n", "none"); } if (len > *lenp) @@ -87,19 +87,19 @@ static int do_autoprobe(struct ctl_table *table, int write, } if ((str = info->class_name) != NULL) - len += sprintf (buffer + len, "CLASS:%s;\n", str); + len += snprintf (buffer + len, sizeof(buffer) - len, "CLASS:%s;\n", str); if ((str = info->model) != NULL) - len += sprintf (buffer + len, "MODEL:%s;\n", str); + len += snprintf (buffer + len, sizeof(buffer) - len, "MODEL:%s;\n", str); if ((str = info->mfr) != NULL) - len += sprintf (buffer + len, "MANUFACTURER:%s;\n", str); + len += snprintf (buffer + len, sizeof(buffer) - len, "MANUFACTURER:%s;\n", str); if ((str = info->description) != NULL) - len += sprintf (buffer + len, "DESCRIPTION:%s;\n", str); + len += snprintf (buffer + len, sizeof(buffer) - len, "DESCRIPTION:%s;\n", str); if ((str = info->cmdset) != NULL) - len += sprintf (buffer + len, "COMMAND SET:%s;\n", str); + len += snprintf (buffer + len, sizeof(buffer) - len, "COMMAND SET:%s;\n", str); if (len > *lenp) len = *lenp; @@ -117,7 +117,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write, size_t *lenp, loff_t *ppos) { struct parport *port = (struct parport *)table->extra1; - char buffer[20]; + char buffer[64]; int len = 0; if (*ppos) { @@ -128,7 +128,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write, if (write) /* permissions prevent this anyway */ return -EACCES; - len += sprintf (buffer, "%lu\t%lu\n", port->base, port->base_hi); + len += snprintf (buffer, sizeof(buffer), "%lu\t%lu\n", port->base, port->base_hi); if (len > *lenp) len = *lenp; @@ -156,7 +156,7 @@ static int do_hardware_irq(struct ctl_table *table, int write, if (write) /* permissions prevent this anyway */ return -EACCES; - len += sprintf (buffer, "%d\n", port->irq); + len += snprintf (buffer, sizeof(buffer), "%d\n", port->irq); if (len > *lenp) len = *lenp; @@ -184,7 +184,7 @@ static int do_hardware_dma(struct ctl_table *table, int write, if (write) /* permissions prevent this anyway */ return -EACCES; - len += sprintf (buffer, "%d\n", port->dma); + len += snprintf (buffer, sizeof(buffer), "%d\n", port->dma); if (len > *lenp) len = *lenp; @@ -213,7 +213,11 @@ static int do_hardware_modes(struct ctl_table *table, int write, return -EACCES; { -#define printmode(x) {if(port->modes&PARPORT_MODE_##x){len+=sprintf(buffer+len,"%s%s",f?",":"",#x);f++;}} +#define printmode(x) \ +do { \ + if (port->modes & PARPORT_MODE_##x) \ + len += snprintf(buffer + len, sizeof(buffer) - len, "%s%s", f++ ? "," : "", #x); \ +} while (0) int f = 0; printmode(PCSPP); printmode(TRISTATE); diff --git a/drivers/parport/share.c b/drivers/parport/share.c index 15c81cffd2de..fc2930fb9bee 100644 --- a/drivers/parport/share.c +++ b/drivers/parport/share.c @@ -555,8 +555,8 @@ void parport_announce_port(struct parport *port) #endif if (!port->dev) - printk(KERN_WARNING "%s: fix this legacy no-device port driver!\n", - port->name); + pr_warn("%s: fix this legacy no-device port driver!\n", + port->name); parport_proc_register(port); mutex_lock(®istration_lock); @@ -728,7 +728,8 @@ parport_register_device(struct parport *port, const char *name, if (flags & PARPORT_DEV_LURK) { if (!pf || !kf) { - printk(KERN_INFO "%s: refused to register lurking device (%s) without callbacks\n", port->name, name); + pr_info("%s: refused to register lurking device (%s) without callbacks\n", + port->name, name); return NULL; } } @@ -997,7 +998,7 @@ void parport_unregister_device(struct pardevice *dev) #ifdef PARPORT_PARANOID if (!dev) { - printk(KERN_ERR "parport_unregister_device: passed NULL\n"); + pr_err("%s: passed NULL\n", __func__); return; } #endif @@ -1138,8 +1139,7 @@ int parport_claim(struct pardevice *dev) unsigned long flags; if (port->cad == dev) { - printk(KERN_INFO "%s: %s already owner\n", - dev->port->name,dev->name); + pr_info("%s: %s already owner\n", dev->port->name, dev->name); return 0; } @@ -1159,9 +1159,8 @@ int parport_claim(struct pardevice *dev) * I think we'll actually deadlock rather than * get here, but just in case.. */ - printk(KERN_WARNING - "%s: %s released port when preempted!\n", - port->name, oldcad->name); + pr_warn("%s: %s released port when preempted!\n", + port->name, oldcad->name); if (port->cad) goto blocked; } @@ -1321,8 +1320,8 @@ void parport_release(struct pardevice *dev) write_lock_irqsave(&port->cad_lock, flags); if (port->cad != dev) { write_unlock_irqrestore(&port->cad_lock, flags); - printk(KERN_WARNING "%s: %s tried to release parport when not owner\n", - port->name, dev->name); + pr_warn("%s: %s tried to release parport when not owner\n", + port->name, dev->name); return; } @@ -1362,7 +1361,8 @@ void parport_release(struct pardevice *dev) if (dev->port->cad) /* racy but no matter */ return; } else { - printk(KERN_ERR "%s: don't know how to wake %s\n", port->name, pd->name); + pr_err("%s: don't know how to wake %s\n", + port->name, pd->name); } } diff --git a/drivers/pci/controller/pci-hyperv.c b/drivers/pci/controller/pci-hyperv.c index f66f07b8eebd..2c502a727f7e 100644 --- a/drivers/pci/controller/pci-hyperv.c +++ b/drivers/pci/controller/pci-hyperv.c @@ -682,8 +682,8 @@ static void _hv_pcifront_read_config(struct hv_pci_dev *hpdev, int where, PCI_CAPABILITY_LIST) { /* ROM BARs are unimplemented */ *val = 0; - } else if (where >= PCI_INTERRUPT_LINE && where + size <= - PCI_INTERRUPT_PIN) { + } else if ((where >= PCI_INTERRUPT_LINE && where + size <= PCI_INTERRUPT_PIN) || + (where >= PCI_INTERRUPT_PIN && where + size <= PCI_MIN_GNT)) { /* * Interrupt Line and Interrupt PIN are hard-wired to zero * because this front-end only supports message-signaled diff --git a/drivers/pci/controller/pcie-rockchip.c b/drivers/pci/controller/pcie-rockchip.c index b047437605cb..6ab7ca0b9bf9 100644 --- a/drivers/pci/controller/pcie-rockchip.c +++ b/drivers/pci/controller/pcie-rockchip.c @@ -84,7 +84,7 @@ int rockchip_pcie_parse_dt(struct rockchip_pcie *rockchip) } rockchip->mgmt_sticky_rst = devm_reset_control_get_exclusive(dev, - "mgmt-sticky"); + "mgmt-sticky"); if (IS_ERR(rockchip->mgmt_sticky_rst)) { if (PTR_ERR(rockchip->mgmt_sticky_rst) != -EPROBE_DEFER) dev_err(dev, "missing mgmt-sticky reset property in node\n"); @@ -120,11 +120,11 @@ int rockchip_pcie_parse_dt(struct rockchip_pcie *rockchip) } if (rockchip->is_rc) { - rockchip->ep_gpio = devm_gpiod_get(dev, "ep", GPIOD_OUT_HIGH); - if (IS_ERR(rockchip->ep_gpio)) { - dev_err(dev, "missing ep-gpios property in node\n"); - return PTR_ERR(rockchip->ep_gpio); - } + rockchip->ep_gpio = devm_gpiod_get_optional(dev, "ep", + GPIOD_OUT_LOW); + if (IS_ERR(rockchip->ep_gpio)) + return dev_err_probe(dev, PTR_ERR(rockchip->ep_gpio), + "failed to get ep GPIO\n"); } rockchip->aclk_pcie = devm_clk_get(dev, "aclk"); diff --git a/drivers/pci/setup-bus.c b/drivers/pci/setup-bus.c index 44f4866d95d8..32e34ade736c 100644 --- a/drivers/pci/setup-bus.c +++ b/drivers/pci/setup-bus.c @@ -818,11 +818,9 @@ static resource_size_t calculate_memsize(resource_size_t size, size = min_size; if (old_size == 1) old_size = 0; - if (size < old_size) - size = old_size; - size = ALIGN(max(size, add_size) + children_add_size, align); - return size; + size = max(size, add_size) + children_add_size; + return ALIGN(max(size, old_size), align); } resource_size_t __weak pcibios_window_alignment(struct pci_bus *bus, diff --git a/drivers/pinctrl/core.c b/drivers/pinctrl/core.c index 3d9e4a8e1bbb..7bf1bc842965 100644 --- a/drivers/pinctrl/core.c +++ b/drivers/pinctrl/core.c @@ -2018,6 +2018,14 @@ out_err: return ERR_PTR(ret); } +static void pinctrl_uninit_controller(struct pinctrl_dev *pctldev, struct pinctrl_desc *pctldesc) +{ + pinctrl_free_pindescs(pctldev, pctldesc->pins, + pctldesc->npins); + mutex_destroy(&pctldev->mutex); + kfree(pctldev); +} + static int pinctrl_claim_hogs(struct pinctrl_dev *pctldev) { pctldev->p = create_pinctrl(pctldev->dev, pctldev); @@ -2098,8 +2106,10 @@ struct pinctrl_dev *pinctrl_register(struct pinctrl_desc *pctldesc, return pctldev; error = pinctrl_enable(pctldev); - if (error) + if (error) { + pinctrl_uninit_controller(pctldev, pctldesc); return ERR_PTR(error); + } return pctldev; diff --git a/drivers/pinctrl/freescale/pinctrl-mxs.c b/drivers/pinctrl/freescale/pinctrl-mxs.c index 735cedd0958a..5b0fcf15f280 100644 --- a/drivers/pinctrl/freescale/pinctrl-mxs.c +++ b/drivers/pinctrl/freescale/pinctrl-mxs.c @@ -405,8 +405,8 @@ static int mxs_pinctrl_probe_dt(struct platform_device *pdev, int ret; u32 val; - child = of_get_next_child(np, NULL); - if (!child) { + val = of_get_child_count(np); + if (val == 0) { dev_err(&pdev->dev, "no group is defined\n"); return -ENOENT; } diff --git a/drivers/pinctrl/pinctrl-single.c b/drivers/pinctrl/pinctrl-single.c index ce5be6f0b7aa..43b25119efa2 100644 --- a/drivers/pinctrl/pinctrl-single.c +++ b/drivers/pinctrl/pinctrl-single.c @@ -323,6 +323,8 @@ static int pcs_get_function(struct pinctrl_dev *pctldev, unsigned pin, return -ENOTSUPP; fselector = setting->func; function = pinmux_generic_get_function(pctldev, fselector); + if (!function) + return -EINVAL; *func = function->data; if (!(*func)) { dev_err(pcs->dev, "%s could not find function%i\n", @@ -1311,7 +1313,6 @@ static void pcs_irq_free(struct pcs_device *pcs) static void pcs_free_resources(struct pcs_device *pcs) { pcs_irq_free(pcs); - pinctrl_unregister(pcs->pctl); #if IS_BUILTIN(CONFIG_PINCTRL_SINGLE) if (pcs->missing_nr_pinctrl_cells) @@ -1864,7 +1865,7 @@ static int pcs_probe(struct platform_device *pdev) if (ret < 0) goto free; - ret = pinctrl_register_and_init(&pcs->desc, pcs->dev, pcs, &pcs->pctl); + ret = devm_pinctrl_register_and_init(pcs->dev, &pcs->desc, pcs, &pcs->pctl); if (ret) { dev_err(pcs->dev, "could not register single pinctrl driver\n"); goto free; @@ -1897,8 +1898,10 @@ static int pcs_probe(struct platform_device *pdev) dev_info(pcs->dev, "%i pins, size %u\n", pcs->desc.npins, pcs->size); - return pinctrl_enable(pcs->pctl); + if (pinctrl_enable(pcs->pctl)) + goto free; + return 0; free: pcs_free_resources(pcs); diff --git a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c index b522ca010332..e75c641c2445 100644 --- a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c +++ b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c @@ -881,7 +881,7 @@ static int ti_iodelay_probe(struct platform_device *pdev) iod->desc.name = dev_name(dev); iod->desc.owner = THIS_MODULE; - ret = pinctrl_register_and_init(&iod->desc, dev, iod, &iod->pctl); + ret = devm_pinctrl_register_and_init(dev, &iod->desc, iod, &iod->pctl); if (ret) { dev_err(dev, "Failed to register pinctrl\n"); goto exit_out; @@ -889,7 +889,11 @@ static int ti_iodelay_probe(struct platform_device *pdev) platform_set_drvdata(pdev, iod); - return pinctrl_enable(iod->pctl); + ret = pinctrl_enable(iod->pctl); + if (ret) + goto exit_out; + + return 0; exit_out: of_node_put(np); @@ -906,12 +910,6 @@ static int ti_iodelay_remove(struct platform_device *pdev) { struct ti_iodelay_device *iod = platform_get_drvdata(pdev); - if (!iod) - return 0; - - if (iod->pctl) - pinctrl_unregister(iod->pctl); - ti_iodelay_pinconf_deinit_dev(iod); /* Expect other allocations to be freed by devm */ diff --git a/drivers/platform/chrome/cros_ec_debugfs.c b/drivers/platform/chrome/cros_ec_debugfs.c index c4b57e1df192..704086ca1dd2 100644 --- a/drivers/platform/chrome/cros_ec_debugfs.c +++ b/drivers/platform/chrome/cros_ec_debugfs.c @@ -308,6 +308,7 @@ static int ec_read_version_supported(struct cros_ec_dev *ec) if (!msg) return 0; + msg->version = 1; msg->command = EC_CMD_GET_CMD_VERSIONS + ec->cmd_offset; msg->outsize = sizeof(*params); msg->insize = sizeof(*response); diff --git a/drivers/platform/mips/cpu_hwmon.c b/drivers/platform/mips/cpu_hwmon.c index 3d29a11c1d6b..66770c1ddc49 100644 --- a/drivers/platform/mips/cpu_hwmon.c +++ b/drivers/platform/mips/cpu_hwmon.c @@ -166,6 +166,9 @@ static int __init loongson_hwmon_init(void) goto fail_hwmon_device_register; } + if (!csr_temp_enable && !loongson_chiptemp[0]) + return -ENODEV; + nr_packages = loongson_sysconf.nr_cpus / loongson_sysconf.cores_per_package; diff --git a/drivers/power/supply/axp288_charger.c b/drivers/power/supply/axp288_charger.c index 2ee6bb7c0804..8dfc0b0b6c4f 100644 --- a/drivers/power/supply/axp288_charger.c +++ b/drivers/power/supply/axp288_charger.c @@ -168,18 +168,18 @@ static inline int axp288_charger_set_cv(struct axp288_chrg_info *info, int cv) u8 reg_val; int ret; - if (cv <= CV_4100MV) { - reg_val = CHRG_CCCV_CV_4100MV; - cv = CV_4100MV; - } else if (cv <= CV_4150MV) { - reg_val = CHRG_CCCV_CV_4150MV; - cv = CV_4150MV; - } else if (cv <= CV_4200MV) { - reg_val = CHRG_CCCV_CV_4200MV; - cv = CV_4200MV; - } else { + if (cv >= CV_4350MV) { reg_val = CHRG_CCCV_CV_4350MV; cv = CV_4350MV; + } else if (cv >= CV_4200MV) { + reg_val = CHRG_CCCV_CV_4200MV; + cv = CV_4200MV; + } else if (cv >= CV_4150MV) { + reg_val = CHRG_CCCV_CV_4150MV; + cv = CV_4150MV; + } else { + reg_val = CHRG_CCCV_CV_4100MV; + cv = CV_4100MV; } reg_val = reg_val << CHRG_CCCV_CV_BIT_POS; @@ -371,8 +371,8 @@ static int axp288_charger_usb_set_property(struct power_supply *psy, dev_warn(&info->pdev->dev, "set charge current failed\n"); break; case POWER_SUPPLY_PROP_CONSTANT_CHARGE_VOLTAGE: - scaled_val = min(val->intval, info->max_cv); - scaled_val = DIV_ROUND_CLOSEST(scaled_val, 1000); + scaled_val = DIV_ROUND_CLOSEST(val->intval, 1000); + scaled_val = min(scaled_val, info->max_cv); ret = axp288_charger_set_cv(info, scaled_val); if (ret < 0) dev_warn(&info->pdev->dev, "set charge voltage failed\n"); diff --git a/drivers/pwm/pwm-stm32.c b/drivers/pwm/pwm-stm32.c index 4b20ff6f687b..9e94a797dcf3 100644 --- a/drivers/pwm/pwm-stm32.c +++ b/drivers/pwm/pwm-stm32.c @@ -451,8 +451,9 @@ static int stm32_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm, enabled = pwm->state.enabled; - if (enabled && !state->enabled) { - stm32_pwm_disable(priv, pwm->hwpwm); + if (!state->enabled) { + if (enabled) + stm32_pwm_disable(priv, pwm->hwpwm); return 0; } diff --git a/drivers/remoteproc/imx_rproc.c b/drivers/remoteproc/imx_rproc.c index 3e72b6f38d4b..3f3d1eb94e6f 100644 --- a/drivers/remoteproc/imx_rproc.c +++ b/drivers/remoteproc/imx_rproc.c @@ -286,6 +286,11 @@ static int imx_rproc_addr_init(struct imx_rproc *priv, struct resource res; node = of_parse_phandle(np, "memory-region", a); + if (!node) + continue; + /* Not map vdevbuffer, vdevring region */ + if (!strncmp(node->name, "vdev", strlen("vdev"))) + continue; err = of_address_to_resource(node, 0, &res); if (err) { dev_err(dev, "unable to resolve memory region\n"); diff --git a/drivers/rtc/interface.c b/drivers/rtc/interface.c index ba345a379e26..d858cd819932 100644 --- a/drivers/rtc/interface.c +++ b/drivers/rtc/interface.c @@ -274,10 +274,9 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm) return err; /* full-function RTCs won't have such missing fields */ - if (rtc_valid_tm(&alarm->time) == 0) { - rtc_add_offset(rtc, &alarm->time); - return 0; - } + err = rtc_valid_tm(&alarm->time); + if (!err) + goto done; /* get the "after" timestamp, to detect wrapped fields */ err = rtc_read_time(rtc, &now); @@ -379,6 +378,8 @@ done: if (err) dev_warn(&rtc->dev, "invalid alarm value: %ptR\n", &alarm->time); + else + rtc_add_offset(rtc, &alarm->time); return err; } diff --git a/drivers/rtc/rtc-cmos.c b/drivers/rtc/rtc-cmos.c index c0dc03ffa817..40936c3ff397 100644 --- a/drivers/rtc/rtc-cmos.c +++ b/drivers/rtc/rtc-cmos.c @@ -597,11 +597,10 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val, size_t count) { unsigned char *buf = val; - int retval; off += NVRAM_OFFSET; spin_lock_irq(&rtc_lock); - for (retval = 0; count; count--, off++, retval++) { + for (; count; count--, off++) { if (off < 128) *buf++ = CMOS_READ(off); else if (can_bank2) @@ -611,7 +610,7 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val, } spin_unlock_irq(&rtc_lock); - return retval; + return count ? -EIO : 0; } static int cmos_nvram_write(void *priv, unsigned int off, void *val, @@ -619,7 +618,6 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val, { struct cmos_rtc *cmos = priv; unsigned char *buf = val; - int retval; /* NOTE: on at least PCs and Ataris, the boot firmware uses a * checksum on part of the NVRAM data. That's currently ignored @@ -628,7 +626,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val, */ off += NVRAM_OFFSET; spin_lock_irq(&rtc_lock); - for (retval = 0; count; count--, off++, retval++) { + for (; count; count--, off++) { /* don't trash RTC registers */ if (off == cmos->day_alrm || off == cmos->mon_alrm @@ -643,7 +641,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val, } spin_unlock_irq(&rtc_lock); - return retval; + return count ? -EIO : 0; } /*----------------------------------------------------------------*/ diff --git a/drivers/rtc/rtc-isl1208.c b/drivers/rtc/rtc-isl1208.c index ebb691fa48a6..cba0dfe21a15 100644 --- a/drivers/rtc/rtc-isl1208.c +++ b/drivers/rtc/rtc-isl1208.c @@ -743,14 +743,13 @@ static int isl1208_nvmem_read(void *priv, unsigned int off, void *buf, { struct isl1208_state *isl1208 = priv; struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent); - int ret; /* nvmem sanitizes offset/count for us, but count==0 is possible */ if (!count) return count; - ret = isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf, + + return isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf, count); - return ret == 0 ? count : ret; } static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf, @@ -758,15 +757,13 @@ static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf, { struct isl1208_state *isl1208 = priv; struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent); - int ret; /* nvmem sanitizes off/count for us, but count==0 is possible */ if (!count) return count; - ret = isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf, - count); - return ret == 0 ? count : ret; + return isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf, + count); } static const struct nvmem_config isl1208_nvmem_config = { diff --git a/drivers/s390/block/dasd.c b/drivers/s390/block/dasd.c index a5cee56ffe61..05363aaa7cfe 100644 --- a/drivers/s390/block/dasd.c +++ b/drivers/s390/block/dasd.c @@ -1665,9 +1665,15 @@ static int dasd_ese_needs_format(struct dasd_block *block, struct irb *irb) if (!sense) return 0; - return !!(sense[1] & SNS1_NO_REC_FOUND) || - !!(sense[1] & SNS1_FILE_PROTECTED) || - scsw_cstat(&irb->scsw) == SCHN_STAT_INCORR_LEN; + if (sense[1] & SNS1_NO_REC_FOUND) + return 1; + + if ((sense[1] & SNS1_INV_TRACK_FORMAT) && + scsw_is_tm(&irb->scsw) && + !(sense[2] & SNS2_ENV_DATA_PRESENT)) + return 1; + + return 0; } static int dasd_ese_oos_cond(u8 *sense) @@ -1688,7 +1694,7 @@ void dasd_int_handler(struct ccw_device *cdev, unsigned long intparm, struct dasd_device *device; unsigned long now; int nrf_suppressed = 0; - int fp_suppressed = 0; + int it_suppressed = 0; struct request *req; u8 *sense = NULL; int expires; @@ -1743,8 +1749,9 @@ void dasd_int_handler(struct ccw_device *cdev, unsigned long intparm, */ sense = dasd_get_sense(irb); if (sense) { - fp_suppressed = (sense[1] & SNS1_FILE_PROTECTED) && - test_bit(DASD_CQR_SUPPRESS_FP, &cqr->flags); + it_suppressed = (sense[1] & SNS1_INV_TRACK_FORMAT) && + !(sense[2] & SNS2_ENV_DATA_PRESENT) && + test_bit(DASD_CQR_SUPPRESS_IT, &cqr->flags); nrf_suppressed = (sense[1] & SNS1_NO_REC_FOUND) && test_bit(DASD_CQR_SUPPRESS_NRF, &cqr->flags); @@ -1759,7 +1766,7 @@ void dasd_int_handler(struct ccw_device *cdev, unsigned long intparm, return; } } - if (!(fp_suppressed || nrf_suppressed)) + if (!(it_suppressed || nrf_suppressed)) device->discipline->dump_sense_dbf(device, irb, "int"); if (device->features & DASD_FEATURE_ERPLOG) @@ -2513,14 +2520,17 @@ retry: rc = 0; list_for_each_entry_safe(cqr, n, ccw_queue, blocklist) { /* - * In some cases the 'File Protected' or 'Incorrect Length' - * error might be expected and error recovery would be - * unnecessary in these cases. Check if the according suppress - * bit is set. + * In some cases certain errors might be expected and + * error recovery would be unnecessary in these cases. + * Check if the according suppress bit is set. */ sense = dasd_get_sense(&cqr->irb); - if (sense && sense[1] & SNS1_FILE_PROTECTED && - test_bit(DASD_CQR_SUPPRESS_FP, &cqr->flags)) + if (sense && (sense[1] & SNS1_INV_TRACK_FORMAT) && + !(sense[2] & SNS2_ENV_DATA_PRESENT) && + test_bit(DASD_CQR_SUPPRESS_IT, &cqr->flags)) + continue; + if (sense && (sense[1] & SNS1_NO_REC_FOUND) && + test_bit(DASD_CQR_SUPPRESS_NRF, &cqr->flags)) continue; if (scsw_cstat(&cqr->irb.scsw) == 0x40 && test_bit(DASD_CQR_SUPPRESS_IL, &cqr->flags)) diff --git a/drivers/s390/block/dasd_3990_erp.c b/drivers/s390/block/dasd_3990_erp.c index 8598c792ded3..e2163176bd9d 100644 --- a/drivers/s390/block/dasd_3990_erp.c +++ b/drivers/s390/block/dasd_3990_erp.c @@ -1401,14 +1401,8 @@ dasd_3990_erp_file_prot(struct dasd_ccw_req * erp) struct dasd_device *device = erp->startdev; - /* - * In some cases the 'File Protected' error might be expected and - * log messages shouldn't be written then. - * Check if the according suppress bit is set. - */ - if (!test_bit(DASD_CQR_SUPPRESS_FP, &erp->flags)) - dev_err(&device->cdev->dev, - "Accessing the DASD failed because of a hardware error\n"); + dev_err(&device->cdev->dev, + "Accessing the DASD failed because of a hardware error\n"); return dasd_3990_erp_cleanup(erp, DASD_CQR_FAILED); diff --git a/drivers/s390/block/dasd_eckd.c b/drivers/s390/block/dasd_eckd.c index c6930c159d2a..fddcb910157c 100644 --- a/drivers/s390/block/dasd_eckd.c +++ b/drivers/s390/block/dasd_eckd.c @@ -2201,6 +2201,7 @@ dasd_eckd_analysis_ccw(struct dasd_device *device) cqr->status = DASD_CQR_FILLED; /* Set flags to suppress output for expected errors */ set_bit(DASD_CQR_SUPPRESS_NRF, &cqr->flags); + set_bit(DASD_CQR_SUPPRESS_IT, &cqr->flags); return cqr; } @@ -2482,7 +2483,6 @@ dasd_eckd_build_check_tcw(struct dasd_device *base, struct format_data_t *fdata, cqr->buildclk = get_tod_clock(); cqr->status = DASD_CQR_FILLED; /* Set flags to suppress output for expected errors */ - set_bit(DASD_CQR_SUPPRESS_FP, &cqr->flags); set_bit(DASD_CQR_SUPPRESS_IL, &cqr->flags); return cqr; @@ -4031,8 +4031,6 @@ static struct dasd_ccw_req *dasd_eckd_build_cp_cmd_single( /* Set flags to suppress output for expected errors */ if (dasd_eckd_is_ese(basedev)) { - set_bit(DASD_CQR_SUPPRESS_FP, &cqr->flags); - set_bit(DASD_CQR_SUPPRESS_IL, &cqr->flags); set_bit(DASD_CQR_SUPPRESS_NRF, &cqr->flags); } @@ -4534,9 +4532,8 @@ static struct dasd_ccw_req *dasd_eckd_build_cp_tpm_track( /* Set flags to suppress output for expected errors */ if (dasd_eckd_is_ese(basedev)) { - set_bit(DASD_CQR_SUPPRESS_FP, &cqr->flags); - set_bit(DASD_CQR_SUPPRESS_IL, &cqr->flags); set_bit(DASD_CQR_SUPPRESS_NRF, &cqr->flags); + set_bit(DASD_CQR_SUPPRESS_IT, &cqr->flags); } return cqr; @@ -5706,36 +5703,32 @@ static void dasd_eckd_dump_sense(struct dasd_device *device, { u8 *sense = dasd_get_sense(irb); - if (scsw_is_tm(&irb->scsw)) { - /* - * In some cases the 'File Protected' or 'Incorrect Length' - * error might be expected and log messages shouldn't be written - * then. Check if the according suppress bit is set. - */ - if (sense && (sense[1] & SNS1_FILE_PROTECTED) && - test_bit(DASD_CQR_SUPPRESS_FP, &req->flags)) - return; - if (scsw_cstat(&irb->scsw) == 0x40 && - test_bit(DASD_CQR_SUPPRESS_IL, &req->flags)) - return; + /* + * In some cases certain errors might be expected and + * log messages shouldn't be written then. + * Check if the according suppress bit is set. + */ + if (sense && (sense[1] & SNS1_INV_TRACK_FORMAT) && + !