diff --git a/Documentation/arm64/silicon-errata.txt b/Documentation/arm64/silicon-errata.txt index c31fe4722c66..9f3109f0e6f2 100644 --- a/Documentation/arm64/silicon-errata.txt +++ b/Documentation/arm64/silicon-errata.txt @@ -61,8 +61,26 @@ stable kernels. | ARM | Cortex-A73 | #858921 | ARM64_ERRATUM_858921 | | ARM | Cortex-A55 | #1024718 | ARM64_ERRATUM_1024718 | | ARM | Cortex-A76 | #1463225 | ARM64_ERRATUM_1463225 | +| ARM | Cortex-A76 | #3324349 | ARM64_ERRATUM_3194386 | +| ARM | Cortex-A77 | #3324348 | ARM64_ERRATUM_3194386 | +| ARM | Cortex-A78 | #3324344 | ARM64_ERRATUM_3194386 | +| ARM | Cortex-A78C | #3324346,3324347| ARM64_ERRATUM_3194386 | +| ARM | Cortex-A710 | #3324338 | ARM64_ERRATUM_3194386 | +| ARM | Cortex-A720 | #3456091 | ARM64_ERRATUM_3194386 | +| ARM | Cortex-A725 | #3456106 | ARM64_ERRATUM_3194386 | +| ARM | Cortex-X1 | #3324344 | ARM64_ERRATUM_3194386 | +| ARM | Cortex-X1C | #3324346 | ARM64_ERRATUM_3194386 | +| ARM | Cortex-X2 | #3324338 | ARM64_ERRATUM_3194386 | +| ARM | Cortex-X3 | #3324335 | ARM64_ERRATUM_3194386 | +| ARM | Cortex-X4 | #3194386 | ARM64_ERRATUM_3194386 | +| ARM | Cortex-X925 | #3324334 | ARM64_ERRATUM_3194386 | | ARM | Cortex-A77 | #1542418 | ARM64_ERRATUM_1542418 | | ARM | Neoverse-N1 | #1542419 | ARM64_ERRATUM_1542419 | +| ARM | Neoverse-N1 | #3324349 | ARM64_ERRATUM_3194386 | +| ARM | Neoverse-N2 | #3324339 | ARM64_ERRATUM_3194386 | +| ARM | Neoverse-V1 | #3324341 | ARM64_ERRATUM_3194386 | +| ARM | Neoverse-V2 | #3324336 | ARM64_ERRATUM_3194386 | +| ARM | Neoverse-V3 | #3312417 | ARM64_ERRATUM_3194386 | | ARM | MMU-500 | #841119,#826419 | N/A | | | | | | | Cavium | ThunderX ITS | #22375, #24313 | CAVIUM_ERRATUM_22375 | diff --git a/Documentation/hwmon/hwmon-kernel-api.txt b/Documentation/hwmon/hwmon-kernel-api.txt index eb7a78aebb38..8bdefb41be30 100644 --- a/Documentation/hwmon/hwmon-kernel-api.txt +++ b/Documentation/hwmon/hwmon-kernel-api.txt @@ -299,17 +299,25 @@ functions is used. The header file linux/hwmon-sysfs.h provides a number of useful macros to declare and use hardware monitoring sysfs attributes. -In many cases, you can use the exsting define DEVICE_ATTR to declare such -attributes. This is feasible if an attribute has no additional context. However, -in many cases there will be additional information such as a sensor index which -will need to be passed to the sysfs attribute handling function. +In many cases, you can use the exsting define DEVICE_ATTR or its variants +DEVICE_ATTR_{RW,RO,WO} to declare such attributes. This is feasible if an +attribute has no additional context. However, in many cases there will be +additional information such as a sensor index which will need to be passed +to the sysfs attribute handling function. SENSOR_DEVICE_ATTR and SENSOR_DEVICE_ATTR_2 can be used to define attributes which need such additional context information. SENSOR_DEVICE_ATTR requires one additional argument, SENSOR_DEVICE_ATTR_2 requires two. -SENSOR_DEVICE_ATTR defines a struct sensor_device_attribute variable. -This structure has the following fields. +Simplified variants of SENSOR_DEVICE_ATTR and SENSOR_DEVICE_ATTR_2 are available +and should be used if standard attribute permissions and function names are +feasible. Standard permissions are 0644 for SENSOR_DEVICE_ATTR[_2]_RW, +0444 for SENSOR_DEVICE_ATTR[_2]_RO, and 0200 for SENSOR_DEVICE_ATTR[_2]_WO. +Standard functions, similar to DEVICE_ATTR_{RW,RO,WO}, have _show and _store +appended to the provided function name. + +SENSOR_DEVICE_ATTR and its variants define a struct sensor_device_attribute +variable. This structure has the following fields. struct sensor_device_attribute { struct device_attribute dev_attr; @@ -320,8 +328,8 @@ You can use to_sensor_dev_attr to get the pointer to this structure from the attribute read or write function. Its parameter is the device to which the attribute is attached. -SENSOR_DEVICE_ATTR_2 defines a struct sensor_device_attribute_2 variable, -which is defined as follows. +SENSOR_DEVICE_ATTR_2 and its variants define a struct sensor_device_attribute_2 +variable, which is defined as follows. struct sensor_device_attribute_2 { struct device_attribute dev_attr; diff --git a/Makefile b/Makefile index 3cbfeb4e1aa1..d67543eb4433 100644 --- a/Makefile +++ b/Makefile @@ -1,7 +1,7 @@ # SPDX-License-Identifier: GPL-2.0 VERSION = 4 PATCHLEVEL = 19 -SUBLEVEL = 318 +SUBLEVEL = 321 EXTRAVERSION = NAME = "People's Front" diff --git a/arch/arm/include/asm/uaccess.h b/arch/arm/include/asm/uaccess.h index 6390a40f16e7..b890e4012136 100644 --- a/arch/arm/include/asm/uaccess.h +++ b/arch/arm/include/asm/uaccess.h @@ -145,16 +145,6 @@ extern int __get_user_64t_1(void *); extern int __get_user_64t_2(void *); extern int __get_user_64t_4(void *); -#define __GUP_CLOBBER_1 "lr", "cc" -#ifdef CONFIG_CPU_USE_DOMAINS -#define __GUP_CLOBBER_2 "ip", "lr", "cc" -#else -#define __GUP_CLOBBER_2 "lr", "cc" -#endif -#define __GUP_CLOBBER_4 "lr", "cc" -#define __GUP_CLOBBER_32t_8 "lr", "cc" -#define __GUP_CLOBBER_8 "lr", "cc" - #define __get_user_x(__r2, __p, __e, __l, __s) \ __asm__ __volatile__ ( \ __asmeq("%0", "r0") __asmeq("%1", "r2") \ @@ -162,7 +152,7 @@ extern int __get_user_64t_4(void *); "bl __get_user_" #__s \ : "=&r" (__e), "=r" (__r2) \ : "0" (__p), "r" (__l) \ - : __GUP_CLOBBER_##__s) + : "ip", "lr", "cc") /* narrowing a double-word get into a single 32bit word register: */ #ifdef __ARMEB__ @@ -184,7 +174,7 @@ extern int __get_user_64t_4(void *); "bl __get_user_64t_" #__s \ : "=&r" (__e), "=r" (__r2) \ : "0" (__p), "r" (__l) \ - : __GUP_CLOBBER_##__s) + : "ip", "lr", "cc") #else #define __get_user_x_64t __get_user_x #endif diff --git a/arch/arm64/Kconfig b/arch/arm64/Kconfig index 28a3fa76fb3c..e26499d0619b 100644 --- a/arch/arm64/Kconfig +++ b/arch/arm64/Kconfig @@ -579,6 +579,44 @@ config ARM64_ERRATUM_1742098 If unsure, say Y. +config ARM64_ERRATUM_3194386 + bool "Cortex-*/Neoverse-*: workaround for MSR SSBS not self-synchronizing" + default y + help + This option adds the workaround for the following errata: + + * ARM Cortex-A76 erratum 3324349 + * ARM Cortex-A77 erratum 3324348 + * ARM Cortex-A78 erratum 3324344 + * ARM Cortex-A78C erratum 3324346 + * ARM Cortex-A78C erratum 3324347 + * ARM Cortex-A710 erratam 3324338 + * ARM Cortex-A720 erratum 3456091 + * ARM Cortex-A725 erratum 3456106 + * ARM Cortex-X1 erratum 3324344 + * ARM Cortex-X1C erratum 3324346 + * ARM Cortex-X2 erratum 3324338 + * ARM Cortex-X3 erratum 3324335 + * ARM Cortex-X4 erratum 3194386 + * ARM Cortex-X925 erratum 3324334 + * ARM Neoverse-N1 erratum 3324349 + * ARM Neoverse N2 erratum 3324339 + * ARM Neoverse-V1 erratum 3324341 + * ARM Neoverse V2 erratum 3324336 + * ARM Neoverse-V3 erratum 3312417 + + On affected cores "MSR SSBS, #0" instructions may not affect + subsequent speculative instructions, which may permit unexepected + speculative store bypassing. + + Work around this problem by placing a Speculation Barrier (SB) or + Instruction Synchronization Barrier (ISB) after kernel changes to + SSBS. The presence of the SSBS special-purpose register is hidden + from hwcaps and EL0 reads of ID_AA64PFR1_EL1, such that userspace + will use the PR_SPEC_STORE_BYPASS prctl to change SSBS. + + If unsure, say Y. + config CAVIUM_ERRATUM_22375 bool "Cavium erratum 22375, 24313" default y diff --git a/arch/arm64/boot/dts/rockchip/rk3328.dtsi b/arch/arm64/boot/dts/rockchip/rk3328.dtsi index f6931f8d36f6..ab870b904396 100644 --- a/arch/arm64/boot/dts/rockchip/rk3328.dtsi +++ b/arch/arm64/boot/dts/rockchip/rk3328.dtsi @@ -649,8 +649,8 @@ <0>, <24000000>, <24000000>, <24000000>, <15000000>, <15000000>, - <100000000>, <100000000>, - <100000000>, <100000000>, + <300000000>, <100000000>, + <400000000>, <100000000>, <50000000>, <100000000>, <100000000>, <100000000>, <50000000>, <50000000>, diff --git a/arch/arm64/include/asm/assembler.h b/arch/arm64/include/asm/assembler.h index 0d9b99f3498d..11ca0b144512 100644 --- a/arch/arm64/include/asm/assembler.h +++ b/arch/arm64/include/asm/assembler.h @@ -147,6 +147,19 @@ hint #22 .endm +/* + * Speculation barrier + */ + .macro sb +alternative_if_not ARM64_HAS_SB + dsb nsh + isb +alternative_else + SB_BARRIER_INSN + nop +alternative_endif + .endm + /* * Sanitise a 64-bit bounded index wrt speculation, returning zero if out * of bounds. diff --git a/arch/arm64/include/asm/barrier.h b/arch/arm64/include/asm/barrier.h index 822a9192c551..f66bb04fdf2d 100644 --- a/arch/arm64/include/asm/barrier.h +++ b/arch/arm64/include/asm/barrier.h @@ -34,6 +34,10 @@ #define psb_csync() asm volatile("hint #17" : : : "memory") #define csdb() asm volatile("hint #20" : : : "memory") +#define spec_bar() asm volatile(ALTERNATIVE("dsb nsh\nisb\n", \ + SB_BARRIER_INSN"nop\n", \ + ARM64_HAS_SB)) + #define mb() dsb(sy) #define rmb() dsb(ld) #define wmb() dsb(st) diff --git a/arch/arm64/include/asm/cpucaps.h b/arch/arm64/include/asm/cpucaps.h index 60bb4b10bb55..99d3c010f963 100644 --- a/arch/arm64/include/asm/cpucaps.h +++ b/arch/arm64/include/asm/cpucaps.h @@ -58,6 +58,8 @@ #define ARM64_WORKAROUND_1542419 37 #define ARM64_SPECTRE_BHB 38 #define ARM64_WORKAROUND_1742098 39 +#define ARM64_HAS_SB 40 +#define ARM64_WORKAROUND_SPECULATIVE_SSBS 41 /* kabi: reserve 40 - 62 for future cpu capabilities */ #define ARM64_NCAPS 62 diff --git a/arch/arm64/include/asm/cputype.h b/arch/arm64/include/asm/cputype.h index f85f0a002ce6..dcfbaff546a1 100644 --- a/arch/arm64/include/asm/cputype.h +++ b/arch/arm64/include/asm/cputype.h @@ -101,6 +101,14 @@ #define ARM_CPU_PART_CORTEX_X2 0xD48 #define ARM_CPU_PART_NEOVERSE_N2 0xD49 #define ARM_CPU_PART_CORTEX_A78C 0xD4B +#define ARM_CPU_PART_CORTEX_X1C 0xD4C +#define ARM_CPU_PART_CORTEX_X3 0xD4E +#define ARM_CPU_PART_NEOVERSE_V2 0xD4F +#define ARM_CPU_PART_CORTEX_A720 0xD81 +#define ARM_CPU_PART_CORTEX_X4 0xD82 +#define ARM_CPU_PART_NEOVERSE_V3 0xD84 +#define ARM_CPU_PART_CORTEX_X925 0xD85 +#define ARM_CPU_PART_CORTEX_A725 0xD87 #define APM_CPU_PART_POTENZA 0x000 @@ -147,6 +155,14 @@ #define MIDR_CORTEX_X2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X2) #define MIDR_NEOVERSE_N2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_N2) #define MIDR_CORTEX_A78C MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_A78C) +#define MIDR_CORTEX_X1C MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X1C) +#define MIDR_CORTEX_X3 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X3) +#define MIDR_NEOVERSE_V2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_V2) +#define MIDR_CORTEX_A720 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_A720) +#define MIDR_CORTEX_X4 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X4) +#define MIDR_NEOVERSE_V3 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_V3) +#define MIDR_CORTEX_X925 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X925) +#define MIDR_CORTEX_A725 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_A725) #define MIDR_THUNDERX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX) #define