(sense[2] & SNS2_ENV_DATA_PRESENT) && + test_bit(DASD_CQR_SUPPRESS_IT, &req->flags)) + return; + if (sense && sense[0] & SNS0_CMD_REJECT && + test_bit(DASD_CQR_SUPPRESS_CR, &req->flags)) + return; + + if (sense && sense[1] & SNS1_NO_REC_FOUND && + test_bit(DASD_CQR_SUPPRESS_NRF, &req->flags)) + return; + + if (scsw_cstat(&irb->scsw) == 0x40 && + test_bit(DASD_CQR_SUPPRESS_IL, &req->flags)) + return; + + if (scsw_is_tm(&irb->scsw)) dasd_eckd_dump_sense_tcw(device, req, irb); - } else { - /* - * In some cases the 'Command Reject' or 'No Record Found' - * error might be expected and log messages shouldn't be - * written then. Check if the according suppress bit is set. - */ - if (sense && sense[0] & SNS0_CMD_REJECT && - test_bit(DASD_CQR_SUPPRESS_CR, &req->flags)) - return; - - if (sense && sense[1] & SNS1_NO_REC_FOUND && - test_bit(DASD_CQR_SUPPRESS_NRF, &req->flags)) - return; - + else dasd_eckd_dump_sense_ccw(device, req, irb); - } } static int dasd_eckd_pm_freeze(struct dasd_device *device) diff --git a/drivers/s390/block/dasd_int.h b/drivers/s390/block/dasd_int.h index 5d7d35ca5eb4..052b5d1ba9c1 100644 --- a/drivers/s390/block/dasd_int.h +++ b/drivers/s390/block/dasd_int.h @@ -226,7 +226,7 @@ struct dasd_ccw_req { * The following flags are used to suppress output of certain errors. */ #define DASD_CQR_SUPPRESS_NRF 4 /* Suppress 'No Record Found' error */ -#define DASD_CQR_SUPPRESS_FP 5 /* Suppress 'File Protected' error*/ +#define DASD_CQR_SUPPRESS_IT 5 /* Suppress 'Invalid Track' error*/ #define DASD_CQR_SUPPRESS_IL 6 /* Suppress 'Incorrect Length' error */ #define DASD_CQR_SUPPRESS_CR 7 /* Suppress 'Command Reject' error */ diff --git a/drivers/s390/char/sclp_sd.c b/drivers/s390/char/sclp_sd.c index 1e244f78f192..64581433c334 100644 --- a/drivers/s390/char/sclp_sd.c +++ b/drivers/s390/char/sclp_sd.c @@ -319,8 +319,14 @@ static int sclp_sd_store_data(struct sclp_sd_data *result, u8 di) &esize); if (rc) { /* Cancel running request if interrupted */ - if (rc == -ERESTARTSYS) - sclp_sd_sync(page, SD_EQ_HALT, di, 0, 0, NULL, NULL); + if (rc == -ERESTARTSYS) { + if (sclp_sd_sync(page, SD_EQ_HALT, di, 0, 0, NULL, NULL)) { + pr_warn("Could not stop Store Data request - leaking at least %zu bytes\n", + (size_t)dsize * PAGE_SIZE); + data = NULL; + asce = 0; + } + } vfree(data); goto out; } diff --git a/drivers/s390/cio/idset.c b/drivers/s390/cio/idset.c index 835de44dbbcc..b98526d3ddfd 100644 --- a/drivers/s390/cio/idset.c +++ b/drivers/s390/cio/idset.c @@ -16,20 +16,21 @@ struct idset { unsigned long bitmap[0]; }; -static inline unsigned long bitmap_size(int num_ssid, int num_id) +static inline unsigned long idset_bitmap_size(int num_ssid, int num_id) { - return BITS_TO_LONGS(num_ssid * num_id) * sizeof(unsigned long); + return bitmap_size(size_mul(num_ssid, num_id)); } static struct idset *idset_new(int num_ssid, int num_id) { struct idset *set; - set = vmalloc(sizeof(struct idset) + bitmap_size(num_ssid, num_id)); + set = vmalloc(sizeof(struct idset) + + idset_bitmap_size(num_ssid, num_id)); if (set) { set->num_ssid = num_ssid; set->num_id = num_id; - memset(set->bitmap, 0, bitmap_size(num_ssid, num_id)); + memset(set->bitmap, 0, idset_bitmap_size(num_ssid, num_id)); } return set; } @@ -41,7 +42,8 @@ void idset_free(struct idset *set) void idset_fill(struct idset *set) { - memset(set->bitmap, 0xff, bitmap_size(set->num_ssid, set->num_id)); + memset(set->bitmap, 0xff, + idset_bitmap_size(set->num_ssid, set->num_id)); } static inline void idset_add(struct idset *set, int ssid, int id) diff --git a/drivers/scsi/aacraid/comminit.c b/drivers/scsi/aacraid/comminit.c index d4fcfa1e54e0..8849eca08a49 100644 --- a/drivers/scsi/aacraid/comminit.c +++ b/drivers/scsi/aacraid/comminit.c @@ -638,6 +638,7 @@ struct aac_dev *aac_init_adapter(struct aac_dev *dev) if (aac_comm_init(dev)<0){ kfree(dev->queues); + dev->queues = NULL; return NULL; } /* @@ -645,6 +646,7 @@ struct aac_dev *aac_init_adapter(struct aac_dev *dev) */ if (aac_fib_setup(dev) < 0) { kfree(dev->queues); + dev->queues = NULL; return NULL; } diff --git a/drivers/scsi/lpfc/lpfc_sli.c b/drivers/scsi/lpfc/lpfc_sli.c index e489c68cfb63..04b9a94f2f5e 100644 --- a/drivers/scsi/lpfc/lpfc_sli.c +++ b/drivers/scsi/lpfc/lpfc_sli.c @@ -6902,7 +6902,7 @@ lpfc_sli4_repost_sgl_list(struct lpfc_hba *phba, struct lpfc_sglq *sglq_entry = NULL; struct lpfc_sglq *sglq_entry_next = NULL; struct lpfc_sglq *sglq_entry_first = NULL; - int status, total_cnt; + int status = 0, total_cnt; int post_cnt = 0, num_posted = 0, block_cnt = 0; int last_xritag = NO_XRI; LIST_HEAD(prep_sgl_list); diff --git a/drivers/scsi/mpt3sas/mpt3sas_base.c b/drivers/scsi/mpt3sas/mpt3sas_base.c index 35c97bc660bd..1bc23e8ee748 100644 --- a/drivers/scsi/mpt3sas/mpt3sas_base.c +++ b/drivers/scsi/mpt3sas/mpt3sas_base.c @@ -2310,12 +2310,8 @@ _base_check_pcie_native_sgl(struct MPT3SAS_ADAPTER *ioc, /* Get the SG list pointer and info. */ sges_left = scsi_dma_map(scmd); - if (sges_left < 0) { - sdev_printk(KERN_ERR, scmd->device, - "scsi_dma_map failed: request for %d bytes!\n", - scsi_bufflen(scmd)); + if (sges_left < 0) return 1; - } /* Check if we need to build a native SG list. */ if (base_is_prp_possible(ioc, pcie_device, @@ -2375,6 +2371,22 @@ _base_build_zero_len_sge_ieee(struct MPT3SAS_ADAPTER *ioc, void *paddr) _base_add_sg_single_ieee(paddr, sgl_flags, 0, 0, -1); } +static inline int _base_scsi_dma_map(struct scsi_cmnd *cmd) +{ + /* + * Some firmware versions byte-swap the REPORT ZONES command reply from + * ATA-ZAC devices by directly accessing in the host buffer. This does + * not respect the default command DMA direction and causes IOMMU page + * faults on some architectures with an IOMMU enforcing write mappings + * (e.g. AMD hosts). Avoid such issue by making the report zones buffer + * mapping bi-directional. + */ + if (cmd->cmnd[0] == ZBC_IN && cmd->cmnd[1] == ZI_REPORT_ZONES) + cmd->sc_data_direction = DMA_BIDIRECTIONAL; + + return scsi_dma_map(cmd); +} + /** * _base_build_sg_scmd - main sg creation routine * pcie_device is unused here! @@ -2421,13 +2433,9 @@ _base_build_sg_scmd(struct MPT3SAS_ADAPTER *ioc, sgl_flags = sgl_flags << MPI2_SGE_FLAGS_SHIFT; sg_scmd = scsi_sglist(scmd); - sges_left = scsi_dma_map(scmd); - if (sges_left < 0) { - sdev_printk(KERN_ERR, scmd->device, - "scsi_dma_map failed: request for %d bytes!\n", - scsi_bufflen(scmd)); + sges_left = _base_scsi_dma_map(scmd); + if (sges_left < 0) return -ENOMEM; - } sg_local = &mpi_request->SGL; sges_in_segment = ioc->max_sges_in_main_message; @@ -2569,13 +2577,9 @@ _base_build_sg_scmd_ieee(struct MPT3SAS_ADAPTER *ioc, } sg_scmd = scsi_sglist(scmd); - sges_left = scsi_dma_map(scmd); - if (sges_left < 0) { - sdev_printk(KERN_ERR, scmd->device, - "scsi_dma_map failed: request for %d bytes!\n", - scsi_bufflen(scmd)); + sges_left = _base_scsi_dma_map(scmd); + if (sges_left < 0) return -ENOMEM; - } sg_local = &mpi_request->SGL; sges_in_segment = (ioc->request_sz - diff --git a/drivers/scsi/qla2xxx/qla_bsg.c b/drivers/scsi/qla2xxx/qla_bsg.c index e584d39dc982..c94dd4e69b65 100644 --- a/drivers/scsi/qla2xxx/qla_bsg.c +++ b/drivers/scsi/qla2xxx/qla_bsg.c @@ -297,7 +297,7 @@ qla2x00_process_els(struct bsg_job *bsg_job) "request_sg_cnt=%x reply_sg_cnt=%x.\n", bsg_job->request_payload.sg_cnt, bsg_job->reply_payload.sg_cnt); - rval = -EPERM; + rval = -ENOBUFS; goto done; } diff --git a/drivers/scsi/qla2xxx/qla_mid.c b/drivers/scsi/qla2xxx/qla_mid.c index eabc5127174e..9ce8e9873935 100644 --- a/drivers/scsi/qla2xxx/qla_mid.c +++ b/drivers/scsi/qla2xxx/qla_mid.c @@ -165,7 +165,7 @@ qla24xx_disable_vp(scsi_qla_host_t *vha) atomic_set(&vha->loop_state, LOOP_DOWN); atomic_set(&vha->loop_down_timer, LOOP_DOWN_TIME); list_for_each_entry(fcport, &vha->vp_fcports, list) - fcport->logout_on_delete = 0; + fcport->logout_on_delete = 1; qla2x00_mark_all_devices_lost(vha, 0); diff --git a/drivers/scsi/qla2xxx/qla_nvme.c b/drivers/scsi/qla2xxx/qla_nvme.c index 11ee87f76f4b..082ab5eb3b90 100644 --- a/drivers/scsi/qla2xxx/qla_nvme.c +++ b/drivers/scsi/qla2xxx/qla_nvme.c @@ -28,7 +28,10 @@ int qla_nvme_register_remote(struct scsi_qla_host *vha, struct fc_port *fcport) return 0; } - if (!vha->nvme_local_port && qla_nvme_register_hba(vha)) + if (qla_nvme_register_hba(vha)) + return 0; + + if (!vha->nvme_local_port) return 0; if (!(fcport->nvme_prli_service_param & diff --git a/drivers/scsi/qla2xxx/qla_os.c b/drivers/scsi/qla2xxx/qla_os.c index 6da85ad96c9b..c73f77ad6095 100644 --- a/drivers/scsi/qla2xxx/qla_os.c +++ b/drivers/scsi/qla2xxx/qla_os.c @@ -1743,14 +1743,9 @@ __qla2x00_abort_all_cmds(struct qla_qpair *qp, int res) for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) { sp = req->outstanding_cmds[cnt]; if (sp) { - /* - * perform lockless completion during driver unload - */ if (qla2x00_chip_is_down(vha)) { req->outstanding_cmds[cnt] = NULL; - spin_unlock_irqrestore(qp->qp_lock_ptr, flags); sp->done(sp, res); - spin_lock_irqsave(qp->qp_lock_ptr, flags); continue; } @@ -4436,7 +4431,7 @@ static void qla2x00_number_of_exch(scsi_qla_host_t *vha, u32 *ret_cnt, u16 max_cnt) { u32 temp; - struct init_cb_81xx *icb = (struct init_cb_81xx *)&vha->hw->init_cb; + struct init_cb_81xx *icb = (struct init_cb_81xx *)vha->hw->init_cb; *ret_cnt = FW_DEF_EXCHANGES_CNT; if (max_cnt > vha->hw->max_exchg) diff --git a/drivers/scsi/scsi_transport_spi.c b/drivers/scsi/scsi_transport_spi.c index c37dd15d16d2..83f2576ed2aa 100644 --- a/drivers/scsi/scsi_transport_spi.c +++ b/drivers/scsi/scsi_transport_spi.c @@ -677,10 +677,10 @@ spi_dv_device_echo_buffer(struct scsi_device *sdev, u8 *buffer, for (r = 0; r < retries; r++) { result = spi_execute(sdev, spi_write_buffer, DMA_TO_DEVICE, buffer, len, &sshdr); - if(result || !scsi_device_online(sdev)) { + if (result || !scsi_device_online(sdev)) { scsi_device_set_state(sdev, SDEV_QUIESCE); - if (scsi_sense_valid(&sshdr) + if (result > 0 && scsi_sense_valid(&sshdr) && sshdr.sense_key == ILLEGAL_REQUEST /* INVALID FIELD IN CDB */ && sshdr.asc == 0x24 && sshdr.ascq == 0x00) diff --git a/drivers/scsi/ufs/ufshcd.c b/drivers/scsi/ufs/ufshcd.c index 7dccfa5d30a3..74a3694e3e2f 100644 --- a/drivers/scsi/ufs/ufshcd.c +++ b/drivers/scsi/ufs/ufshcd.c @@ -3811,11 +3811,16 @@ static inline void ufshcd_add_delay_before_dme_cmd(struct ufs_hba *hba) min_sleep_time_us = MIN_DELAY_BEFORE_DME_CMDS_US - delta; else - return; /* no more delay required */ + min_sleep_time_us = 0; /* no more delay required */ } - /* allow sleep for extra 50us if needed */ - usleep_range(min_sleep_time_us, min_sleep_time_us + 50); + if (min_sleep_time_us > 0) { + /* allow sleep for extra 50us if needed */ + usleep_range(min_sleep_time_us, min_sleep_time_us + 50); + } + + /* update the last_dme_cmd_tstamp */ + hba->last_dme_cmd_tstamp = ktime_get(); } /** diff --git a/drivers/soc/qcom/cmd-db.c b/drivers/soc/qcom/cmd-db.c index 1967757a2066..1e139be8201f 100644 --- a/drivers/soc/qcom/cmd-db.c +++ b/drivers/soc/qcom/cmd-db.c @@ -248,7 +248,7 @@ static int cmd_db_dev_probe(struct platform_device *pdev) return -EINVAL; } - cmd_db_header = memremap(rmem->base, rmem->size, MEMREMAP_WB); + cmd_db_header = memremap(rmem->base, rmem->size, MEMREMAP_WC); if (!cmd_db_header) { ret = -ENOMEM; cmd_db_header = NULL; diff --git a/drivers/soundwire/stream.c b/drivers/soundwire/stream.c index 3b3f909407c3..b7d81bde35ca 100644 --- a/drivers/soundwire/stream.c +++ b/drivers/soundwire/stream.c @@ -1407,18 +1407,18 @@ struct sdw_dpn_prop *sdw_get_slave_dpn_prop(struct sdw_slave *slave, unsigned int port_num) { struct sdw_dpn_prop *dpn_prop; - u8 num_ports; + unsigned long mask; int i; if (direction == SDW_DATA_DIR_TX) { - num_ports = hweight32(slave->prop.source_ports); + mask = slave->prop.source_ports; dpn_prop = slave->prop.src_dpn_prop; } else { - num_ports = hweight32(slave->prop.sink_ports); + mask = slave->prop.sink_ports; dpn_prop = slave->prop.sink_dpn_prop; } - for (i = 0; i < num_ports; i++) { + for_each_set_bit(i, &mask, 32) { if (dpn_prop[i].num == port_num) return &dpn_prop[i]; } diff --git a/drivers/spi/spi-fsl-lpspi.c b/drivers/spi/spi-fsl-lpspi.c index 58b2da91be1c..2708bf15e126 100644 --- a/drivers/spi/spi-fsl-lpspi.c +++ b/drivers/spi/spi-fsl-lpspi.c @@ -86,8 +86,6 @@ #define TCR_RXMSK BIT(19) #define TCR_TXMSK BIT(18) -static int clkdivs[] = {1, 2, 4, 8, 16, 32, 64, 128}; - struct lpspi_config { u8 bpw; u8 chip_select; @@ -319,7 +317,7 @@ static void fsl_lpspi_set_watermark(struct fsl_lpspi_data *fsl_lpspi) static int fsl_lpspi_set_bitrate(struct fsl_lpspi_data *fsl_lpspi) { struct lpspi_config config = fsl_lpspi->config; - unsigned int perclk_rate, scldiv; + unsigned int perclk_rate, scldiv, div; u8 prescale; perclk_rate = clk_get_rate(fsl_lpspi->clk_per); @@ -330,16 +328,17 @@ static int fsl_lpspi_set_bitrate(struct fsl_lpspi_data *fsl_lpspi) return -EINVAL; } + div = DIV_ROUND_UP(perclk_rate, config.speed_hz); + for (prescale = 0; prescale < 8; prescale++) { - scldiv = perclk_rate / - (clkdivs[prescale] * config.speed_hz) - 2; + scldiv = div / (1 << prescale) - 2; if (scldiv < 256) { fsl_lpspi->config.prescale = prescale; break; } } - if (prescale == 8 && scldiv >= 256) + if (scldiv >= 256) return -EINVAL; writel(scldiv | (scldiv << 8) | ((scldiv >> 1) << 16), diff --git a/drivers/ssb/main.c b/drivers/ssb/main.c index 0a26984acb2c..9e54bc7eec66 100644 --- a/drivers/ssb/main.c +++ b/drivers/ssb/main.c @@ -835,7 +835,7 @@ static u32 clkfactor_f6_resolve(u32 v) case SSB_CHIPCO_CLK_F6_7: return 7; } - return 0; + return 1; } /* Calculate the speed the backplane would run at a given set of clockcontrol values */ diff --git a/drivers/staging/ks7010/ks7010_sdio.c b/drivers/staging/ks7010/ks7010_sdio.c index 3fbe223d59b8..28723db44a8f 100644 --- a/drivers/staging/ks7010/ks7010_sdio.c +++ b/drivers/staging/ks7010/ks7010_sdio.c @@ -395,9 +395,9 @@ int ks_wlan_hw_tx(struct ks_wlan_private *priv, void *p, unsigned long size, priv->hostt.buff[priv->hostt.qtail] = le16_to_cpu(hdr->event); priv->hostt.qtail = (priv->hostt.qtail + 1) % SME_EVENT_BUFF_SIZE; - spin_lock(&priv->tx_dev.tx_dev_lock); + spin_lock_bh(&priv->tx_dev.tx_dev_lock); result = enqueue_txdev(priv, p, size, complete_handler, skb); - spin_unlock(&priv->tx_dev.tx_dev_lock); + spin_unlock_bh(&priv->tx_dev.tx_dev_lock); if (txq_has_space(priv)) queue_delayed_work(priv->wq, &priv->rw_dwork, 0); diff --git a/drivers/tty/serial/serial_core.c b/drivers/tty/serial/serial_core.c index fa0877a5e29f..e6dcfa28c4cc 100644 --- a/drivers/tty/serial/serial_core.c +++ b/drivers/tty/serial/serial_core.c @@ -847,6 +847,14 @@ static int uart_set_info(struct tty_struct *tty, struct tty_port *port, new_flags = (__force upf_t)new_info->flags; old_custom_divisor = uport->custom_divisor; + if (!(uport->flags & UPF_FIXED_PORT)) { + unsigned int uartclk = new_info->baud_base * 16; + /* check needs to be done here before other settings made */ + if (uartclk == 0) { + retval = -EINVAL; + goto exit; + } + } if (!capable(CAP_SYS_ADMIN)) { retval = -EPERM; if (change_irq || change_port || diff --git a/drivers/usb/class/cdc-acm.c b/drivers/usb/class/cdc-acm.c index edb62b49f572..e8768d33efd6 100644 --- a/drivers/usb/class/cdc-acm.c +++ b/drivers/usb/class/cdc-acm.c @@ -1767,6 +1767,9 @@ static const struct usb_device_id acm_ids[] = { { USB_DEVICE(0x11ca, 0x0201), /* VeriFone Mx870 Gadget Serial */ .driver_info = SINGLE_RX_URB, }, + { USB_DEVICE(0x1901, 0x0006), /* GE Healthcare Patient Monitor UI Controller */ + .driver_info = DISABLE_ECHO, /* DISABLE ECHO in termios flag */ + }, { USB_DEVICE(0x1965, 0x0018), /* Uniden UBC125XLT */ .driver_info = NO_UNION_NORMAL, /* has no union descriptor */ }, diff --git a/drivers/usb/core/sysfs.c b/drivers/usb/core/sysfs.c index 4a4f39c458a9..859388d96117 100644 --- a/drivers/usb/core/sysfs.c +++ b/drivers/usb/core/sysfs.c @@ -690,6 +690,7 @@ static int add_power_attributes(struct device *dev) static void remove_power_attributes(struct device *dev) { + sysfs_unmerge_group(&dev->kobj, &usb3_hardware_lpm_attr_group); sysfs_unmerge_group(&dev->kobj, &usb2_hardware_lpm_attr_group); sysfs_unmerge_group(&dev->kobj, &power_attr_group); } diff --git a/drivers/usb/core/urb.c b/drivers/usb/core/urb.c index 0045bbc3627d..850d0fffe1c6 100644 --- a/drivers/usb/core/urb.c +++ b/drivers/usb/core/urb.c @@ -191,6 +191,28 @@ static const int pipetypes[4] = { PIPE_CONTROL, PIPE_ISOCHRONOUS, PIPE_BULK, PIPE_INTERRUPT }; +/** + * usb_pipe_type_check - sanity check of a specific pipe for a usb device + * @dev: struct usb_device to be checked + * @pipe: pipe to check + * + * This performs a light-weight sanity check for the endpoint in the + * given usb device. It returns 0 if the pipe is valid for the specific usb + * device, otherwise a negative error code. + */ +int usb_pipe_type_check(struct usb_device *dev, unsigned int pipe) +{ + const struct usb_host_endpoint *ep; + + ep = usb_pipe_endpoint(dev, pipe); + if (!ep) + return -EINVAL; + if (usb_pipetype(pipe) != pipetypes[usb_endpoint_type(&ep->desc)]) + return -EINVAL; + return 0; +} +EXPORT_SYMBOL_GPL(usb_pipe_type_check); + /** * usb_urb_ep_type_check - sanity check of endpoint in the given urb * @urb: urb to be checked @@ -201,14 +223,7 @@ static const int pipetypes[4] = { */ int usb_urb_ep_type_check(const struct urb *urb) { - const struct usb_host_endpoint *ep; - - ep = usb_pipe_endpoint(urb->dev, urb->pipe); - if (!ep) - return -EINVAL; - if (usb_pipetype(urb->pipe) != pipetypes[usb_endpoint_type(&ep->desc)]) - return -EINVAL; - return 0; + return usb_pipe_type_check(urb->dev, urb->pipe); } EXPORT_SYMBOL_GPL(usb_urb_ep_type_check); @@ -474,7 +489,7 @@ int usb_submit_urb(struct urb *urb, gfp_t mem_flags) */ /* Check that the pipe's type matches the endpoint's type */ - if (usb_urb_ep_type_check(urb)) + if (usb_pipe_type_check(urb->dev, urb->pipe)) dev_WARN(&dev->dev, "BOGUS urb xfer, pipe %x != type %x\n", usb_pipetype(urb->pipe), pipetypes[xfertype]); diff --git a/drivers/usb/dwc3/core.c b/drivers/usb/dwc3/core.c index d48ed1f32337..bbe064f5c096 100644 --- a/drivers/usb/dwc3/core.c +++ b/drivers/usb/dwc3/core.c @@ -385,6 +385,13 @@ static void dwc3_free_event_buffers(struct dwc3 *dwc) static int dwc3_alloc_event_buffers(struct dwc3 *dwc, unsigned length) { struct dwc3_event_buffer *evt; + unsigned int hw_mode; + + hw_mode = DWC3_GHWPARAMS0_MODE(dwc->hwparams.hwparams0); + if (hw_mode == DWC3_GHWPARAMS0_MODE_HOST) { + dwc->ev_buf = NULL; + return 0; + } evt = dwc3_alloc_one_event_buffer(dwc, length); if (IS_ERR(evt)) { @@ -406,6 +413,9 @@ int dwc3_event_buffers_setup(struct dwc3 *dwc) { struct dwc3_event_buffer *evt; + if (!dwc->ev_buf) + return 0; + evt = dwc->ev_buf; evt->lpos = 0; dwc3_writel(dwc->regs, DWC3_GEVNTADRLO(0), @@ -422,6 +432,17 @@ int dwc3_event_buffers_setup(struct dwc3 *dwc) void dwc3_event_buffers_cleanup(struct dwc3 *dwc) { struct dwc3_event_buffer *evt; + u32 reg; + + if (!dwc->ev_buf) + return; + /* + * Exynos platforms may not be able to access event buffer if the + * controller failed to halt on dwc3_core_exit(). + */ + reg = dwc3_readl(dwc->regs, DWC3_DSTS); + if (!(reg & DWC3_DSTS_DEVCTRLHLT)) + return; evt = dwc->ev_buf; diff --git a/drivers/usb/dwc3/dwc3-omap.c b/drivers/usb/dwc3/dwc3-omap.c index 81ee1cd794f7..5465b355f00b 100644 --- a/drivers/usb/dwc3/dwc3-omap.c +++ b/drivers/usb/dwc3/dwc3-omap.c @@ -527,11 +527,13 @@ static int dwc3_omap_probe(struct platform_device *pdev) if (ret) { dev_err(dev, "failed to request IRQ #%d --> %d\n", omap->irq, ret); - goto err1; + goto err2; } dwc3_omap_enable_irqs(omap); return 0; +err2: + of_platform_depopulate(dev); err1: pm_runtime_put_sync(dev); pm_runtime_disable(dev); diff --git a/drivers/usb/dwc3/dwc3-st.c b/drivers/usb/dwc3/dwc3-st.c index c682420f25ca..c48fd6bb97b7 100644 --- a/drivers/usb/dwc3/dwc3-st.c +++ b/drivers/usb/dwc3/dwc3-st.c @@ -219,10 +219,8 @@ static int st_dwc3_probe(struct platform_device *pdev) dwc3_data->regmap = regmap; res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "syscfg-reg"); - if (!res) { - ret = -ENXIO; - goto undo_platform_dev_alloc; - } + if (!res) + return -ENXIO; dwc3_data->syscfg_reg_off = res->start; @@ -233,8 +231,7 @@ static int st_dwc3_probe(struct platform_device *pdev) devm_reset_control_get_exclusive(dev, "powerdown"); if (IS_ERR(dwc3_data->rstc_pwrdn)) { dev_err(&pdev->dev, "could not get power controller\n"); - ret = PTR_ERR(dwc3_data->rstc_pwrdn); - goto undo_platform_dev_alloc; + return PTR_ERR(dwc3_data->rstc_pwrdn); } /* Manage PowerDown */ @@ -269,7 +266,7 @@ static int st_dwc3_probe(struct platform_device *pdev) if (!child_pdev) { dev_err(dev, "failed to find dwc3 core device\n"); ret = -ENODEV; - goto err_node_put; + goto depopulate; } dwc3_data->dr_mode = usb_get_dr_mode(&child_pdev->dev); @@ -285,6 +282,7 @@ static int st_dwc3_probe(struct platform_device *pdev) ret = st_dwc3_drd_init(dwc3_data); if (ret) { dev_err(dev, "drd initialisation failed\n"); + of_platform_depopulate(dev); goto undo_softreset; } @@ -294,14 +292,14 @@ static int st_dwc3_probe(struct platform_device *pdev) platform_set_drvdata(pdev, dwc3_data); return 0; +depopulate: + of_platform_depopulate(dev); err_node_put: of_node_put(child); undo_softreset: reset_control_assert(dwc3_data->rstc_rst); undo_powerdown: reset_control_assert(dwc3_data->rstc_pwrdn); -undo_platform_dev_alloc: - platform_device_put(pdev); return ret; } diff --git a/drivers/usb/gadget/udc/core.c b/drivers/usb/gadget/udc/core.c index 1fabc2f90626..31ee1ae344d9 100644 --- a/drivers/usb/gadget/udc/core.c +++ b/drivers/usb/gadget/udc/core.c @@ -99,12 +99,10 @@ int usb_ep_enable(struct usb_ep *ep) goto out; /* UDC drivers can't handle endpoints with maxpacket size 0 */ - if (usb_endpoint_maxp(ep->desc) == 0) { - /* - * We should log an error message here, but we can't call - * dev_err() because there's no way to find the gadget - * given only ep. - */ + if (!ep->desc || usb_endpoint_maxp(ep->desc) == 0) { + WARN_ONCE(1, "%s: ep%d (%s) has %s\n", __func__, ep->address, ep->name, + (!ep->desc) ? "NULL descriptor" : "maxpacket 0"); + ret = -EINVAL; goto out; } diff --git a/drivers/usb/gadget/udc/fsl_udc_core.c b/drivers/usb/gadget/udc/fsl_udc_core.c index 9a05863b2876..6a4e206b1e2d 100644 --- a/drivers/usb/gadget/udc/fsl_udc_core.c +++ b/drivers/usb/gadget/udc/fsl_udc_core.c @@ -2503,7 +2503,7 @@ static int fsl_udc_probe(struct platform_device *pdev) /* setup the udc->eps[] for non-control endpoints and link * to gadget.ep_list */ for (i = 1; i < (int)(udc_controller->max_ep / 2); i++) { - char name[14]; + char name[16]; sprintf(name, "ep%dout", i); struct_ep_setup(udc_controller, i * 2, name, 1); diff --git a/drivers/usb/host/xhci.c b/drivers/usb/host/xhci.c index eb78091d1b35..dfc406be0856 100644 --- a/drivers/usb/host/xhci.c +++ b/drivers/usb/host/xhci.c @@ -2819,7 +2819,7 @@ static int xhci_configure_endpoint(struct xhci_hcd *xhci, xhci->num_active_eps); return -ENOMEM; } - if ((xhci->quirks & XHCI_SW_BW_CHECKING) && + if ((xhci->quirks & XHCI_SW_BW_CHECKING) && !ctx_change && xhci_reserve_bandwidth(xhci, virt_dev, command->in_ctx)) { if ((xhci->quirks & XHCI_EP_LIMIT_QUIRK)) xhci_free_host_resources(xhci, ctrl_ctx); @@ -4231,8 +4231,10 @@ static int xhci_setup_device(struct usb_hcd *hcd, struct usb_device *udev, mutex_unlock(&xhci->mutex); ret = xhci_disable_slot(xhci, udev->slot_id); xhci_free_virt_device(xhci, udev->slot_id); - if (!ret) - xhci_alloc_dev(hcd, udev); + if (!ret) { + if (xhci_alloc_dev(hcd, udev) == 1) + xhci_setup_addressable_virt_dev(xhci, udev); + } kfree(command->completion); kfree(command); return -EPROTO; diff --git a/drivers/usb/serial/option.c b/drivers/usb/serial/option.c index 6545b295be99..35bd9c10518f 100644 --- a/drivers/usb/serial/option.c +++ b/drivers/usb/serial/option.c @@ -619,6 +619,8 @@ static void option_instat_callback(struct urb *urb); /* MeiG Smart Technology products */ #define MEIGSMART_VENDOR_ID 0x2dee +/* MeiG Smart SRM825L based on Qualcomm 315 */ +#define MEIGSMART_PRODUCT_SRM825L 0x4d22 /* MeiG Smart SLM320 based on UNISOC UIS8910 */ #define MEIGSMART_PRODUCT_SLM320 0x4d41 @@ -2366,6 +2368,9 @@ static const struct usb_device_id option_ids[] = { { USB_DEVICE_AND_INTERFACE_INFO(UNISOC_VENDOR_ID, TOZED_PRODUCT_LT70C, 0xff, 0, 0) }, { USB_DEVICE_AND_INTERFACE_INFO(UNISOC_VENDOR_ID, LUAT_PRODUCT_AIR720U, 0xff, 0, 0) }, { USB_DEVICE_AND_INTERFACE_INFO(MEIGSMART_VENDOR_ID, MEIGSMART_PRODUCT_SLM320, 0xff, 0, 0) }, + { USB_DEVICE_AND_INTERFACE_INFO(MEIGSMART_VENDOR_ID, MEIGSMART_PRODUCT_SRM825L, 0xff, 0xff, 0x30) }, + { USB_DEVICE_AND_INTERFACE_INFO(MEIGSMART_VENDOR_ID, MEIGSMART_PRODUCT_SRM825L, 0xff, 0xff, 