MIDR_THUNDERX_81XX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX_81XX) #define MIDR_THUNDERX_83XX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX_83XX) diff --git a/arch/arm64/include/asm/sysreg.h b/arch/arm64/include/asm/sysreg.h index a34f4ee064ef..7a4153bc3ca0 100644 --- a/arch/arm64/include/asm/sysreg.h +++ b/arch/arm64/include/asm/sysreg.h @@ -107,6 +107,11 @@ #define SET_PSTATE_UAO(x) __emit_inst(0xd500401f | PSTATE_UAO | ((!!x) << PSTATE_Imm_shift)) #define SET_PSTATE_SSBS(x) __emit_inst(0xd500401f | PSTATE_SSBS | ((!!x) << PSTATE_Imm_shift)) +#define __SYS_BARRIER_INSN(CRm, op2, Rt) \ + __emit_inst(0xd5000000 | sys_insn(0, 3, 3, (CRm), (op2)) | ((Rt) & 0x1f)) + +#define SB_BARRIER_INSN __SYS_BARRIER_INSN(0, 7, 31) + #define SYS_DC_ISW sys_insn(1, 0, 7, 6, 2) #define SYS_DC_IGSW sys_insn(1, 0, 7, 6, 4) #define SYS_DC_IGDSW sys_insn(1, 0, 7, 6, 6) @@ -538,6 +543,7 @@ #define ID_AA64ISAR0_AES_SHIFT 4 /* id_aa64isar1 */ +#define ID_AA64ISAR1_SB_SHIFT 36 #define ID_AA64ISAR1_LRCPC_SHIFT 20 #define ID_AA64ISAR1_FCMA_SHIFT 16 #define ID_AA64ISAR1_JSCVT_SHIFT 12 diff --git a/arch/arm64/include/asm/uaccess.h b/arch/arm64/include/asm/uaccess.h index 16969bc49bb8..7e5da711405b 100644 --- a/arch/arm64/include/asm/uaccess.h +++ b/arch/arm64/include/asm/uaccess.h @@ -46,8 +46,7 @@ static inline void set_fs(mm_segment_t fs) * Prevent a mispredicted conditional call to set_fs from forwarding * the wrong address limit to access_ok under speculation. */ - dsb(nsh); - isb(); + spec_bar(); /* On user-mode return, check fs is correct */ set_thread_flag(TIF_FSCHECK); diff --git a/arch/arm64/include/uapi/asm/hwcap.h b/arch/arm64/include/uapi/asm/hwcap.h index 2bcd6e4f3474..7784f7cba16c 100644 --- a/arch/arm64/include/uapi/asm/hwcap.h +++ b/arch/arm64/include/uapi/asm/hwcap.h @@ -49,5 +49,6 @@ #define HWCAP_ILRCPC (1 << 26) #define HWCAP_FLAGM (1 << 27) #define HWCAP_SSBS (1 << 28) +#define HWCAP_SB (1 << 29) #endif /* _UAPI__ASM_HWCAP_H */ diff --git a/arch/arm64/kernel/acpi_numa.c b/arch/arm64/kernel/acpi_numa.c index 4f4f1815e047..dfd5238aa3ca 100644 --- a/arch/arm64/kernel/acpi_numa.c +++ b/arch/arm64/kernel/acpi_numa.c @@ -28,7 +28,7 @@ #include -static int acpi_early_node_map[NR_CPUS] __initdata = { NUMA_NO_NODE }; +static int acpi_early_node_map[NR_CPUS] __initdata = { [0 ... NR_CPUS - 1] = NUMA_NO_NODE }; int __init acpi_numa_get_nid(unsigned int cpu) { diff --git a/arch/arm64/kernel/cpu_errata.c b/arch/arm64/kernel/cpu_errata.c index dfef42b590c6..0885673cd867 100644 --- a/arch/arm64/kernel/cpu_errata.c +++ b/arch/arm64/kernel/cpu_errata.c @@ -345,6 +345,19 @@ void arm64_set_ssbd_mitigation(bool state) asm volatile(SET_PSTATE_SSBS(0)); else asm volatile(SET_PSTATE_SSBS(1)); + + /* + * SSBS is self-synchronizing and is intended to affect + * subsequent speculative instructions, but some CPUs can + * speculate with a stale value of SSBS. + * + * Mitigate this with an unconditional speculation barrier, as + * CPUs could mis-speculate branches and bypass a conditional + * barrier. + */ + if (IS_ENABLED(CONFIG_ARM64_ERRATUM_3194386)) + spec_bar(); + return; } @@ -743,6 +756,30 @@ static struct midr_range broken_aarch32_aes[] = { }; #endif +#ifdef CONFIG_ARM64_ERRATUM_3194386 +static const struct midr_range erratum_spec_ssbs_list[] = { + MIDR_ALL_VERSIONS(MIDR_CORTEX_A76), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A77), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A78), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A78C), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A710), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A720), + MIDR_ALL_VERSIONS(MIDR_CORTEX_A725), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X1), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X1C), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X2), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X3), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X4), + MIDR_ALL_VERSIONS(MIDR_CORTEX_X925), + MIDR_ALL_VERSIONS(MIDR_NEOVERSE_N1), + MIDR_ALL_VERSIONS(MIDR_NEOVERSE_N2), + MIDR_ALL_VERSIONS(MIDR_NEOVERSE_V1), + MIDR_ALL_VERSIONS(MIDR_NEOVERSE_V2), + MIDR_ALL_VERSIONS(MIDR_NEOVERSE_V3), + {} +}; +#endif + const struct arm64_cpu_capabilities arm64_errata[] = { #if defined(CONFIG_ARM64_ERRATUM_826319) || \ defined(CONFIG_ARM64_ERRATUM_827319) || \ @@ -964,6 +1001,13 @@ const struct arm64_cpu_capabilities arm64_errata[] = { CAP_MIDR_RANGE_LIST(broken_aarch32_aes), .type = ARM64_CPUCAP_LOCAL_CPU_ERRATUM, }, +#endif +#ifdef CONFIG_ARM64_ERRATUM_3194386 + { + .desc = "SSBS not fully self-synchronizing", + .capability = ARM64_WORKAROUND_SPECULATIVE_SSBS, + ERRATA_MIDR_RANGE_LIST(erratum_spec_ssbs_list), + }, #endif { } diff --git a/arch/arm64/kernel/cpufeature.c b/arch/arm64/kernel/cpufeature.c index 89b3c3eecac9..f97049b00e93 100644 --- a/arch/arm64/kernel/cpufeature.c +++ b/arch/arm64/kernel/cpufeature.c @@ -144,6 +144,7 @@ static const struct arm64_ftr_bits ftr_id_aa64isar0[] = { }; static const struct arm64_ftr_bits ftr_id_aa64isar1[] = { + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_AA64ISAR1_SB_SHIFT, 4, 0), ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_AA64ISAR1_LRCPC_SHIFT, 4, 0), ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_AA64ISAR1_FCMA_SHIFT, 4, 0), ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_AA64ISAR1_JSCVT_SHIFT, 4, 0), @@ -273,6 +274,30 @@ static const struct arm64_ftr_bits ftr_id_aa64dfr0[] = { ARM64_FTR_END, }; +static const struct arm64_ftr_bits ftr_mvfr0[] = { + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPROUND_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPSHVEC_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPSQRT_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPDIVIDE_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPTRAP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPDP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_FPSP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR0_SIMD_SHIFT, 4, 0), + ARM64_FTR_END, +}; + +static const struct arm64_ftr_bits ftr_mvfr1[] = { + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDFMAC_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_FPHP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDHP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDSP_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDINT_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_SIMDLS_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_FPDNAN_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, MVFR1_FPFTZ_SHIFT, 4, 0), + ARM64_FTR_END, +}; + static const struct arm64_ftr_bits ftr_mvfr2[] = { ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, 4, 4, 0), /* FPMisc */ ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, 0, 4, 0), /* SIMDMisc */ @@ -288,10 +313,10 @@ static const struct arm64_ftr_bits ftr_dczid[] = { static const struct arm64_ftr_bits ftr_id_isar5[] = { ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_RDM_SHIFT, 4, 0), - ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_CRC32_SHIFT, 4, 0), - ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA2_SHIFT, 4, 0), - ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA1_SHIFT, 4, 0), - ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_AES_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_CRC32_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA2_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SHA1_SHIFT, 4, 0), + ARM64_FTR_BITS(FTR_VISIBLE, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_AES_SHIFT, 4, 0), ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, ID_ISAR5_SEVL_SHIFT, 4, 0), ARM64_FTR_END, }; @@ -331,7 +356,7 @@ static const struct arm64_ftr_bits ftr_zcr[] = { * Common ftr bits for a 32bit register with all hidden, strict * attributes, with 4bit feature fields and a default safe value of * 0. Covers the following 32bit registers: - * id_isar[0-4], id_mmfr[1-3], id_pfr1, mvfr[0-1] + * id_isar[1-3], id_mmfr[1-3] */ static const struct arm64_ftr_bits ftr_generic_32bits[] = { ARM64_FTR_BITS(FTR_HIDDEN, FTR_STRICT, FTR_LOWER_SAFE, 28, 4, 0), @@ -386,8 +411,8 @@ static const struct __ftr_reg_entry { ARM64_FTR_REG(SYS_ID_MMFR4_EL1, ftr_id_mmfr4), /* Op1 = 0, CRn = 0, CRm = 3 */ - ARM64_FTR_REG(SYS_MVFR0_EL1, ftr_generic_32bits), - ARM64_FTR_REG(SYS_MVFR1_EL1, ftr_generic_32bits), + ARM64_FTR_REG(SYS_MVFR0_EL1, ftr_mvfr0), + ARM64_FTR_REG(SYS_MVFR1_EL1, ftr_mvfr1), ARM64_FTR_REG(SYS_MVFR2_EL1, ftr_mvfr2), /* Op1 = 0, CRn = 0, CRm = 4 */ @@ -826,17 +851,39 @@ feature_matches(u64 reg, const struct arm64_cpu_capabilities *entry) return val >= entry->min_field_value; } +static u64 +read_scoped_sysreg(const struct arm64_cpu_capabilities *entry, int scope) +{ + WARN_ON(scope == SCOPE_LOCAL_CPU && preemptible()); + if (scope == SCOPE_SYSTEM) + return read_sanitised_ftr_reg(entry->sys_reg); + else + return __read_sysreg_by_encoding(entry->sys_reg); +} + +static bool +has_user_cpuid_feature(const struct arm64_cpu_capabilities *entry, int scope) +{ + int mask; + struct arm64_ftr_reg *regp; + u64 val = read_scoped_sysreg(entry, scope); + + regp = get_arm64_ftr_reg(entry->sys_reg); + if (!regp) + return false; + + mask = cpuid_feature_extract_unsigned_field(regp->user_mask, + entry->field_pos); + if (!mask) + return false; + + return feature_matches(val, entry); +} + static bool has_cpuid_feature(const struct arm64_cpu_capabilities *entry, int scope) { - u64 val; - - WARN_ON(scope == SCOPE_LOCAL_CPU && preemptible()); - if (scope == SCOPE_SYSTEM) - val = read_sanitised_ftr_reg(entry->sys_reg); - else - val = __read_sysreg_by_encoding(entry->sys_reg); - + u64 val = read_scoped_sysreg(entry, scope); return feature_matches(val, entry); } @@ -1157,6 +1204,17 @@ static void cpu_enable_ssbs(const struct arm64_cpu_capabilities *__unused) } #endif /* CONFIG_ARM64_SSBD */ +static void user_feature_fixup(void) +{ + if (cpus_have_cap(ARM64_WORKAROUND_SPECULATIVE_SSBS)) { + struct arm64_ftr_reg *regp; + + regp = get_arm64_ftr_reg(SYS_ID_AA64PFR1_EL1); + if (regp) + regp->user_mask &= ~GENMASK(7, 4); /* SSBS */ + } +} + static void elf_hwcap_fixup(void) { #ifdef CONFIG_ARM64_ERRATUM_1742098 @@ -1363,12 +1421,21 @@ static const struct arm64_cpu_capabilities arm64_features[] = { .cpu_enable = cpu_enable_ssbs, }, #endif + { + .desc = "Speculation barrier (SB)", + .capability = ARM64_HAS_SB, + .type = ARM64_CPUCAP_SYSTEM_FEATURE, + .matches = has_cpuid_feature, + .sys_reg = SYS_ID_AA64ISAR1_EL1, + .field_pos = ID_AA64ISAR1_SB_SHIFT, + .sign = FTR_UNSIGNED, + .min_field_value = 1, + }, {}, }; - #define HWCAP_CPUID_MATCH(reg, field, s, min_value) \ - .matches = has_cpuid_feature, \ + .matches = has_user_cpuid_feature, \ .sys_reg = reg, \ .field_pos = field, \ .sign = s, \ @@ -1417,6 +1484,7 @@ static const struct arm64_cpu_capabilities arm64_elf_hwcaps[] = { HWCAP_CAP(SYS_ID_AA64ISAR1_EL1, ID_AA64ISAR1_FCMA_SHIFT, FTR_UNSIGNED, 1, CAP_HWCAP, HWCAP_FCMA), HWCAP_CAP(SYS_ID_AA64ISAR1_EL1, ID_AA64ISAR1_LRCPC_SHIFT, FTR_UNSIGNED, 1, CAP_HWCAP, HWCAP_LRCPC), HWCAP_CAP(SYS_ID_AA64ISAR1_EL1, ID_AA64ISAR1_LRCPC_SHIFT, FTR_UNSIGNED, 2, CAP_HWCAP, HWCAP_ILRCPC), + HWCAP_CAP(SYS_ID_AA64ISAR1_EL1, ID_AA64ISAR1_SB_SHIFT, FTR_UNSIGNED, 1, CAP_HWCAP, HWCAP_SB), HWCAP_CAP(SYS_ID_AA64MMFR2_EL1, ID_AA64MMFR2_AT_SHIFT, FTR_UNSIGNED, 1, CAP_HWCAP, HWCAP_USCAT), #ifdef CONFIG_ARM64_SVE HWCAP_CAP(SYS_ID_AA64PFR0_EL1, ID_AA64PFR0_SVE_SHIFT, FTR_UNSIGNED, ID_AA64PFR0_SVE, CAP_HWCAP, HWCAP_SVE), @@ -1811,6 +1879,7 @@ void __init setup_cpu_features(void) setup_system_capabilities(); mark_const_caps_ready(); + user_feature_fixup(); setup_elf_hwcaps(arm64_elf_hwcaps); if (system_supports_32bit_el0()) { @@ -1844,7 +1913,7 @@ cpufeature_pan_not_uao(const struct arm64_cpu_capabilities *entry, int __unused) /* * We emulate only the following system register space. - * Op0 = 0x3, CRn = 0x0, Op1 = 0x0, CRm = [0, 4 - 7] + * Op0 = 0x3, CRn = 0x0, Op1 = 0x0, CRm = [0, 2 - 7] * See Table C5-6 System instruction encodings for System register accesses, * ARMv8 ARM(ARM DDI 0487A.f) for more details. */ @@ -1854,7 +1923,7 @@ static inline bool __attribute_const__ is_emulated(u32 id) sys_reg_CRn(id) == 0x0 && sys_reg_Op1(id) == 0x0 && (sys_reg_CRm(id) == 0 || - ((sys_reg_CRm(id) >= 4) && (sys_reg_CRm(id) <= 7)))); + ((sys_reg_CRm(id) >= 2) && (sys_reg_CRm(id) <= 7)))); } /* diff --git a/arch/arm64/kernel/cpuinfo.c b/arch/arm64/kernel/cpuinfo.c index 601c89363ac0..ea41f1cd85f6 100644 --- a/arch/arm64/kernel/cpuinfo.c +++ b/arch/arm64/kernel/cpuinfo.c @@ -89,6 +89,7 @@ static const char *const hwcap_str[] = { "ilrcpc", "flagm", "ssbs", + "sb", NULL }; diff --git a/arch/m68k/amiga/config.c b/arch/m68k/amiga/config.c index 65f63a457130..52dec92614e8 100644 --- a/arch/m68k/amiga/config.c +++ b/arch/m68k/amiga/config.c @@ -181,6 +181,15 @@ int __init amiga_parse_bootinfo(const struct bi_record *record) dev->slotsize = be16_to_cpu(cd->cd_SlotSize); dev->boardaddr = be32_to_cpu(cd->cd_BoardAddr); dev->boardsize = be32_to_cpu(cd->cd_BoardSize); + + /* CS-LAB Warp 1260 workaround */ + if (be16_to_cpu(dev->rom.er_Manufacturer) == ZORRO_MANUF(ZORRO_PROD_CSLAB_WARP_1260) && + dev->rom.er_Product == ZORRO_PROD(ZORRO_PROD_CSLAB_WARP_1260)) { + + /* turn off all interrupts */ + pr_info("Warp 1260 card detected: applying interrupt storm workaround\n"); + *(uint32_t *)(dev->boardaddr + 0x1000) = 0xfff; + } } else pr_warn("amiga_parse_bootinfo: too many AutoConfig devices\n"); #endif /* CONFIG_ZORRO */ diff --git a/arch/m68k/atari/ataints.c b/arch/m68k/atari/ataints.c index 56f02ea2c248..715d1e0d973e 100644 --- a/arch/m68k/atari/ataints.c +++ b/arch/m68k/atari/ataints.c @@ -302,11 +302,7 @@ void __init atari_init_IRQ(void) if (ATARIHW_PRESENT(SCU)) { /* init the SCU if present */ - tt_scu.sys_mask = 0x10; /* enable VBL (for the cursor) and - * disable HSYNC interrupts (who - * needs them?) MFP and SCC are - * enabled in VME mask - */ + tt_scu.sys_mask = 0x0; /* disable all interrupts */ tt_scu.vme_mask = 0x60; /* enable MFP and SCC ints */ } else { /* If no SCU and no Hades, the HSYNC interrupt needs to be diff --git a/arch/m68k/include/asm/cmpxchg.h b/arch/m68k/include/asm/cmpxchg.h index 38e1d7acc44d..1f996713ce87 100644 --- a/arch/m68k/include/asm/cmpxchg.h +++ b/arch/m68k/include/asm/cmpxchg.h @@ -33,7 +33,7 @@ static inline unsigned long __xchg(unsigned long x, volatile void * ptr, int siz x = tmp; break; default: - tmp = __invalid_xchg_size(x, ptr, size); + x = __invalid_xchg_size(x, ptr, size); break; } diff --git a/arch/mips/include/asm/mips-cm.h b/arch/mips/include/asm/mips-cm.h index 890e51b159e0..11a3d5120e2b 100644 --- a/arch/mips/include/asm/mips-cm.h +++ b/arch/mips/include/asm/mips-cm.h @@ -232,6 +232,10 @@ GCR_ACCESSOR_RO(32, 0x0d0, gic_status) GCR_ACCESSOR_RO(32, 0x0f0, cpc_status) #define CM_GCR_CPC_STATUS_EX BIT(0) +/* GCR_ACCESS - Controls core/IOCU access to GCRs */ +GCR_ACCESSOR_RW(32, 0x120, access_cm3) +#define CM_GCR_ACCESS_ACCESSEN GENMASK(7, 0) + /* GCR_L2_CONFIG - Indicates L2 cache configuration when Config5.L2C=1 */ GCR_ACCESSOR_RW(32, 0x130, l2_config) #define CM_GCR_L2_CONFIG_BYPASS BIT(20) diff --git a/arch/mips/kernel/smp-cps.c b/arch/mips/kernel/smp-cps.c index 03f1026ad148..1861b20e978d 100644 --- a/arch/mips/kernel/smp-cps.c +++ b/arch/mips/kernel/smp-cps.c @@ -233,7 +233,10 @@ static void boot_core(unsigned int core, unsigned int vpe_id) write_gcr_co_reset_ext_base(CM_GCR_Cx_RESET_EXT_BASE_UEB); /* Ensure the core can access the GCRs */ - set_gcr_access(1 << core); + if (mips_cm_revision() < CM_REV_CM3) + set_gcr_access(1 << core); + else + set_gcr_access_cm3(1 << core); if (mips_cpc_present()) { /* Reset the core */ diff --git a/arch/mips/pci/pcie-octeon.c b/arch/mips/pci/pcie-octeon.c old mode 100755 new mode 100644 diff --git a/arch/openrisc/kernel/setup.c b/arch/openrisc/kernel/setup.c index f3a7375ac3cd..f306816c98cb 100644 --- a/arch/openrisc/kernel/setup.c +++ b/arch/openrisc/kernel/setup.c @@ -287,6 +287,9 @@ void calibrate_delay(void) void __init setup_arch(char **cmdline_p) { + /* setup memblock allocator */ + setup_memory(); + unflatten_and_copy_device_tree(); setup_cpuinfo(); @@ -311,9 +314,6 @@ void __init setup_arch(char **cmdline_p) initrd_below_start_ok = 1; #endif - /* setup memblock allocator */ - setup_memory(); - /* paging_init() sets up the MMU and marks all pages as reserved */ paging_init(); diff --git a/arch/parisc/kernel/irq.c b/arch/parisc/kernel/irq.c index 11c1505775f8..6b20a0a11913 100644 --- a/arch/parisc/kernel/irq.c +++ b/arch/parisc/kernel/irq.c @@ -524,7 +524,7 @@ void do_cpu_irq_mask(struct pt_regs *regs) old_regs = set_irq_regs(regs); local_irq_disable(); - irq_enter(); + irq_enter_rcu(); eirr_val = mfctl(23) & cpu_eiem & per_cpu(local_ack_eiem, cpu); if (!eirr_val) @@ -559,7 +559,7 @@ void do_cpu_irq_mask(struct pt_regs *regs) #endif /* CONFIG_IRQSTACKS */ out: - irq_exit(); + irq_exit_rcu(); set_irq_regs(old_regs); return; diff --git a/arch/powerpc/boot/simple_alloc.c b/arch/powerpc/boot/simple_alloc.c index 65ec135d0157..bc99f75b8582 100644 --- a/arch/powerpc/boot/simple_alloc.c +++ b/arch/powerpc/boot/simple_alloc.c @@ -114,8 +114,11 @@ static void *simple_realloc(void *ptr, unsigned long size) return ptr; new = simple_malloc(size); - memcpy(new, ptr, p->size); - simple_free(ptr); + if (new) { + memcpy(new, ptr, p->size); + simple_free(ptr); + } + return new; } diff --git a/arch/powerpc/sysdev/xics/icp-native.c b/arch/powerpc/sysdev/xics/icp-native.c index 340de58a15bd..71278d554715 100644 --- a/arch/powerpc/sysdev/xics/icp-native.c +++ b/arch/powerpc/sysdev/xics/icp-native.c @@ -240,6 +240,8 @@ static int __init icp_native_map_one_cpu(int hw_id, unsigned long addr, rname = kasprintf(GFP_KERNEL, "CPU %d [0x%x] Interrupt Presentation", cpu, hw_id); + if (!rname) + return -ENOMEM; if (!request_mem_region(addr, size, rname)) { pr_warn("icp_native: Could not reserve ICP MMIO for CPU %d, interrupt server #0x%x\n", cpu, hw_id); diff --git a/arch/powerpc/xmon/ppc-dis.c b/arch/powerpc/xmon/ppc-dis.c index 27f1e6415036..8f84e6502776 100644 --- a/arch/powerpc/xmon/ppc-dis.c +++ b/arch/powerpc/xmon/ppc-dis.c @@ -133,32 +133,21 @@ int print_insn_powerpc (unsigned long insn, unsigned long memaddr) bool insn_is_short; ppc_cpu_t dialect; - dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON - | PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_ALTIVEC; + dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON; - if (cpu_has_feature(CPU_FTRS_POWER5)) - dialect |= PPC_OPCODE_POWER5; + if (IS_ENABLED(CONFIG_PPC64)) + dialect |= PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_CELL | + PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 | PPC_OPCODE_POWER8 | + PPC_OPCODE_POWER9; - if (cpu_has_feature(CPU_FTRS_CELL)) - dialect |= (PPC_OPCODE_CELL | PPC_OPCODE_ALTIVEC); + if (cpu_has_feature(CPU_FTR_TM)) + dialect |= PPC_OPCODE_HTM; - if (cpu_has_feature(CPU_FTRS_POWER6)) - dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_ALTIVEC); + if (cpu_has_feature(CPU_FTR_ALTIVEC)) + dialect |= PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2; - if (cpu_has_feature(CPU_FTRS_POWER7)) - dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 - | PPC_OPCODE_ALTIVEC | PPC_OPCODE_VSX); - - if (cpu_has_feature(CPU_FTRS_POWER8)) - dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 - | PPC_OPCODE_POWER8 | PPC_OPCODE_HTM - | PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2 | PPC_OPCODE_VSX); - - if (cpu_has_feature(CPU_FTRS_POWER9)) - dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 - | PPC_OPCODE_POWER8 | PPC_OPCODE_POWER9 | PPC_OPCODE_HTM - | PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2 - | PPC_OPCODE_VSX | PPC_OPCODE_VSX3); + if (cpu_has_feature(CPU_FTR_VSX)) + dialect |= PPC_OPCODE_VSX | PPC_OPCODE_VSX3; /* Get the major opcode of the insn. */ opcode = NULL; diff --git a/arch/sparc/include/asm/oplib_64.h b/arch/sparc/include/asm/oplib_64.h index a67abebd4359..1b86d02a8455 100644 --- a/arch/sparc/include/asm/oplib_64.h +++ b/arch/sparc/include/asm/oplib_64.h @@ -247,6 +247,7 @@ void prom_sun4v_guest_soft_state(void); int prom_ihandle2path(int handle, char *buffer, int bufsize); /* Client interface level routines. */ +void prom_cif_init(void *cif_handler); void p1275_cmd_direct(unsigned long *); #endif /* !(__SPARC64_OPLIB_H) */ diff --git a/arch/sparc/prom/init_64.c b/arch/sparc/prom/init_64.c index 103aa9104318..f7b8a1a865b8 100644 --- a/arch/sparc/prom/init_64.c +++ b/arch/sparc/prom/init_64.c @@ -26,9 +26,6 @@ phandle prom_chosen_node; * routines in the prom library. * It gets passed the pointer to the PROM vector. */ - -extern void prom_cif_init(void *); - void __init prom_init(void *cif_handler) { phandle node; diff --git a/arch/sparc/prom/p1275.c b/arch/sparc/prom/p1275.c index 889aa602f8d8..51c3f984bbf7 100644 --- a/arch/sparc/prom/p1275.c +++ b/arch/sparc/prom/p1275.c @@ -49,7 +49,7 @@ void p1275_cmd_direct(unsigned long *args) local_irq_restore(flags); } -void prom_cif_init(void *cif_handler, void *cif_stack) +void prom_cif_init(void *cif_handler) { p1275buf.prom_cif_handler = (void (*)(long *))cif_handler; } diff --git a/arch/x86/events/intel/pt.c b/arch/x86/events/intel/pt.c index 49b3ea1c1ea1..87cca5622885 100644 --- a/arch/x86/events/intel/pt.c +++ b/arch/x86/events/intel/pt.c @@ -75,7 +75,7 @@ static struct pt_cap_desc { PT_CAP(psb_periods, 1, CPUID_EBX, 0xffff0000), }; -static u32 pt_cap_get(enum pt_capabilities cap) +u32 intel_pt_validate_hw_cap(enum pt_capabilities cap) { struct pt_cap_desc *cd = &pt_caps[cap]; u32 c = pt_pmu.caps[cd->leaf * PT_CPUID_REGS_NUM + cd->reg]; @@ -83,6 +83,7 @@ static u32 pt_cap_get(enum pt_capabilities cap) return (c & cd->mask) >> shift; } +EXPORT_SYMBOL_GPL(intel_pt_validate_hw_cap); static ssize_t pt_cap_show(struct device *cdev, struct device_attribute *attr, @@ -92,7 +93,7 @@ static ssize_t pt_cap_show(struct device *cdev, container_of(attr, struct dev_ext_attribute, attr); enum pt_capabilities cap = (long)ea->var; - return snprintf(buf, PAGE_SIZE, "%x\n", pt_cap_get(cap)); + return snprintf(buf, PAGE_SIZE, "%x\n", intel_pt_validate_hw_cap(cap)); } static struct attribute_group pt_cap_group = { @@ -310,16 +311,16 @@ static bool pt_event_valid(struct perf_event *event) return false; if (config & RTIT_CTL_CYC_PSB) { - if (!pt_cap_get(PT_CAP_psb_cyc)) + if (!intel_pt_validate_hw_cap(PT_CAP_psb_cyc)) return false; - allowed = pt_cap_get(PT_CAP_psb_periods); + allowed = intel_pt_validate_hw_cap(PT_CAP_psb_periods); requested = (config & RTIT_CTL_PSB_FREQ) >> RTIT_CTL_PSB_FREQ_OFFSET; if (requested && (!