0x40) }, + { USB_DEVICE_AND_INTERFACE_INFO(MEIGSMART_VENDOR_ID, MEIGSMART_PRODUCT_SRM825L, 0xff, 0xff, 0x60) }, { } /* Terminating entry */ }; MODULE_DEVICE_TABLE(usb, option_ids); diff --git a/drivers/usb/serial/usb_debug.c b/drivers/usb/serial/usb_debug.c index aaf4813e4971..406cb326e812 100644 --- a/drivers/usb/serial/usb_debug.c +++ b/drivers/usb/serial/usb_debug.c @@ -69,6 +69,11 @@ static void usb_debug_process_read_urb(struct urb *urb) usb_serial_generic_process_read_urb(urb); } +static void usb_debug_init_termios(struct tty_struct *tty) +{ + tty->termios.c_lflag &= ~(ECHO | ECHONL); +} + static struct usb_serial_driver debug_device = { .driver = { .owner = THIS_MODULE, @@ -78,6 +83,7 @@ static struct usb_serial_driver debug_device = { .num_ports = 1, .bulk_out_size = USB_DEBUG_MAX_PACKET_SIZE, .break_ctl = usb_debug_break_ctl, + .init_termios = usb_debug_init_termios, .process_read_urb = usb_debug_process_read_urb, }; @@ -89,6 +95,7 @@ static struct usb_serial_driver dbc_device = { .id_table = dbc_id_table, .num_ports = 1, .break_ctl = usb_debug_break_ctl, + .init_termios = usb_debug_init_termios, .process_read_urb = usb_debug_process_read_urb, }; diff --git a/drivers/usb/usbip/vhci_hcd.c b/drivers/usb/usbip/vhci_hcd.c index 170abb06a8a4..ee8fa558e3ed 100644 --- a/drivers/usb/usbip/vhci_hcd.c +++ b/drivers/usb/usbip/vhci_hcd.c @@ -746,6 +746,7 @@ static int vhci_urb_enqueue(struct usb_hcd *hcd, struct urb *urb, gfp_t mem_flag * */ if (usb_pipedevice(urb->pipe) == 0) { + struct usb_device *old; __u8 type = usb_pipetype(urb->pipe); struct usb_ctrlrequest *ctrlreq = (struct usb_ctrlrequest *) urb->setup_packet; @@ -756,14 +757,15 @@ static int vhci_urb_enqueue(struct usb_hcd *hcd, struct urb *urb, gfp_t mem_flag goto no_need_xmit; } + old = vdev->udev; switch (ctrlreq->bRequest) { case USB_REQ_SET_ADDRESS: /* set_address may come when a device is reset */ dev_info(dev, "SetAddress Request (%d) to port %d\n", ctrlreq->wValue, vdev->rhport); - usb_put_dev(vdev->udev); vdev->udev = usb_get_dev(urb->dev); + usb_put_dev(old); spin_lock(&vdev->ud.lock); vdev->ud.status = VDEV_ST_USED; @@ -782,8 +784,8 @@ static int vhci_urb_enqueue(struct usb_hcd *hcd, struct urb *urb, gfp_t mem_flag usbip_dbg_vhci_hc( "Not yet?:Get_Descriptor to device 0 (get max pipe size)\n"); - usb_put_dev(vdev->udev); vdev->udev = usb_get_dev(urb->dev); + usb_put_dev(old); goto out; default: @@ -1090,6 +1092,7 @@ static void vhci_shutdown_connection(struct usbip_device *ud) static void vhci_device_reset(struct usbip_device *ud) { struct vhci_device *vdev = container_of(ud, struct vhci_device, ud); + struct usb_device *old = vdev->udev; unsigned long flags; spin_lock_irqsave(&ud->lock, flags); @@ -1097,8 +1100,8 @@ static void vhci_device_reset(struct usbip_device *ud) vdev->speed = 0; vdev->devid = 0; - usb_put_dev(vdev->udev); vdev->udev = NULL; + usb_put_dev(old); if (ud->tcp_socket) { sockfd_put(ud->tcp_socket); diff --git a/fs/binfmt_elf_fdpic.c b/fs/binfmt_elf_fdpic.c index 28aef31a6e6f..aeeba59fa734 100644 --- a/fs/binfmt_elf_fdpic.c +++ b/fs/binfmt_elf_fdpic.c @@ -320,7 +320,7 @@ static int load_elf_fdpic_binary(struct linux_binprm *bprm) else executable_stack = EXSTACK_DEFAULT; - if (stack_size == 0) { + if (stack_size == 0 && interp_params.flags & ELF_FDPIC_FLAG_PRESENT) { stack_size = interp_params.stack_size; if (interp_params.flags & ELF_FDPIC_FLAG_EXEC_STACK) executable_stack = EXSTACK_ENABLE_X; diff --git a/fs/binfmt_misc.c b/fs/binfmt_misc.c index 23b563ff0dd7..7557fb429df5 100644 --- a/fs/binfmt_misc.c +++ b/fs/binfmt_misc.c @@ -60,12 +60,11 @@ typedef struct { char *name; struct dentry *dentry; struct file *interp_file; + refcount_t users; /* sync removal with load_misc_binary() */ } Node; static DEFINE_RWLOCK(entries_lock); static struct file_system_type bm_fs_type; -static struct vfsmount *bm_mnt; -static int entry_count; /* * Max length of the register string. Determined by: @@ -82,19 +81,23 @@ static int entry_count; */ #define MAX_REGISTER_LENGTH 1920 -/* - * Check if we support the binfmt - * if we do, return the node, else NULL - * locking is done in load_misc_binary +/** + * search_binfmt_handler - search for a binary handler for @bprm + * @misc: handle to binfmt_misc instance + * @bprm: binary for which we are looking for a handler + * + * Search for a binary type handler for @bprm in the list of registered binary + * type handlers. + * + * Return: binary type list entry on success, NULL on failure */ -static Node *check_file(struct linux_binprm *bprm) +static Node *search_binfmt_handler(struct linux_binprm *bprm) { char *p = strrchr(bprm->interp, '.'); - struct list_head *l; + Node *e; /* Walk all the registered handlers. */ - list_for_each(l, &entries) { - Node *e = list_entry(l, Node, list); + list_for_each_entry(e, &entries, list) { char *s; int j; @@ -123,9 +126,49 @@ static Node *check_file(struct linux_binprm *bprm) if (j == e->size) return e; } + return NULL; } +/** + * get_binfmt_handler - try to find a binary type handler + * @misc: handle to binfmt_misc instance + * @bprm: binary for which we are looking for a handler + * + * Try to find a binfmt handler for the binary type. If one is found take a + * reference to protect against removal via bm_{entry,status}_write(). + * + * Return: binary type list entry on success, NULL on failure + */ +static Node *get_binfmt_handler(struct linux_binprm *bprm) +{ + Node *e; + + read_lock(&entries_lock); + e = search_binfmt_handler(bprm); + if (e) + refcount_inc(&e->users); + read_unlock(&entries_lock); + return e; +} + +/** + * put_binfmt_handler - put binary handler node + * @e: node to put + * + * Free node syncing with load_misc_binary() and defer final free to + * load_misc_binary() in case it is using the binary type handler we were + * requested to remove. + */ +static void put_binfmt_handler(Node *e) +{ + if (refcount_dec_and_test(&e->users)) { + if (e->flags & MISC_FMT_OPEN_FILE) + filp_close(e->interp_file, NULL); + kfree(e); + } +} + /* * the loader itself */ @@ -140,12 +183,7 @@ static int load_misc_binary(struct linux_binprm *bprm) if (!enabled) return retval; - /* to keep locking time low, we copy the interpreter string */ - read_lock(&entries_lock); - fmt = check_file(bprm); - if (fmt) - dget(fmt->dentry); - read_unlock(&entries_lock); + fmt = get_binfmt_handler(bprm); if (!fmt) return retval; @@ -239,7 +277,16 @@ static int load_misc_binary(struct linux_binprm *bprm) goto error; ret: - dput(fmt->dentry); + + /* + * If we actually put the node here all concurrent calls to + * load_misc_binary() will have finished. We also know + * that for the refcount to be zero ->evict_inode() must have removed + * the node to be deleted from the list. All that is left for us is to + * close and free. + */ + put_binfmt_handler(fmt); + return retval; error: if (fd_binary > 0) @@ -600,30 +647,90 @@ static struct inode *bm_get_inode(struct super_block *sb, int mode) return inode; } +/** + * bm_evict_inode - cleanup data associated with @inode + * @inode: inode to which the data is attached + * + * Cleanup the binary type handler data associated with @inode if a binary type + * entry is removed or the filesystem is unmounted and the super block is + * shutdown. + * + * If the ->evict call was not caused by a super block shutdown but by a write + * to remove the entry or all entries via bm_{entry,status}_write() the entry + * will have already been removed from the list. We keep the list_empty() check + * to make that explicit. +*/ static void bm_evict_inode(struct inode *inode) { Node *e = inode->i_private; - if (e && e->flags & MISC_FMT_OPEN_FILE) - filp_close(e->interp_file, NULL); - clear_inode(inode); - kfree(e); + + if (e) { + write_lock(&entries_lock); + if (!list_empty(&e->list)) + list_del_init(&e->list); + write_unlock(&entries_lock); + put_binfmt_handler(e); + } } -static void kill_node(Node *e) +/** + * unlink_binfmt_dentry - remove the dentry for the binary type handler + * @dentry: dentry associated with the binary type handler + * + * Do the actual filesystem work to remove a dentry for a registered binary + * type handler. Since binfmt_misc only allows simple files to be created + * directly under the root dentry of the filesystem we ensure that we are + * indeed passed a dentry directly beneath the root dentry, that the inode + * associated with the root dentry is locked, and that it is a regular file we + * are asked to remove. + */ +static void unlink_binfmt_dentry(struct dentry *dentry) { - struct dentry *dentry; + struct dentry *parent = dentry->d_parent; + struct inode *inode, *parent_inode; + /* All entries are immediate descendants of the root dentry. */ + if (WARN_ON_ONCE(dentry->d_sb->s_root != parent)) + return; + + /* We only expect to be called on regular files. */ + inode = d_inode(dentry); + if (WARN_ON_ONCE(!S_ISREG(inode->i_mode))) + return; + + /* The parent inode must be locked. */ + parent_inode = d_inode(parent); + if (WARN_ON_ONCE(!inode_is_locked(parent_inode))) + return; + + if (simple_positive(dentry)) { + dget(dentry); + simple_unlink(parent_inode, dentry); + d_delete(dentry); + dput(dentry); + } +} + +/** + * remove_binfmt_handler - remove a binary type handler + * @misc: handle to binfmt_misc instance + * @e: binary type handler to remove + * + * Remove a binary type handler from the list of binary type handlers and + * remove its associated dentry. This is called from + * binfmt_{entry,status}_write(). In the future, we might want to think about + * adding a proper ->unlink() method to binfmt_misc instead of forcing caller's + * to use writes to files in order to delete binary type handlers. But it has + * worked for so long that it's not a pressing issue. + */ +static void remove_binfmt_handler(Node *e) +{ write_lock(&entries_lock); list_del_init(&e->list); write_unlock(&entries_lock); - - dentry = e->dentry; - drop_nlink(d_inode(dentry)); - d_drop(dentry); - dput(dentry); - simple_release_fs(&bm_mnt, &entry_count); + unlink_binfmt_dentry(e->dentry); } /* / */ @@ -650,8 +757,8 @@ bm_entry_read(struct file *file, char __user *buf, size_t nbytes, loff_t *ppos) static ssize_t bm_entry_write(struct file *file, const char __user *buffer, size_t count, loff_t *ppos) { - struct dentry *root; - Node *e = file_inode(file)->i_private; + struct inode *inode = file_inode(file); + Node *e = inode->i_private; int res = parse_command(buffer, count); switch (res) { @@ -665,13 +772,22 @@ static ssize_t bm_entry_write(struct file *file, const char __user *buffer, break; case 3: /* Delete this handler. */ - root = file_inode(file)->i_sb->s_root; - inode_lock(d_inode(root)); + inode = d_inode(inode->i_sb->s_root); + inode_lock(inode); + /* + * In order to add new element or remove elements from the list + * via bm_{entry,register,status}_write() inode_lock() on the + * root inode must be held. + * The lock is exclusive ensuring that the list can't be + * modified. Only load_misc_binary() can access but does so + * read-only. So we only need to take the write lock when we + * actually remove the entry from the list. + */ if (!list_empty(&e->list)) - kill_node(e); + remove_binfmt_handler(e); - inode_unlock(d_inode(root)); + inode_unlock(inode); break; default: return res; @@ -730,13 +846,7 @@ static ssize_t bm_register_write(struct file *file, const char __user *buffer, if (!inode) goto out2; - err = simple_pin_fs(&bm_fs_type, &bm_mnt, &entry_count); - if (err) { - iput(inode); - inode = NULL; - goto out2; - } - + refcount_set(&e->users, 1); e->dentry = dget(dentry); inode->i_private = e; inode->i_fop = &bm_entry_operations; @@ -780,7 +890,8 @@ static ssize_t bm_status_write(struct file *file, const char __user *buffer, size_t count, loff_t *ppos) { int res = parse_command(buffer, count); - struct dentry *root; + Node *e, *next; + struct inode *inode; switch (res) { case 1: @@ -793,13 +904,22 @@ static ssize_t bm_status_write(struct file *file, const char __user *buffer, break; case 3: /* Delete all handlers. */ - root = file_inode(file)->i_sb->s_root; - inode_lock(d_inode(root)); + inode = d_inode(file_inode(file)->i_sb->s_root); + inode_lock(inode); - while (!list_empty(&entries)) - kill_node(list_first_entry(&entries, Node, list)); + /* + * In order to add new element or remove elements from the list + * via bm_{entry,register,status}_write() inode_lock() on the + * root inode must be held. + * The lock is exclusive ensuring that the list can't be + * modified. Only load_misc_binary() can access but does so + * read-only. So we only need to take the write lock when we + * actually remove the entry from the list. + */ + list_for_each_entry_safe(e, next, &entries, list) + remove_binfmt_handler(e); - inode_unlock(d_inode(root)); + inode_unlock(inode); break; default: return res; diff --git a/fs/btrfs/delayed-inode.c b/fs/btrfs/delayed-inode.c index 95afe5ef7500..e3a43bf63f06 100644 --- a/fs/btrfs/delayed-inode.c +++ b/fs/btrfs/delayed-inode.c @@ -988,7 +988,7 @@ static void btrfs_release_delayed_inode(struct btrfs_delayed_node *delayed_node) if (delayed_node && test_bit(BTRFS_DELAYED_NODE_INODE_DIRTY, &delayed_node->flags)) { - BUG_ON(!delayed_node->root); + ASSERT(delayed_node->root); clear_bit(BTRFS_DELAYED_NODE_INODE_DIRTY, &delayed_node->flags); delayed_node->count--; diff --git a/fs/btrfs/free-space-cache.c b/fs/btrfs/free-space-cache.c index 0cb93f73acb2..7819bae9be29 100644 --- a/fs/btrfs/free-space-cache.c +++ b/fs/btrfs/free-space-cache.c @@ -788,6 +788,7 @@ static int __load_free_space_cache(struct btrfs_root *root, struct inode *inode, spin_unlock(&ctl->tree_lock); btrfs_err(fs_info, "Duplicate entries in free space cache, dumping"); + kmem_cache_free(btrfs_free_space_bitmap_cachep, e->bitmap); kmem_cache_free(btrfs_free_space_cachep, e); goto free_cache; } @@ -1728,9 +1729,9 @@ static void bitmap_clear_bits(struct btrfs_free_space_ctl *ctl, ctl->free_space -= bytes; } -static void bitmap_set_bits(struct btrfs_free_space_ctl *ctl, - struct btrfs_free_space *info, u64 offset, - u64 bytes) +static void btrfs_bitmap_set_bits(struct btrfs_free_space_ctl *ctl, + struct btrfs_free_space *info, u64 offset, + u64 bytes) { unsigned long start, count; @@ -1987,7 +1988,7 @@ static u64 add_bytes_to_bitmap(struct btrfs_free_space_ctl *ctl, bytes_to_set = min(end - offset, bytes); - bitmap_set_bits(ctl, info, offset, bytes_to_set); + btrfs_bitmap_set_bits(ctl, info, offset, bytes_to_set); /* * We set some bytes, we have no idea what the max extent size is diff --git a/fs/btrfs/inode.c b/fs/btrfs/inode.c index 2c86be3fc25c..d2a988bf9c89 100644 --- a/fs/btrfs/inode.c +++ b/fs/btrfs/inode.c @@ -4520,7 +4520,14 @@ static noinline int may_destroy_subvol(struct btrfs_root *root) ret = btrfs_search_slot(NULL, fs_info->tree_root, &key, path, 0, 0); if (ret < 0) goto out; - BUG_ON(ret == 0); + if (ret == 0) { + /* + * Key with offset -1 found, there would have to exist a root + * with such id, but this is out of valid range. + */ + ret = -EUCLEAN; + goto out; + } ret = 0; if (path->slots[0] > 0) { diff --git a/fs/btrfs/qgroup.c b/fs/btrfs/qgroup.c index d6184b6206ff..7d0b7e58d66a 100644 --- a/fs/btrfs/qgroup.c +++ b/fs/btrfs/qgroup.c @@ -2603,8 +2603,6 @@ int btrfs_qgroup_account_extent(struct btrfs_trans_handle *trans, u64 bytenr, if (nr_old_roots == 0 && nr_new_roots == 0) goto out_free; - BUG_ON(!fs_info->quota_root); - trace_btrfs_qgroup_account_extent(fs_info, trans->transid, bytenr, num_bytes, nr_old_roots, nr_new_roots); diff --git a/fs/btrfs/send.c b/fs/btrfs/send.c index 576c027909f8..e1063ef3dece 100644 --- a/fs/btrfs/send.c +++ b/fs/btrfs/send.c @@ -692,7 +692,12 @@ static int begin_cmd(struct send_ctx *sctx, int cmd) if (WARN_ON(!sctx->send_buf)) return -EINVAL; - BUG_ON(sctx->send_size); + if (unlikely(sctx->send_size != 0)) { + btrfs_err(sctx->send_root->fs_info, + "send: command header buffer not empty cmd %d offset %llu", + cmd, sctx->send_off); + return -EINVAL; + } sctx->send_size += sizeof(*hdr); hdr = (struct btrfs_cmd_header *)sctx->send_buf; diff --git a/fs/exec.c b/fs/exec.c index 4a3a1afbfef0..f835ac250a95 100644 --- a/fs/exec.c +++ b/fs/exec.c @@ -1542,6 +1542,7 @@ static void bprm_fill_uid(struct linux_binprm *bprm) unsigned int mode; kuid_t uid; kgid_t gid; + int err; /* * Since this can be called multiple times (via prepare_binprm), @@ -1566,12 +1567,17 @@ static void bprm_fill_uid(struct linux_binprm *bprm) /* Be careful if suid/sgid is set */ inode_lock(inode); - /* reload atomically mode/uid/gid now that lock held */ + /* Atomically reload and check mode/uid/gid now that lock held. */ mode = inode->i_mode; uid = inode->i_uid; gid = inode->i_gid; + err = inode_permission(inode, MAY_EXEC); inode_unlock(inode); + /* Did the exec bit vanish out from under us? Give up. */ + if (err) + return; + /* We ignore suid/sgid if there are no mappings for them in the ns */ if (!kuid_has_mapping(bprm->cred->user_ns, uid) || !kgid_has_mapping(bprm->cred->user_ns, gid)) diff --git a/fs/ext4/extents.c b/fs/ext4/extents.c index 90b12c7c0f20..fed3dfed2c24 100644 --- a/fs/ext4/extents.c +++ b/fs/ext4/extents.c @@ -3591,9 +3591,10 @@ static int ext4_ext_convert_to_initialized(handle_t *handle, struct ext4_extent *ex, *abut_ex; ext4_lblk_t ee_block, eof_block; unsigned int ee_len, depth, map_len = map->m_len; - int allocated = 0, max_zeroout = 0; int err = 0; int split_flag = EXT4_EXT_DATA_VALID2; + int allocated = 0; + unsigned int max_zeroout = 0; ext_debug("ext4_ext_convert_to_initialized: inode %lu, logical" "block %llu, max_blocks %u\n", inode->i_ino, diff --git a/fs/ext4/mballoc.c b/fs/ext4/mballoc.c index b2e7b1907d41..b268dc0e1df4 100644 --- a/fs/ext4/mballoc.c +++ b/fs/ext4/mballoc.c @@ -1850,8 +1850,7 @@ int ext4_mb_find_by_goal(struct ext4_allocation_context *ac, if (max >= ac->ac_g_ex.fe_len && ac->ac_g_ex.fe_len == sbi->s_stripe) { ext4_fsblk_t start; - start = ext4_group_first_block_no(ac->ac_sb, e4b->bd_group) + - ex.fe_start; + start = ext4_grp_offs_to_block(ac->ac_sb, &ex); /* use do_div to get remainder (would be 64-bit modulo) */ if (do_div(start, sbi->s_stripe) == 0) { ac->ac_found++; @@ -5228,6 +5227,9 @@ static int ext4_try_to_trim_range(struct super_block *sb, bool set_trimmed = false; void *bitmap; + if (unlikely(EXT4_MB_GRP_BBITMAP_CORRUPT(e4b->bd_info))) + return 0; + last = ext4_last_grp_cluster(sb, e4b->bd_group); bitmap = e4b->bd_bitmap; if (start == 0 && max >= last) diff --git a/fs/ext4/namei.c b/fs/ext4/namei.c index 33a122a2619d..3ad92e7060cf 100644 --- a/fs/ext4/namei.c +++ b/fs/ext4/namei.c @@ -135,10 +135,11 @@ static struct buffer_head *__ext4_read_dirblock(struct inode *inode, return bh; } - if (!bh && (type == INDEX || type == DIRENT_HTREE)) { + /* The first directory block must not be a hole. */ + if (!bh && (type == INDEX || type == DIRENT_HTREE || block == 0)) { ext4_error_inode(inode, func, line, block, - "Directory hole found for htree %s block", - (type == INDEX) ? "index" : "leaf"); + "Directory hole found for htree %s block %u", + (type == INDEX) ? "index" : "leaf", block); return ERR_PTR(-EFSCORRUPTED); } if (!bh) @@ -2175,6 +2176,52 @@ static int add_dirent_to_buf(handle_t *handle, struct ext4_filename *fname, return 0; } +static bool ext4_check_dx_root(struct inode *dir, struct dx_root *root) +{ + struct fake_dirent *fde; + const char *error_msg; + unsigned int rlen; + unsigned int blocksize = dir->i_sb->s_blocksize; + char *blockend = (char *)root + dir->i_sb->s_blocksize; + + fde = &root->dot; + if (unlikely(fde->name_len != 1)) { + error_msg = "invalid name_len for '.'"; + goto corrupted; + } + if (unlikely(strncmp(root->dot_name, ".", fde->name_len))) { + error_msg = "invalid name for '.'"; + goto corrupted; + } + rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize); + if (unlikely((char *)fde + rlen >= blockend)) { + error_msg = "invalid rec_len for '.'"; + goto corrupted; + } + + fde = &root->dotdot; + if (unlikely(fde->name_len != 2)) { + error_msg = "invalid name_len for '..'"; + goto corrupted; + } + if (unlikely(strncmp(root->dotdot_name, "..", fde->name_len))) { + error_msg = "invalid name for '..'"; + goto corrupted; + } + rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize); + if (unlikely((char *)fde + rlen >= blockend)) { + error_msg = "invalid rec_len for '..'"; + goto corrupted; + } + + return true; + +corrupted: + EXT4_ERROR_INODE(dir, "Corrupt dir, %s, running e2fsck is recommended", + error_msg); + return false; +} + /* * This converts a one block unindexed directory to a 3 block indexed * directory, and adds the dentry to the indexed directory. @@ -2208,17 +2255,17 @@ static int make_indexed_dir(handle_t *handle, struct ext4_filename *fname, brelse(bh); return retval; } + root = (struct dx_root *) bh->b_data; + if (!ext4_check_dx_root(dir, root)) { + brelse(bh); + return -EFSCORRUPTED; + } /* The 0th block becomes the root, move the dirents out */ fde = &root->dotdot; de = (struct ext4_dir_entry_2 *)((char *)fde + ext4_rec_len_from_disk(fde->rec_len, blocksize)); - if ((char *) de >= (((char *) root) + blocksize)) { - EXT4_ERROR_INODE(dir, "invalid rec_len for '..'"); - brelse(bh); - return -EFSCORRUPTED; - } len = ((char *) root) + (blocksize - csum_size) - (char *) de; /* Allocate new block for the 0th block's dirents */ @@ -2997,10 +3044,7 @@ bool ext4_empty_dir(struct inode *inode) EXT4_ERROR_INODE(inode, "invalid size"); return true; } - /* The first directory block must not be a hole, - * so treat it as DIRENT_HTREE - */ - bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE); + bh = ext4_read_dirblock(inode, 0, EITHER); if (IS_ERR(bh)) return true; @@ -3594,10 +3638,7 @@ static struct buffer_head *ext4_get_first_dir_block(handle_t *handle, struct ext4_dir_entry_2 *de; unsigned int offset; - /* The first directory block must not be a hole, so - * treat it as DIRENT_HTREE - */ - bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE); + bh = ext4_read_dirblock(inode, 0, EITHER); if (IS_ERR(bh)) { *retval = PTR_ERR(bh); return NULL; diff --git a/fs/ext4/xattr.c b/fs/ext4/xattr.c index cb7faaa935cc..d65f1eb85a92 100644 --- a/fs/ext4/xattr.c +++ b/fs/ext4/xattr.c @@ -1396,6 +1396,12 @@ retry: goto out; memcpy(bh->b_data, buf, csize); + /* + * Zero out block tail to avoid writing uninitialized memory + * to disk. + */ + if (csize < blocksize) + memset(bh->b_data + csize, 0, blocksize - csize); set_buffer_uptodate(bh); ext4_handle_dirty_metadata(handle, ea_inode, bh); diff --git a/fs/f2fs/inode.c b/fs/f2fs/inode.c index f617dbcdd099..8e593677c1f6 100644 --- a/fs/f2fs/inode.c +++ b/fs/f2fs/inode.c @@ -23,6 +23,9 @@ void f2fs_mark_inode_dirty_sync(struct inode *inode, bool sync) if (is_inode_flag_set(inode, FI_NEW_INODE)) return; + if (f2fs_readonly(F2FS_I_SB(inode)->sb)) + return; + if (f2fs_inode_dirtied(inode, sync)) return; diff --git a/fs/f2fs/segment.c b/fs/f2fs/segment.c index dff5bf7f455b..4efdfb3b1295 100644 --- a/fs/f2fs/segment.c +++ b/fs/f2fs/segment.c @@ -2138,6 +2138,8 @@ static void update_sit_entry(struct f2fs_sb_info *sbi, block_t blkaddr, int del) #endif segno = GET_SEGNO(sbi, blkaddr); + if (segno == NULL_SEGNO) + return; se = get_seg_entry(sbi, segno); new_vblocks = se->valid_blocks + del; @@ -3149,8 +3151,7 @@ void f2fs_allocate_data_block(struct f2fs_sb_info *sbi, struct page *page, * since SSR needs latest valid block information. */ update_sit_entry(sbi, *new_blkaddr, 1); - if (GET_SEGNO(sbi, old_blkaddr) != NULL_SEGNO) - update_sit_entry(sbi, old_blkaddr, -1); + update_sit_entry(sbi, old_blkaddr, -1); if (!__has_curseg_space(sbi, type)) sit_i->s_ops->allocate_segment(sbi, type, false); diff --git a/fs/file.c b/fs/file.c index 64892b744419..cf7c04f35564 100644 --- a/fs/file.c +++ b/fs/file.c @@ -41,27 +41,23 @@ static void free_fdtable_rcu(struct rcu_head *rcu) #define BITBIT_NR(nr) BITS_TO_LONGS(BITS_TO_LONGS(nr)) #define BITBIT_SIZE(nr) (BITBIT_NR(nr) * sizeof(long)) +#define fdt_words(fdt) ((fdt)->max_fds / BITS_PER_LONG) // words in ->open_fds /* * Copy 'count' fd bits from the old table to the new table and clear the extra * space if any. This does not copy the file pointers. Called with the files * spinlock held for write. */ -static void copy_fd_bitmaps(struct fdtable *nfdt, struct fdtable *ofdt, - unsigned int count) +static inline void copy_fd_bitmaps(struct fdtable *nfdt, struct fdtable *ofdt, + unsigned int copy_words) { - unsigned int cpy, set; + unsigned int nwords = fdt_words(nfdt); - cpy = count / BITS_PER_BYTE; - set = (nfdt->max_fds - count) / BITS_PER_BYTE; - memcpy(nfdt->open_fds, ofdt->open_fds, cpy); - memset((char *)nfdt->open_fds + cpy, 0, set); - memcpy(nfdt->close_on_exec, ofdt->close_on_exec, cpy); - memset((char *)nfdt->close_on_exec + cpy, 0, set); - - cpy = BITBIT_SIZE(count); - set = BITBIT_SIZE(nfdt->max_fds) - cpy; - memcpy(nfdt->full_fds_bits, ofdt->full_fds_bits, cpy); - memset((char *)nfdt->full_fds_bits + cpy, 0, set); + bitmap_copy_and_extend(nfdt->open_fds, ofdt->open_fds, + copy_words * BITS_PER_LONG, nwords * BITS_PER_LONG); + bitmap_copy_and_extend(nfdt->close_on_exec, ofdt->close_on_exec, + copy_words * BITS_PER_LONG, nwords * BITS_PER_LONG); + bitmap_copy_and_extend(nfdt->full_fds_bits, ofdt->full_fds_bits, + copy_words, nwords); } /* @@ -79,7 +75,7 @@ static void copy_fdtable(struct fdtable *nfdt, struct fdtable *ofdt) memcpy(nfdt->fd, ofdt->fd, cpy); memset((char *)nfdt->fd + cpy, 0, set); - copy_fd_bitmaps(nfdt, ofdt, ofdt->max_fds); + copy_fd_bitmaps(nfdt, ofdt, fdt_words(ofdt)); } static struct fdtable * alloc_fdtable(unsigned int nr) @@ -330,7 +326,7 @@ struct files_struct *dup_fd(struct files_struct *oldf, int *errorp) open_files = count_open_files(old_fdt); } - copy_fd_bitmaps(new_fdt, old_fdt, open_files); + copy_fd_bitmaps(new_fdt, old_fdt, open_files / BITS_PER_LONG); old_fds = old_fdt->fd; new_fds = new_fdt->fd; @@ -908,6 +904,7 @@ __releases(&files->file_lock) * tables and this condition does not arise without those. */ fdt = files_fdtable(files); + fd = array_index_nospec(fd, fdt->max_fds); tofree = fdt->fd[fd]; if (!tofree && fd_is_open(fd, fdt)) goto Ebusy; diff --git a/fs/fuse/dev.c b/fs/fuse/dev.c index 94e580358e76..55b271339440 100644 --- a/fs/fuse/dev.c +++ b/fs/fuse/dev.c @@ -1627,9 +1627,11 @@ static int fuse_notify_store(struct fuse_conn *fc, unsigned int size, this_num = min_t(unsigned, num, PAGE_SIZE - offset); err = fuse_copy_page(cs, &page, offset, this_num, 0); - if (!err && offset == 0 && - (this_num == PAGE_SIZE || file_size == end)) + if (!PageUptodate(page) && !err && offset == 0 && + (this_num == PAGE_SIZE || file_size == end)) { + zero_user_segment(page, this_num, PAGE_SIZE); SetPageUptodate(page); + } unlock_page(page); put_page(page); diff --git a/fs/fuse/virtio_fs.c b/fs/fuse/virtio_fs.c index fadf6fb90fe2..48f144d08381 100644 --- a/fs/fuse/virtio_fs.c +++ b/fs/fuse/virtio_fs.c @@ -237,6 +237,16 @@ static int virtio_fs_read_tag(struct virtio_device *vdev, struct virtio_fs *fs) return -ENOMEM; memcpy(fs->tag, tag_buf, len); fs->tag[len] = '\0'; + + /* While the VIRTIO specification allows any character, newlines are + * awkward on mount(8) command-lines and cause problems in the sysfs + * "tag" attr and uevent TAG= properties. Forbid them. + */ + if (strchr(fs->tag, '\n')) { + dev_dbg(&vdev->dev, "refusing virtiofs tag with newline character\n"); + return -EINVAL; + } + return 0; } diff --git a/fs/gfs2/inode.c b/fs/gfs2/inode.c index 988bb7b17ed8..4e0c933e0800 100644 --- a/fs/gfs2/inode.c +++ b/fs/gfs2/inode.c @@ -1869,7 +1869,7 @@ static int setattr_chown(struct inode *inode, struct iattr *attr) kuid_t ouid, nuid; kgid_t ogid, ngid; int error; - struct gfs2_alloc_parms ap; + struct gfs2_alloc_parms ap = {}; ouid = inode->i_uid; ogid = inode->i_gid; diff --git a/fs/hfs/inode.c b/fs/hfs/inode.c index ee2ea5532e69..c58792cab2be 100644 --- a/fs/hfs/inode.c +++ b/fs/hfs/inode.c @@ -199,6 +199,7 @@ struct inode *hfs_new_inode(struct inode *dir, const struct qstr *name, umode_t HFS_I(inode)->flags = 0; HFS_I(inode)->rsrc_inode = NULL; HFS_I(inode)->fs_blocks = 0; + HFS_I(inode)->tz_secondswest = sys_tz.tz_minuteswest * 60; if (S_ISDIR(mode)) { inode->i_size = 2; HFS_SB(sb)->folder_count++; @@ -274,6 +275,8 @@ void hfs_inode_read_fork(struct inode *inode, struct hfs_extent *ext, for (count = 0, i = 0; i < 3; i++) count += be16_to_cpu(ext[i].count); HFS_I(inode)->first_blocks = count; + HFS_I(inode)->cached_start = 0; + HFS_I(inode)->cached_blocks = 0; inode->i_size = HFS_I(inode)->phys_size = log_size; HFS_I(inode)->fs_blocks = (log_size + sb->s_blocksize - 1) >> sb->s_blocksize_bits; diff --git a/fs/hfsplus/bfind.c b/fs/hfsplus/bfind.c index ca2ba8c9f82e..901e83d65d20 100644 --- a/fs/hfsplus/bfind.c +++ b/fs/hfsplus/bfind.c @@ -25,19 +25,8 @@ int hfs_find_init(struct hfs_btree *tree, struct hfs_find_data *fd) fd->key = ptr + tree->max_key_len + 2; hfs_dbg(BNODE_REFS, "find_init: %d (%p)\n", tree->cnid, __builtin_return_address(0)); - switch (tree->cnid) { - case HFSPLUS_CAT_CNID: - mutex_lock_nested(&tree->tree_lock, CATALOG_BTREE_MUTEX); - break; - case HFSPLUS_EXT_CNID: - mutex_lock_nested(&tree->tree_lock, EXTENTS_BTREE_MUTEX); - break; - case HFSPLUS_ATTR_CNID: - mutex_lock_nested(&tree->tree_lock, ATTR_BTREE_MUTEX); - break; - default: - BUG(); - } + mutex_lock_nested(&tree->tree_lock, + hfsplus_btree_lock_class(tree)); return 0; } diff --git a/fs/hfsplus/extents.c b/fs/hfsplus/extents.c index 7054a542689f..c95a2f0ed4a7 100644 --- a/fs/hfsplus/extents.c +++ b/fs/hfsplus/extents.c @@ -430,7 +430,8 @@ int hfsplus_free_fork(struct super_block *sb, u32 cnid, hfsplus_free_extents(sb, ext_entry, total_blocks - start, total_blocks); total_blocks = start; - mutex_lock(&fd.tree->tree_lock); + mutex_lock_nested(&fd.tree->tree_lock, + hfsplus_btree_lock_class(fd.tree)); } while (total_blocks > blocks); hfs_find_exit(&fd); @@ -592,7 +593,8 @@ void hfsplus_file_truncate(struct inode *inode) alloc_cnt, alloc_cnt - blk_cnt); hfsplus_dump_extent(hip->first_extents); hip->first_blocks = blk_cnt; - mutex_lock(&fd.tree->tree_lock); + mutex_lock_nested(&fd.tree->tree_lock, + hfsplus_btree_lock_class(fd.tree)); break; } res = __hfsplus_ext_cache_extent(&fd, inode, alloc_cnt); @@ -606,7 +608,8 @@ void hfsplus_file_truncate(struct inode *inode) hfsplus_free_extents(sb, hip->cached_extents, alloc_cnt - start, alloc_cnt - blk_cnt); hfsplus_dump_extent(hip->cached_extents); - mutex_lock(&fd.tree->tree_lock); + mutex_lock_nested(&fd.tree->tree_lock, + hfsplus_btree_lock_class(fd.tree)); if (blk_cnt > start) { hip->extent_state |= HFSPLUS_EXT_DIRTY; break; diff --git a/fs/hfsplus/hfsplus_fs.h b/fs/hfsplus/hfsplus_fs.h index 9580179ff535..909e03956c3f 100644 --- a/fs/hfsplus/hfsplus_fs.h +++ b/fs/hfsplus/hfsplus_fs.h @@ -539,6 +539,27 @@ int hfsplus_read_wrapper(struct super_block *sb); #define __hfsp_mt2ut(t) (be32_to_cpu(t) - 2082844800U) #define __hfsp_ut2mt(t) (cpu_to_be32(t + 2082844800U)) +static inline enum hfsplus_btree_mutex_classes +hfsplus_btree_lock_class(struct hfs_btree *tree) +{ + enum hfsplus_btree_mutex_classes class; + + switch (tree->cnid) { + case HFSPLUS_CAT_CNID: + class = CATALOG_BTREE_MUTEX; + break; + case HFSPLUS_EXT_CNID: + class = EXTENTS_BTREE_MUTEX; + break; + case HFSPLUS_ATTR_CNID: + class = ATTR_BTREE_MUTEX; + break; + default: + BUG(); + } + return class; +} + /* compatibility */ #define hfsp_mt2ut(t) (struct timespec){ .tv_sec = __hfsp_mt2ut(t) } #define hfsp_ut2mt(t) __hfsp_ut2mt((t).tv_sec) diff --git a/fs/inode.c b/fs/inode.c index 21ab82291b37..36359bf006c7 100644 --- a/fs/inode.c +++ b/fs/inode.c @@ -451,6 +451,39 @@ static void inode_lru_list_del(struct inode *inode) this_cpu_dec(nr_unused); } +static void inode_pin_lru_isolating(struct inode *inode) +{ + lockdep_assert_held(&inode->i_lock); + WARN_ON(inode->i_state & (I_LRU_ISOLATING | I_FREEING | I_WILL_FREE)); + inode->i_state |= I_LRU_ISOLATING; +} + +static void inode_unpin_lru_isolating(struct inode *inode) +{ + spin_lock(&inode->i_lock); + WARN_ON(!(inode->i_state & I_LRU_ISOLATING)); + inode->i_state &= ~I_LRU_ISOLATING; + smp_mb(); + wake_up_bit(&inode->i_state, __I_LRU_ISOLATING); + spin_unlock(&inode->i_lock); +} + +static void inode_wait_for_lru_isolating(struct inode *inode) +{ + spin_lock(&inode->i_lock); + if (inode->i_state & I_LRU_ISOLATING) { + DEFINE_WAIT_BIT(wq, &inode->i_state, __I_LRU_ISOLATING); + wait_queue_head_t *wqh; + + wqh = bit_waitqueue(&inode->i_state, __I_LRU_ISOLATING); + spin_unlock(&inode->i_lock); + __wait_on_bit(wqh, &wq, bit_wait, TASK_UNINTERRUPTIBLE); + spin_lock(&inode->i_lock); + WARN_ON(inode->i_state & I_LRU_ISOLATING); + } + spin_unlock(&inode->i_lock); +} + /** * inode_sb_list_add - add inode to the superblock list of inodes * @inode: inode to add @@ -563,6 +596,8 @@ static void evict(struct inode *inode) inode_sb_list_del(inode); + inode_wait_for_lru_isolating(inode); + /* * Wait for flusher thread to be done with the inode so that filesystem * does not start destroying it while writeback is still running. Since @@ -762,7 +797,7 @@ static enum lru_status inode_lru_isolate(struct list_head *item, } if (inode_has_buffers(inode) || inode->i_data.nrpages) { - __iget(inode); + inode_pin_lru_isolating(inode); spin_unlock(&inode->i_lock); spin_unlock(lru_lock); if (remove_inode_buffers(inode)) { @@ -775,7 +810,7 @@ static enum lru_status inode_lru_isolate(struct list_head *item, if (current->reclaim_state) current->reclaim_state->reclaimed_slab += reap; } - iput(inode); + inode_unpin_lru_isolating(inode); spin_lock(lru_lock); return LRU_RETRY; } diff --git a/fs/jbd2/journal.c b/fs/jbd2/journal.c index 81bd7b29a10b..cfa21c29f312 100644 --- a/fs/jbd2/journal.c +++ b/fs/jbd2/journal.c @@ -408,6 +408,7 @@ repeat: tmp = jbd2_alloc(bh_in->b_size, GFP_NOFS); if (!tmp) { brelse(new_bh); + free_buffer_head(new_bh); return -ENOMEM; } jbd_lock_bh_state(bh_in); diff --git a/fs/jfs/jfs_imap.c b/fs/jfs/jfs_imap.c index b0965f3ef186..36ed75682064 100644 --- a/fs/jfs/jfs_imap.c +++ b/fs/jfs/jfs_imap.c @@ -292,7 +292,7 @@ int diSync(struct inode *ipimap) int diRead(struct inode *ip) { struct jfs_sb_info *sbi = JFS_SBI(ip->i_sb); - int iagno, ino, extno, rc; + int iagno, ino, extno, rc, agno; struct inode *ipimap; struct dinode *dp; struct iag *iagp; @@ -341,8 +341,11 @@ int diRead(struct inode *ip) /* get the ag for the iag */ agstart = le64_to_cpu(iagp->agstart); + agno = BLKTOAG(agstart, JFS_SBI(ip->i_sb)); release_metapage(mp); + if (agno >= MAXAG || agno < 0) + return -EIO; rel_inode = (ino & (INOSPERPAGE - 1)); pageno = blkno >> sbi->l2nbperpage; diff --git a/fs/locks.c b/fs/locks.c index 85c8af53d4eb..cf6ed857664b 100644 --- a/fs/locks.c +++ b/fs/locks.c @@ -2542,7 +2542,7 @@ int fcntl_setlk(unsigned int fd, struct file *filp, unsigned int cmd, f = fcheck(fd); spin_unlock(¤t->files->file_lock); if (f != filp) { - locks_remove_posix(filp, ¤t->files); + locks_remove_posix(filp, current->files); error = -EBADF; } } @@ -2672,7 +2672,7 @@ int fcntl_setlk64(unsigned int fd, struct file *filp, unsigned int cmd, f = fcheck(fd); spin_unlock(¤t->files->file_lock); if (f != filp) { - locks_remove_posix(filp, ¤t->files); + locks_remove_posix(filp, current->files); error = -EBADF; } } diff --git a/fs/nfs/pnfs.c b/fs/nfs/pnfs.c index 3b19fa74b062..3f7d905d7528 100644 --- a/fs/nfs/pnfs.c +++ b/fs/nfs/pnfs.c @@ -1953,6 +1953,14 @@ pnfs_update_layout(struct inode *ino, } lookup_again: + if (!nfs4_valid_open_stateid(ctx->state)) { + trace_pnfs_update_layout(ino, pos, count, + iomode, lo, lseg, + PNFS_UPDATE_LAYOUT_INVALID_OPEN); + lseg = ERR_PTR(-EIO); + goto out; + } + lseg = ERR_PTR(nfs4_client_recover_expired_lease(clp)); if (IS_ERR(lseg)) goto out; diff --git a/fs/nilfs2/btnode.c b/fs/nilfs2/btnode.c index 1776121677e2..28a726553318 100644 --- a/fs/nilfs2/btnode.c +++ b/fs/nilfs2/btnode.c @@ -51,12 +51,21 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr) bh = nilfs_grab_buffer(inode, btnc, blocknr, BIT(BH_NILFS_Node)); if (unlikely(!bh)) - return NULL; + return ERR_PTR(-ENOMEM); if (unlikely(buffer_mapped(bh) || buffer_uptodate(bh) || buffer_dirty(bh))) { - brelse(bh); - BUG(); + /* + * The block buffer at the specified new address was already + * in use. This can happen if it is a virtual block number + * and has been reallocated due to corruption of the bitmap + * used to manage its allocation state (if not, the buffer + * clearing of an abandoned b-tree node is missing somewhere). + */ + nilfs_error(inode->i_sb, + "state inconsistency probably due to duplicate use of b-tree node block address %llu (ino=%lu)", + (unsigned long long)blocknr, inode->i_ino); + goto failed; } memset(bh->b_data, 0, i_blocksize(inode)); bh->b_bdev = inode->i_sb->s_bdev; @@ -67,6 +76,12 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr) unlock_page(bh->b_page); put_page(bh->b_page); return bh; + +failed: + unlock_page(bh->b_page); + put_page(bh->b_page); + brelse(bh); + return ERR_PTR(-EIO); } int nilfs_btnode_submit_block(struct address_space *btnc, __u64 blocknr, @@ -217,8 +232,8 @@ retry: } nbh = nilfs_btnode_create_block(btnc, newkey); - if (!nbh) - return -ENOMEM; + if (IS_ERR(nbh)) + return PTR_ERR(nbh); BUG_ON(nbh == obh); ctxt->newbh = nbh; diff --git a/fs/nilfs2/btree.c b/fs/nilfs2/btree.c index 4905b7cd7bf3..a426e4e2acda 100644 --- a/fs/nilfs2/btree.c +++ b/fs/nilfs2/btree.c @@ -63,8 +63,8 @@ static int nilfs_btree_get_new_block(const struct nilfs_bmap *btree, struct buffer_head *bh; bh = nilfs_btnode_create_block(btnc, ptr); - if (!bh) - return -ENOMEM; + if (IS_ERR(bh)) + return PTR_ERR(bh); set_buffer_nilfs_volatile(bh); *bhp = bh; diff --git a/fs/nilfs2/segment.c b/fs/nilfs2/segment.c index 23b24ec79527..3c4272762779 100644 --- a/fs/nilfs2/segment.c +++ b/fs/nilfs2/segment.c @@ -134,14 +134,9 @@ static void nilfs_segctor_do_flush(struct nilfs_sc_info *, int); static void nilfs_segctor_do_immediate_flush(struct nilfs_sc_info *); static void nilfs_dispose_list(struct the_nilfs *, struct list_head *, int); -#define nilfs_cnt32_gt(a, b) \ - (typecheck(__u32, a) && typecheck(__u32, b) && \ - ((__s32)(b) - (__s32)(a) < 0)) #define nilfs_cnt32_ge(a, b) \ (typecheck(__u32, a) && typecheck(__u32, b) && \ - ((__s32)(a) - (__s32)(b) >= 0)) -#define nilfs_cnt32_lt(a, b) nilfs_cnt32_gt(b, a) -#define nilfs_cnt32_le(a, b) nilfs_cnt32_ge(b, a) + ((__s32)((a) - (b)) >= 0)) static int nilfs_prepare_segment_lock(struct super_block *sb, struct nilfs_transaction_info *ti) diff --git a/fs/quota/dquot.c b/fs/quota/dquot.c index a7ddb874912d..14c0dd5b65a4 100644 --- a/fs/quota/dquot.c +++ b/fs/quota/dquot.c @@ -986,9 +986,8 @@ we_slept: * smp_mb__before_atomic() in dquot_acquire(). */ smp_rmb(); -#ifdef CONFIG_QUOTA_DEBUG - BUG_ON(!dquot->dq_sb); /* Has somebody invalidated entry under us? */ -#endif + /* Has somebody invalidated entry under us? */ + WARN_ON_ONCE(hlist_unhashed(&dquot->dq_hash)); out: if (empty) do_destroy_dquot(empty); diff --git a/fs/udf/balloc.c b/fs/udf/balloc.c index f416b7fe092f..aa73ab1b50a5 100644 --- a/fs/udf/balloc.c +++ b/fs/udf/balloc.c @@ -22,6 +22,7 @@ #include "udfdecl.h" #include +#include #include "udf_i.h" #include "udf_sb.h" @@ -68,8 +69,12 @@ static int read_block_bitmap(struct super_block *sb, } for (i = 0; i < count; i++) - if (udf_test_bit(i + off, bh->b_data)) + if (udf_test_bit(i + off, bh->b_data)) { + bitmap->s_block_bitmap[bitmap_nr] = + ERR_PTR(-EFSCORRUPTED); + brelse(bh); return -EFSCORRUPTED; + } return 0; } @@ -85,8 +90,15 @@ static int __load_block_bitmap(struct super_block *sb, block_group, nr_groups); } - if (bitmap->s_block_bitmap[block_group]) + if (bitmap->s_block_bitmap[block_group]) { + /* + * The bitmap failed verification in the past. No point in + * trying again. + */ + if (IS_ERR(bitmap->s_block_bitmap[block_group])) + return PTR_ERR(bitmap->s_block_bitmap[block_group]); return block_group; + } retval = read_block_bitmap(sb, bitmap, block_group, block_group); if (retval < 0) @@ -133,7 +145,6 @@ static void udf_bitmap_free_blocks(struct super_block *sb, { struct udf_sb_info *sbi = UDF_SB(sb); struct buffer_head *bh = NULL; - struct udf_part_map *partmap; unsigned long block; unsigned long block_group; unsigned long bit; @@ -142,19 +153,9 @@ static void udf_bitmap_free_blocks(struct super_block *sb, unsigned long overflow; mutex_lock(&sbi->s_alloc_mutex); - partmap = &sbi->s_partmaps[bloc->partitionReferenceNum]; - if (bloc->logicalBlockNum + count < count || - (bloc->logicalBlockNum + count) > partmap->s_partition_len) { - udf_debug("%u < %d || %u + %u > %u\n", - bloc->logicalBlockNum, 0, - bloc->logicalBlockNum, count, - partmap->s_partition_len); - goto error_return; - } - + /* We make sure this cannot overflow when mounting the filesystem */ block = bloc->logicalBlockNum + offset + (sizeof(struct spaceBitmapDesc) << 3); - do { overflow = 0; block_group = block >> (sb->s_blocksize_bits + 3); @@ -384,7 +385,6 @@ static void udf_table_free_blocks(struct super_block *sb, uint32_t count) { struct udf_sb_info *sbi = UDF_SB(sb); - struct udf_part_map *partmap; uint32_t start, end; uint32_t elen; struct kernel_lb_addr eloc; @@ -393,16 +393,6 @@ static void udf_table_free_blocks(struct super_block *sb, struct udf_inode_info *iinfo; mutex_lock(&sbi->s_alloc_mutex); - partmap = &sbi->s_partmaps[bloc->partitionReferenceNum]; - if (bloc->logicalBlockNum + count < count || - (bloc->logicalBlockNum + count) > partmap->s_partition_len) { - udf_debug("%u < %d || %u + %u > %u\n", - bloc->logicalBlockNum, 0, - bloc->logicalBlockNum, count, - partmap->s_partition_len); - goto error_return; - } - iinfo = UDF_I(table); udf_add_free_space(sb, sbi->s_partition, count); @@ -677,6 +667,17 @@ void udf_free_blocks(struct super_block *sb, struct inode *inode, { uint16_t partition = bloc->partitionReferenceNum; struct udf_part_map *map = &UDF_SB(sb)->s_partmaps[partition]; + uint32_t blk; + + if (check_add_overflow(bloc->logicalBlockNum, offset, &blk) || + check_add_overflow(blk, count, &blk) || + bloc->logicalBlockNum + count > map->s_partition_len) { + udf_debug("Invalid request to free blocks: (%d, %u), off %u, " + "len %u, partition len %u\n", + partition, bloc->logicalBlockNum, offset, count, + map->s_partition_len); + return; + } if (map->s_partition_flags & UDF_PART_FLAG_UNALLOC_BITMAP) { udf_bitmap_free_blocks(sb, map->s_uspace.s_bitmap, diff --git a/fs/udf/super.c b/fs/udf/super.c index 0f8b3cb35585..46384284e7e0 100644 --- a/fs/udf/super.c +++ b/fs/udf/super.c @@ -266,7 +266,8 @@ static void udf_sb_free_bitmap(struct udf_bitmap *bitmap) int nr_groups = bitmap->s_nr_groups; for (i = 0; i < nr_groups; i++) - brelse(bitmap->s_block_bitmap[i]); + if (!IS_ERR_OR_NULL(bitmap->s_block_bitmap[i])) + brelse(bitmap->s_block_bitmap[i]); kvfree(bitmap); } diff --git a/include/linux/bitmap.h b/include/linux/bitmap.h index 29fc933df3bf..a92ecbc391ef 100644 --- a/include/linux/bitmap.h +++ b/include/linux/bitmap.h @@ -216,22 +216,24 @@ extern int bitmap_print_to_pagebuf(bool list, char *buf, #define small_const_nbits(nbits) \ (__builtin_constant_p(nbits) && (nbits) <= BITS_PER_LONG && (nbits) > 0) +#define bitmap_size(nbits) (ALIGN(nbits, BITS_PER_LONG) / BITS_PER_BYTE) + static inline void bitmap_zero(unsigned long *dst, unsigned int nbits) { - unsigned int len = BITS_TO_LONGS(nbits) * sizeof(unsigned long); + unsigned int len = bitmap_size(nbits); memset(dst, 0, len); } static inline void bitmap_fill(unsigned long *dst, unsigned int nbits) { - unsigned int len = BITS_TO_LONGS(nbits) * sizeof(unsigned long); + unsigned int len = bitmap_size(nbits); memset(dst, 0xff, len); } static inline void bitmap_copy(unsigned long *dst, const unsigned long *src, unsigned int nbits) { - unsigned int len = BITS_TO_LONGS(nbits) * sizeof(unsigned long); + unsigned int len = bitmap_size(nbits); memcpy(dst, src, len); } @@ -246,6 +248,18 @@ static inline void bitmap_copy_clear_tail(unsigned long *dst, dst[nbits / BITS_PER_LONG] &= BITMAP_LAST_WORD_MASK(nbits); } +static inline void bitmap_copy_and_extend(unsigned long *to, + const unsigned long *from, + unsigned int count, unsigned int size) +{ + unsigned int copy = BITS_TO_LONGS(count); + + memcpy(to, from, copy * sizeof(long)); + if (count % BITS_PER_LONG) + to[copy - 1] &= BITMAP_LAST_WORD_MASK(count); + memset(to + copy, 0, bitmap_size(size) - copy * sizeof(long)); +} + /* * On 32-bit systems bitmaps are represented as u32 arrays internally, and * therefore conversion is not needed when copying data from/to arrays of u32. diff --git a/include/linux/blkdev.h b/include/linux/blkdev.h index bbe9f40dba2d..704c39cc1f47 100644 --- a/include/linux/blkdev.h +++ b/include/linux/blkdev.h @@ -60,7 +60,7 @@ struct keyslot_manager; */ #define BLKCG_MAX_POLS 5 -static inline int blk_validate_block_size(unsigned int bsize) +static inline int blk_validate_block_size(unsigned long bsize) { if (bsize < 512 || bsize > PAGE_SIZE || !is_power_of_2(bsize)) return -EINVAL; diff --git a/include/linux/compiler_attributes.h b/include/linux/compiler_attributes.h index a72b0f756a24..1b2338dee977 100644 --- a/include/linux/compiler_attributes.h +++ b/include/linux/compiler_attributes.h @@ -40,6 +40,7 @@ # define __GCC4_has_attribute___noclone__ 1 # define __GCC4_has_attribute___nonstring__ 0 # define __GCC4_has_attribute___no_sanitize_address__ (__GNUC_MINOR__ >= 8) +# define __GCC4_has_attribute___uninitialized__ 0 # define __GCC4_has_attribute___fallthrough__ 0 #endif diff --git a/include/linux/cpumask.h b/include/linux/cpumask.h index 78a73eba64dd..30c0c3c610ad 100644 --- a/include/linux/cpumask.h +++ b/include/linux/cpumask.h @@ -685,7 +685,7 @@ static inline int cpulist_parse(const char *buf, struct cpumask *dstp) */ static inline unsigned int cpumask_size(void) { - return BITS_TO_LONGS(nr_cpumask_bits) * sizeof(long); + return bitmap_size(nr_cpumask_bits); } /* diff --git a/include/linux/device-mapper.h b/include/linux/device-mapper.h index c47a867fe475..e006d624c8b5 100644 --- a/include/linux/device-mapper.h +++ b/include/linux/device-mapper.h @@ -339,6 +339,8 @@ void *dm_per_bio_data(struct bio *bio, size_t data_size); struct bio *dm_bio_from_per_bio_data(void *data, size_t data_size); unsigned dm_bio_get_target_bio_nr(const struct bio *bio); +u64 dm_start_time_ns_from_clone(struct bio *bio); + int dm_register_target(struct target_type *t); void dm_unregister_target(struct target_type *t); diff --git a/include/linux/fs.h b/include/linux/fs.h index 8824a611cd58..11af34688f40 100644 --- a/include/linux/fs.h +++ b/include/linux/fs.h @@ -2230,6 +2230,9 @@ static inline void init_sync_kiocb(struct kiocb *kiocb, struct file *filp) * Used to detect that mark_inode_dirty() should not move * inode between dirty lists. * + * I_LRU_ISOLATING Inode is pinned being isolated from LRU without holding + * i_count. + * * Q: What is the difference between I_WILL_FREE and I_FREEING? */ #define I_DIRTY_SYNC (1 << 0) @@ -2251,6 +2254,8 @@ static inline void init_sync_kiocb(struct kiocb *kiocb, struct file *filp) #define I_OVL_INUSE (1 << 14) #define I_CREATING (1 << 15) #define I_SYNC_QUEUED (1 << 17) +#define __I_LRU_ISOLATING 19 +#define I_LRU_ISOLATING (1 << __I_LRU_ISOLATING) #define I_DIRTY_INODE (I_DIRTY_SYNC | I_DIRTY_DATASYNC) #define I_DIRTY (I_DIRTY_INODE | I_DIRTY_PAGES) diff --git a/include/linux/objagg.h b/include/linux/objagg.h index 78021777df46..6df5b887dc54 100644 --- a/include/linux/objagg.h +++ b/include/linux/objagg.h @@ -8,7 +8,6 @@ struct objagg_ops { size_t obj_size; bool (*delta_check)(void *priv, const void *parent_obj, const void *obj); - int (*hints_obj_cmp)(const void *obj1, const void *obj2); void * (*delta_create)(void *priv, void *parent_obj, void *obj); void (*delta_destroy)(void *priv, void *delta_priv); void * (*root_create)(void *priv, void *obj, unsigned int root_id); diff --git a/include/linux/overflow.h b/include/linux/overflow.h index 50c93ca0c3d6..63e7c77ba942 100644 --- a/include/linux/overflow.h +++ b/include/linux/overflow.h @@ -240,6 +240,69 @@ (*_d >> _to_shift) != _a); \ }) +/** + * size_mul() - Calculate size_t multiplication with saturation at SIZE_MAX + * + * @factor1: first factor + * @factor2: second factor + * + * Returns: calculate @factor1 * @factor2, both promoted to size_t, + * with any overflow causing the return value to be SIZE_MAX. The + * lvalue must