(allowed & BIT(requested)))) return false; - allowed = pt_cap_get(PT_CAP_cycle_thresholds); + allowed = intel_pt_validate_hw_cap(PT_CAP_cycle_thresholds); requested = (config & RTIT_CTL_CYC_THRESH) >> RTIT_CTL_CYC_THRESH_OFFSET; if (requested && (!(allowed & BIT(requested)))) @@ -334,10 +335,10 @@ static bool pt_event_valid(struct perf_event *event) * Spec says that setting mtc period bits while mtc bit in * CPUID is 0 will #GP, so better safe than sorry. */ - if (!pt_cap_get(PT_CAP_mtc)) + if (!intel_pt_validate_hw_cap(PT_CAP_mtc)) return false; - allowed = pt_cap_get(PT_CAP_mtc_periods); + allowed = intel_pt_validate_hw_cap(PT_CAP_mtc_periods); if (!allowed) return false; @@ -349,11 +350,11 @@ static bool pt_event_valid(struct perf_event *event) } if (config & RTIT_CTL_PWR_EVT_EN && - !pt_cap_get(PT_CAP_power_event_trace)) + !intel_pt_validate_hw_cap(PT_CAP_power_event_trace)) return false; if (config & RTIT_CTL_PTW) { - if (!pt_cap_get(PT_CAP_ptwrite)) + if (!intel_pt_validate_hw_cap(PT_CAP_ptwrite)) return false; /* FUPonPTW without PTW doesn't make sense */ @@ -545,16 +546,8 @@ static void pt_config_buffer(void *buf, unsigned int topa_idx, wrmsrl(MSR_IA32_RTIT_OUTPUT_MASK, reg); } -/* - * Keep ToPA table-related metadata on the same page as the actual table, - * taking up a few words from the top - */ - -#define TENTS_PER_PAGE (((PAGE_SIZE - 40) / sizeof(struct topa_entry)) - 1) - /** - * struct topa - page-sized ToPA table with metadata at the top - * @table: actual ToPA table entries, as understood by PT hardware + * struct topa - ToPA metadata * @list: linkage to struct pt_buffer's list of tables * @phys: physical address of this page * @offset: offset of the first entry in this table in the buffer @@ -562,7 +555,6 @@ static void pt_config_buffer(void *buf, unsigned int topa_idx, * @last: index of the last initialized entry in this table */ struct topa { - struct topa_entry table[TENTS_PER_PAGE]; struct list_head list; u64 phys; u64 offset; @@ -570,8 +562,40 @@ struct topa { int last; }; +/* + * Keep ToPA table-related metadata on the same page as the actual table, + * taking up a few words from the top + */ + +#define TENTS_PER_PAGE \ + ((PAGE_SIZE - sizeof(struct topa)) / sizeof(struct topa_entry)) + +/** + * struct topa_page - page-sized ToPA table with metadata at the top + * @table: actual ToPA table entries, as understood by PT hardware + * @topa: metadata + */ +struct topa_page { + struct topa_entry table[TENTS_PER_PAGE]; + struct topa topa; +}; + +static inline struct topa_page *topa_to_page(struct topa *topa) +{ + return container_of(topa, struct topa_page, topa); +} + +static inline struct topa_page *topa_entry_to_page(struct topa_entry *te) +{ + return (struct topa_page *)((unsigned long)te & PAGE_MASK); +} + /* make -1 stand for the last table entry */ -#define TOPA_ENTRY(t, i) ((i) == -1 ? &(t)->table[(t)->last] : &(t)->table[(i)]) +#define TOPA_ENTRY(t, i) \ + ((i) == -1 \ + ? &topa_to_page(t)->table[(t)->last] \ + : &topa_to_page(t)->table[(i)]) +#define TOPA_ENTRY_SIZE(t, i) (sizes(TOPA_ENTRY((t), (i))->size)) /** * topa_alloc() - allocate page-sized ToPA table @@ -583,27 +607,27 @@ struct topa { static struct topa *topa_alloc(int cpu, gfp_t gfp) { int node = cpu_to_node(cpu); - struct topa *topa; + struct topa_page *tp; struct page *p; p = alloc_pages_node(node, gfp | __GFP_ZERO, 0); if (!p) return NULL; - topa = page_address(p); - topa->last = 0; - topa->phys = page_to_phys(p); + tp = page_address(p); + tp->topa.last = 0; + tp->topa.phys = page_to_phys(p); /* * In case of singe-entry ToPA, always put the self-referencing END * link as the 2nd entry in the table */ - if (!pt_cap_get(PT_CAP_topa_multiple_entries)) { - TOPA_ENTRY(topa, 1)->base = topa->phys >> TOPA_SHIFT; - TOPA_ENTRY(topa, 1)->end = 1; + if (!intel_pt_validate_hw_cap(PT_CAP_topa_multiple_entries)) { + TOPA_ENTRY(&tp->topa, 1)->base = tp->topa.phys; + TOPA_ENTRY(&tp->topa, 1)->end = 1; } - return topa; + return &tp->topa; } /** @@ -638,7 +662,7 @@ static void topa_insert_table(struct pt_buffer *buf, struct topa *topa) topa->offset = last->offset + last->size; buf->last = topa; - if (!pt_cap_get(PT_CAP_topa_multiple_entries)) + if (!intel_pt_validate_hw_cap(PT_CAP_topa_multiple_entries)) return; BUG_ON(last->last != TENTS_PER_PAGE - 1); @@ -654,7 +678,7 @@ static void topa_insert_table(struct pt_buffer *buf, struct topa *topa) static bool topa_table_full(struct topa *topa) { /* single-entry ToPA is a special case */ - if (!pt_cap_get(PT_CAP_topa_multiple_entries)) + if (!intel_pt_validate_hw_cap(PT_CAP_topa_multiple_entries)) return !!topa->last; return topa->last == TENTS_PER_PAGE - 1; @@ -690,7 +714,8 @@ static int topa_insert_pages(struct pt_buffer *buf, gfp_t gfp) TOPA_ENTRY(topa, -1)->base = page_to_phys(p) >> TOPA_SHIFT; TOPA_ENTRY(topa, -1)->size = order; - if (!buf->snapshot && !pt_cap_get(PT_CAP_topa_multiple_entries)) { + if (!buf->snapshot && + !intel_pt_validate_hw_cap(PT_CAP_topa_multiple_entries)) { TOPA_ENTRY(topa, -1)->intr = 1; TOPA_ENTRY(topa, -1)->stop = 1; } @@ -712,22 +737,23 @@ static void pt_topa_dump(struct pt_buffer *buf) struct topa *topa; list_for_each_entry(topa, &buf->tables, list) { + struct topa_page *tp = topa_to_page(topa); int i; - pr_debug("# table @%p (%016Lx), off %llx size %zx\n", topa->table, + pr_debug("# table @%p (%016Lx), off %llx size %zx\n", tp->table, topa->phys, topa->offset, topa->size); for (i = 0; i < TENTS_PER_PAGE; i++) { pr_debug("# entry @%p (%lx sz %u %c%c%c) raw=%16llx\n", - &topa->table[i], - (unsigned long)topa->table[i].base << TOPA_SHIFT, - sizes(topa->table[i].size), - topa->table[i].end ? 'E' : ' ', - topa->table[i].intr ? 'I' : ' ', - topa->table[i].stop ? 'S' : ' ', - *(u64 *)&topa->table[i]); - if ((pt_cap_get(PT_CAP_topa_multiple_entries) && - topa->table[i].stop) || - topa->table[i].end) + &tp->table[i], + (unsigned long)tp->table[i].base << TOPA_SHIFT, + sizes(tp->table[i].size), + tp->table[i].end ? 'E' : ' ', + tp->table[i].intr ? 'I' : ' ', + tp->table[i].stop ? 'S' : ' ', + *(u64 *)&tp->table[i]); + if ((intel_pt_validate_hw_cap(PT_CAP_topa_multiple_entries) && + tp->table[i].stop) || + tp->table[i].end) break; } } @@ -770,7 +796,7 @@ static void pt_update_head(struct pt *pt) /* offset of the current output region within this table */ for (topa_idx = 0; topa_idx < buf->cur_idx; topa_idx++) - base += sizes(buf->cur->table[topa_idx].size); + base += TOPA_ENTRY_SIZE(buf->cur, topa_idx); if (buf->snapshot) { local_set(&buf->data_size, base); @@ -790,7 +816,7 @@ static void pt_update_head(struct pt *pt) */ static void *pt_buffer_region(struct pt_buffer *buf) { - return phys_to_virt(buf->cur->table[buf->cur_idx].base << TOPA_SHIFT); + return phys_to_virt((phys_addr_t)TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT); } /** @@ -799,7 +825,7 @@ static void *pt_buffer_region(struct pt_buffer *buf) */ static size_t pt_buffer_region_size(struct pt_buffer *buf) { - return sizes(buf->cur->table[buf->cur_idx].size); + return TOPA_ENTRY_SIZE(buf->cur, buf->cur_idx); } /** @@ -828,8 +854,8 @@ static void pt_handle_status(struct pt *pt) * means we are already losing data; need to let the decoder * know. */ - if (!pt_cap_get(PT_CAP_topa_multiple_entries) || - buf->output_off == sizes(TOPA_ENTRY(buf->cur, buf->cur_idx)->size)) { + if (!intel_pt_validate_hw_cap(PT_CAP_topa_multiple_entries) || + buf->output_off == pt_buffer_region_size(buf)) { perf_aux_output_flag(&pt->handle, PERF_AUX_FLAG_TRUNCATED); advance++; @@ -840,7 +866,8 @@ static void pt_handle_status(struct pt *pt) * Also on single-entry ToPA implementations, interrupt will come * before the output reaches its output region's boundary. */ - if (!pt_cap_get(PT_CAP_topa_multiple_entries) && !buf->snapshot && + if (!intel_pt_validate_hw_cap(PT_CAP_topa_multiple_entries) && + !buf->snapshot && pt_buffer_region_size(buf) - buf->output_off <= TOPA_PMI_MARGIN) { void *head = pt_buffer_region(buf); @@ -866,9 +893,11 @@ static void pt_handle_status(struct pt *pt) static void pt_read_offset(struct pt_buffer *buf) { u64 offset, base_topa; + struct topa_page *tp; rdmsrl(MSR_IA32_RTIT_OUTPUT_BASE, base_topa); - buf->cur = phys_to_virt(base_topa); + tp = phys_to_virt(base_topa); + buf->cur = &tp->topa; rdmsrl(MSR_IA32_RTIT_OUTPUT_MASK, offset); /* offset within current output region */ @@ -923,15 +952,14 @@ static int pt_buffer_reset_markers(struct pt_buffer *buf, unsigned long idx, npages, wakeup; /* can't stop in the middle of an output region */ - if (buf->output_off + handle->size + 1 < - sizes(TOPA_ENTRY(buf->cur, buf->cur_idx)->size)) { + if (buf->output_off + handle->size + 1 < pt_buffer_region_size(buf)) { perf_aux_output_flag(handle, PERF_AUX_FLAG_TRUNCATED); return -EINVAL; } /* single entry ToPA is handled by marking all regions STOP=1 INT=1 */ - if (!pt_cap_get(PT_CAP_topa_multiple_entries)) + if (!intel_pt_validate_hw_cap(PT_CAP_topa_multiple_entries)) return 0; /* clear STOP and INT from current entry */ @@ -1019,6 +1047,7 @@ static void pt_buffer_setup_topa_index(struct pt_buffer *buf) */ static void pt_buffer_reset_offsets(struct pt_buffer *buf, unsigned long head) { + struct topa_page *cur_tp; int pg; if (buf->snapshot) @@ -1027,10 +1056,10 @@ static void pt_buffer_reset_offsets(struct pt_buffer *buf, unsigned long head) pg = (head >> PAGE_SHIFT) & (buf->nr_pages - 1); pg = pt_topa_next_entry(buf, pg); - buf->cur = (struct topa *)((unsigned long)buf->topa_index[pg] & PAGE_MASK); - buf->cur_idx = ((unsigned long)buf->topa_index[pg] - - (unsigned long)buf->cur) / sizeof(struct topa_entry); - buf->output_off = head & (sizes(buf->cur->table[buf->cur_idx].size) - 1); + cur_tp = topa_entry_to_page(buf->topa_index[pg]); + buf->cur = &cur_tp->topa; + buf->cur_idx = buf->topa_index[pg] - TOPA_ENTRY(buf->cur, 0); + buf->output_off = head & (pt_buffer_region_size(buf) - 1); local64_set(&buf->head, head); local_set(&buf->data_size, 0); @@ -1082,7 +1111,7 @@ static int pt_buffer_init_topa(struct pt_buffer *buf, unsigned long nr_pages, pt_buffer_setup_topa_index(buf); /* link last table to the first one, unless we're double buffering */ - if (pt_cap_get(PT_CAP_topa_multiple_entries)) { + if (intel_pt_validate_hw_cap(PT_CAP_topa_multiple_entries)) { TOPA_ENTRY(buf->last, -1)->base = buf->first->phys >> TOPA_SHIFT; TOPA_ENTRY(buf->last, -1)->end = 1; } @@ -1154,7 +1183,7 @@ static int pt_addr_filters_init(struct perf_event *event) struct pt_filters *filters; int node = event->cpu == -1 ? -1 : cpu_to_node(event->cpu); - if (!pt_cap_get(PT_CAP_num_address_ranges)) + if (!intel_pt_validate_hw_cap(PT_CAP_num_address_ranges)) return 0; filters = kzalloc_node(sizeof(struct pt_filters), GFP_KERNEL, node); @@ -1203,7 +1232,7 @@ static int pt_event_addr_filters_validate(struct list_head *filters) return -EINVAL; } - if (++range > pt_cap_get(PT_CAP_num_address_ranges)) + if (++range > intel_pt_validate_hw_cap(PT_CAP_num_address_ranges)) return -EOPNOTSUPP; } @@ -1294,7 +1323,7 @@ void intel_pt_interrupt(void) return; } - pt_config_buffer(buf->cur->table, buf->cur_idx, + pt_config_buffer(topa_to_page(buf->cur)->table, buf->cur_idx, buf->output_off); pt_config(event); } @@ -1359,7 +1388,7 @@ static void pt_event_start(struct perf_event *event, int mode) WRITE_ONCE(pt->handle_nmi, 1); hwc->state = 0; - pt_config_buffer(buf->cur->table, buf->cur_idx, + pt_config_buffer(topa_to_page(buf->cur)->table, buf->cur_idx, buf->output_off); pt_config(event); @@ -1509,12 +1538,12 @@ static __init int pt_init(void) if (ret) return ret; - if (!pt_cap_get(PT_CAP_topa_output)) { + if (!intel_pt_validate_hw_cap(PT_CAP_topa_output)) { pr_warn("ToPA output is not supported on this CPU\n"); return -ENODEV; } - if (!pt_cap_get(PT_CAP_topa_multiple_entries)) + if (!intel_pt_validate_hw_cap(PT_CAP_topa_multiple_entries)) pt_pmu.pmu.capabilities = PERF_PMU_CAP_AUX_NO_SG | PERF_PMU_CAP_AUX_SW_DOUBLEBUF; @@ -1532,7 +1561,7 @@ static __init int pt_init(void) pt_pmu.pmu.addr_filters_sync = pt_event_addr_filters_sync; pt_pmu.pmu.addr_filters_validate = pt_event_addr_filters_validate; pt_pmu.pmu.nr_addr_filters = - pt_cap_get(PT_CAP_num_address_ranges); + intel_pt_validate_hw_cap(PT_CAP_num_address_ranges); ret = perf_pmu_register(&pt_pmu.pmu, "intel_pt", -1); diff --git a/arch/x86/events/intel/pt.h b/arch/x86/events/intel/pt.h index 0eb41d07b79a..ad4ac27f0468 100644 --- a/arch/x86/events/intel/pt.h +++ b/arch/x86/events/intel/pt.h @@ -78,34 +78,13 @@ struct topa_entry { u64 rsvd2 : 1; u64 size : 4; u64 rsvd3 : 2; - u64 base : 36; - u64 rsvd4 : 16; + u64 base : 40; + u64 rsvd4 : 12; }; -#define PT_CPUID_LEAVES 2 -#define PT_CPUID_REGS_NUM 4 /* number of regsters (eax, ebx, ecx, edx) */ - /* TSC to Core Crystal Clock Ratio */ #define CPUID_TSC_LEAF 0x15 -enum pt_capabilities { - PT_CAP_max_subleaf = 0, - PT_CAP_cr3_filtering, - PT_CAP_psb_cyc, - PT_CAP_ip_filtering, - PT_CAP_mtc, - PT_CAP_ptwrite, - PT_CAP_power_event_trace, - PT_CAP_topa_output, - PT_CAP_topa_multiple_entries, - PT_CAP_single_range_output, - PT_CAP_payloads_lip, - PT_CAP_num_address_ranges, - PT_CAP_mtc_periods, - PT_CAP_cycle_thresholds, - PT_CAP_psb_periods, -}; - struct pt_pmu { struct pmu pmu; u32 caps[PT_CPUID_REGS_NUM * PT_CPUID_LEAVES]; diff --git a/arch/x86/include/asm/intel_pt.h b/arch/x86/include/asm/intel_pt.h index b523f51c5400..fa4b4fd2dbed 100644 --- a/arch/x86/include/asm/intel_pt.h +++ b/arch/x86/include/asm/intel_pt.h @@ -2,10 +2,33 @@ #ifndef _ASM_X86_INTEL_PT_H #define _ASM_X86_INTEL_PT_H +#define PT_CPUID_LEAVES 2 +#define PT_CPUID_REGS_NUM 4 /* number of regsters (eax, ebx, ecx, edx) */ + +enum pt_capabilities { + PT_CAP_max_subleaf = 0, + PT_CAP_cr3_filtering, + PT_CAP_psb_cyc, + PT_CAP_ip_filtering, + PT_CAP_mtc, + PT_CAP_ptwrite, + PT_CAP_power_event_trace, + PT_CAP_topa_output, + PT_CAP_topa_multiple_entries, + PT_CAP_single_range_output, + PT_CAP_payloads_lip, + PT_CAP_num_address_ranges, + PT_CAP_mtc_periods, + PT_CAP_cycle_thresholds, + PT_CAP_psb_periods, +}; + #if defined(CONFIG_PERF_EVENTS) && defined(CONFIG_CPU_SUP_INTEL) void cpu_emergency_stop_pt(void); +extern u32 intel_pt_validate_hw_cap(enum pt_capabilities cap); #else static inline void cpu_emergency_stop_pt(void) {} +static inline u32 intel_pt_validate_hw_cap(enum pt_capabilities cap) { return 0; } #endif #endif /* _ASM_X86_INTEL_PT_H */ diff --git a/arch/x86/kernel/cpu/mtrr/mtrr.c b/arch/x86/kernel/cpu/mtrr/mtrr.c index 9a19c800fe40..1935e20c6759 100644 --- a/arch/x86/kernel/cpu/mtrr/mtrr.c +++ b/arch/x86/kernel/cpu/mtrr/mtrr.c @@ -819,7 +819,7 @@ void mtrr_save_state(void) { int first_cpu; - if (!mtrr_enabled()) + if (!mtrr_enabled() || !mtrr_state.have_fixed) return; first_cpu = cpumask_first(cpu_online_mask); diff --git a/arch/x86/kernel/devicetree.c b/arch/x86/kernel/devicetree.c index f39f3a06c26f..c4c84e1a3044 100644 --- a/arch/x86/kernel/devicetree.c +++ b/arch/x86/kernel/devicetree.c @@ -90,7 +90,7 @@ static int x86_of_pci_irq_enable(struct pci_dev *dev) ret = pci_read_config_byte(dev, PCI_INTERRUPT_PIN, &pin); if (ret) - return ret; + return pcibios_err_to_errno(ret); if (!pin) return 0; diff --git a/arch/x86/mm/pti.c b/arch/x86/mm/pti.c index 8316cdb407a0..b50725287da5 100644 --- a/arch/x86/mm/pti.c +++ b/arch/x86/mm/pti.c @@ -383,14 +383,14 @@ pti_clone_pgtable(unsigned long start, unsigned long end, */ *target_pmd = *pmd; - addr += PMD_SIZE; + addr = round_up(addr + 1, PMD_SIZE); } else if (level == PTI_CLONE_PTE) { /* Walk the page-table down to the pte level */ pte = pte_offset_kernel(pmd, addr); if (pte_none(*pte)) { - addr += PAGE_SIZE; + addr = round_up(addr + 1, PAGE_SIZE); continue; } @@ -410,7 +410,7 @@ pti_clone_pgtable(unsigned long start, unsigned long end, /* Clone the PTE */ *target_pte = *pte; - addr += PAGE_SIZE; + addr = round_up(addr + 1, PAGE_SIZE); } else { BUG(); diff --git a/arch/x86/pci/intel_mid_pci.c b/arch/x86/pci/intel_mid_pci.c index eea5a0f3b959..63513968f561 100644 --- a/arch/x86/pci/intel_mid_pci.c +++ b/arch/x86/pci/intel_mid_pci.c @@ -223,9 +223,9 @@ static int intel_mid_pci_irq_enable(struct pci_dev *dev) return 0; ret = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi); - if (ret < 0) { + if (ret) { dev_warn(&dev->dev, "Failed to read interrupt line: %d\n", ret); - return ret; + return pcibios_err_to_errno(ret); } switch (intel_mid_identify_cpu()) { diff --git a/arch/x86/pci/xen.c b/arch/x86/pci/xen.c index bacf8d988f65..d308057aec0b 100644 --- a/arch/x86/pci/xen.c +++ b/arch/x86/pci/xen.c @@ -36,10 +36,10 @@ static int xen_pcifront_enable_irq(struct pci_dev *dev) u8 gsi; rc = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi); - if (rc < 0) { + if (rc) { dev_warn(&dev->dev, "Xen PCI: failed to read interrupt line: %d\n", rc); - return rc; + return pcibios_err_to_errno(rc); } /* In PV DomU the Xen PCI backend puts the PIRQ in the interrupt line.*/ pirq = gsi; diff --git a/arch/x86/platform/intel/iosf_mbi.c b/arch/x86/platform/intel/iosf_mbi.c index 6f37a2137a79..dfeedbd6467f 100644 --- a/arch/x86/platform/intel/iosf_mbi.c +++ b/arch/x86/platform/intel/iosf_mbi.c @@ -68,7 +68,7 @@ static int iosf_mbi_pci_read_mdr(u32 mcrx, u32 mcr, u32 *mdr) fail_read: dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result); - return result; + return pcibios_err_to_errno(result); } static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr) @@ -97,7 +97,7 @@ static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr) fail_write: dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result); - return result; + return pcibios_err_to_errno(result); } int iosf_mbi_read(u8 port, u8 opcode, u32 offset, u32 *mdr) diff --git a/arch/x86/xen/p2m.c b/arch/x86/xen/p2m.c index f9b31eb6846c..8cbdc5e6863c 100644 --- a/arch/x86/xen/p2m.c +++ b/arch/x86/xen/p2m.c @@ -733,7 +733,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops, * immediate unmapping. */ map_ops[i].status = GNTST_general_error; - unmap[0].host_addr = map_ops[i].host_addr, + unmap[0].host_addr = map_ops[i].host_addr; unmap[0].handle = map_ops[i].handle; map_ops[i].handle = ~0; if (map_ops[i].flags & GNTMAP_device_map) @@ -743,7 +743,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops, if (kmap_ops) { kmap_ops[i].status = GNTST_general_error; - unmap[1].host_addr = kmap_ops[i].host_addr, + unmap[1].host_addr = kmap_ops[i].host_addr; unmap[1].handle = kmap_ops[i].handle; kmap_ops[i].handle = ~0; if (kmap_ops[i].flags & GNTMAP_device_map) diff --git a/drivers/acpi/ec.c b/drivers/acpi/ec.c index d2fde87e4d0d..7db62dec2ee5 100644 --- a/drivers/acpi/ec.c +++ b/drivers/acpi/ec.c @@ -1330,10 +1330,13 @@ acpi_ec_space_handler(u32 function, acpi_physical_address address, if (ec->busy_polling || bits > 8) acpi_ec_burst_enable(ec); - for (i = 0; i < bytes; ++i, ++address, ++value) + for (i = 0; i < bytes; ++i, ++address, ++value) { result = (function == ACPI_READ) ? acpi_ec_read(ec, address, value) : acpi_ec_write(ec, address, *value); + if (result < 0) + break; + } if (ec->busy_polling || bits > 8) acpi_ec_burst_disable(ec); @@ -1345,8 +1348,10 @@ acpi_ec_space_handler(u32 function, acpi_physical_address address, return AE_NOT_FOUND; case -ETIME: return AE_TIME; - default: + case 0: return AE_OK; + default: + return AE_ERROR; } } diff --git a/drivers/acpi/processor_idle.c b/drivers/acpi/processor_idle.c index 22b56a6e9cca..363c149e8237 100644 --- a/drivers/acpi/processor_idle.c +++ b/drivers/acpi/processor_idle.c @@ -29,7 +29,6 @@ #include #include #include /* need_resched() */ -#include #include #include #include @@ -545,28 +544,24 @@ static void acpi_processor_power_verify_c3(struct acpi_processor *pr, return; } -static int acpi_cst_latency_cmp(const void *a, const void *b) +static void acpi_cst_latency_sort(struct acpi_processor_cx *states, size_t length) { - const struct acpi_processor_cx *x = a, *y = b; + int i, j, k; - if (!(x->valid && y->valid)) - return 0; - if (x->latency > y->latency) - return 1; - if (x->latency < y->latency) - return -1; - return 0; -} -static void acpi_cst_latency_swap(void *a, void *b, int n) -{ - struct acpi_processor_cx *x = a, *y = b; - u32 tmp; + for (i = 1; i < length; i++) { + if (!states[i].valid) + continue; - if (!