be size_t to avoid implicit type conversion. + */ +static inline size_t __must_check size_mul(size_t factor1, size_t factor2) +{ + size_t bytes; + + if (check_mul_overflow(factor1, factor2, &bytes)) + return SIZE_MAX; + + return bytes; +} + +/** + * size_add() - Calculate size_t addition with saturation at SIZE_MAX + * + * @addend1: first addend + * @addend2: second addend + * + * Returns: calculate @addend1 + @addend2, both promoted to size_t, + * with any overflow causing the return value to be SIZE_MAX. The + * lvalue must be size_t to avoid implicit type conversion. + */ +static inline size_t __must_check size_add(size_t addend1, size_t addend2) +{ + size_t bytes; + + if (check_add_overflow(addend1, addend2, &bytes)) + return SIZE_MAX; + + return bytes; +} + +/** + * size_sub() - Calculate size_t subtraction with saturation at SIZE_MAX + * + * @minuend: value to subtract from + * @subtrahend: value to subtract from @minuend + * + * Returns: calculate @minuend - @subtrahend, both promoted to size_t, + * with any overflow causing the return value to be SIZE_MAX. For + * composition with the size_add() and size_mul() helpers, neither + * argument may be SIZE_MAX (or the result with be forced to SIZE_MAX). + * The lvalue must be size_t to avoid implicit type conversion. + */ +static inline size_t __must_check size_sub(size_t minuend, size_t subtrahend) +{ + size_t bytes; + + if (minuend == SIZE_MAX || subtrahend == SIZE_MAX || + check_sub_overflow(minuend, subtrahend, &bytes)) + return SIZE_MAX; + + return bytes; +} + /** * array_size() - Calculate size of 2-dimensional array. * @@ -251,15 +314,7 @@ * Returns: number of bytes needed to represent the array or SIZE_MAX on * overflow. */ -static inline __must_check size_t array_size(size_t a, size_t b) -{ - size_t bytes; - - if (check_mul_overflow(a, b, &bytes)) - return SIZE_MAX; - - return bytes; -} +#define array_size(a, b) size_mul(a, b) /** * array3_size() - Calculate size of 3-dimensional array. @@ -273,48 +328,38 @@ static inline __must_check size_t array_size(size_t a, size_t b) * Returns: number of bytes needed to represent the array or SIZE_MAX on * overflow. */ -static inline __must_check size_t array3_size(size_t a, size_t b, size_t c) -{ - size_t bytes; - - if (check_mul_overflow(a, b, &bytes)) - return SIZE_MAX; - if (check_mul_overflow(bytes, c, &bytes)) - return SIZE_MAX; - - return bytes; -} - -/* - * Compute a*b+c, returning SIZE_MAX on overflow. Internal helper for - * struct_size() below. - */ -static inline __must_check size_t __ab_c_size(size_t a, size_t b, size_t c) -{ - size_t bytes; - - if (check_mul_overflow(a, b, &bytes)) - return SIZE_MAX; - if (check_add_overflow(bytes, c, &bytes)) - return SIZE_MAX; - - return bytes; -} +#define array3_size(a, b, c) size_mul(size_mul(a, b), c) /** - * struct_size() - Calculate size of structure with trailing array. - * @p: Pointer to the structure. - * @member: Name of the array member. - * @n: Number of elements in the array. + * flex_array_size() - Calculate size of a flexible array member + * within an enclosing structure. * - * Calculates size of memory needed for structure @p followed by an - * array of @n @member elements. + * @p: Pointer to the structure. + * @member: Name of the flexible array member. + * @count: Number of elements in the array. + * + * Calculates size of a flexible array of @count number of @member + * elements, at the end of structure @p. * * Return: number of bytes needed or SIZE_MAX on overflow. */ -#define struct_size(p, member, n) \ - __ab_c_size(n, \ - sizeof(*(p)->member) + __must_be_array((p)->member),\ - sizeof(*(p))) +#define flex_array_size(p, member, count) \ + size_mul(count, \ + sizeof(*(p)->member) + __must_be_array((p)->member)) + +/** + * struct_size() - Calculate size of structure with trailing flexible array. + * + * @p: Pointer to the structure. + * @member: Name of the array member. + * @count: Number of elements in the array. + * + * Calculates size of memory needed for structure @p followed by an + * array of @count number of @member elements. + * + * Return: number of bytes needed or SIZE_MAX on overflow. + */ +#define struct_size(p, member, count) \ + size_add(sizeof(*(p)), flex_array_size(p, member, count)) #endif /* __LINUX_OVERFLOW_H */ diff --git a/include/linux/pci_ids.h b/include/linux/pci_ids.h index 711120a6b085..22d761094c1b 100644 --- a/include/linux/pci_ids.h +++ b/include/linux/pci_ids.h @@ -2136,6 +2136,8 @@ #define PCI_VENDOR_ID_CHELSIO 0x1425 +#define PCI_VENDOR_ID_EDIMAX 0x1432 + #define PCI_VENDOR_ID_ADLINK 0x144a #define PCI_VENDOR_ID_SAMSUNG 0x144d diff --git a/include/linux/platform_data/x86/soc.h b/include/linux/platform_data/x86/soc.h new file mode 100644 index 000000000000..da05f425587a --- /dev/null +++ b/include/linux/platform_data/x86/soc.h @@ -0,0 +1,65 @@ +/* SPDX-License-Identifier: GPL-2.0-only */ +/* + * Helpers for Intel SoC model detection + * + * Copyright (c) 2019, Intel Corporation. + */ + +#ifndef __PLATFORM_DATA_X86_SOC_H +#define __PLATFORM_DATA_X86_SOC_H + +#if IS_ENABLED(CONFIG_X86) + +#include +#include + +#define SOC_INTEL_IS_CPU(soc, type) \ +static inline bool soc_intel_is_##soc(void) \ +{ \ + static const struct x86_cpu_id soc##_cpu_ids[] = { \ + X86_MATCH_INTEL_FAM6_MODEL(type, NULL), \ + {} \ + }; \ + const struct x86_cpu_id *id; \ + \ + id = x86_match_cpu(soc##_cpu_ids); \ + if (id) \ + return true; \ + return false; \ +} + +SOC_INTEL_IS_CPU(byt, ATOM_SILVERMONT); +SOC_INTEL_IS_CPU(cht, ATOM_AIRMONT); +SOC_INTEL_IS_CPU(apl, ATOM_GOLDMONT); +SOC_INTEL_IS_CPU(glk, ATOM_GOLDMONT_PLUS); +SOC_INTEL_IS_CPU(cml, KABYLAKE_L); + +#else /* IS_ENABLED(CONFIG_X86) */ + +static inline bool soc_intel_is_byt(void) +{ + return false; +} + +static inline bool soc_intel_is_cht(void) +{ + return false; +} + +static inline bool soc_intel_is_apl(void) +{ + return false; +} + +static inline bool soc_intel_is_glk(void) +{ + return false; +} + +static inline bool soc_intel_is_cml(void) +{ + return false; +} +#endif /* IS_ENABLED(CONFIG_X86) */ + +#endif /* __PLATFORM_DATA_X86_SOC_H */ diff --git a/include/linux/qed/qed_eth_if.h b/include/linux/qed/qed_eth_if.h index a1310482c4ed..8e11dd56dd63 100644 --- a/include/linux/qed/qed_eth_if.h +++ b/include/linux/qed/qed_eth_if.h @@ -171,12 +171,6 @@ struct qed_filter_mcast_params { unsigned char mac[64][ETH_ALEN]; }; -union qed_filter_type_params { - enum qed_filter_rx_mode_type accept_flags; - struct qed_filter_ucast_params ucast; - struct qed_filter_mcast_params mcast; -}; - enum qed_filter_type { QED_FILTER_TYPE_UCAST, QED_FILTER_TYPE_MCAST, @@ -184,11 +178,6 @@ enum qed_filter_type { QED_MAX_FILTER_TYPES, }; -struct qed_filter_params { - enum qed_filter_type type; - union qed_filter_type_params filter; -}; - struct qed_tunn_params { u16 vxlan_port; u8 update_vxlan_port; @@ -340,8 +329,14 @@ struct qed_eth_ops { int (*q_tx_stop)(struct qed_dev *cdev, u8 rss_id, void *handle); - int (*filter_config)(struct qed_dev *cdev, - struct qed_filter_params *params); + int (*filter_config_rx_mode)(struct qed_dev *cdev, + enum qed_filter_rx_mode_type type); + + int (*filter_config_ucast)(struct qed_dev *cdev, + struct qed_filter_ucast_params *params); + + int (*filter_config_mcast)(struct qed_dev *cdev, + struct qed_filter_mcast_params *params); int (*fastpath_stop)(struct qed_dev *cdev); diff --git a/include/linux/trace_events.h b/include/linux/trace_events.h index b82e17bc3791..b7f112517a95 100644 --- a/include/linux/trace_events.h +++ b/include/linux/trace_events.h @@ -574,7 +574,6 @@ do { \ struct perf_event; DECLARE_PER_CPU(struct pt_regs, perf_trace_regs); -DECLARE_PER_CPU(int, bpf_kprobe_override); extern int perf_trace_init(struct perf_event *event); extern void perf_trace_destroy(struct perf_event *event); diff --git a/include/linux/usb.h b/include/linux/usb.h index 5dba2790556d..484608d419f5 100644 --- a/include/linux/usb.h +++ b/include/linux/usb.h @@ -1791,6 +1791,7 @@ static inline int usb_urb_dir_out(struct urb *urb) return (urb->transfer_flags & URB_DIR_MASK) == URB_DIR_OUT; } +int usb_pipe_type_check(struct usb_device *dev, unsigned int pipe); int usb_urb_ep_type_check(const struct urb *urb); void *usb_alloc_coherent(struct usb_device *dev, size_t size, diff --git a/include/net/busy_poll.h b/include/net/busy_poll.h index 16258c0c7319..36259516ec0d 100644 --- a/include/net/busy_poll.h +++ b/include/net/busy_poll.h @@ -61,7 +61,7 @@ static inline bool sk_can_busy_loop(struct sock *sk) static inline unsigned long busy_loop_current_time(void) { #ifdef CONFIG_NET_RX_BUSY_POLL - return (unsigned long)(local_clock() >> 10); + return (unsigned long)(ktime_get_ns() >> 10); #else return 0; #endif diff --git a/include/net/kcm.h b/include/net/kcm.h index 2d704f8f4905..8e8252e08a9c 100644 --- a/include/net/kcm.h +++ b/include/net/kcm.h @@ -70,6 +70,7 @@ struct kcm_sock { struct work_struct tx_work; struct list_head wait_psock_list; struct sk_buff *seq_skb; + struct mutex tx_mutex; u32 tx_stopped : 1; /* Don't use bit fields here, these are set under different locks */ diff --git a/include/net/netfilter/nf_tables.h b/include/net/netfilter/nf_tables.h index 4f77e2f8e1ca..648aac42dfec 100644 --- a/include/net/netfilter/nf_tables.h +++ b/include/net/netfilter/nf_tables.h @@ -13,6 +13,7 @@ #include #include #include +#include struct module; @@ -656,10 +657,16 @@ static inline struct nft_expr *nft_set_ext_expr(const struct nft_set_ext *ext) return nft_set_ext(ext, NFT_SET_EXT_EXPR); } -static inline bool nft_set_elem_expired(const struct nft_set_ext *ext) +static inline bool __nft_set_elem_expired(const struct nft_set_ext *ext, + u64 tstamp) { return nft_set_ext_exists(ext, NFT_SET_EXT_EXPIRATION) && - time_is_before_eq_jiffies64(*nft_set_ext_expiration(ext)); + time_after_eq64(tstamp, *nft_set_ext_expiration(ext)); +} + +static inline bool nft_set_elem_expired(const struct nft_set_ext *ext) +{ + return __nft_set_elem_expired(ext, get_jiffies_64()); } static inline struct nft_set_ext *nft_set_elem_ext(const struct nft_set *set, @@ -1482,9 +1489,19 @@ struct nftables_pernet { struct list_head module_list; struct list_head notify_list; struct mutex commit_mutex; + u64 tstamp; unsigned int base_seq; u8 validate_state; unsigned int gc_seq; }; +extern unsigned int nf_tables_net_id; + +static inline u64 nft_net_tstamp(const struct net *net) +{ + struct nftables_pernet *nft_net = net_generic(net, nf_tables_net_id); + + return nft_net->tstamp; +} + #endif /* _NET_NF_TABLES_H */ diff --git a/include/net/sctp/sctp.h b/include/net/sctp/sctp.h index 35c108a6b872..aa29695f4bd7 100644 --- a/include/net/sctp/sctp.h +++ b/include/net/sctp/sctp.h @@ -506,8 +506,8 @@ static inline int sctp_ep_hashfn(struct net *net, __u16 lport) return (net_hash_mix(net) + lport) & (sctp_ep_hashsize - 1); } -#define sctp_for_each_hentry(epb, head) \ - hlist_for_each_entry(epb, head, node) +#define sctp_for_each_hentry(ep, head) \ + hlist_for_each_entry(ep, head, node) /* Is a socket of this style? */ #define sctp_style(sk, style) __sctp_style((sk), (SCTP_SOCKET_##style)) diff --git a/include/net/sctp/structs.h b/include/net/sctp/structs.h index 48cbf3352042..146d46a44b43 100644 --- a/include/net/sctp/structs.h +++ b/include/net/sctp/structs.h @@ -1224,10 +1224,6 @@ enum sctp_endpoint_type { */ struct sctp_ep_common { - /* Fields to help us manage our entries in the hash tables. */ - struct hlist_node node; - int hashent; - /* Runtime type information. What kind of endpoint is this? */ enum sctp_endpoint_type type; @@ -1279,6 +1275,10 @@ struct sctp_endpoint { /* Common substructure for endpoint and association. */ struct sctp_ep_common base; + /* Fields to help us manage our entries in the hash tables. */ + struct hlist_node node; + int hashent; + /* Associations: A list of current associations and mappings * to the data consumers for each association. This * may be in the form of a hash table or other diff --git a/include/trace/events/rpcgss.h b/include/trace/events/rpcgss.h index d1f7fe1b6fe4..23e8288a76b5 100644 --- a/include/trace/events/rpcgss.h +++ b/include/trace/events/rpcgss.h @@ -42,7 +42,7 @@ TRACE_DEFINE_ENUM(GSS_S_UNSEQ_TOKEN); TRACE_DEFINE_ENUM(GSS_S_GAP_TOKEN); #define show_gss_status(x) \ - __print_flags(x, "|", \ + __print_symbolic(x, \ { GSS_S_BAD_MECH, "GSS_S_BAD_MECH" }, \ { GSS_S_BAD_NAME, "GSS_S_BAD_NAME" }, \ { GSS_S_BAD_NAMETYPE, "GSS_S_BAD_NAMETYPE" }, \ diff --git a/include/uapi/linux/netfilter/nf_tables.h b/include/uapi/linux/netfilter/nf_tables.h index bc70d580e8d6..3e6c61d026e3 100644 --- a/include/uapi/linux/netfilter/nf_tables.h +++ b/include/uapi/linux/netfilter/nf_tables.h @@ -1213,7 +1213,7 @@ enum nft_secmark_attributes { #define NFTA_SECMARK_MAX (__NFTA_SECMARK_MAX - 1) /* Max security context length */ -#define NFT_SECMARK_CTX_MAXLEN 256 +#define NFT_SECMARK_CTX_MAXLEN 4096 /** * enum nft_reject_types - nf_tables reject expression reject types diff --git a/include/uapi/linux/zorro_ids.h b/include/uapi/linux/zorro_ids.h index 6e574d7b7d79..393f2ee9c042 100644 --- a/include/uapi/linux/zorro_ids.h +++ b/include/uapi/linux/zorro_ids.h @@ -449,6 +449,9 @@ #define ZORRO_PROD_VMC_ISDN_BLASTER_Z2 ZORRO_ID(VMC, 0x01, 0) #define ZORRO_PROD_VMC_HYPERCOM_4 ZORRO_ID(VMC, 0x02, 0) +#define ZORRO_MANUF_CSLAB 0x1400 +#define ZORRO_PROD_CSLAB_WARP_1260 ZORRO_ID(CSLAB, 0x65, 0) + #define ZORRO_MANUF_INFORMATION 0x157C #define ZORRO_PROD_INFORMATION_ISDN_ENGINE_I ZORRO_ID(INFORMATION, 0x64, 0) diff --git a/ipc/util.c b/ipc/util.c index 09c3bd9f8e76..aaf28b14a030 100644 --- a/ipc/util.c +++ b/ipc/util.c @@ -754,21 +754,13 @@ struct pid_namespace *ipc_seq_pid_ns(struct seq_file *s) static struct kern_ipc_perm *sysvipc_find_ipc(struct ipc_ids *ids, loff_t pos, loff_t *new_pos) { - struct kern_ipc_perm *ipc; - int total, id; + struct kern_ipc_perm *ipc = NULL; + int max_idx = ipc_get_maxidx(ids); - total = 0; - for (id = 0; id < pos && total < ids->in_use; id++) { - ipc = idr_find(&ids->ipcs_idr, id); - if (ipc != NULL) - total++; - } - - ipc = NULL; - if (total >= ids->in_use) + if (max_idx == -1 || pos > max_idx) goto out; - for (; pos < ipc_mni; pos++) { + for (; pos <= max_idx; pos++) { ipc = idr_find(&ids->ipcs_idr, pos); if (ipc != NULL) { rcu_read_lock(); diff --git a/kernel/cgroup/cpuset.c b/kernel/cgroup/cpuset.c index 6a2a7e53b461..624b4f463397 100644 --- a/kernel/cgroup/cpuset.c +++ b/kernel/cgroup/cpuset.c @@ -22,6 +22,7 @@ * distribution for more details. */ +#include "cgroup-internal.h" #include #include #include @@ -3633,10 +3634,14 @@ int proc_cpuset_show(struct seq_file *m, struct pid_namespace *ns, if (!buf) goto out; - css = task_get_css(tsk, cpuset_cgrp_id); - retval = cgroup_path_ns(css->cgroup, buf, PATH_MAX, - current->nsproxy->cgroup_ns); - css_put(css); + rcu_read_lock(); + spin_lock_irq(&css_set_lock); + css = task_css(tsk, cpuset_cgrp_id); + retval = cgroup_path_ns_locked(css->cgroup, buf, PATH_MAX, + current->nsproxy->cgroup_ns); + spin_unlock_irq(&css_set_lock); + rcu_read_unlock(); + if (retval >= PATH_MAX) retval = -ENAMETOOLONG; if (retval < 0) diff --git a/kernel/debug/kdb/kdb_io.c b/kernel/debug/kdb/kdb_io.c index 5358e8a8b6f1..bfce77a0daac 100644 --- a/kernel/debug/kdb/kdb_io.c +++ b/kernel/debug/kdb/kdb_io.c @@ -192,7 +192,7 @@ static int kdb_read_get_key(char *buffer, size_t bufsize) */ static void kdb_position_cursor(char *prompt, char *buffer, char *cp) { - kdb_printf("\r%s", kdb_prompt_str); + kdb_printf("\r%s", prompt); if (cp > buffer) kdb_printf("%.*s", (int)(cp - buffer), buffer); } @@ -368,7 +368,7 @@ poll_again: if (i >= dtab_count) kdb_printf("..."); kdb_printf("\n"); - kdb_printf(kdb_prompt_str); + kdb_printf("%s", kdb_prompt_str); kdb_printf("%s", buffer); if (cp != lastchar) kdb_position_cursor(kdb_prompt_str, buffer, cp); @@ -460,7 +460,7 @@ char *kdb_getstr(char *buffer, size_t bufsize, const char *prompt) { if (prompt && kdb_prompt_str != prompt) strscpy(kdb_prompt_str, prompt, CMD_BUFLEN); - kdb_printf(kdb_prompt_str); + kdb_printf("%s", kdb_prompt_str); kdb_nextline = 1; /* Prompt and input resets line number */ return kdb_read(buffer, bufsize); } diff --git a/kernel/dma/mapping.c b/kernel/dma/mapping.c index 839e7366bf34..ba2094358dc0 100644 --- a/kernel/dma/mapping.c +++ b/kernel/dma/mapping.c @@ -59,8 +59,8 @@ void dmam_free_coherent(struct device *dev, size_t size, void *vaddr, { struct dma_devres match_data = { size, vaddr, dma_handle }; - dma_free_coherent(dev, size, vaddr, dma_handle); WARN_ON(devres_destroy(dev, dmam_release, dmam_match, &match_data)); + dma_free_coherent(dev, size, vaddr, dma_handle); } EXPORT_SYMBOL(dmam_free_coherent); diff --git a/kernel/events/core.c b/kernel/events/core.c index 9a6e235f686e..ce931801a7e8 100644 --- a/kernel/events/core.c +++ b/kernel/events/core.c @@ -5827,6 +5827,8 @@ static int perf_mmap(struct file *file, struct vm_area_struct *vma) return -EINVAL; nr_pages = vma_size / PAGE_SIZE; + if (nr_pages > INT_MAX) + return -ENOMEM; mutex_lock(&event->mmap_mutex); ret = -EINVAL; diff --git a/kernel/events/internal.h b/kernel/events/internal.h index 6e87b358e082..30218d7c74e6 100644 --- a/kernel/events/internal.h +++ b/kernel/events/internal.h @@ -122,7 +122,7 @@ static inline unsigned long perf_data_size(struct ring_buffer *rb) static inline unsigned long perf_aux_size(struct ring_buffer *rb) { - return rb->aux_nr_pages << PAGE_SHIFT; + return (unsigned long)rb->aux_nr_pages << PAGE_SHIFT; } #define __DEFINE_OUTPUT_COPY_BODY(advance_buf, memcpy_func, ...) \ diff --git a/kernel/irq/irqdesc.c b/kernel/irq/irqdesc.c index 0272a2e36ae6..a0e86b426ba5 100644 --- a/kernel/irq/irqdesc.c +++ b/kernel/irq/irqdesc.c @@ -491,6 +491,7 @@ static int alloc_descs(unsigned int start, unsigned int cnt, int node, flags = IRQD_AFFINITY_MANAGED | IRQD_MANAGED_SHUTDOWN; } + flags |= IRQD_AFFINITY_SET; mask = &affinity->mask; node = cpu_to_node(cpumask_first(mask)); affinity++; diff --git a/kernel/time/hrtimer.c b/kernel/time/hrtimer.c index 8e3c9228aec9..62760c1eec67 100644 --- a/kernel/time/hrtimer.c +++ b/kernel/time/hrtimer.c @@ -1182,6 +1182,8 @@ void hrtimer_start_range_ns(struct hrtimer *timer, ktime_t tim, struct hrtimer_clock_base *base; unsigned long flags; + if (WARN_ON_ONCE(!timer->function)) + return; /* * Check whether the HRTIMER_MODE_SOFT bit and hrtimer.is_soft * match on CONFIG_PREEMPT_RT = n. With PREEMPT_RT check the hard diff --git a/kernel/time/ntp.c b/kernel/time/ntp.c index 069ca78fb0bf..02d96c007673 100644 --- a/kernel/time/ntp.c +++ b/kernel/time/ntp.c @@ -679,17 +679,16 @@ static inline void process_adjtimex_modes(const struct __kernel_timex *txc, } if (txc->modes & ADJ_MAXERROR) - time_maxerror = txc->maxerror; + time_maxerror = clamp(txc->maxerror, (long long)0, (long long)NTP_PHASE_LIMIT); if (txc->modes & ADJ_ESTERROR) - time_esterror = txc->esterror; + time_esterror = clamp(txc->esterror, (long long)0, (long long)NTP_PHASE_LIMIT); if (txc->modes & ADJ_TIMECONST) { - time_constant = txc->constant; + time_constant = clamp(txc->constant, (long long)0, (long long)MAXTC); if (!(time_status & STA_NANO)) time_constant += 4; - time_constant = min(time_constant, (long)MAXTC); - time_constant = max(time_constant, 0l); + time_constant = clamp(time_constant, (long)0, (long)MAXTC); } if (txc->modes & ADJ_TAI && diff --git a/kernel/time/tick-broadcast.c b/kernel/time/tick-broadcast.c index ce7339ff10d2..9629c3ddf631 100644 --- a/kernel/time/tick-broadcast.c +++ b/kernel/time/tick-broadcast.c @@ -951,6 +951,30 @@ void hotplug_cpu__broadcast_tick_pull(int deadcpu) bc = tick_broadcast_device.evtdev; if (bc && broadcast_needs_cpu(bc, deadcpu)) { + /* + * If the broadcast force bit of the current CPU is set, + * then the current CPU has not yet reprogrammed the local + * timer device to avoid a ping-pong race. See + * ___tick_broadcast_oneshot_control(). + * + * If the broadcast device is hrtimer based then + * programming the broadcast event below does not have any + * effect because the local clockevent device is not + * running and not programmed because the broadcast event + * is not earlier than the pending event of the local clock + * event device. As a consequence all CPUs waiting for a + * broadcast event are stuck forever. + * + * Detect this condition and reprogram the cpu local timer + * device to avoid the starvation. + */ + if (tick_check_broadcast_expired()) { + struct tick_device *td = this_cpu_ptr(&tick_cpu_device); + + cpumask_clear_cpu(smp_processor_id(), tick_broadcast_force_mask); + tick_program_event(td->evtdev->next_event, 1); + } + /* This moves the broadcast assignment to this CPU: */ clockevents_program_event(bc, bc->next_event, 1); } diff --git a/kernel/trace/tracing_map.c b/kernel/trace/tracing_map.c index 33c463967bb3..208cfe24c547 100644 --- a/kernel/trace/tracing_map.c +++ b/kernel/trace/tracing_map.c @@ -454,7 +454,7 @@ static struct tracing_map_elt *get_free_elt(struct tracing_map *map) struct tracing_map_elt *elt = NULL; int idx; - idx = atomic_inc_return(&map->next_elt); + idx = atomic_fetch_add_unless(&map->next_elt, 1, map->max_elts); if (idx < map->max_elts) { elt = *(TRACING_MAP_ELT(map->elts, idx)); if (map->ops && map->ops->elt_init) @@ -699,7 +699,7 @@ void tracing_map_clear(struct tracing_map *map) { unsigned int i; - atomic_set(&map->next_elt, -1); + atomic_set(&map->next_elt, 0); atomic64_set(&map->hits, 0); atomic64_set(&map->drops, 0); @@ -783,7 +783,7 @@ struct tracing_map *tracing_map_create(unsigned int map_bits, map->map_bits = map_bits; map->max_elts = (1 << map_bits); - atomic_set(&map->next_elt, -1); + atomic_set(&map->next_elt, 0); map->map_size = (1 << (map_bits + 1)); map->ops = ops; diff --git a/kernel/watchdog_hld.c b/kernel/watchdog_hld.c index 1e8a49dc956e..8ba4b269ab89 100644 --- a/kernel/watchdog_hld.c +++ b/kernel/watchdog_hld.c @@ -91,11 +91,15 @@ static bool watchdog_check_timestamp(void) __this_cpu_write(last_timestamp, now); return true; } -#else -static inline bool watchdog_check_timestamp(void) + +static void watchdog_init_timestamp(void) { - return true; + __this_cpu_write(nmi_rearmed, 0); + __this_cpu_write(last_timestamp, ktime_get_mono_fast_ns()); } +#else +static inline bool watchdog_check_timestamp(void) { return true; } +static inline void watchdog_init_timestamp(void) { } #endif static struct perf_event_attr wd_hw_attr = { @@ -196,6 +200,7 @@ void hardlockup_detector_perf_enable(void) if (!atomic_fetch_inc(&watchdog_cpus)) pr_info("Enabled. Permanently consumes one hw-PMU counter.\n"); + watchdog_init_timestamp(); perf_event_enable(this_cpu_read(watchdog_ev)); } diff --git a/lib/decompress_bunzip2.c b/lib/decompress_bunzip2.c index 7c4932eed748..b16236747b55 100644 --- a/lib/decompress_bunzip2.c +++ b/lib/decompress_bunzip2.c @@ -232,7 +232,8 @@ static int INIT get_next_block(struct bunzip_data *bd) RUNB) */ symCount = symTotal+2; for (j = 0; j < groupCount; j++) { - unsigned char length[MAX_SYMBOLS], temp[MAX_HUFCODE_BITS+1]; + unsigned char length[MAX_SYMBOLS]; + unsigned short temp[MAX_HUFCODE_BITS+1]; int minLen, maxLen, pp; /* Read Huffman code lengths for each symbol. They're stored in a way similar to mtf; record a starting diff --git a/lib/kobject_uevent.c b/lib/kobject_uevent.c index c87d5b6a8a55..38716b2eb671 100644 --- a/lib/kobject_uevent.c +++ b/lib/kobject_uevent.c @@ -432,8 +432,23 @@ static void zap_modalias_env(struct kobj_uevent_env *env) len = strlen(env->envp[i]) + 1; if (i != env->envp_idx - 1) { + /* @env->envp[] contains pointers to @env->buf[] + * with @env->buflen chars, and we are removing + * variable MODALIAS here pointed by @env->envp[i] + * with length @len as shown below: + * + * 0 @env->buf[] @env->buflen + * --------------------------------------------- + * ^ ^ ^ ^ + * | |-> @len <-| target block | + * @env->envp[0] @env->envp[i] @env->envp[i + 1] + * + * so the "target block" indicated above is moved + * backward by @len, and its right size is + * @env->buflen - (@env->envp[i + 1] - @env->envp[0]). + */ memmove(env->envp[i], env->envp[i + 1], - env->buflen - len); + env->buflen - (env->envp[i + 1] - env->envp[0])); for (j = i; j < env->envp_idx - 1; j++) env->envp[j] = env->envp[j + 1] - len; diff --git a/lib/math/prime_numbers.c b/lib/math/prime_numbers.c index 052f5b727be7..d6b3964197d3 100644 --- a/lib/math/prime_numbers.c +++ b/lib/math/prime_numbers.c @@ -6,8 +6,6 @@ #include #include -#define bitmap_size(nbits) (BITS_TO_LONGS(nbits) * sizeof(unsigned long)) - struct primes { struct rcu_head rcu; unsigned long last, sz; diff --git a/lib/objagg.c b/lib/objagg.c index 55621fb82e0a..8a84c6dfa24b 100644 --- a/lib/objagg.c +++ b/lib/objagg.c @@ -167,6 +167,9 @@ static int objagg_obj_parent_assign(struct objagg *objagg, { void *delta_priv; + if (WARN_ON(!objagg_obj_is_root(parent))) + return -EINVAL; + delta_priv = objagg->ops->delta_create(objagg->priv, parent->obj, objagg_obj->obj); if (IS_ERR(delta_priv)) @@ -906,20 +909,6 @@ static const struct objagg_opt_algo *objagg_opt_algos[] = { [OBJAGG_OPT_ALGO_SIMPLE_GREEDY] = &objagg_opt_simple_greedy, }; -static int objagg_hints_obj_cmp(struct rhashtable_compare_arg *arg, - const void *obj) -{ - struct rhashtable *ht = arg->ht; - struct objagg_hints *objagg_hints = - container_of(ht, struct objagg_hints, node_ht); - const struct objagg_ops *ops = objagg_hints->ops; - const char *ptr = obj; - - ptr += ht->p.key_offset; - return ops->hints_obj_cmp ? ops->hints_obj_cmp(ptr, arg->key) : - memcmp(ptr, arg->key, ht->p.key_len); -} - /** * objagg_hints_get - obtains hints instance * @objagg: objagg instance @@ -958,7 +947,6 @@ struct objagg_hints *objagg_hints_get(struct objagg *objagg, offsetof(struct objagg_hints_node, obj); objagg_hints->ht_params.head_offset = offsetof(struct objagg_hints_node, ht_node); - objagg_hints->ht_params.obj_cmpfn = objagg_hints_obj_cmp; err = rhashtable_init(&objagg_hints->node_ht, &objagg_hints->ht_params); if (err) diff --git a/lib/test_overflow.c b/lib/test_overflow.c index 7a4b6f6c5473..7a5a5738d2d2 100644 --- a/lib/test_overflow.c +++ b/lib/test_overflow.c @@ -588,12 +588,110 @@ static int __init test_overflow_allocation(void) return err; } +struct __test_flex_array { + unsigned long flags; + size_t count; + unsigned long data[]; +}; + +static int __init test_overflow_size_helpers(void) +{ + struct __test_flex_array *obj; + int count = 0; + int err = 0; + int var; + +#define check_one_size_helper(expected, func, args...) ({ \ + bool __failure = false; \ + size_t _r; \ + \ + _r = func(args); \ + if (_r != (expected)) { \ + pr_warn("expected " #func "(" #args ") " \ + "to return %zu but got %zu instead\n", \ + (size_t)(expected), _r); \ + __failure = true; \ + } \ + count++; \ + __failure; \ +}) + + var = 4; + err |= check_one_size_helper(20, size_mul, var++, 5); + err |= check_one_size_helper(20, size_mul, 4, var++); + err |= check_one_size_helper(0, size_mul, 0, 3); + err |= check_one_size_helper(0, size_mul, 3, 0); + err |= check_one_size_helper(6, size_mul, 2, 3); + err |= check_one_size_helper(SIZE_MAX, size_mul, SIZE_MAX, 1); + err |= check_one_size_helper(SIZE_MAX, size_mul, SIZE_MAX, 3); + err |= check_one_size_helper(SIZE_MAX, size_mul, SIZE_MAX, -3); + + var = 4; + err |= check_one_size_helper(9, size_add, var++, 5); + err |= check_one_size_helper(9, size_add, 4, var++); + err |= check_one_size_helper(9, size_add, 9, 0); + err |= check_one_size_helper(9, size_add, 0, 9); + err |= check_one_size_helper(5, size_add, 2, 3); + err |= check_one_size_helper(SIZE_MAX, size_add, SIZE_MAX, 1); + err |= check_one_size_helper(SIZE_MAX, size_add, SIZE_MAX, 3); + err |= check_one_size_helper(SIZE_MAX, size_add, SIZE_MAX, -3); + + var = 4; + err |= check_one_size_helper(1, size_sub, var--, 3); + err |= check_one_size_helper(1, size_sub, 4, var--); + err |= check_one_size_helper(1, size_sub, 3, 2); + err |= check_one_size_helper(9, size_sub, 9, 0); + err |= check_one_size_helper(SIZE_MAX, size_sub, 9, -3); + err |= check_one_size_helper(SIZE_MAX, size_sub, 0, 9); + err |= check_one_size_helper(SIZE_MAX, size_sub, 2, 3); + err |= check_one_size_helper(SIZE_MAX, size_sub, SIZE_MAX, 0); + err |= check_one_size_helper(SIZE_MAX, size_sub, SIZE_MAX, 10); + err |= check_one_size_helper(SIZE_MAX, size_sub, 0, SIZE_MAX); + err |= check_one_size_helper(SIZE_MAX, size_sub, 14, SIZE_MAX); + err |= check_one_size_helper(SIZE_MAX - 2, size_sub, SIZE_MAX - 1, 1); + err |= check_one_size_helper(SIZE_MAX - 4, size_sub, SIZE_MAX - 1, 3); + err |= check_one_size_helper(1, size_sub, SIZE_MAX - 1, -3); + + var = 4; + err |= check_one_size_helper(4 * sizeof(*obj->data), + flex_array_size, obj, data, var++); + err |= check_one_size_helper(5 * sizeof(*obj->data), + flex_array_size, obj, data, var++); + err |= check_one_size_helper(0, flex_array_size, obj, data, 0); + err |= check_one_size_helper(sizeof(*obj->data), + flex_array_size, obj, data, 1); + err |= check_one_size_helper(7 * sizeof(*obj->data), + flex_array_size, obj, data, 7); + err |= check_one_size_helper(SIZE_MAX, + flex_array_size, obj, data, -1); + err |= check_one_size_helper(SIZE_MAX, + flex_array_size, obj, data, SIZE_MAX - 4); + + var = 4; + err |= check_one_size_helper(sizeof(*obj) + (4 * sizeof(*obj->data)), + struct_size, obj, data, var++); + err |= check_one_size_helper(sizeof(*obj) + (5 * sizeof(*obj->data)), + struct_size, obj, data, var++); + err |= check_one_size_helper(sizeof(*obj), struct_size, obj, data, 0); + err |= check_one_size_helper(sizeof(*obj) + sizeof(*obj->data), + struct_size, obj, data, 1); + err |= check_one_size_helper(SIZE_MAX, + struct_size, obj, data, -3); + err |= check_one_size_helper(SIZE_MAX, + struct_size, obj, data, SIZE_MAX - 3); + + pr_info("%d overflow size helper tests finished\n", count); + + return err; +} + static int __init test_module_init(void) { int err = 0; err |= test_overflow_calculation(); err |= test_overflow_shift(); + err |= test_overflow_size_helpers(); err |= test_overflow_allocation(); if (err) { diff --git a/mm/memcontrol.c b/mm/memcontrol.c index 0cc7ee52d6bd..5ac119509335 100644 --- a/mm/memcontrol.c +++ b/mm/memcontrol.c @@ -4732,9 +4732,12 @@ static ssize_t memcg_write_event_control(struct kernfs_open_file *of, buf = endp + 1; cfd = simple_strtoul(buf, &endp, 10); - if ((*endp != ' ') && (*endp != '\0')) + if (*endp == '\0') + buf = endp; + else if (*endp == ' ') + buf = endp + 1; + else return -EINVAL; - buf = endp + 1; event = kzalloc(sizeof(*event), GFP_KERNEL); if (!event) diff --git a/mm/page-writeback.c b/mm/page-writeback.c index 5cc892b26339..fd00a511644e 100644 --- a/mm/page-writeback.c +++ b/mm/page-writeback.c @@ -433,13 +433,20 @@ static void domain_dirty_limits(struct dirty_throttle_control *dtc) else bg_thresh = (bg_ratio * available_memory) / PAGE_SIZE; - if (bg_thresh >= thresh) - bg_thresh = thresh / 2; tsk = current; if (tsk->flags & PF_LESS_THROTTLE || rt_task(tsk)) { bg_thresh += bg_thresh / 4 + global_wb_domain.dirty_limit / 32; thresh += thresh / 4 + global_wb_domain.dirty_limit / 32; } + /* + * Dirty throttling logic assumes the limits in page units fit into + * 32-bits. This gives 16TB dirty limits max which is hopefully enough. + */ + if (thresh > UINT_MAX) + thresh = UINT_MAX; + /* This makes sure bg_thresh is within 32-bits as well */ + if (bg_thresh >= thresh) + bg_thresh = thresh / 2; dtc->thresh = thresh; dtc->bg_thresh = bg_thresh; @@ -489,7 +496,11 @@ static unsigned long node_dirty_limit(struct pglist_data *pgdat) if (tsk->flags & PF_LESS_THROTTLE || rt_task(tsk)) dirty += dirty / 4; - return dirty; + /* + * Dirty throttling logic assumes the limits in page units fit into + * 32-bits. This gives 16TB dirty limits max which is hopefully enough. + */ + return min_t(unsigned long, dirty, UINT_MAX); } /** @@ -528,10 +539,17 @@ int dirty_background_bytes_handler(struct ctl_table *table, int write, loff_t *ppos) { int ret; + unsigned long old_bytes = dirty_background_bytes; ret = proc_doulongvec_minmax(table, write, buffer, lenp, ppos); - if (ret == 0 && write) + if (ret == 0 && write) { + if (DIV_ROUND_UP(dirty_background_bytes, PAGE_SIZE) > + UINT_MAX) { + dirty_background_bytes = old_bytes; + return -ERANGE; + } dirty_background_ratio = 0; + } return ret; } @@ -559,6 +577,10 @@ int dirty_bytes_handler(struct ctl_table *table, int write, ret = proc_doulongvec_minmax(table, write, buffer, lenp, ppos); if (ret == 0 && write && vm_dirty_bytes != old_bytes) { + if (DIV_ROUND_UP(vm_dirty_bytes, PAGE_SIZE) > UINT_MAX) { + vm_dirty_bytes = old_bytes; + return -ERANGE; + } writeback_set_ratelimit(); vm_dirty_ratio = 0; } diff --git a/net/bluetooth/bnep/core.c b/net/bluetooth/bnep/core.c index 43c284158f63..089160361dde 100644 --- a/net/bluetooth/bnep/core.c +++ b/net/bluetooth/bnep/core.c @@ -385,7 +385,8 @@ static int bnep_rx_frame(struct bnep_session *s, struct sk_buff *skb) case BNEP_COMPRESSED_DST_ONLY: __skb_put_data(nskb, skb_mac_header(skb), ETH_ALEN); - __skb_put_data(nskb, s->eh.h_source, ETH_ALEN + 2); + __skb_put_data(nskb, s->eh.h_source, ETH_ALEN); + put_unaligned(s->eh.h_proto, (__be16 *)__skb_put(nskb, 2)); break; case BNEP_GENERAL: diff --git a/net/bluetooth/hci_core.c b/net/bluetooth/hci_core.c index 92a434ceed58..d3862da05f33 100644 --- a/net/bluetooth/hci_core.c +++ b/net/bluetooth/hci_core.c @@ -4053,15 +4053,27 @@ static inline int __get_blocks(struct hci_dev *hdev, struct sk_buff *skb) return DIV_ROUND_UP(skb->len - HCI_ACL_HDR_SIZE, hdev->block_len); } -static void __check_timeout(struct hci_dev *hdev, unsigned int cnt) +static void __check_timeout(struct hci_dev *hdev, unsigned int cnt, u8 type) { - if (!hci_dev_test_flag(hdev, HCI_UNCONFIGURED)) { - /* ACL tx timeout must be longer than maximum - * link supervision timeout (40.9 seconds) */ - if (!cnt && time_after(jiffies, hdev->acl_last_tx + - HCI_ACL_TX_TIMEOUT)) - hci_link_tx_to(hdev, ACL_LINK); + unsigned long last_tx; + + if (hci_dev_test_flag(hdev, HCI_UNCONFIGURED)) + return; + + switch (type) { + case LE_LINK: + last_tx = hdev->le_last_tx; + break; + default: + last_tx = hdev->acl_last_tx; + break; } + + /* tx timeout must be longer than maximum link supervision timeout + * (40.9 seconds) + */ + if (!cnt && time_after(jiffies, last_tx + HCI_ACL_TX_TIMEOUT)) + hci_link_tx_to(hdev, type); } static void hci_sched_acl_pkt(struct hci_dev *hdev) @@ -4071,7 +4083,7 @@ static void hci_sched_acl_pkt(struct hci_dev *hdev) struct sk_buff *skb; int quote; - __check_timeout(hdev, cnt); + __check_timeout(hdev, cnt, ACL_LINK); while (hdev->acl_cnt && (chan = hci_chan_sent(hdev, ACL_LINK, "e))) { @@ -4110,8 +4122,6 @@ static void hci_sched_acl_blk(struct hci_dev *hdev) int quote; u8 type; - __check_timeout(hdev, cnt); - BT_DBG("%s", hdev->name); if (hdev->dev_type == HCI_AMP) @@ -4119,6 +4129,8 @@ static void hci_sched_acl_blk(struct hci_dev *hdev) else type = ACL_LINK; + __check_timeout(hdev, cnt, type); + while (hdev->block_cnt > 0 && (chan = hci_chan_sent(hdev, type, "e))) { u32 priority = (skb_peek(&chan->data_q))->priority; @@ -4231,24 +4243,19 @@ static void hci_sched_le(struct hci_dev *hdev) { struct hci_chan *chan; struct sk_buff *skb; - int quote, cnt, tmp; + int quote, *cnt, tmp; BT_DBG("%s", hdev->name); if (!hci_conn_num(hdev, LE_LINK)) return; - if (!hci_dev_test_flag(hdev, HCI_UNCONFIGURED)) { - /* LE tx timeout must be longer than maximum - * link supervision timeout (40.9 seconds) */ - if (!hdev->le_cnt && hdev->le_pkts && - time_after(jiffies, hdev->le_last_tx + HZ * 45)) - hci_link_tx_to(hdev, LE_LINK); - } + cnt = hdev->le_pkts ? &hdev->le_cnt : &hdev->acl_cnt; - cnt = hdev->le_pkts ? hdev->le_cnt : hdev->acl_cnt; - tmp = cnt; - while (cnt && (chan = hci_chan_sent(hdev, LE_LINK, "e))) { + __check_timeout(hdev, *cnt, LE_LINK); + + tmp = *cnt; + while (*cnt && (chan = hci_chan_sent(hdev, LE_LINK, "e))) { u32 priority = (skb_peek(&chan->data_q))->priority; while (quote-- && (skb = skb_peek(&chan->data_q))) { BT_DBG("chan %p skb %p len %d priority %u", chan, skb, @@ -4263,18 +4270,13 @@ static void hci_sched_le(struct hci_dev *hdev) hci_send_frame(hdev, skb); hdev->le_last_tx = jiffies; - cnt--; + (*cnt)--; chan->sent++; chan->conn->sent++; } } - if (hdev->le_pkts) - hdev->le_cnt = cnt; - else - hdev->acl_cnt = cnt; - - if (cnt != tmp) + if (*cnt != tmp) hci_prio_recalculate(hdev, LE_LINK); } diff --git a/net/bluetooth/l2cap_core.c b/net/bluetooth/l2cap_core.c index 2eea802a9cb2..874f12d93bfa 100644 --- a/net/bluetooth/l2cap_core.c +++ b/net/bluetooth/l2cap_core.c @@ -7089,6 +7089,7 @@ static void l2cap_conless_channel(struct l2cap_conn *conn, __le16 psm, bt_cb(skb)->l2cap.psm = psm; if (!chan->ops->recv(chan, skb)) { + l2cap_chan_unlock(chan); l2cap_chan_put(chan); return; } diff --git a/net/bluetooth/mgmt.c b/net/bluetooth/mgmt.c index 0ae5d3cab4dc..2706e238ca44 100644 --- a/net/bluetooth/mgmt.c +++ b/net/bluetooth/mgmt.c @@ -2908,6 +2908,10 @@ static int pair_device(struct sock *sk, struct hci_dev *hdev, void *data, * will be kept and this function does nothing. */ p = hci_conn_params_add(hdev, &cp->addr.bdaddr, addr_type); + if (!p) { + err = -EIO; + goto unlock; + } if (p->auto_connect == HCI_AUTO_CONN_EXPLICIT) p->auto_connect = HCI_AUTO_CONN_DISABLED; diff --git a/net/core/ethtool.c b/net/core/ethtool.c index 85da03668e28..ca627623697d 100644 --- a/net/core/ethtool.c +++ b/net/core/ethtool.c @@ -550,6 +550,9 @@ int __ethtool_get_link_ksettings(struct net_device *dev, if (!dev->ethtool_ops->get_link_ksettings) return -EOPNOTSUPP; + if (!netif_device_present(dev)) + return -ENODEV; + memset(link_ksettings, 0, sizeof(*link_ksettings)); return dev->ethtool_ops->get_link_ksettings(dev, link_ksettings); } diff --git a/net/core/filter.c b/net/core/filter.c index d7913705d398..f537ed9c2654 100644 --- a/net/core/filter.c +++ b/net/core/filter.c @@ -3126,13 +3126,20 @@ static int bpf_skb_net_grow(struct sk_buff *skb, u32 off, u32 len_diff, if (skb_is_gso(skb)) { struct skb_shared_info *shinfo = skb_shinfo(skb); - /* Due to header grow, MSS needs to be downgraded. */ - if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO)) - skb_decrease_gso_size(shinfo, len_diff); - /* Header must be checked, and gso_segs recomputed. */ shinfo->gso_type |= gso_type; shinfo->gso_segs = 0; + + /* Due to header growth, MSS needs to be downgraded. + * There is a BUG_ON() when segmenting the frag_list with + * head_frag true, so linearize the skb after downgrading + * the MSS. + */ + if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO)) { + skb_decrease_gso_size(shinfo, len_diff); + if (shinfo->frag_list) + return skb_linearize(skb); + } } return 0; diff --git a/net/core/link_watch.c b/net/core/link_watch.c index 35b0e39030da..a70b2adc47a1 100644 --- a/net/core/link_watch.c +++ b/net/core/link_watch.c @@ -130,9 +130,9 @@ static void linkwatch_schedule_work(int urgent) * override the existing timer. */ if (test_bit(LW_URGENT, &linkwatch_flags)) - mod_delayed_work(system_wq, &linkwatch_work, 0); + mod_delayed_work(system_unbound_wq, &linkwatch_work, 0); else - schedule_delayed_work(&linkwatch_work, delay); + queue_delayed_work(system_unbound_wq, &linkwatch_work, delay); } diff --git a/net/core/net-sysfs.c b/net/core/net-sysfs.c index ad45f13a0370..bcad7028bbf4 100644 --- a/net/core/net-sysfs.c +++ b/net/core/net-sysfs.c @@ -212,7 +212,7 @@ static ssize_t speed_show(struct device *dev, if (!rtnl_trylock()) return restart_syscall(); - if (netif_running(netdev) && netif_device_present(netdev)) { + if (netif_running(netdev)) { struct ethtool_link_ksettings cmd; if (!__ethtool_get_link_ksettings(netdev, &cmd)) diff --git a/net/ipv4/nexthop.c b/net/ipv4/nexthop.c index da78db405d2f..28f31c07f06b 100644 --- a/net/ipv4/nexthop.c +++ b/net/ipv4/nexthop.c @@ -201,9 +201,10 @@ static int nla_put_nh_group(struct sk_buff *skb, struct nh_group *nhg) p = nla_data(nla); for (i = 0; i < nhg->num_nh; ++i) { - p->id = nhg->nh_entries[i].nh->id; - p->weight = nhg->nh_entries[i].weight - 1; - p += 1; + *p++ = (struct nexthop_grp) { + .id = nhg->nh_entries[i].nh->id, + .weight = nhg->nh_entries[i].weight - 1, + }; } return 0; diff --git a/net/ipv4/route.c b/net/ipv4/route.c index f3fd630836e3..9bc3be65592e 100644 --- a/net/ipv4/route.c +++ b/net/ipv4/route.c @@ -1283,7 +1283,7 @@ void ip_rt_get_source(u8 *addr, struct sk_buff *skb, struct rtable *rt) struct flowi4 fl4 = { .daddr = iph->daddr, .saddr = iph->saddr, - .flowi4_tos = RT_TOS(iph->tos), + .flowi4_tos = iph->tos & IPTOS_RT_MASK, .flowi4_oif = rt->dst.dev->ifindex, .flowi4_iif = skb->dev->ifindex, .flowi4_mark = skb->mark, diff --git a/net/ipv6/addrconf.c b/net/ipv6/addrconf.c index b174a307210e..1ce9fdb2e6f4 100644 --- a/net/ipv6/addrconf.c +++ b/net/ipv6/addrconf.c @@ -1831,7 +1831,8 @@ int ipv6_dev_get_saddr(struct net *net, const struct net_device *dst_dev, master, &dst, scores, hiscore_idx); - if (scores[hiscore_idx].ifa) + if (scores[hiscore_idx].ifa && + scores[hiscore_idx].scopedist >= 0) goto out; } diff --git a/net/ipv6/ip6_output.c b/net/ipv6/ip6_output.c index c67d634dccd4..a34a562b0954 100644 --- a/net/ipv6/ip6_output.c +++ b/net/ipv6/ip6_output.c @@ -1882,6 +1882,7 @@ int ip6_send_skb(struct sk_buff *skb) struct rt6_info *rt = (struct rt6_info *)skb_dst(skb); int err; + rcu_read_lock(); err = ip6_local_out(net, skb->sk, skb); if (err) { if (err > 0) @@ -1891,6 +1892,7 @@ int ip6_send_skb(struct sk_buff *skb) IPSTATS_MIB_OUTDISCARDS); } + rcu_read_unlock(); return err; } diff --git a/net/ipv6/ndisc.c b/net/ipv6/ndisc.c index d410117c2350..bbe5745647b9 100644 --- a/net/ipv6/ndisc.c +++ b/net/ipv6/ndisc.c @@ -224,6 +224,7 @@ struct ndisc_options *ndisc_parse_options(const struct net_device *dev, return NULL; memset(ndopts, 0, sizeof(*ndopts)); while (opt_len) { + bool unknown = false; int l; if (opt_len < sizeof(struct nd_opt_hdr)) return NULL; @@ -259,22 +260,23 @@ struct ndisc_options *ndisc_parse_options(const struct net_device *dev, break; #endif default: - if (ndisc_is_useropt(dev, nd_opt)) { - ndopts->nd_useropts_end = nd_opt; - if (!ndopts->nd_useropts) - ndopts->nd_useropts = nd_opt; - } else { - /* - * Unknown options must be silently ignored, - * to accommodate future extension to the - * protocol. - */ - ND_PRINTK(2, notice, - "%s: ignored unsupported option; type=%d, len=%d\n", - __func__, - nd_opt->nd_opt_type, - nd_opt->nd_opt_len); - } + unknown = true; + } + if (ndisc_is_useropt(dev, nd_opt)) { + ndopts->nd_useropts_end = nd_opt; + if (!ndopts->nd_useropts) + ndopts->nd_useropts = nd_opt; + } else if (unknown) { + /* + * Unknown options must be silently ignored, + * to accommodate future extension to the + * protocol. + */ + ND_PRINTK(2, notice, + "%s: ignored unsupported option; type=%d, len=%d\n", + __func__, + nd_opt->nd_opt_type, + nd_opt->nd_opt_len); } next_opt: opt_len -= l; diff --git a/net/iucv/af_iucv.c b/net/iucv/af_iucv.c index 652285191da1..74cf37f17ea9 100644 --- a/net/iucv/af_iucv.c +++ b/net/iucv/af_iucv.c @@ -453,8 +453,8 @@ static void iucv_sever_path(struct sock *sk, int with_user_data) struct iucv_sock *iucv = iucv_sk(sk); struct iucv_path *path = iucv->path; - if (iucv->path) { - iucv->path = NULL; + /* Whoever resets the path pointer, must sever and free it. */ + if (xchg(&iucv->path, NULL)) { if (with_user_data) { low_nmcpy(user_data, iucv->src_name); high_nmcpy(user_data, iucv->dst_name); diff --git a/net/iucv/iucv.c b/net/iucv/iucv.c index f0364649186b..dc8597347928 100644 --- a/net/iucv/iucv.c +++ b/net/iucv/iucv.c @@ -1136,8 +1136,7 @@ static int iucv_message_receive_iprmdata(struct iucv_path *path, size = (size < 8) ? size : 8; for (array = buffer; size > 0; array++) { copy = min_t(size_t, size, array->length); - memcpy((u8 *)(addr_t) array->address, - rmmsg, copy); + memcpy(phys_to_virt(array->address), rmmsg, copy); rmmsg += copy; size -= copy; } diff --git a/net/kcm/kcmsock.c b/net/kcm/kcmsock.c index 920b0ebf1cb8..50dceed77ba6 100644 --- a/net/kcm/kcmsock.c +++ b/net/kcm/kcmsock.c @@ -913,6 +913,7 @@ static int kcm_sendmsg(struct socket *sock, struct msghdr *msg, size_t len) !(msg->msg_flags & MSG_MORE) : !!(msg->msg_flags & MSG_EOR); int err = -EPIPE; + mutex_lock(&kcm->tx_mutex); lock_sock(sk); /* Per tcp_sendmsg this should be in poll */ @@ -1061,6 +1062,7 @@ partial_message: KCM_STATS_ADD(kcm->stats.tx_bytes, copied); release_sock(sk); + mutex_unlock(&kcm->tx_mutex); return copied; out_error: @@ -1086,6 +1088,7 @@ out_error: sk->sk_write_space(sk); release_sock(sk); + mutex_unlock(&kcm->tx_mutex); return err; } @@ -1328,6 +1331,7 @@ static void init_kcm_sock(struct kcm_sock *kcm, struct kcm_mux *mux) spin_unlock_bh(&mux->lock); INIT_WORK(&kcm->tx_work, kcm_tx_work); + mutex_init(&kcm->tx_mutex); spin_lock_bh(&mux->rx_lock); kcm_rcv_ready(kcm); diff --git a/net/netfilter/ipset/ip_set_list_set.c b/net/netfilter/ipset/ip_set_list_set.c index 9f4f0126d6ed..c4aae8c586ac 100644 --- a/net/netfilter/ipset/ip_set_list_set.c +++ b/net/netfilter/ipset/ip_set_list_set.c @@ -547,6 +547,9 @@ list_set_cancel_gc(struct ip_set *set) if (SET_WITH_TIMEOUT(set)) del_timer_sync(&map->gc); + + /* Flush list to drop references to other ipsets */ + list_set_flush(set); } static const struct ip_set_type_variant set_variant = { diff --git a/net/netfilter/ipvs/ip_vs_proto_sctp.c b/net/netfilter/ipvs/ip_vs_proto_sctp.c index 1e689c714127..83e452916403 100644 --- a/net/netfilter/ipvs/ip_vs_proto_sctp.c +++ b/net/netfilter/ipvs/ip_vs_proto_sctp.c @@ -126,7 +126,7 @@ sctp_snat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp, if (sctph->source != cp->vport || payload_csum || skb->ip_summed == CHECKSUM_PARTIAL) { sctph->source = cp->vport; - if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb)) + if (!skb_is_gso(skb)) sctp_nat_csum(skb, sctph, sctphoff); } else { skb->ip_summed = CHECKSUM_UNNECESSARY; @@ -175,7 +175,7 @@ sctp_dnat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp, (skb->ip_summed == CHECKSUM_PARTIAL && !