(x->valid && y->valid)) - return; - tmp = x->latency; - x->latency = y->latency; - y->latency = tmp; + for (j = i - 1, k = i; j >= 0; j--) { + if (!states[j].valid) + continue; + + if (states[j].latency > states[k].latency) + swap(states[j].latency, states[k].latency); + + k = j; + } + } } static int acpi_processor_power_verify(struct acpi_processor *pr) @@ -611,10 +606,7 @@ static int acpi_processor_power_verify(struct acpi_processor *pr) if (buggy_latency) { pr_notice("FW issue: working around C-state latencies out of order\n"); - sort(&pr->power.states[1], max_cstate, - sizeof(struct acpi_processor_cx), - acpi_cst_latency_cmp, - acpi_cst_latency_swap); + acpi_cst_latency_sort(&pr->power.states[1], max_cstate); } lapic_timer_propagate_broadcast(pr); diff --git a/drivers/android/binder.c b/drivers/android/binder.c index 2794a5ef980a..bdafe5f53e60 100644 --- a/drivers/android/binder.c +++ b/drivers/android/binder.c @@ -1002,9 +1002,7 @@ static bool binder_has_work(struct binder_thread *thread, bool do_proc_work) static bool binder_available_for_proc_work_ilocked(struct binder_thread *thread) { return !thread->transaction_stack && - binder_worklist_empty_ilocked(&thread->todo) && - (thread->looper & (BINDER_LOOPER_STATE_ENTERED | - BINDER_LOOPER_STATE_REGISTERED)); + binder_worklist_empty_ilocked(&thread->todo); } static void binder_wakeup_poll_threads_ilocked(struct binder_proc *proc, diff --git a/drivers/ata/libata-core.c b/drivers/ata/libata-core.c index 00b15aa57c0e..5d931409c21e 100644 --- a/drivers/ata/libata-core.c +++ b/drivers/ata/libata-core.c @@ -6159,6 +6159,9 @@ static void ata_host_release(struct kref *kref) for (i = 0; i < host->n_ports; i++) { struct ata_port *ap = host->ports[i]; + if (!ap) + continue; + kfree(ap->pmp_link); kfree(ap->slave_link); kfree(ap); diff --git a/drivers/atm/idt77252.c b/drivers/atm/idt77252.c index 36629633ae52..c76792a47135 100644 --- a/drivers/atm/idt77252.c +++ b/drivers/atm/idt77252.c @@ -1117,8 +1117,8 @@ dequeue_rx(struct idt77252_dev *card, struct rsq_entry *rsqe) rpp->len += skb->len; if (stat & SAR_RSQE_EPDU) { + unsigned int len, truesize; unsigned char *l1l2; - unsigned int len; l1l2 = (unsigned char *) ((unsigned long) skb->data + skb->len - 6); @@ -1188,14 +1188,15 @@ dequeue_rx(struct idt77252_dev *card, struct rsq_entry *rsqe) ATM_SKB(skb)->vcc = vcc; __net_timestamp(skb); + truesize = skb->truesize; vcc->push(vcc, skb); atomic_inc(&vcc->stats->rx); - if (skb->truesize > SAR_FB_SIZE_3) + if (truesize > SAR_FB_SIZE_3) add_rx_skb(card, 3, SAR_FB_SIZE_3, 1); - else if (skb->truesize > SAR_FB_SIZE_2) + else if (truesize > SAR_FB_SIZE_2) add_rx_skb(card, 2, SAR_FB_SIZE_2, 1); - else if (skb->truesize > SAR_FB_SIZE_1) + else if (truesize > SAR_FB_SIZE_1) add_rx_skb(card, 1, SAR_FB_SIZE_1, 1); else add_rx_skb(card, 0, SAR_FB_SIZE_0, 1); diff --git a/drivers/base/core.c b/drivers/base/core.c index 0cf11a0bf7f4..94b394338bc0 100644 --- a/drivers/base/core.c +++ b/drivers/base/core.c @@ -24,6 +24,7 @@ #include #include #include +#include #include #include @@ -1585,6 +1586,7 @@ static int dev_uevent(struct kset *kset, struct kobject *kobj, struct kobj_uevent_env *env) { struct device *dev = kobj_to_dev(kobj); + struct device_driver *driver; int retval = 0; /* add device node properties if present */ @@ -1613,8 +1615,12 @@ static int dev_uevent(struct kset *kset, struct kobject *kobj, if (dev->type && dev->type->name) add_uevent_var(env, "DEVTYPE=%s", dev->type->name); - if (dev->driver) - add_uevent_var(env, "DRIVER=%s", dev->driver->name); + /* Synchronize with module_remove_driver() */ + rcu_read_lock(); + driver = READ_ONCE(dev->driver); + if (driver) + add_uevent_var(env, "DRIVER=%s", driver->name); + rcu_read_unlock(); /* Add common DT information about the device */ of_device_uevent(dev, env); @@ -1684,11 +1690,8 @@ static ssize_t uevent_show(struct device *dev, struct device_attribute *attr, if (!env) return -ENOMEM; - /* Synchronize with really_probe() */ - device_lock(dev); /* let the kset specific function add its keys */ retval = kset->uevent_ops->uevent(kset, &dev->kobj, env); - device_unlock(dev); if (retval) goto out; diff --git a/drivers/base/devres.c b/drivers/base/devres.c index d68b52cf9225..a64f70a62e28 100644 --- a/drivers/base/devres.c +++ b/drivers/base/devres.c @@ -1057,7 +1057,11 @@ EXPORT_SYMBOL_GPL(__devm_alloc_percpu); */ void devm_free_percpu(struct device *dev, void __percpu *pdata) { - WARN_ON(devres_destroy(dev, devm_percpu_release, devm_percpu_match, - (void *)pdata)); + /* + * Use devres_release() to prevent memory leakage as + * devm_free_pages() does. + */ + WARN_ON(devres_release(dev, devm_percpu_release, devm_percpu_match, + (__force void *)pdata)); } EXPORT_SYMBOL_GPL(devm_free_percpu); diff --git a/drivers/base/module.c b/drivers/base/module.c index 46ad4d636731..851cc5367c04 100644 --- a/drivers/base/module.c +++ b/drivers/base/module.c @@ -7,6 +7,7 @@ #include #include #include +#include #include "base.h" static char *make_driver_name(struct device_driver *drv) @@ -77,6 +78,9 @@ void module_remove_driver(struct device_driver *drv) if (!drv) return; + /* Synchronize with dev_uevent() */ + synchronize_rcu(); + sysfs_remove_link(&drv->p->kobj, "module"); if (drv->owner) diff --git a/drivers/bluetooth/hci_ldisc.c b/drivers/bluetooth/hci_ldisc.c index 48560e646e53..ee57848e20cb 100644 --- a/drivers/bluetooth/hci_ldisc.c +++ b/drivers/bluetooth/hci_ldisc.c @@ -773,7 +773,8 @@ static int hci_uart_tty_ioctl(struct tty_struct *tty, struct file *file, break; case HCIUARTGETPROTO: - if (test_bit(HCI_UART_PROTO_SET, &hu->flags)) + if (test_bit(HCI_UART_PROTO_SET, &hu->flags) && + test_bit(HCI_UART_PROTO_READY, &hu->flags)) err = hu->proto->id; else err = -EUNATCH; diff --git a/drivers/char/hw_random/amd-rng.c b/drivers/char/hw_random/amd-rng.c index db3dd467194c..3f3fdf6ee3d5 100644 --- a/drivers/char/hw_random/amd-rng.c +++ b/drivers/char/hw_random/amd-rng.c @@ -142,8 +142,10 @@ static int __init mod_init(void) found: err = pci_read_config_dword(pdev, 0x58, &pmbase); - if (err) + if (err) { + err = pcibios_err_to_errno(err); goto put_dev; + } pmbase &= 0x0000FF00; if (pmbase == 0) { diff --git a/drivers/char/tpm/eventlog/common.c b/drivers/char/tpm/eventlog/common.c index 462476467bff..1d7ee22deeab 100644 --- a/drivers/char/tpm/eventlog/common.c +++ b/drivers/char/tpm/eventlog/common.c @@ -52,6 +52,8 @@ static int tpm_bios_measurements_open(struct inode *inode, if (!err) { seq = file->private_data; seq->private = chip; + } else { + put_device(&chip->dev); } return err; diff --git a/drivers/clocksource/sh_cmt.c b/drivers/clocksource/sh_cmt.c index 0ca8819acc4d..278b27298ca4 100644 --- a/drivers/clocksource/sh_cmt.c +++ b/drivers/clocksource/sh_cmt.c @@ -518,6 +518,7 @@ static void sh_cmt_set_next(struct sh_cmt_channel *ch, unsigned long delta) static irqreturn_t sh_cmt_interrupt(int irq, void *dev_id) { struct sh_cmt_channel *ch = dev_id; + unsigned long flags; /* clear flags */ sh_cmt_write_cmcsr(ch, sh_cmt_read_cmcsr(ch) & @@ -548,6 +549,8 @@ static irqreturn_t sh_cmt_interrupt(int irq, void *dev_id) ch->flags &= ~FLAG_SKIPEVENT; + raw_spin_lock_irqsave(&ch->lock, flags); + if (ch->flags & FLAG_REPROGRAM) { ch->flags &= ~FLAG_REPROGRAM; sh_cmt_clock_event_program_verify(ch, 1); @@ -560,6 +563,8 @@ static irqreturn_t sh_cmt_interrupt(int irq, void *dev_id) ch->flags &= ~FLAG_IRQCONTEXT; + raw_spin_unlock_irqrestore(&ch->lock, flags); + return IRQ_HANDLED; } @@ -758,12 +763,18 @@ static int sh_cmt_clock_event_next(unsigned long delta, struct clock_event_device *ced) { struct sh_cmt_channel *ch = ced_to_sh_cmt(ced); + unsigned long flags; BUG_ON(!clockevent_state_oneshot(ced)); + + raw_spin_lock_irqsave(&ch->lock, flags); + if (likely(ch->flags & FLAG_IRQCONTEXT)) ch->next_match_value = delta - 1; else - sh_cmt_set_next(ch, delta - 1); + __sh_cmt_set_next(ch, delta - 1); + + raw_spin_unlock_irqrestore(&ch->lock, flags); return 0; } diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_ctx.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_ctx.c index df6965761046..3bd990e11844 100644 --- a/drivers/gpu/drm/amd/amdgpu/amdgpu_ctx.c +++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_ctx.c @@ -288,16 +288,24 @@ int amdgpu_ctx_ioctl(struct drm_device *dev, void *data, switch (args->in.op) { case AMDGPU_CTX_OP_ALLOC_CTX: + if (args->in.flags) + return -EINVAL; r = amdgpu_ctx_alloc(adev, fpriv, filp, priority, &id); args->out.alloc.ctx_id = id; break; case AMDGPU_CTX_OP_FREE_CTX: + if (args->in.flags) + return -EINVAL; r = amdgpu_ctx_free(fpriv, id); break; case AMDGPU_CTX_OP_QUERY_STATE: + if (args->in.flags) + return -EINVAL; r = amdgpu_ctx_query(adev, fpriv, id, &args->out); break; case AMDGPU_CTX_OP_QUERY_STATE2: + if (args->in.flags) + return -EINVAL; r = amdgpu_ctx_query2(adev, fpriv, id, &args->out); break; default: diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_vce.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_vce.c index 17862b9ecccd..9c8ce75c760a 100644 --- a/drivers/gpu/drm/amd/amdgpu/amdgpu_vce.c +++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_vce.c @@ -714,7 +714,8 @@ int amdgpu_vce_ring_parse_cs(struct amdgpu_cs_parser *p, uint32_t ib_idx) uint32_t created = 0; uint32_t allocated = 0; uint32_t tmp, handle = 0; - uint32_t *size = &tmp; + uint32_t dummy = 0xffffffff; + uint32_t *size = &dummy; unsigned idx; int i, r = 0; diff --git a/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c b/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c index a5f2763d72e4..229b05cd3c9a 100644 --- a/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c +++ b/drivers/gpu/drm/bridge/analogix/analogix_dp_reg.c @@ -1109,7 +1109,6 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, u32 status_reg; u8 *buffer = msg->buffer; unsigned int i; - int num_transferred = 0; int ret; /* Buffer size of AUX CH is 16 bytes */ @@ -1161,7 +1160,6 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, reg = buffer[i]; writel(reg, dp->reg_base + ANALOGIX_DP_BUF_DATA_0 + 4 * i); - num_transferred++; } } @@ -1209,7 +1207,6 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, reg = readl(dp->reg_base + ANALOGIX_DP_BUF_DATA_0 + 4 * i); buffer[i] = (unsigned char)reg; - num_transferred++; } } @@ -1226,7 +1223,7 @@ ssize_t analogix_dp_transfer(struct analogix_dp_device *dp, (msg->request & ~DP_AUX_I2C_MOT) == DP_AUX_NATIVE_READ) msg->reply = DP_AUX_NATIVE_REPLY_ACK; - return num_transferred > 0 ? num_transferred : -EBUSY; + return msg->size; aux_error: /* if aux err happen, reset aux */ diff --git a/drivers/gpu/drm/drm_fb_helper.c b/drivers/gpu/drm/drm_fb_helper.c index ee6801fa36ad..f8c8513de271 100644 --- a/drivers/gpu/drm/drm_fb_helper.c +++ b/drivers/gpu/drm/drm_fb_helper.c @@ -1713,6 +1713,9 @@ int drm_fb_helper_check_var(struct fb_var_screeninfo *var, return -EINVAL; } + var->xres_virtual = fb->width; + var->yres_virtual = fb->height; + /* * Workaround for SDL 1.2, which is known to be setting all pixel format * fields values to zero in some cases. We treat this situation as a diff --git a/drivers/gpu/drm/etnaviv/etnaviv_gem.c b/drivers/gpu/drm/etnaviv/etnaviv_gem.c index 1fa74226db91..69f91662ba23 100644 --- a/drivers/gpu/drm/etnaviv/etnaviv_gem.c +++ b/drivers/gpu/drm/etnaviv/etnaviv_gem.c @@ -370,9 +370,11 @@ static void *etnaviv_gem_vmap_impl(struct etnaviv_gem_object *obj) static inline enum dma_data_direction etnaviv_op_to_dma_dir(u32 op) { - if (op & ETNA_PREP_READ) + op &= ETNA_PREP_READ | ETNA_PREP_WRITE; + + if (op == ETNA_PREP_READ) return DMA_FROM_DEVICE; - else if (op & ETNA_PREP_WRITE) + else if (op == ETNA_PREP_WRITE) return DMA_TO_DEVICE; else return DMA_BIDIRECTIONAL; diff --git a/drivers/gpu/drm/gma500/cdv_intel_lvds.c b/drivers/gpu/drm/gma500/cdv_intel_lvds.c index 9c8446184b17..4f96cd10971f 100644 --- a/drivers/gpu/drm/gma500/cdv_intel_lvds.c +++ b/drivers/gpu/drm/gma500/cdv_intel_lvds.c @@ -404,6 +404,9 @@ static int cdv_intel_lvds_get_modes(struct drm_connector *connector) if (mode_dev->panel_fixed_mode != NULL) { struct drm_display_mode *mode = drm_mode_duplicate(dev, mode_dev->panel_fixed_mode); + if (!mode) + return 0; + drm_mode_probed_add(connector, mode); return 1; } diff --git a/drivers/gpu/drm/gma500/psb_intel_lvds.c b/drivers/gpu/drm/gma500/psb_intel_lvds.c index 8baf6325c6e4..5e5b05cde0f4 100644 --- a/drivers/gpu/drm/gma500/psb_intel_lvds.c +++ b/drivers/gpu/drm/gma500/psb_intel_lvds.c @@ -519,6 +519,9 @@ static int psb_intel_lvds_get_modes(struct drm_connector *connector) if (mode_dev->panel_fixed_mode != NULL) { struct drm_display_mode *mode = drm_mode_duplicate(dev, mode_dev->panel_fixed_mode); + if (!mode) + return 0; + drm_mode_probed_add(connector, mode); return 1; } diff --git a/drivers/gpu/drm/i915/i915_gem.c b/drivers/gpu/drm/i915/i915_gem.c index 5b0d6d8b3ab8..478d989a2369 100644 --- a/drivers/gpu/drm/i915/i915_gem.c +++ b/drivers/gpu/drm/i915/i915_gem.c @@ -2009,6 +2009,39 @@ compute_partial_view(struct drm_i915_gem_object *obj, return view; } +static void set_address_limits(struct vm_area_struct *area, + struct i915_vma *vma, + unsigned long *start_vaddr, + unsigned long *end_vaddr) +{ + unsigned long vm_start, vm_end, vma_size; /* user's memory parameters */ + long start, end; /* memory boundaries */ + + /* + * Let's move into the ">> PAGE_SHIFT" + * domain to be sure not to lose bits + */ + vm_start = area->vm_start >> PAGE_SHIFT; + vm_end = area->vm_end >> PAGE_SHIFT; + vma_size = vma->size >> PAGE_SHIFT; + + /* + * Calculate the memory boundaries by considering the offset + * provided by the user during memory mapping and the offset + * provided for the partial mapping. + */ + start = vm_start; + start += vma->ggtt_view.partial.offset; + end = start + vma_size; + + start = max_t(long, start, vm_start); + end = min_t(long, end, vm_end); + + /* Let's move back into the "<< PAGE_SHIFT" domain */ + *start_vaddr = (unsigned long)start << PAGE_SHIFT; + *end_vaddr = (unsigned long)end << PAGE_SHIFT; +} + /** * i915_gem_fault - fault a page into the GTT * @vmf: fault info @@ -2036,8 +2069,10 @@ vm_fault_t i915_gem_fault(struct vm_fault *vmf) struct drm_i915_private *dev_priv = to_i915(dev); struct i915_ggtt *ggtt = &dev_priv->ggtt; bool write = !!(vmf->flags & FAULT_FLAG_WRITE); + unsigned long start, end; /* memory boundaries */ struct i915_vma *vma; pgoff_t page_offset; + unsigned long pfn; int ret; /* Sanity check that we allow writing into this object */ @@ -2119,12 +2154,14 @@ vm_fault_t i915_gem_fault(struct vm_fault *vmf) if (ret) goto err_unpin; + set_address_limits(area, vma, &start, &end); + + pfn = (ggtt->gmadr.start + i915_ggtt_offset(vma)) >> PAGE_SHIFT; + pfn += (start - area->vm_start) >> PAGE_SHIFT; + pfn -= vma->ggtt_view.partial.offset; + /* Finally, remap it using the new GTT offset */ - ret = remap_io_mapping(area, - area->vm_start + (vma->ggtt_view.partial.offset << PAGE_SHIFT), - (ggtt->gmadr.start + vma->node.start) >> PAGE_SHIFT, - min_t(u64, vma->size, area->vm_end - area->vm_start), - &ggtt->iomap); + ret = remap_io_mapping(area, start, pfn, end - start, &ggtt->iomap); if (ret) goto err_fence; diff --git a/drivers/gpu/drm/mgag200/mgag200_i2c.c b/drivers/gpu/drm/mgag200/mgag200_i2c.c index 77d1c4771786..0919021168e1 100644 --- a/drivers/gpu/drm/mgag200/mgag200_i2c.c +++ b/drivers/gpu/drm/mgag200/mgag200_i2c.c @@ -133,7 +133,7 @@ struct mga_i2c_chan *mgag200_i2c_create(struct drm_device *dev) i2c->adapter.algo_data = &i2c->bit; i2c->bit.udelay = 10; - i2c->bit.timeout = 2; + i2c->bit.timeout = usecs_to_jiffies(2200); i2c->bit.data = i2c; i2c->bit.setsda = mga_gpio_setsda; i2c->bit.setscl = mga_gpio_setscl; diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h b/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h index 56ae888e18fc..2023cb0d21a8 100644 --- a/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h +++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_kms.h @@ -41,24 +41,14 @@ * @fmt: Pointer to format string */ #define DPU_DEBUG(fmt, ...) \ - do { \ - if (unlikely(drm_debug & DRM_UT_KMS)) \ - DRM_DEBUG(fmt, ##__VA_ARGS__); \ - else \ - pr_debug(fmt, ##__VA_ARGS__); \ - } while (0) + DRM_DEBUG_DRIVER(fmt, ##__VA_ARGS__) /** * DPU_DEBUG_DRIVER - macro for hardware driver logging * @fmt: Pointer to format string */ #define DPU_DEBUG_DRIVER(fmt, ...) \ - do { \ - if (unlikely(drm_debug & DRM_UT_DRIVER)) \ - DRM_ERROR(fmt, ##__VA_ARGS__); \ - else \ - pr_debug(fmt, ##__VA_ARGS__); \ - } while (0) + DRM_DEBUG_DRIVER(fmt, ##__VA_ARGS__) #define DPU_ERROR(fmt, ...) pr_err("[dpu error]" fmt, ##__VA_ARGS__) #define DPU_ERROR_RATELIMITED(fmt, ...) pr_err_ratelimited("[dpu error]" fmt, ##__VA_ARGS__) diff --git a/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c b/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c index 9f1b9d289bec..5318c949e891 100644 --- a/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c +++ b/drivers/gpu/drm/vmwgfx/vmwgfx_overlay.c @@ -100,7 +100,7 @@ static int vmw_overlay_send_put(struct vmw_private *dev_priv, { struct vmw_escape_video_flush *flush; size_t fifo_size; - bool have_so = (dev_priv->active_display_unit == vmw_du_screen_object); + bool have_so = (dev_priv->active_display_unit != vmw_du_legacy); int i, num_items; SVGAGuestPtr ptr; diff --git a/drivers/hid/wacom_wac.c b/drivers/hid/wacom_wac.c index 46dd5a93a375..fe4051024db3 100644 --- a/drivers/hid/wacom_wac.c +++ b/drivers/hid/wacom_wac.c @@ -1830,12 +1830,14 @@ static void wacom_map_usage(struct input_dev *input, struct hid_usage *usage, int fmax = field->logical_maximum; unsigned int equivalent_usage = wacom_equivalent_usage(usage->hid); int resolution_code = code; - int resolution = hidinput_calc_abs_res(field, resolution_code); + int resolution; if (equivalent_usage == HID_DG_TWIST) { resolution_code = ABS_RZ; } + resolution = hidinput_calc_abs_res(field, resolution_code); + if (equivalent_usage == HID_GD_X) { fmin += features->offset_left; fmax -= features->offset_right; diff --git a/drivers/hwmon/adt7475.c b/drivers/hwmon/adt7475.c index 2db2665dcd4d..6406520f3915 100644 --- a/drivers/hwmon/adt7475.c +++ b/drivers/hwmon/adt7475.c @@ -1785,7 +1785,7 @@ static void adt7475_read_pwm(struct i2c_client *client, int index) data->pwm[CONTROL][index] &= ~0xE0; data->pwm[CONTROL][index] |= (7 << 5); - i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index), + i2c_smbus_write_byte_data(client, PWM_REG(index), data->pwm[INPUT][index]); i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index), diff --git a/drivers/hwmon/max6697.c b/drivers/hwmon/max6697.c index 6df28fe0577d..14c34a2d36af 100644 --- a/drivers/hwmon/max6697.c +++ b/drivers/hwmon/max6697.c @@ -251,7 +251,7 @@ abort: return ret; } -static ssize_t show_temp_input(struct device *dev, +static ssize_t temp_input_show(struct device *dev, struct device_attribute *devattr, char *buf) { int index = to_sensor_dev_attr(devattr)->index; @@ -267,8 +267,8 @@ static ssize_t show_temp_input(struct device *dev, return sprintf(buf, "%d\n", temp * 125); } -static ssize_t show_temp(struct device *dev, - struct device_attribute *devattr, char *buf) +static ssize_t temp_show(struct device *dev, struct device_attribute *devattr, + char *buf) { int nr = to_sensor_dev_attr_2(devattr)->nr; int index = to_sensor_dev_attr_2(devattr)->index; @@ -284,7 +284,7 @@ static ssize_t show_temp(struct device *dev, return sprintf(buf, "%d\n", temp * 1000); } -static ssize_t show_alarm(struct device *dev, struct device_attribute *attr, +static ssize_t alarm_show(struct device *dev, struct device_attribute *attr, char *buf) { int index = to_sensor_dev_attr(attr)->index; @@ -299,9 +299,9 @@ static ssize_t show_alarm(struct device *dev, struct device_attribute *attr, return sprintf(buf, "%u\n", (data->alarms >> index) & 0x1); } -static ssize_t set_temp(struct device *dev, - struct device_attribute *devattr, - const char *buf, size_t count) +static ssize_t temp_store(struct device *dev, + struct device_attribute *devattr, const char *buf, + size_t count) { int nr = to_sensor_dev_attr_2(devattr)->nr; int index = to_sensor_dev_attr_2(devattr)->index; @@ -314,6 +314,7 @@ static ssize_t set_temp(struct device *dev, return ret; mutex_lock(&data->update_lock); + temp = clamp_val(temp, -1000000, 1000000); /* prevent underflow */ temp = DIV_ROUND_CLOSEST(temp, 1000) + data->temp_offset; temp = clamp_val(temp, 0, data->type == max6581 ? 255 : 127); data->temp[nr][index] = temp; @@ -326,79 +327,63 @@ static ssize_t set_temp(struct device *dev, return ret < 0 ? ret : count; } -static SENSOR_DEVICE_ATTR(temp1_input, S_IRUGO, show_temp_input, NULL, 0); -static SENSOR_DEVICE_ATTR_2(temp1_max, S_IRUGO | S_IWUSR, show_temp, set_temp, - 0, MAX6697_TEMP_MAX); -static SENSOR_DEVICE_ATTR_2(temp1_crit, S_IRUGO | S_IWUSR, show_temp, set_temp, - 0, MAX6697_TEMP_CRIT); +static SENSOR_DEVICE_ATTR_RO(temp1_input, temp_input, 0); +static SENSOR_DEVICE_ATTR_2_RW(temp1_max, temp, 0, MAX6697_TEMP_MAX); +static SENSOR_DEVICE_ATTR_2_RW(temp1_crit, temp, 0, MAX6697_TEMP_CRIT); -static SENSOR_DEVICE_ATTR(temp2_input, S_IRUGO, show_temp_input, NULL, 1); -static SENSOR_DEVICE_ATTR_2(temp2_max, S_IRUGO | S_IWUSR, show_temp, set_temp, - 1, MAX6697_TEMP_MAX); -static SENSOR_DEVICE_ATTR_2(temp2_crit, S_IRUGO | S_IWUSR, show_temp, set_temp, - 1, MAX6697_TEMP_CRIT); +static SENSOR_DEVICE_ATTR_RO(temp2_input, temp_input, 1); +static SENSOR_DEVICE_ATTR_2_RW(temp2_max, temp, 1, MAX6697_TEMP_MAX); +static SENSOR_DEVICE_ATTR_2_RW(temp2_crit, temp, 1, MAX6697_TEMP_CRIT); -static SENSOR_DEVICE_ATTR(temp3_input, S_IRUGO, show_temp_input, NULL, 2); -static SENSOR_DEVICE_ATTR_2(temp3_max, S_IRUGO | S_IWUSR, show_temp, set_temp, - 2, MAX6697_TEMP_MAX); -static SENSOR_DEVICE_ATTR_2(temp3_crit, S_IRUGO | S_IWUSR, show_temp, set_temp, - 2, MAX6697_TEMP_CRIT); +static SENSOR_DEVICE_ATTR_RO(temp3_input, temp_input, 2); +static SENSOR_DEVICE_ATTR_2_RW(temp3_max, temp, 2, MAX6697_TEMP_MAX); +static SENSOR_DEVICE_ATTR_2_RW(temp3_crit, temp, 2, MAX6697_TEMP_CRIT); -static SENSOR_DEVICE_ATTR(temp4_input, S_IRUGO, show_temp_input, NULL, 3); -static SENSOR_DEVICE_ATTR_2(temp4_max, S_IRUGO | S_IWUSR, show_temp, set_temp, - 3, MAX6697_TEMP_MAX); -static SENSOR_DEVICE_ATTR_2(temp4_crit, S_IRUGO | S_IWUSR, show_temp, set_temp, - 3, MAX6697_TEMP_CRIT); +static SENSOR_DEVICE_ATTR_RO(temp4_input, temp_input, 3); +static SENSOR_DEVICE_ATTR_2_RW(temp4_max, temp, 3, MAX6697_TEMP_MAX); +static SENSOR_DEVICE_ATTR_2_RW(temp4_crit, temp, 3, MAX6697_TEMP_CRIT); -static SENSOR_DEVICE_ATTR(temp5_input, S_IRUGO, show_temp_input, NULL, 4); -static SENSOR_DEVICE_ATTR_2(temp5_max, S_IRUGO | S_IWUSR, show_temp, set_temp, - 4, MAX6697_TEMP_MAX); -static SENSOR_DEVICE_ATTR_2(temp5_crit, S_IRUGO | S_IWUSR, show_temp, set_temp, - 4, MAX6697_TEMP_CRIT); +static SENSOR_DEVICE_ATTR_RO(temp5_input, temp_input, 4); +static SENSOR_DEVICE_ATTR_2_RW(temp5_max, temp, 4, MAX6697_TEMP_MAX); +static SENSOR_DEVICE_ATTR_2_RW(temp5_crit, temp, 4, MAX6697_TEMP_CRIT); -static SENSOR_DEVICE_ATTR(temp6_input, S_IRUGO, show_temp_input, NULL, 