(skb_dst(skb)->dev->features & NETIF_F_SCTP_CRC))) { sctph->dest = cp->dport; - if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb)) + if (!skb_is_gso(skb)) sctp_nat_csum(skb, sctph, sctphoff); } else if (skb->ip_summed != CHECKSUM_PARTIAL) { skb->ip_summed = CHECKSUM_UNNECESSARY; diff --git a/net/netfilter/nf_conntrack_netlink.c b/net/netfilter/nf_conntrack_netlink.c index 45d02185f4b9..c1401193a971 100644 --- a/net/netfilter/nf_conntrack_netlink.c +++ b/net/netfilter/nf_conntrack_netlink.c @@ -3129,7 +3129,8 @@ static int ctnetlink_del_expect(struct net *net, struct sock *ctnl, if (cda[CTA_EXPECT_ID]) { __be32 id = nla_get_be32(cda[CTA_EXPECT_ID]); - if (ntohl(id) != (u32)(unsigned long)exp) { + + if (id != nf_expect_get_id(exp)) { nf_ct_expect_put(exp); return -ENOENT; } diff --git a/net/netfilter/nf_tables_api.c b/net/netfilter/nf_tables_api.c index aa35bf6ea916..7a79c9326994 100644 --- a/net/netfilter/nf_tables_api.c +++ b/net/netfilter/nf_tables_api.c @@ -2829,6 +2829,15 @@ static void nf_tables_rule_release(const struct nft_ctx *ctx, nf_tables_rule_destroy(ctx, rule); } +/** nft_chain_validate - loop detection and hook validation + * + * @ctx: context containing call depth and base chain + * @chain: chain to validate + * + * Walk through the rules of the given chain and chase all jumps/gotos + * and set lookups until either the jump limit is hit or all reachable + * chains have been validated. + */ int nft_chain_validate(const struct nft_ctx *ctx, const struct nft_chain *chain) { struct nft_expr *expr, *last; @@ -2847,6 +2856,9 @@ int nft_chain_validate(const struct nft_ctx *ctx, const struct nft_chain *chain) if (!expr->ops->validate) continue; + /* This may call nft_chain_validate() recursively, + * callers that do so must increment ctx->level. + */ err = expr->ops->validate(ctx, expr, &data); if (err < 0) return err; @@ -4670,8 +4682,10 @@ static int nf_tables_getsetelem(struct net *net, struct sock *nlsk, nla_for_each_nested(attr, nla[NFTA_SET_ELEM_LIST_ELEMENTS], rem) { err = nft_get_set_elem(&ctx, set, attr); - if (err < 0) + if (err < 0) { + NL_SET_BAD_ATTR(extack, attr); break; + } } return err; @@ -5063,8 +5077,10 @@ static int nf_tables_newsetelem(struct net *net, struct sock *nlsk, nla_for_each_nested(attr, nla[NFTA_SET_ELEM_LIST_ELEMENTS], rem) { err = nft_add_set_elem(&ctx, set, attr, nlh->nlmsg_flags); - if (err < 0) + if (err < 0) { + NL_SET_BAD_ATTR(extack, attr); return err; + } } if (nft_net->validate_state == NFT_VALIDATE_DO) @@ -5264,9 +5280,10 @@ static int nf_tables_delsetelem(struct net *net, struct sock *nlsk, nla_for_each_nested(attr, nla[NFTA_SET_ELEM_LIST_ELEMENTS], rem) { err = nft_del_setelem(&ctx, set, attr); - if (err < 0) + if (err < 0) { + NL_SET_BAD_ATTR(extack, attr); break; - + } set->ndeact++; } return err; @@ -7751,6 +7768,7 @@ static bool nf_tables_valid_genid(struct net *net, u32 genid) bool genid_ok; mutex_lock(&nft_net->commit_mutex); + nft_net->tstamp = get_jiffies_64(); genid_ok = genid == 0 || nft_net->base_seq == genid; if (!genid_ok) @@ -7804,106 +7822,6 @@ int nft_chain_validate_hooks(const struct nft_chain *chain, } EXPORT_SYMBOL_GPL(nft_chain_validate_hooks); -/* - * Loop detection - walk through the ruleset beginning at the destination chain - * of a new jump until either the source chain is reached (loop) or all - * reachable chains have been traversed. - * - * The loop check is performed whenever a new jump verdict is added to an - * expression or verdict map or a verdict map is bound to a new chain. - */ - -static int nf_tables_check_loops(const struct nft_ctx *ctx, - const struct nft_chain *chain); - -static int nf_tables_loop_check_setelem(const struct nft_ctx *ctx, - struct nft_set *set, - const struct nft_set_iter *iter, - struct nft_set_elem *elem) -{ - const struct nft_set_ext *ext = nft_set_elem_ext(set, elem->priv); - const struct nft_data *data; - - if (nft_set_ext_exists(ext, NFT_SET_EXT_FLAGS) && - *nft_set_ext_flags(ext) & NFT_SET_ELEM_INTERVAL_END) - return 0; - - data = nft_set_ext_data(ext); - switch (data->verdict.code) { - case NFT_JUMP: - case NFT_GOTO: - return nf_tables_check_loops(ctx, data->verdict.chain); - default: - return 0; - } -} - -static int nf_tables_check_loops(const struct nft_ctx *ctx, - const struct nft_chain *chain) -{ - const struct nft_rule *rule; - const struct nft_expr *expr, *last; - struct nft_set *set; - struct nft_set_binding *binding; - struct nft_set_iter iter; - - if (ctx->chain == chain) - return -ELOOP; - - list_for_each_entry(rule, &chain->rules, list) { - nft_rule_for_each_expr(expr, last, rule) { - struct nft_immediate_expr *priv; - const struct nft_data *data; - int err; - - if (strcmp(expr->ops->type->name, "immediate")) - continue; - - priv = nft_expr_priv(expr); - if (priv->dreg != NFT_REG_VERDICT) - continue; - - data = &priv->data; - switch (data->verdict.code) { - case NFT_JUMP: - case NFT_GOTO: - err = nf_tables_check_loops(ctx, - data->verdict.chain); - if (err < 0) - return err; - default: - break; - } - } - } - - list_for_each_entry(set, &ctx->table->sets, list) { - if (!nft_is_active_next(ctx->net, set)) - continue; - if (!(set->flags & NFT_SET_MAP) || - set->dtype != NFT_DATA_VERDICT) - continue; - - list_for_each_entry(binding, &set->bindings, list) { - if (!(binding->flags & NFT_SET_MAP) || - binding->chain != chain) - continue; - - iter.genmask = nft_genmask_next(ctx->net); - iter.skip = 0; - iter.count = 0; - iter.err = 0; - iter.fn = nf_tables_loop_check_setelem; - - set->ops->walk(ctx, set, &iter); - if (iter.err < 0) - return iter.err; - } - } - - return 0; -} - /** * nft_parse_u32_check - fetch u32 attribute and check for maximum value * @@ -8039,7 +7957,7 @@ static int nft_validate_register_store(const struct nft_ctx *ctx, if (data != NULL && (data->verdict.code == NFT_GOTO || data->verdict.code == NFT_JUMP)) { - err = nf_tables_check_loops(ctx, data->verdict.chain); + err = nft_chain_validate(ctx, data->verdict.chain); if (err < 0) return err; } diff --git a/net/netfilter/nft_counter.c b/net/netfilter/nft_counter.c index f6d4d0fa23a6..bf829fabf278 100644 --- a/net/netfilter/nft_counter.c +++ b/net/netfilter/nft_counter.c @@ -105,11 +105,16 @@ static void nft_counter_reset(struct nft_counter_percpu_priv *priv, struct nft_counter *total) { struct nft_counter *this_cpu; + seqcount_t *myseq; local_bh_disable(); this_cpu = this_cpu_ptr(priv->counter); + myseq = this_cpu_ptr(&nft_counter_seq); + + write_seqcount_begin(myseq); this_cpu->packets -= total->packets; this_cpu->bytes -= total->bytes; + write_seqcount_end(myseq); local_bh_enable(); } diff --git a/net/netfilter/nft_set_hash.c b/net/netfilter/nft_set_hash.c index 0581d5499c5a..ec03d4c77b3d 100644 --- a/net/netfilter/nft_set_hash.c +++ b/net/netfilter/nft_set_hash.c @@ -38,6 +38,7 @@ struct nft_rhash_cmp_arg { const struct nft_set *set; const u32 *key; u8 genmask; + u64 tstamp; }; static inline u32 nft_rhash_key(const void *data, u32 len, u32 seed) @@ -64,7 +65,7 @@ static inline int nft_rhash_cmp(struct rhashtable_compare_arg *arg, return 1; if (nft_set_elem_is_dead(&he->ext)) return 1; - if (nft_set_elem_expired(&he->ext)) + if (__nft_set_elem_expired(&he->ext, x->tstamp)) return 1; if (!nft_set_elem_active(&he->ext, x->genmask)) return 1; @@ -88,6 +89,7 @@ static bool nft_rhash_lookup(const struct net *net, const struct nft_set *set, .genmask = nft_genmask_cur(net), .set = set, .key = key, + .tstamp = get_jiffies_64(), }; he = rhashtable_lookup(&priv->ht, &arg, nft_rhash_params); @@ -106,6 +108,7 @@ static void *nft_rhash_get(const struct net *net, const struct nft_set *set, .genmask = nft_genmask_cur(net), .set = set, .key = elem->key.val.data, + .tstamp = get_jiffies_64(), }; he = rhashtable_lookup(&priv->ht, &arg, nft_rhash_params); @@ -129,6 +132,7 @@ static bool nft_rhash_update(struct nft_set *set, const u32 *key, .genmask = NFT_GENMASK_ANY, .set = set, .key = key, + .tstamp = get_jiffies_64(), }; he = rhashtable_lookup(&priv->ht, &arg, nft_rhash_params); @@ -172,6 +176,7 @@ static int nft_rhash_insert(const struct net *net, const struct nft_set *set, .genmask = nft_genmask_next(net), .set = set, .key = elem->key.val.data, + .tstamp = nft_net_tstamp(net), }; struct nft_rhash_elem *prev; @@ -214,6 +219,7 @@ static void *nft_rhash_deactivate(const struct net *net, .genmask = nft_genmask_next(net), .set = set, .key = elem->key.val.data, + .tstamp = nft_net_tstamp(net), }; rcu_read_lock(); diff --git a/net/netfilter/nft_set_rbtree.c b/net/netfilter/nft_set_rbtree.c index 2b5f65a424b7..ed54cc057899 100644 --- a/net/netfilter/nft_set_rbtree.c +++ b/net/netfilter/nft_set_rbtree.c @@ -315,6 +315,7 @@ static int __nft_rbtree_insert(const struct net *net, const struct nft_set *set, struct nft_rbtree *priv = nft_set_priv(set); u8 cur_genmask = nft_genmask_cur(net); u8 genmask = nft_genmask_next(net); + u64 tstamp = nft_net_tstamp(net); int d, err; /* Descend the tree to search for an existing element greater than the @@ -362,7 +363,7 @@ static int __nft_rbtree_insert(const struct net *net, const struct nft_set *set, /* perform garbage collection to avoid bogus overlap reports * but skip new elements in this transaction. */ - if (nft_set_elem_expired(&rbe->ext) && + if (__nft_set_elem_expired(&rbe->ext, tstamp) && nft_set_elem_active(&rbe->ext, cur_genmask)) { err = nft_rbtree_gc_elem(set, priv, rbe); if (err < 0) @@ -537,6 +538,7 @@ static void *nft_rbtree_deactivate(const struct net *net, const struct rb_node *parent = priv->root.rb_node; struct nft_rbtree_elem *rbe, *this = elem->priv; u8 genmask = nft_genmask_next(net); + u64 tstamp = nft_net_tstamp(net); int d; while (parent != NULL) { @@ -557,7 +559,7 @@ static void *nft_rbtree_deactivate(const struct net *net, nft_rbtree_interval_end(this)) { parent = parent->rb_right; continue; - } else if (nft_set_elem_expired(&rbe->ext)) { + } else if (__nft_set_elem_expired(&rbe->ext, tstamp)) { break; } else if (!nft_set_elem_active(&rbe->ext, genmask)) { parent = parent->rb_left; diff --git a/net/packet/af_packet.c b/net/packet/af_packet.c index 3e8077003d59..004cad5b6279 100644 --- a/net/packet/af_packet.c +++ b/net/packet/af_packet.c @@ -492,6 +492,61 @@ static void *packet_current_frame(struct packet_sock *po, return packet_lookup_frame(po, rb, rb->head, status); } +static u16 vlan_get_tci(struct sk_buff *skb, struct net_device *dev) +{ + u8 *skb_orig_data = skb->data; + int skb_orig_len = skb->len; + struct vlan_hdr vhdr, *vh; + unsigned int header_len; + + if (!dev) + return 0; + + /* In the SOCK_DGRAM scenario, skb data starts at the network + * protocol, which is after the VLAN headers. The outer VLAN + * header is at the hard_header_len offset in non-variable + * length link layer headers. If it's a VLAN device, the + * min_header_len should be used to exclude the VLAN header + * size. + */ + if (dev->min_header_len == dev->hard_header_len) + header_len = dev->hard_header_len; + else if (is_vlan_dev(dev)) + header_len = dev->min_header_len; + else + return 0; + + skb_push(skb, skb->data - skb_mac_header(skb)); + vh = skb_header_pointer(skb, header_len, sizeof(vhdr), &vhdr); + if (skb_orig_data != skb->data) { + skb->data = skb_orig_data; + skb->len = skb_orig_len; + } + if (unlikely(!vh)) + return 0; + + return ntohs(vh->h_vlan_TCI); +} + +static __be16 vlan_get_protocol_dgram(struct sk_buff *skb) +{ + __be16 proto = skb->protocol; + + if (unlikely(eth_type_vlan(proto))) { + u8 *skb_orig_data = skb->data; + int skb_orig_len = skb->len; + + skb_push(skb, skb->data - skb_mac_header(skb)); + proto = __vlan_get_protocol(skb, proto, NULL); + if (skb_orig_data != skb->data) { + skb->data = skb_orig_data; + skb->len = skb_orig_len; + } + } + + return proto; +} + static void prb_del_retire_blk_timer(struct tpacket_kbdq_core *pkc) { del_timer_sync(&pkc->retire_blk_timer); @@ -967,10 +1022,16 @@ static void prb_clear_rxhash(struct tpacket_kbdq_core *pkc, static void prb_fill_vlan_info(struct tpacket_kbdq_core *pkc, struct tpacket3_hdr *ppd) { + struct packet_sock *po = container_of(pkc, struct packet_sock, rx_ring.prb_bdqc); + if (skb_vlan_tag_present(pkc->skb)) { ppd->hv1.tp_vlan_tci = skb_vlan_tag_get(pkc->skb); ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->vlan_proto); ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; + } else if (unlikely(po->sk.sk_type == SOCK_DGRAM && eth_type_vlan(pkc->skb->protocol))) { + ppd->hv1.tp_vlan_tci = vlan_get_tci(pkc->skb, pkc->skb->dev); + ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->protocol); + ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; } else { ppd->hv1.tp_vlan_tci = 0; ppd->hv1.tp_vlan_tpid = 0; @@ -2363,6 +2424,10 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev, h.h2->tp_vlan_tci = skb_vlan_tag_get(skb); h.h2->tp_vlan_tpid = ntohs(skb->vlan_proto); status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; + } else if (unlikely(sk->sk_type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) { + h.h2->tp_vlan_tci = vlan_get_tci(skb, skb->dev); + h.h2->tp_vlan_tpid = ntohs(skb->protocol); + status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; } else { h.h2->tp_vlan_tci = 0; h.h2->tp_vlan_tpid = 0; @@ -2392,7 +2457,8 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev, sll->sll_halen = dev_parse_header(skb, sll->sll_addr); sll->sll_family = AF_PACKET; sll->sll_hatype = dev->type; - sll->sll_protocol = skb->protocol; + sll->sll_protocol = (sk->sk_type == SOCK_DGRAM) ? + vlan_get_protocol_dgram(skb) : skb->protocol; sll->sll_pkttype = skb->pkt_type; if (unlikely(packet_sock_flag(po, PACKET_SOCK_ORIGDEV))) sll->sll_ifindex = orig_dev->ifindex; @@ -3420,7 +3486,8 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len, /* Original length was stored in sockaddr_ll fields */ origlen = PACKET_SKB_CB(skb)->sa.origlen; sll->sll_family = AF_PACKET; - sll->sll_protocol = skb->protocol; + sll->sll_protocol = (sock->type == SOCK_DGRAM) ? + vlan_get_protocol_dgram(skb) : skb->protocol; } sock_recv_ts_and_drops(msg, sk, skb); @@ -3475,6 +3542,21 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len, aux.tp_vlan_tci = skb_vlan_tag_get(skb); aux.tp_vlan_tpid = ntohs(skb->vlan_proto); aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; + } else if (unlikely(sock->type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) { + struct sockaddr_ll *sll = &PACKET_SKB_CB(skb)->sa.ll; + struct net_device *dev; + + rcu_read_lock(); + dev = dev_get_by_index_rcu(sock_net(sk), sll->sll_ifindex); + if (dev) { + aux.tp_vlan_tci = vlan_get_tci(skb, dev); + aux.tp_vlan_tpid = ntohs(skb->protocol); + aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; + } else { + aux.tp_vlan_tci = 0; + aux.tp_vlan_tpid = 0; + } + rcu_read_unlock(); } else { aux.tp_vlan_tci = 0; aux.tp_vlan_tpid = 0; diff --git a/net/rds/recv.c b/net/rds/recv.c index 967d115f97ef..f570d64367a4 100644 --- a/net/rds/recv.c +++ b/net/rds/recv.c @@ -424,6 +424,7 @@ static int rds_still_queued(struct rds_sock *rs, struct rds_incoming *inc, struct sock *sk = rds_rs_to_sk(rs); int ret = 0; unsigned long flags; + struct rds_incoming *to_drop = NULL; write_lock_irqsave(&rs->rs_recv_lock, flags); if (!list_empty(&inc->i_item)) { @@ -434,11 +435,14 @@ static int rds_still_queued(struct rds_sock *rs, struct rds_incoming *inc, -be32_to_cpu(inc->i_hdr.h_len), inc->i_hdr.h_dport); list_del_init(&inc->i_item); - rds_inc_put(inc); + to_drop = inc; } } write_unlock_irqrestore(&rs->rs_recv_lock, flags); + if (to_drop) + rds_inc_put(to_drop); + rdsdebug("inc %p rs %p still %d dropped %d\n", inc, rs, ret, drop); return ret; } @@ -761,16 +765,21 @@ void rds_clear_recv_queue(struct rds_sock *rs) struct sock *sk = rds_rs_to_sk(rs); struct rds_incoming *inc, *tmp; unsigned long flags; + LIST_HEAD(to_drop); write_lock_irqsave(&rs->rs_recv_lock, flags); list_for_each_entry_safe(inc, tmp, &rs->rs_recv_queue, i_item) { rds_recv_rcvbuf_delta(rs, sk, inc->i_conn->c_lcong, -be32_to_cpu(inc->i_hdr.h_len), inc->i_hdr.h_dport); + list_move(&inc->i_item, &to_drop); + } + write_unlock_irqrestore(&rs->rs_recv_lock, flags); + + list_for_each_entry_safe(inc, tmp, &to_drop, i_item) { list_del_init(&inc->i_item); rds_inc_put(inc); } - write_unlock_irqrestore(&rs->rs_recv_lock, flags); } /* diff --git a/net/sched/sch_netem.c b/net/sched/sch_netem.c index 265a02b6ad09..591ca93e2a01 100644 --- a/net/sched/sch_netem.c +++ b/net/sched/sch_netem.c @@ -437,12 +437,10 @@ static int netem_enqueue(struct sk_buff *skb, struct Qdisc *sch, struct netem_sched_data *q = qdisc_priv(sch); /* We don't fill cb now as skb_unshare() may invalidate it */ struct netem_skb_cb *cb; - struct sk_buff *skb2; + struct sk_buff *skb2 = NULL; struct sk_buff *segs = NULL; unsigned int prev_len = qdisc_pkt_len(skb); int count = 1; - int rc = NET_XMIT_SUCCESS; - int rc_drop = NET_XMIT_DROP; /* Do not fool qdisc_drop_all() */ skb->prev = NULL; @@ -471,19 +469,11 @@ static int netem_enqueue(struct sk_buff *skb, struct Qdisc *sch, skb_orphan_partial(skb); /* - * If we need to duplicate packet, then re-insert at top of the - * qdisc tree, since parent queuer expects that only one - * skb will be queued. + * If we need to duplicate packet, then clone it before + * original is modified. */ - if (count > 1 && (skb2 = skb_clone(skb, GFP_ATOMIC)) != NULL) { - struct Qdisc *rootq = qdisc_root_bh(sch); - u32 dupsave = q->duplicate; /* prevent duplicating a dup... */ - - q->duplicate = 0; - rootq->enqueue(skb2, rootq, to_free); - q->duplicate = dupsave; - rc_drop = NET_XMIT_SUCCESS; - } + if (count > 1) + skb2 = skb_clone(skb, GFP_ATOMIC); /* * Randomized packet corruption. @@ -495,7 +485,8 @@ static int netem_enqueue(struct sk_buff *skb, struct Qdisc *sch, if (skb_is_gso(skb)) { skb = netem_segment(skb, sch, to_free); if (!skb) - return rc_drop; + goto finish_segs; + segs = skb->next; skb_mark_not_on_list(skb); qdisc_skb_cb(skb)->pkt_len = skb->len; @@ -521,7 +512,24 @@ static int netem_enqueue(struct sk_buff *skb, struct Qdisc *sch, /* re-link segs, so that qdisc_drop_all() frees them all */ skb->next = segs; qdisc_drop_all(skb, sch, to_free); - return rc_drop; + if (skb2) + __qdisc_drop(skb2, to_free); + return NET_XMIT_DROP; + } + + /* + * If doing duplication then re-insert at top of the + * qdisc tree, since parent queuer expects that only one + * skb will be queued. + */ + if (skb2) { + struct Qdisc *rootq = qdisc_root_bh(sch); + u32 dupsave = q->duplicate; /* prevent duplicating a dup... */ + + q->duplicate = 0; + rootq->enqueue(skb2, rootq, to_free); + q->duplicate = dupsave; + skb2 = NULL; } qdisc_qstats_backlog_inc(sch, skb); @@ -592,9 +600,12 @@ static int netem_enqueue(struct sk_buff *skb, struct Qdisc *sch, } finish_segs: + if (skb2) + __qdisc_drop(skb2, to_free); + if (segs) { unsigned int len, last_len; - int nb; + int rc, nb; len = skb ? skb->len : 0; nb = skb ? 1 : 0; diff --git a/net/sctp/input.c b/net/sctp/input.c index c306cb25f524..b1d3e342ac83 100644 --- a/net/sctp/input.c +++ b/net/sctp/input.c @@ -722,23 +722,25 @@ static int __sctp_hash_endpoint(struct sctp_endpoint *ep) struct sock *sk = ep->base.sk; struct net *net = sock_net(sk); struct sctp_hashbucket *head; - struct sctp_ep_common *epb; + int err = 0; - epb = &ep->base; - epb->hashent = sctp_ep_hashfn(net, epb->bind_addr.port); - head = &sctp_ep_hashtable[epb->hashent]; + ep->hashent = sctp_ep_hashfn(net, ep->base.bind_addr.port); + head = &sctp_ep_hashtable[ep->hashent]; + write_lock(&head->lock); if (sk->sk_reuseport) { bool any = sctp_is_ep_boundall(sk); - struct sctp_ep_common *epb2; + struct sctp_endpoint *ep2; struct list_head *list; - int cnt = 0, err = 1; + int cnt = 0; + + err = 1; list_for_each(list, &ep->base.bind_addr.address_list) cnt++; - sctp_for_each_hentry(epb2, &head->chain) { - struct sock *sk2 = epb2->sk; + sctp_for_each_hentry(ep2, &head->chain) { + struct sock *sk2 = ep2->base.sk; if (!net_eq(sock_net(sk2), net) || sk2 == sk || !uid_eq(sock_i_uid(sk2), sock_i_uid(sk)) || @@ -750,24 +752,24 @@ static int __sctp_hash_endpoint(struct sctp_endpoint *ep) if (!err) { err = reuseport_add_sock(sk, sk2, any); if (err) - return err; + goto out; break; } else if (err < 0) { - return err; + goto out; } } if (err) { err = reuseport_alloc(sk, any); if (err) - return err; + goto out; } } - write_lock(&head->lock); - hlist_add_head(&epb->node, &head->chain); + hlist_add_head(&ep->node, &head->chain); +out: write_unlock(&head->lock); - return 0; + return err; } /* Add an endpoint to the hash. Local BH-safe. */ @@ -787,19 +789,15 @@ static void __sctp_unhash_endpoint(struct sctp_endpoint *ep) { struct sock *sk = ep->base.sk; struct sctp_hashbucket *head; - struct sctp_ep_common *epb; - epb = &ep->base; + ep->hashent = sctp_ep_hashfn(sock_net(sk), ep->base.bind_addr.port); - epb->hashent = sctp_ep_hashfn(sock_net(sk), epb->bind_addr.port); - - head = &sctp_ep_hashtable[epb->hashent]; - - if (rcu_access_pointer(sk->sk_reuseport_cb)) - reuseport_detach_sock(sk); + head = &sctp_ep_hashtable[ep->hashent]; write_lock(&head->lock); - hlist_del_init(&epb->node); + if (rcu_access_pointer(sk->sk_reuseport_cb)) + reuseport_detach_sock(sk); + hlist_del_init(&ep->node); write_unlock(&head->lock); } @@ -832,7 +830,6 @@ static struct sctp_endpoint *__sctp_rcv_lookup_endpoint( const union sctp_addr *paddr) { struct sctp_hashbucket *head; - struct sctp_ep_common *epb; struct sctp_endpoint *ep; struct sock *sk; __be16 lport; @@ -842,8 +839,7 @@ static struct sctp_endpoint *__sctp_rcv_lookup_endpoint( hash = sctp_ep_hashfn(net, ntohs(lport)); head = &sctp_ep_hashtable[hash]; read_lock(&head->lock); - sctp_for_each_hentry(epb, &head->chain) { - ep = sctp_ep(epb); + sctp_for_each_hentry(ep, &head->chain) { if (sctp_endpoint_is_match(ep, net, laddr)) goto hit; } diff --git a/net/sctp/proc.c b/net/sctp/proc.c index 963b94517ec2..ec00ee75d59a 100644 --- a/net/sctp/proc.c +++ b/net/sctp/proc.c @@ -161,7 +161,6 @@ static void *sctp_eps_seq_next(struct seq_file *seq, void *v, loff_t *pos) static int sctp_eps_seq_show(struct seq_file *seq, void *v) { struct sctp_hashbucket *head; - struct sctp_ep_common *epb; struct sctp_endpoint *ep; struct sock *sk; int hash = *(loff_t *)v; @@ -171,18 +170,17 @@ static int sctp_eps_seq_show(struct seq_file *seq, void *v) head = &sctp_ep_hashtable[hash]; read_lock_bh(&head->lock); - sctp_for_each_hentry(epb, &head->chain) { - ep = sctp_ep(epb); - sk = epb->sk; + sctp_for_each_hentry(ep, &head->chain) { + sk = ep->base.sk; if (!net_eq(sock_net(sk), seq_file_net(seq))) continue; seq_printf(seq, "%8pK %8pK %-3d %-3d %-4d %-5d %5u %5lu ", ep, sk, sctp_sk(sk)->type, sk->sk_state, hash, - epb->bind_addr.port, + ep->base.bind_addr.port, from_kuid_munged(seq_user_ns(seq), sock_i_uid(sk)), sock_i_ino(sk)); - sctp_seq_dump_local_addrs(seq, epb); + sctp_seq_dump_local_addrs(seq, &ep->base); seq_printf(seq, "\n"); } read_unlock_bh(&head->lock); diff --git a/net/sctp/socket.c b/net/sctp/socket.c index 4f132809eb59..efdb06379f2a 100644 --- a/net/sctp/socket.c +++ b/net/sctp/socket.c @@ -5370,14 +5370,14 @@ int sctp_for_each_endpoint(int (*cb)(struct sctp_endpoint *, void *), void *p) { int err = 0; int hash = 0; - struct sctp_ep_common *epb; + struct sctp_endpoint *ep; struct sctp_hashbucket *head; for (head = sctp_ep_hashtable; hash < sctp_ep_hashsize; hash++, head++) { read_lock_bh(&head->lock); - sctp_for_each_hentry(epb, &head->chain) { - err = cb(sctp_ep(epb), p); + sctp_for_each_hentry(ep, &head->chain) { + err = cb(ep, p); if (err) break; } diff --git a/net/smc/smc_core.c b/net/smc/smc_core.c index 66cdfd5725ac..0a1520c75b86 100644 --- a/net/smc/smc_core.c +++ b/net/smc/smc_core.c @@ -681,21 +681,31 @@ out: return rc; } -/* convert the RMB size into the compressed notation - minimum 16K. +#define SMCD_DMBE_SIZES 6 /* 0 -> 16KB, 1 -> 32KB, .. 6 -> 1MB */ +#define SMCR_RMBE_SIZES 5 /* 0 -> 16KB, 1 -> 32KB, .. 5 -> 512KB */ + +/* convert the RMB size into the compressed notation (minimum 16K, see + * SMCD/R_DMBE_SIZES. * In contrast to plain ilog2, this rounds towards the next power of 2, * so the socket application gets at least its desired sndbuf / rcvbuf size. */ -static u8 smc_compress_bufsize(int size) +static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb) { u8 compressed; if (size <= SMC_BUF_MIN_SIZE) return 0; - size = (size - 1) >> 14; - compressed = ilog2(size) + 1; - if (compressed >= SMC_RMBE_SIZES) - compressed = SMC_RMBE_SIZES - 1; + size = (size - 1) >> 14; /* convert to 16K multiple */ + compressed = min_t(u8, ilog2(size) + 1, + is_smcd ? SMCD_DMBE_SIZES : SMCR_RMBE_SIZES); + +#ifdef CONFIG_ARCH_NO_SG_CHAIN + if (!is_smcd && is_rmb) + /* RMBs are backed by & limited to max size of scatterlists */ + compressed = min_t(u8, compressed, ilog2((SG_MAX_SINGLE_ALLOC * PAGE_SIZE) >> 14)); +#endif + return compressed; } @@ -796,17 +806,12 @@ static struct smc_buf_desc *smcr_new_buf_create(struct smc_link_group *lgr, return buf_desc; } -#define SMCD_DMBE_SIZES 6 /* 0 -> 16KB, 1 -> 32KB, .. 6 -> 1MB */ - static struct smc_buf_desc *smcd_new_buf_create(struct smc_link_group *lgr, bool is_dmb, int bufsize) { struct smc_buf_desc *buf_desc; int rc; - if (smc_compress_bufsize(bufsize) > SMCD_DMBE_SIZES) - return ERR_PTR(-EAGAIN); - /* try to alloc a new DMB */ buf_desc = kzalloc(sizeof(*buf_desc), GFP_KERNEL); if (!buf_desc) @@ -850,9 +855,8 @@ static int __smc_buf_create(struct smc_sock *smc, bool is_smcd, bool is_rmb) /* use socket send buffer size (w/o overhead) as start value */ sk_buf_size = smc->sk.sk_sndbuf / 2; - for (bufsize_short = smc_compress_bufsize(sk_buf_size); + for (bufsize_short = smc_compress_bufsize(sk_buf_size, is_smcd, is_rmb); bufsize_short >= 0; bufsize_short--) { - if (is_rmb) { lock = &lgr->rmbs_lock; buf_list = &lgr->rmbs[bufsize_short]; @@ -861,8 +865,6 @@ static int __smc_buf_create(struct smc_sock *smc, bool is_smcd, bool is_rmb) buf_list = &lgr->sndbufs[bufsize_short]; } bufsize = smc_uncompress_bufsize(bufsize_short); - if ((1 << get_order(bufsize)) > SG_MAX_SINGLE_ALLOC) - continue; /* check for reusable slot in the link group */ buf_desc = smc_buf_get_slot(bufsize_short, lock, buf_list); diff --git a/net/sunrpc/auth_gss/gss_krb5_keys.c b/net/sunrpc/auth_gss/gss_krb5_keys.c index 3b7f721c023b..f77ea3dc0cc8 100644 --- a/net/sunrpc/auth_gss/gss_krb5_keys.c +++ b/net/sunrpc/auth_gss/gss_krb5_keys.c @@ -161,7 +161,7 @@ u32 krb5_derive_key(const struct gss_krb5_enctype *gk5e, if (IS_ERR(cipher)) goto err_return; if (crypto_sync_skcipher_setkey(cipher, inkey->data, inkey->len)) - goto err_return; + goto err_free_cipher; /* allocate and set up buffers */ diff --git a/net/sunrpc/clnt.c b/net/sunrpc/clnt.c index 2e08876bf856..f689c7b0c304 100644 --- a/net/sunrpc/clnt.c +++ b/net/sunrpc/clnt.c @@ -2236,12 +2236,13 @@ call_transmit_status(struct rpc_task *task) task->tk_action = call_transmit; task->tk_status = 0; break; - case -ECONNREFUSED: case -EHOSTDOWN: case -ENETDOWN: case -EHOSTUNREACH: case -ENETUNREACH: case -EPERM: + break; + case -ECONNREFUSED: if (RPC_IS_SOFTCONN(task)) { if (!task->tk_msg.rpc_proc->p_proc) trace_xprt_ping(task->tk_xprt, diff --git a/net/sunrpc/sched.c b/net/sunrpc/sched.c index a5c6a3d05741..df83c59cde7f 100644 --- a/net/sunrpc/sched.c +++ b/net/sunrpc/sched.c @@ -368,8 +368,10 @@ static void rpc_make_runnable(struct workqueue_struct *wq, if (RPC_IS_ASYNC(task)) { INIT_WORK(&task->u.tk_work, rpc_async_schedule); queue_work(wq, &task->u.tk_work); - } else + } else { + smp_mb__after_atomic(); wake_up_bit(&task->tk_runstate, RPC_TASK_QUEUED); + } } /* diff --git a/net/tipc/udp_media.c b/net/tipc/udp_media.c index 1fb0535e2eb4..4db2185a32ae 100644 --- a/net/tipc/udp_media.c +++ b/net/tipc/udp_media.c @@ -128,8 +128,11 @@ static int tipc_udp_addr2str(struct tipc_media_addr *a, char *buf, int size) snprintf(buf, size, "%pI4:%u", &ua->ipv4, ntohs(ua->port)); else if (ntohs(ua->proto) == ETH_P_IPV6) snprintf(buf, size, "%pI6:%u", &ua->ipv6, ntohs(ua->port)); - else + else { pr_err("Invalid UDP media address\n"); + return 1; + } + return 0; } diff --git a/net/wireless/nl80211.c b/net/wireless/nl80211.c index 8b67401f3c2f..92f4d7f500a5 100644 --- a/net/wireless/nl80211.c +++ b/net/wireless/nl80211.c @@ -3848,10 +3848,7 @@ static void get_key_callback(void *c, struct key_params *params) struct nlattr *key; struct get_key_cookie *cookie = c; - if ((params->key && - nla_put(cookie->msg, NL80211_ATTR_KEY_DATA, - params->key_len, params->key)) || - (params->seq && + if ((params->seq && nla_put(cookie->msg, NL80211_ATTR_KEY_SEQ, params->seq_len, params->seq)) || (params->cipher && @@ -3863,10 +3860,7 @@ static void get_key_callback(void *c, struct key_params *params) if (!key) goto nla_put_failure; - if ((params->key && - nla_put(cookie->msg, NL80211_KEY_DATA, - params->key_len, params->key)) || - (params->seq && + if ((params->seq && nla_put(cookie->msg, NL80211_KEY_SEQ, params->seq_len, params->seq)) || (params->cipher && diff --git a/net/wireless/util.c b/net/wireless/util.c index 01df67b9c201..a84ad8197353 100644 --- a/net/wireless/util.c +++ b/net/wireless/util.c @@ -1301,7 +1301,7 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate) 2048, /* 1.000000... */ }; u32 rates_160M[3] = { 960777777, 907400000, 816666666 }; - u32 rates_969[3] = { 480388888, 453700000, 408333333 }; + u32 rates_996[3] = { 480388888, 453700000, 408333333 }; u32 rates_484[3] = { 229411111, 216666666, 195000000 }; u32 rates_242[3] = { 114711111, 108333333, 97500000 }; u32 rates_106[3] = { 40000000, 37777777, 34000000 }; @@ -1321,12 +1321,14 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate) if (WARN_ON_ONCE(rate->nss < 1 || rate->nss > 8)) return 0; - if (rate->bw == RATE_INFO_BW_160) + if (rate->bw == RATE_INFO_BW_160 || + (rate->bw == RATE_INFO_BW_HE_RU && + rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_2x996)) result = rates_160M[rate->he_gi]; else if (rate->bw == RATE_INFO_BW_80 || (rate->bw == RATE_INFO_BW_HE_RU && rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_996)) - result = rates_969[rate->he_gi]; + result = rates_996[rate->he_gi]; else if (rate->bw == RATE_INFO_BW_40 || (rate->bw == RATE_INFO_BW_HE_RU && rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_484)) diff --git a/scripts/gcc-x86_32-has-stack-protector.sh b/scripts/gcc-x86_32-has-stack-protector.sh index f5c119495254..e05020116b37 100755 --- a/scripts/gcc-x86_32-has-stack-protector.sh +++ b/scripts/gcc-x86_32-has-stack-protector.sh @@ -1,4 +1,4 @@ #!/bin/sh # SPDX-License-Identifier: GPL-2.0 -echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m32 -O0 -fstack-protector - -o - 2> /dev/null | grep -q "%gs" +echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m32 -O0 -fstack-protector - -o - 2> /dev/null | grep -q "%gs" diff --git a/scripts/gcc-x86_64-has-stack-protector.sh b/scripts/gcc-x86_64-has-stack-protector.sh index 75e4e22b986a..f680bb01aeeb 100755 --- a/scripts/gcc-x86_64-has-stack-protector.sh +++ b/scripts/gcc-x86_64-has-stack-protector.sh @@ -1,4 +1,4 @@ #!/bin/sh # SPDX-License-Identifier: GPL-2.0 -echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs" +echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs" diff --git a/security/apparmor/lsm.c b/security/apparmor/lsm.c index 21e03380dd86..4c69259b62f1 100644 --- a/security/apparmor/lsm.c +++ b/security/apparmor/lsm.c @@ -1035,6 +1035,13 @@ static int apparmor_socket_sock_rcv_skb(struct sock *sk, struct sk_buff *skb) if (!skb->secmark) return 0; + /* + * If reach here before socket_post_create hook is called, in which + * case label is null, drop the packet. + */ + if (!ctx->label) + return -EACCES; + return apparmor_secmark_check(ctx->label, OP_RECVMSG, AA_MAY_RECEIVE, skb->secmark, sk); } diff --git a/security/selinux/avc.c b/security/selinux/avc.c index 4a744b1cebc8..ebe3d08cccac 100644 --- a/security/selinux/avc.c +++ b/security/selinux/avc.c @@ -329,12 +329,12 @@ static int avc_add_xperms_decision(struct avc_node *node, { struct avc_xperms_decision_node *dest_xpd; - node->ae.xp_node->xp.len++; dest_xpd = avc_xperms_decision_alloc(src->used); if (!dest_xpd) return -ENOMEM; avc_copy_xperms_decision(&dest_xpd->xpd, src); list_add(&dest_xpd->xpd_list, &node->ae.xp_node->xpd_head); + node->ae.xp_node->xp.len++; return 0; } diff --git a/sound/core/timer.c b/sound/core/timer.c index 246fabc0f667..98ee2a898b39 100644 --- a/sound/core/timer.c +++ b/sound/core/timer.c @@ -527,7 +527,7 @@ static int snd_timer_start1(struct snd_timer_instance *timeri, /* check the actual time for the start tick; * bail out as error if it's way too low (< 100us) */ - if (start) { + if (start && !(timer->hw.flags & SNDRV_TIMER_HW_SLAVE)) { if ((u64)snd_timer_hw_resolution(timer) * ticks < 100000) { result = -EINVAL; goto unlock; diff --git a/sound/pci/hda/patch_hdmi.c b/sound/pci/hda/patch_hdmi.c index ff81e6051773..31ba21b80504 100644 --- a/sound/pci/hda/patch_hdmi.c +++ b/sound/pci/hda/patch_hdmi.c @@ -1818,6 +1818,8 @@ static int hdmi_add_cvt(struct hda_codec *codec, hda_nid_t cvt_nid) } static const struct snd_pci_quirk force_connect_list[] = { + SND_PCI_QUIRK(0x103c, 0x83e2, "HP EliteDesk 800 G4", 1), + SND_PCI_QUIRK(0x103c, 0x83ef, "HP MP9 G4 Retail System AMS", 1), SND_PCI_QUIRK(0x103c, 0x870f, "HP", 1), SND_PCI_QUIRK(0x103c, 0x871a, "HP", 1), SND_PCI_QUIRK(0x103c, 0x8711, "HP", 1), diff --git a/sound/pci/hda/patch_realtek.c b/sound/pci/hda/patch_realtek.c index 77034c31fa12..dddf3f55cb13 100644 --- a/sound/pci/hda/patch_realtek.c +++ b/sound/pci/hda/patch_realtek.c @@ -520,7 +520,6 @@ static void alc_shutup_pins(struct hda_codec *codec) switch (codec->core.vendor_id) { case 0x10ec0236: case 0x10ec0256: - case 0x10ec0257: case 0x19e58326: case 0x10ec0283: case 0x10ec0285: diff --git a/sound/soc/codecs/max98088.c b/sound/soc/codecs/max98088.c index fa4cdbfd0b80..678b209d0bce 100644 --- a/sound/soc/codecs/max98088.c +++ b/sound/soc/codecs/max98088.c @@ -1317,6 +1317,7 @@ static int max98088_set_bias_level(struct snd_soc_component *component, enum snd_soc_bias_level level) { struct max98088_priv *max98088 = snd_soc_component_get_drvdata(component); + int ret; switch (level) { case SND_SOC_BIAS_ON: @@ -1332,10 +1333,13 @@ static int max98088_set_bias_level(struct snd_soc_component *component, */ if (!IS_ERR(max98088->mclk)) { if (snd_soc_component_get_bias_level(component) == - SND_SOC_BIAS_ON) + SND_SOC_BIAS_ON) { clk_disable_unprepare(max98088->mclk); - else - clk_prepare_enable(max98088->mclk); + } else { + ret = clk_prepare_enable(max98088->mclk); + if (ret) + return ret; + } } break; diff --git a/sound/soc/intel/common/soc-intel-quirks.h b/sound/soc/intel/common/soc-intel-quirks.h index 645baf0ed3dd..a7960b41a6a3 100644 --- a/sound/soc/intel/common/soc-intel-quirks.h +++ b/sound/soc/intel/common/soc-intel-quirks.h @@ -9,36 +9,13 @@ #ifndef _SND_SOC_INTEL_QUIRKS_H #define _SND_SOC_INTEL_QUIRKS_H -#if IS_ENABLED(CONFIG_X86) +#include + +#if IS_REACHABLE(CONFIG_IOSF_MBI) #include -#include -#include #include -#define ICPU(model) { X86_VENDOR_INTEL, 6, model, X86_FEATURE_ANY, } - -#define SOC_INTEL_IS_CPU(soc, type) \ -static inline bool soc_intel_is_##soc(void) \ -{ \ - static const struct x86_cpu_id soc##_cpu_ids[] = { \ - ICPU(type), \ - {} \ - }; \ - const struct x86_cpu_id *id; \ - \ - id = x86_match_cpu(soc##_cpu_ids); \ - if (id) \ - return true; \ - return false; \ -} - -SOC_INTEL_IS_CPU(byt, INTEL_FAM6_ATOM_SILVERMONT); -SOC_INTEL_IS_CPU(cht, INTEL_FAM6_ATOM_AIRMONT); -SOC_INTEL_IS_CPU(apl, INTEL_FAM6_ATOM_GOLDMONT); -SOC_INTEL_IS_CPU(glk, INTEL_FAM6_ATOM_GOLDMONT_PLUS); -SOC_INTEL_IS_CPU(cml, INTEL_FAM6_KABYLAKE_L); - static inline bool soc_intel_is_byt_cr(struct platform_device *pdev) { /* @@ -116,30 +93,6 @@ static inline bool soc_intel_is_byt_cr(struct platform_device *pdev) return false; } -static inline bool soc_intel_is_byt(void) -{ - return false; -} - -static inline bool soc_intel_is_cht(void) -{ - return false; -} - -static inline bool soc_intel_is_apl(void) -{ - return false; -} - -static inline bool soc_intel_is_glk(void) -{ - return false; -} - -static inline bool soc_intel_is_cml(void) -{ - return false; -} #endif - #endif /* _SND_SOC_INTEL_QUIRKS_H */ +#endif /* _SND_SOC_INTEL_QUIRKS_H */ diff --git a/sound/usb/helper.c b/sound/usb/helper.c index 4c12cc5b53fd..cf92d7110773 100644 --- a/sound/usb/helper.c +++ b/sound/usb/helper.c @@ -63,20 +63,6 @@ void *snd_usb_find_csint_desc(void *buffer, int buflen, void *after, u8 dsubtype return NULL; } -/* check the validity of pipe and EP types */ -int snd_usb_pipe_sanity_check(struct usb_device *dev, unsigned int pipe) -{ - static const int pipetypes[4] = { - PIPE_CONTROL, PIPE_ISOCHRONOUS, PIPE_BULK, PIPE_INTERRUPT - }; - struct usb_host_endpoint *ep; - - ep = usb_pipe_endpoint(dev, pipe); - if (!ep || usb_pipetype(pipe) != pipetypes[usb_endpoint_type(&ep->desc)]) - return -EINVAL; - return 0; -} - /* * Wrapper for usb_control_msg(). * Allocates a temp buffer to prevent dmaing from/to the stack. @@ -89,7 +75,7 @@ int snd_usb_ctl_msg(struct usb_device *dev, unsigned int pipe, __u8 request, void *buf = NULL; int timeout; - if (snd_usb_pipe_sanity_check(dev, pipe)) + if (usb_pipe_type_check(dev, pipe)) return -EINVAL; if (size > 0) { diff --git a/sound/usb/helper.h b/sound/usb/helper.h index 5e8a18b4e7b9..f5b4c6647e4d 100644 --- a/sound/usb/helper.h +++ b/sound/usb/helper.h @@ -7,7 +7,6 @@ unsigned int snd_usb_combine_bytes(unsigned char *bytes, int size); void *snd_usb_find_desc(void *descstart, int desclen, void *after, u8 dtype); void *snd_usb_find_csint_desc(void *descstart, int desclen, void *after, u8 dsubtype); -int snd_usb_pipe_sanity_check(struct usb_device *dev, unsigned int pipe); int snd_usb_ctl_msg(struct usb_device *dev, unsigned int pipe, __u8 request, __u8 requesttype, __u16 value, __u16 index, void *data, __u16 size); diff --git a/sound/usb/line6/driver.c b/sound/usb/line6/driver.c index efa8fb59d3ad..c60ad1ba0bd5 100644 --- a/sound/usb/line6/driver.c +++ b/sound/usb/line6/driver.c @@ -285,12 +285,14 @@ static void line6_data_received(struct urb *urb) { struct usb_line6 *line6 = (struct usb_line6 *)urb->context; struct midi_buffer *mb = &line6->line6midi->midibuf_in; + unsigned long flags; int done; if (urb->status == -ESHUTDOWN) return; if (line6->properties->capabilities & LINE6_CAP_CONTROL_MIDI) { + spin_lock_irqsave(&line6->line6midi->lock, flags); done = line6_midibuf_write(mb, urb->transfer_buffer, urb->actual_length); @@ -299,12 +301,15 @@ static void line6_data_received(struct urb *urb) dev_dbg(line6->ifcdev, "%d %d buffer overflow - message skipped\n", done, urb->actual_length); } + spin_unlock_irqrestore(&line6->line6midi->lock, flags); for (;;) { + spin_lock_irqsave(&line6->line6midi->lock, flags); done = line6_midibuf_read(mb, line6->buffer_message, LINE6_MIDI_MESSAGE_MAXLEN, LINE6_MIDIBUF_READ_RX); + spin_unlock_irqrestore(&line6->line6midi->lock, flags); if (done <= 0) break; diff --git a/sound/usb/mixer_scarlett_gen2.c b/sound/usb/mixer_scarlett_gen2.c index ab7abe360fcf..6d8ef3aa99b5 100644 --- a/sound/usb/mixer_scarlett_gen2.c +++ b/sound/usb/mixer_scarlett_gen2.c @@ -1988,7 +1988,7 @@ static int scarlett2_mixer_status_create(struct usb_mixer_interface *mixer) return 0; } - if (snd_usb_pipe_sanity_check(dev, pipe)) + if (usb_pipe_type_check(dev, pipe)) return -EINVAL; mixer->urb = usb_alloc_urb(0, GFP_KERNEL); diff --git a/sound/usb/quirks-table.h b/sound/usb/quirks-table.h index 96d32766e93c..a5b0a1a0fc57 100644 --- a/sound/usb/quirks-table.h +++ b/sound/usb/quirks-table.h @@ -390,6 +390,7 @@ YAMAHA_DEVICE(0x105a, NULL), YAMAHA_DEVICE(0x105b, NULL), YAMAHA_DEVICE(0x105c, NULL), YAMAHA_DEVICE(0x105d, NULL), +YAMAHA_DEVICE(0x1718, "P-125"), { USB_DEVICE(0x0499, 0x1503), .driver_info = (unsigned long) & (const struct snd_usb_audio_quirk) { diff --git a/sound/usb/quirks.c b/sound/usb/quirks.c index 112429884906..4f8e01313efe 100644 --- a/sound/usb/quirks.c +++ b/sound/usb/quirks.c @@ -854,7 +854,7 @@ static int snd_usb_accessmusic_boot_quirk(struct usb_device *dev) static const u8 seq[] = { 0x4e, 0x73, 0x52, 0x01 }; void *buf; - if (snd_usb_pipe_sanity_check(dev, usb_sndintpipe(dev, 0x05))) + if (usb_pipe_type_check(dev, usb_sndintpipe(dev, 0x05))) return -EINVAL; buf = kmemdup(seq, ARRAY_SIZE(seq), GFP_KERNEL); if (!buf) @@ -883,7 +883,7 @@ static int snd_usb_nativeinstruments_boot_quirk(struct usb_device *dev) { int ret; - if (snd_usb_pipe_sanity_check(dev, usb_sndctrlpipe(dev, 0))) + if (usb_pipe_type_check(dev, usb_sndctrlpipe(dev, 0))) return -EINVAL; ret = usb_control_msg(dev, usb_sndctrlpipe(dev, 0), 0xaf, USB_TYPE_VENDOR | USB_RECIP_DEVICE, @@ -992,7 +992,7 @@ static int snd_usb_axefx3_boot_quirk(struct usb_device *dev) dev_dbg(&dev->dev, "Waiting for Axe-Fx III to boot up...\n"); - if (snd_usb_pipe_sanity_check(dev, usb_sndctrlpipe(dev, 0))) + if (usb_pipe_type_check(dev, usb_sndctrlpipe(dev, 0))) return -EINVAL; /* If the Axe-Fx III has not fully booted, it will timeout when trying * to enable the audio streaming interface. A more generous timeout is @@ -1026,7 +1026,7 @@ static int snd_usb_motu_microbookii_communicate(struct usb_device *dev, u8 *buf, { int err, actual_length; - if (snd_usb_pipe_sanity_check(dev, usb_sndintpipe(dev, 0x01))) + if (usb_pipe_type_check(dev, usb_sndintpipe(dev, 0x01))) return -EINVAL; err = usb_interrupt_msg(dev, usb_sndintpipe(dev, 0x01), buf, *length, &actual_length, 1000); @@ -1038,7 +1038,7 @@ static int snd_usb_motu_microbookii_communicate(struct usb_device *dev, u8 *buf, memset(buf, 0, buf_size); - if (snd_usb_pipe_sanity_check(dev, usb_rcvintpipe(dev, 0x82))) + if (usb_pipe_type_check(dev, usb_rcvintpipe(dev, 0x82))) return -EINVAL; err = usb_interrupt_msg(dev, usb_rcvintpipe(dev, 0x82), buf, buf_size, &actual_length, 1000); @@ -1125,7 +1125,7 @@ static int snd_usb_motu_m_series_boot_quirk(struct usb_device *dev) { int ret; - if (snd_usb_pipe_sanity_check(dev, usb_sndctrlpipe(dev, 0))) + if (usb_pipe_type_check(dev, usb_sndctrlpipe(dev, 0))) return -EINVAL; ret = usb_control_msg(dev, usb_sndctrlpipe(dev, 0), 1, USB_TYPE_VENDOR | USB_RECIP_DEVICE, diff --git a/sound/usb/stream.c b/sound/usb/stream.c index 4e859320d17c..c485dc623c77 100644 --- a/sound/usb/stream.c +++ b/sound/usb/stream.c @@ -248,8 +248,8 @@ static struct snd_pcm_chmap_elem *convert_chmap(int channels, unsigned int bits, SNDRV_CHMAP_FR, /* right front */ SNDRV_CHMAP_FC, /* center front */ SNDRV_CHMAP_LFE, /* LFE */ - SNDRV_CHMAP_SL, /* left surround */ - SNDRV_CHMAP_SR, /* right surround */ + SNDRV_CHMAP_RL, /* left surround */ + SNDRV_CHMAP_RR, /* right surround */ SNDRV_CHMAP_FLC, /* left of center */ SNDRV_CHMAP_FRC, /* right of center */ SNDRV_CHMAP_RC, /* surround */ diff --git a/tools/include/linux/align.h b/tools/include/linux/align.h new file mode 100644 index 000000000000..14e34ace80dd --- /dev/null +++ b/tools/include/linux/align.h @@ -0,0 +1,12 @@ +/* SPDX-License-Identifier: GPL-2.0-only */ + +#ifndef _TOOLS_LINUX_ALIGN_H +#define _TOOLS_LINUX_ALIGN_H + +#include + +#define ALIGN(x, a) __ALIGN_KERNEL((x), (a)) +#define ALIGN_DOWN(x, a) __ALIGN_KERNEL((x) - ((a) - 1), (a)) +#define IS_ALIGNED(x, a) (((x) & ((typeof(x))(a) - 1)) == 0) + +#endif /* _TOOLS_LINUX_ALIGN_H */ diff --git a/tools/include/linux/bitmap.h b/tools/include/linux/bitmap.h index 05dca5c203f3..61cf3b9a23a6 100644 --- a/tools/include/linux/bitmap.h +++ b/tools/include/linux/bitmap.h @@ -3,6 +3,7 @@ #define _PERF_BITOPS_H #include +#include #include #include #include @@ -28,13 +29,14 @@ void bitmap_clear(unsigned long *map, unsigned int start, int len); #define small_const_nbits(nbits) \ (__builtin_constant_p(nbits) && (nbits) <= BITS_PER_LONG) +#define bitmap_size(nbits) (ALIGN(nbits, BITS_PER_LONG) / BITS_PER_BYTE) + static inline void bitmap_zero(unsigned long *dst, int nbits) { if (small_const_nbits(nbits)) *dst = 0UL; else { - int len = BITS_TO_LONGS(nbits) * sizeof(unsigned long); - memset(dst, 0, len); + memset(dst, 0, bitmap_size(nbits)); } } @@ -120,7 +122,7 @@ static inline int test_and_clear_bit(int nr, unsigned long *addr) */ static inline unsigned long *bitmap_alloc(int nbits) { - return calloc(1, BITS_TO_LONGS(nbits) * sizeof(unsigned long)); + return calloc(1, bitmap_size(nbits)); } /* diff --git a/tools/lib/bpf/btf_dump.c b/tools/lib/bpf/btf_dump.c index a1176a9e8430..1391f6c29205 100644 --- a/tools/lib/bpf/btf_dump.c +++ b/tools/lib/bpf/btf_dump.c @@ -1302,10 +1302,12 @@ static void btf_dump_emit_type_chain(struct btf_dump *d, * Clang for BPF target generates func_proto with no * args as a func_proto with a single void arg (e.g., * `int (*f)(void)` vs just `int (*f)()`). We are - * going to pretend there are no args for such case. + * going to emit valid empty args (void) syntax for + * such case. Similarly and conveniently, valid + * no args case can be special-cased here as well. */ - if (vlen == 1 && p->type == 0) { - btf_dump_printf(d, ")"); + if (vlen == 0 || (vlen == 1 && p->type == 0)) { + btf_dump_printf(d, "void)"); return; } diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat index 6b52f365d73a..9f3b5b38221b 100644 --- a/tools/memory-model/lock.cat +++ b/tools/memory-model/lock.cat @@ -102,19 +102,19 @@ let rf-lf = rfe-lf | rfi-lf * within one of the lock's critical sections returns False. *) -(* rfi for RU events: an RU may read from the last po-previous UL *) -let rfi-ru = ([UL] ; po-loc ; [RU]) \ ([UL] ; po-loc ; [LKW] ; po-loc) - -(* rfe for RU events: an RU may read from an external UL or the initial write *) -let all-possible-rfe-ru = - let possible-rfe-ru r = +(* + * rf for RU events: an RU may read from an external UL or the initial write, + * or from the last po-previous UL + *) +let all-possible-rf-ru = + let possible-rf-ru r = let pair-to-relation p = p ++ 0 - in map pair-to-relation (((UL | IW) * {r}) & loc & ext) - in map possible-rfe-ru RU + in map pair-to-relation ((((UL | IW) * {r}) & loc & ext) | + (((UL * {r}) & po-loc) \ ([UL] ; po-loc ; [LKW] ; po-loc))) + in map possible-rf-ru RU (* Generate all rf relations for RU events *) -with rfe-ru from cross(all-possible-rfe-ru) -let rf-ru = rfe-ru | rfi-ru +with rf-ru from cross(all-possible-rf-ru) (* Final rf relation *) let rf = rf | rf-lf | rf-ru diff --git a/tools/perf/util/sort.c b/tools/perf/util/sort.c index baf73ca66a2b..d2d149966acc 100644 --- a/tools/perf/util/sort.c +++ b/tools/perf/util/sort.c @@ -269,7 +269,7 @@ sort__sym_cmp(struct hist_entry *left, struct hist_entry *right) * comparing symbol address alone is not enough since it's a * relative address within a dso. */ - if (!hists__has(left->hists, dso) || hists__has(right->hists, dso)) { + if (!hists__has(left->hists, dso)) { ret = sort__dso_cmp(left, right); if (ret != 0) return ret; diff --git a/tools/testing/selftests/bpf/prog_tests/send_signal.c b/tools/testing/selftests/bpf/prog_tests/send_signal.c index b607112c64e7..281d097b4b76 100644 --- a/tools/testing/selftests/bpf/prog_tests/send_signal.c +++ b/tools/testing/selftests/bpf/prog_tests/send_signal.c @@ -174,7 +174,8 @@ static void test_send_signal_tracepoint(void) static void test_send_signal_perf(void) { struct perf_event_attr attr = { - .sample_period = 1, + .freq = 1, + .sample_freq = 1000, .type = PERF_TYPE_SOFTWARE, .config = PERF_COUNT_SW_CPU_CLOCK, }; diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c index ba97165bdb28..a657651eba52 100644 --- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c +++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c @@ -14,9 +14,9 @@ typedef int *ptr_arr_t[6]; typedef int *ptr_multiarr_t[7][8][9][10]; -typedef int * (*fn_ptr_arr_t[11])(); +typedef int * (*fn_ptr_arr_t[11])(void); -typedef int * (*fn_ptr_multiarr_t[12][13])(); +typedef int * (*fn_ptr_multiarr_t[12][13])(void); struct root_struct { arr_t _1; diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c index 0620580a5c16..1fcca43ab342 100644 --- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c +++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c @@ -67,7 +67,7 @@ typedef void (*printf_fn_t)(const char *, ...); * `int -> char *` function and returns pointer to a char. Equivalent: * typedef char * (*fn_input_t)(int); * typedef char * (*fn_output_outer_t)(fn_input_t); - * typedef const fn_output_outer_t (* fn_output_inner_t)(); + * typedef const fn_output_outer_t (* fn_output_inner_t)(void); * typedef const fn_output_inner_t fn_ptr_arr2_t[5]; */ /* ----- START-EXPECTED-OUTPUT ----- */ @@ -94,7 +94,7 @@ typedef void (* (*signal_t)(int, void (*)(int)))(int); typedef char * (*fn_ptr_arr1_t[10])(int **); -typedef char * (* (* const fn_ptr_arr2_t[5])())(char * (*)(int)); +typedef char * (* (* const fn_ptr_arr2_t[5])(void))(char * (*)(int)); struct struct_w_typedefs { int_t a; diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c index 779e11da979c..5e5648ed0b11 100644 --- a/tools/testing/selftests/bpf/test_sockmap.c +++ b/tools/testing/selftests/bpf/test_sockmap.c @@ -552,7 +552,8 @@ static int msg_loop(int fd, int iov_count, int iov_length, int cnt, } } - s->bytes_recvd += recv; + if (recv > 0) + s->bytes_recvd += recv; if (data) { int chunk_sz = opt->sendpage ? diff --git a/tools/testing/selftests/net/forwarding/devlink_lib.sh b/tools/testing/selftests/net/forwarding/devlink_lib.sh index 13d03a6d85ba..dd9a85631858 100644 --- a/tools/testing/selftests/net/forwarding/devlink_lib.sh +++ b/tools/testing/selftests/net/forwarding/devlink_lib.sh @@ -102,6 +102,8 @@ devlink_reload() still_pending=$(devlink resource show "$DEVLINK_DEV" | \ grep -c "size_new") check_err $still_pending "Failed reload - There are still unset sizes" + + udevadm settle } declare -A DEVLINK_ORIG diff --git a/tools/testing/selftests/sigaltstack/current_stack_pointer.h b/tools/testing/selftests/sigaltstack/current_stack_pointer.h index ea9bdf3a90b1..09da8f1011ce 100644 --- a/tools/testing/selftests/sigaltstack/current_stack_pointer.h +++ b/tools/testing/selftests/sigaltstack/current_stack_pointer.h @@ -8,7 +8,7 @@ register unsigned long sp asm("sp"); register unsigned long sp asm("esp"); #elif __loongarch64 register unsigned long sp asm("$sp"); -#elif __ppc__ +#elif __powerpc__ register unsigned long sp asm("r1"); #elif __s390x__ register unsigned long sp asm("%15"); diff --git a/tools/testing/selftests/tc-testing/tdc.py b/tools/testing/selftests/tc-testing/tdc.py index e566c70e64a1..81f76a5d12ac 100755 --- a/tools/testing/selftests/tc-testing/tdc.py +++ b/tools/testing/selftests/tc-testing/tdc.py @@ -129,7 +129,6 @@ class PluginMgr: except Exception as ee: print('exception {} in call to pre_case for {} plugin'. format(ee, pgn_inst.__class__)) - print('test_ordinal is {}'.format(test_ordinal)) print('testid is {}'.format(caseinfo['id'])) raise