5); -static SENSOR_DEVICE_ATTR_2(temp6_max, S_IRUGO | S_IWUSR, show_temp, set_temp, - 5, MAX6697_TEMP_MAX); -static SENSOR_DEVICE_ATTR_2(temp6_crit, S_IRUGO | S_IWUSR, show_temp, set_temp, - 5, MAX6697_TEMP_CRIT); +static SENSOR_DEVICE_ATTR_RO(temp6_input, temp_input, 5); +static SENSOR_DEVICE_ATTR_2_RW(temp6_max, temp, 5, MAX6697_TEMP_MAX); +static SENSOR_DEVICE_ATTR_2_RW(temp6_crit, temp, 5, MAX6697_TEMP_CRIT); -static SENSOR_DEVICE_ATTR(temp7_input, S_IRUGO, show_temp_input, NULL, 6); -static SENSOR_DEVICE_ATTR_2(temp7_max, S_IRUGO | S_IWUSR, show_temp, set_temp, - 6, MAX6697_TEMP_MAX); -static SENSOR_DEVICE_ATTR_2(temp7_crit, S_IRUGO | S_IWUSR, show_temp, set_temp, - 6, MAX6697_TEMP_CRIT); +static SENSOR_DEVICE_ATTR_RO(temp7_input, temp_input, 6); +static SENSOR_DEVICE_ATTR_2_RW(temp7_max, temp, 6, MAX6697_TEMP_MAX); +static SENSOR_DEVICE_ATTR_2_RW(temp7_crit, temp, 6, MAX6697_TEMP_CRIT); -static SENSOR_DEVICE_ATTR(temp8_input, S_IRUGO, show_temp_input, NULL, 7); -static SENSOR_DEVICE_ATTR_2(temp8_max, S_IRUGO | S_IWUSR, show_temp, set_temp, - 7, MAX6697_TEMP_MAX); -static SENSOR_DEVICE_ATTR_2(temp8_crit, S_IRUGO | S_IWUSR, show_temp, set_temp, - 7, MAX6697_TEMP_CRIT); +static SENSOR_DEVICE_ATTR_RO(temp8_input, temp_input, 7); +static SENSOR_DEVICE_ATTR_2_RW(temp8_max, temp, 7, MAX6697_TEMP_MAX); +static SENSOR_DEVICE_ATTR_2_RW(temp8_crit, temp, 7, MAX6697_TEMP_CRIT); -static SENSOR_DEVICE_ATTR(temp1_max_alarm, S_IRUGO, show_alarm, NULL, 22); -static SENSOR_DEVICE_ATTR(temp2_max_alarm, S_IRUGO, show_alarm, NULL, 16); -static SENSOR_DEVICE_ATTR(temp3_max_alarm, S_IRUGO, show_alarm, NULL, 17); -static SENSOR_DEVICE_ATTR(temp4_max_alarm, S_IRUGO, show_alarm, NULL, 18); -static SENSOR_DEVICE_ATTR(temp5_max_alarm, S_IRUGO, show_alarm, NULL, 19); -static SENSOR_DEVICE_ATTR(temp6_max_alarm, S_IRUGO, show_alarm, NULL, 20); -static SENSOR_DEVICE_ATTR(temp7_max_alarm, S_IRUGO, show_alarm, NULL, 21); -static SENSOR_DEVICE_ATTR(temp8_max_alarm, S_IRUGO, show_alarm, NULL, 23); +static SENSOR_DEVICE_ATTR_RO(temp1_max_alarm, alarm, 22); +static SENSOR_DEVICE_ATTR_RO(temp2_max_alarm, alarm, 16); +static SENSOR_DEVICE_ATTR_RO(temp3_max_alarm, alarm, 17); +static SENSOR_DEVICE_ATTR_RO(temp4_max_alarm, alarm, 18); +static SENSOR_DEVICE_ATTR_RO(temp5_max_alarm, alarm, 19); +static SENSOR_DEVICE_ATTR_RO(temp6_max_alarm, alarm, 20); +static SENSOR_DEVICE_ATTR_RO(temp7_max_alarm, alarm, 21); +static SENSOR_DEVICE_ATTR_RO(temp8_max_alarm, alarm, 23); -static SENSOR_DEVICE_ATTR(temp1_crit_alarm, S_IRUGO, show_alarm, NULL, 14); -static SENSOR_DEVICE_ATTR(temp2_crit_alarm, S_IRUGO, show_alarm, NULL, 8); -static SENSOR_DEVICE_ATTR(temp3_crit_alarm, S_IRUGO, show_alarm, NULL, 9); -static SENSOR_DEVICE_ATTR(temp4_crit_alarm, S_IRUGO, show_alarm, NULL, 10); -static SENSOR_DEVICE_ATTR(temp5_crit_alarm, S_IRUGO, show_alarm, NULL, 11); -static SENSOR_DEVICE_ATTR(temp6_crit_alarm, S_IRUGO, show_alarm, NULL, 12); -static SENSOR_DEVICE_ATTR(temp7_crit_alarm, S_IRUGO, show_alarm, NULL, 13); -static SENSOR_DEVICE_ATTR(temp8_crit_alarm, S_IRUGO, show_alarm, NULL, 15); +static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 15); +static SENSOR_DEVICE_ATTR_RO(temp2_crit_alarm, alarm, 8); +static SENSOR_DEVICE_ATTR_RO(temp3_crit_alarm, alarm, 9); +static SENSOR_DEVICE_ATTR_RO(temp4_crit_alarm, alarm, 10); +static SENSOR_DEVICE_ATTR_RO(temp5_crit_alarm, alarm, 11); +static SENSOR_DEVICE_ATTR_RO(temp6_crit_alarm, alarm, 12); +static SENSOR_DEVICE_ATTR_RO(temp7_crit_alarm, alarm, 13); +static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 14); -static SENSOR_DEVICE_ATTR(temp2_fault, S_IRUGO, show_alarm, NULL, 1); -static SENSOR_DEVICE_ATTR(temp3_fault, S_IRUGO, show_alarm, NULL, 2); -static SENSOR_DEVICE_ATTR(temp4_fault, S_IRUGO, show_alarm, NULL, 3); -static SENSOR_DEVICE_ATTR(temp5_fault, S_IRUGO, show_alarm, NULL, 4); -static SENSOR_DEVICE_ATTR(temp6_fault, S_IRUGO, show_alarm, NULL, 5); -static SENSOR_DEVICE_ATTR(temp7_fault, S_IRUGO, show_alarm, NULL, 6); -static SENSOR_DEVICE_ATTR(temp8_fault, S_IRUGO, show_alarm, NULL, 7); +static SENSOR_DEVICE_ATTR_RO(temp2_fault, alarm, 1); +static SENSOR_DEVICE_ATTR_RO(temp3_fault, alarm, 2); +static SENSOR_DEVICE_ATTR_RO(temp4_fault, alarm, 3); +static SENSOR_DEVICE_ATTR_RO(temp5_fault, alarm, 4); +static SENSOR_DEVICE_ATTR_RO(temp6_fault, alarm, 5); +static SENSOR_DEVICE_ATTR_RO(temp7_fault, alarm, 6); +static SENSOR_DEVICE_ATTR_RO(temp8_fault, alarm, 7); static DEVICE_ATTR(dummy, 0, NULL, NULL); diff --git a/drivers/i2c/busses/i2c-riic.c b/drivers/i2c/busses/i2c-riic.c index e6f351c92c02..82ffa8eecec8 100644 --- a/drivers/i2c/busses/i2c-riic.c +++ b/drivers/i2c/busses/i2c-riic.c @@ -315,7 +315,7 @@ static int riic_init_hw(struct riic_dev *riic, struct i2c_timings *t) * frequency with only 62 clock ticks max (31 high, 31 low). * Aim for a duty of 60% LOW, 40% HIGH. */ - total_ticks = DIV_ROUND_UP(rate, t->bus_freq_hz); + total_ticks = DIV_ROUND_UP(rate, t->bus_freq_hz ?: 1); for (cks = 0; cks < 7; cks++) { /* diff --git a/drivers/i2c/i2c-smbus.c b/drivers/i2c/i2c-smbus.c index 5a1dd7f13bac..0e9c2943194c 100644 --- a/drivers/i2c/i2c-smbus.c +++ b/drivers/i2c/i2c-smbus.c @@ -42,6 +42,7 @@ static int smbus_do_alert(struct device *dev, void *addrp) struct i2c_client *client = i2c_verify_client(dev); struct alert_data *data = addrp; struct i2c_driver *driver; + int ret; if (!client || client->addr != data->addr) return 0; @@ -55,16 +56,47 @@ static int smbus_do_alert(struct device *dev, void *addrp) device_lock(dev); if (client->dev.driver) { driver = to_i2c_driver(client->dev.driver); - if (driver->alert) + if (driver->alert) { + /* Stop iterating after we find the device */ driver->alert(client, data->type, data->data); - else + ret = -EBUSY; + } else { dev_warn(&client->dev, "no driver alert()!\n"); - } else + ret = -EOPNOTSUPP; + } + } else { dev_dbg(&client->dev, "alert with no driver\n"); + ret = -ENODEV; + } device_unlock(dev); - /* Stop iterating after we find the device */ - return -EBUSY; + return ret; +} + +/* Same as above, but call back all drivers with alert handler */ + +static int smbus_do_alert_force(struct device *dev, void *addrp) +{ + struct i2c_client *client = i2c_verify_client(dev); + struct alert_data *data = addrp; + struct i2c_driver *driver; + + if (!client || (client->flags & I2C_CLIENT_TEN)) + return 0; + + /* + * Drivers should either disable alerts, or provide at least + * a minimal handler. Lock so the driver won't change. + */ + device_lock(dev); + if (client->dev.driver) { + driver = to_i2c_driver(client->dev.driver); + if (driver->alert) + driver->alert(client, data->type, data->data); + } + device_unlock(dev); + + return 0; } /* @@ -75,7 +107,7 @@ static irqreturn_t smbus_alert(int irq, void *d) { struct i2c_smbus_alert *alert = d; struct i2c_client *ara; - unsigned short prev_addr = 0; /* Not a valid address */ + unsigned short prev_addr = I2C_CLIENT_END; /* Not a valid address */ ara = alert->ara; @@ -99,17 +131,28 @@ static irqreturn_t smbus_alert(int irq, void *d) data.addr = status >> 1; data.type = I2C_PROTOCOL_SMBUS_ALERT; - if (data.addr == prev_addr) { - dev_warn(&ara->dev, "Duplicate SMBALERT# from dev " - "0x%02x, skipping\n", data.addr); - break; - } dev_dbg(&ara->dev, "SMBALERT# from dev 0x%02x, flag %d\n", data.addr, data.data); /* Notify driver for the device which issued the alert */ - device_for_each_child(&ara->adapter->dev, &data, - smbus_do_alert); + status = device_for_each_child(&ara->adapter->dev, &data, + smbus_do_alert); + /* + * If we read the same address more than once, and the alert + * was not handled by a driver, it won't do any good to repeat + * the loop because it will never terminate. Try again, this + * time calling the alert handlers of all devices connected to + * the bus, and abort the loop afterwards. If this helps, we + * are all set. If it doesn't, there is nothing else we can do, + * so we might as well abort the loop. + * Note: This assumes that a driver with alert handler handles + * the alert properly and clears it if necessary. + */ + if (data.addr == prev_addr && status != -EBUSY) { + device_for_each_child(&ara->adapter->dev, &data, + smbus_do_alert_force); + break; + } prev_addr = data.addr; } diff --git a/drivers/infiniband/core/iwcm.c b/drivers/infiniband/core/iwcm.c index 57aec656ab7f..84fa7b727a2b 100644 --- a/drivers/infiniband/core/iwcm.c +++ b/drivers/infiniband/core/iwcm.c @@ -369,8 +369,10 @@ EXPORT_SYMBOL(iw_cm_disconnect); * * Clean up all resources associated with the connection and release * the initial reference taken by iw_create_cm_id. + * + * Returns true if and only if the last cm_id_priv reference has been dropped. */ -static void destroy_cm_id(struct iw_cm_id *cm_id) +static bool destroy_cm_id(struct iw_cm_id *cm_id) { struct iwcm_id_private *cm_id_priv; unsigned long flags; @@ -438,7 +440,7 @@ static void destroy_cm_id(struct iw_cm_id *cm_id) iwpm_remove_mapping(&cm_id->local_addr, RDMA_NL_IWCM); } - (void)iwcm_deref_id(cm_id_priv); + return iwcm_deref_id(cm_id_priv); } /* @@ -449,7 +451,8 @@ static void destroy_cm_id(struct iw_cm_id *cm_id) */ void iw_destroy_cm_id(struct iw_cm_id *cm_id) { - destroy_cm_id(cm_id); + if (!destroy_cm_id(cm_id)) + flush_workqueue(iwcm_wq); } EXPORT_SYMBOL(iw_destroy_cm_id); @@ -1022,7 +1025,7 @@ static void cm_work_handler(struct work_struct *_work) if (!test_bit(IWCM_F_DROP_EVENTS, &cm_id_priv->flags)) { ret = process_event(cm_id_priv, &levent); if (ret) - destroy_cm_id(&cm_id_priv->id); + WARN_ON_ONCE(destroy_cm_id(&cm_id_priv->id)); } else pr_debug("dropping event %d\n", levent.event); if (iwcm_deref_id(cm_id_priv)) diff --git a/drivers/infiniband/hw/bnxt_re/ib_verbs.c b/drivers/infiniband/hw/bnxt_re/ib_verbs.c index e365fa8251c1..e2c93a50fe76 100644 --- a/drivers/infiniband/hw/bnxt_re/ib_verbs.c +++ b/drivers/infiniband/hw/bnxt_re/ib_verbs.c @@ -2112,7 +2112,7 @@ static int bnxt_re_build_send_wqe(struct bnxt_re_qp *qp, break; case IB_WR_SEND_WITH_IMM: wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_IMM; - wqe->send.imm_data = wr->ex.imm_data; + wqe->send.imm_data = be32_to_cpu(wr->ex.imm_data); break; case IB_WR_SEND_WITH_INV: wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_INV; @@ -2142,7 +2142,7 @@ static int bnxt_re_build_rdma_wqe(const struct ib_send_wr *wr, break; case IB_WR_RDMA_WRITE_WITH_IMM: wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_WRITE_WITH_IMM; - wqe->rdma.imm_data = wr->ex.imm_data; + wqe->rdma.imm_data = be32_to_cpu(wr->ex.imm_data); break; case IB_WR_RDMA_READ: wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_READ; @@ -3110,7 +3110,7 @@ static void bnxt_re_process_res_shadow_qp_wc(struct bnxt_re_qp *qp, wc->byte_len = orig_cqe->length; wc->qp = &qp1_qp->ib_qp; - wc->ex.imm_data = orig_cqe->immdata; + wc->ex.imm_data = cpu_to_be32(le32_to_cpu(orig_cqe->immdata)); wc->src_qp = orig_cqe->src_qp; memcpy(wc->smac, orig_cqe->smac, ETH_ALEN); if (bnxt_re_is_vlan_pkt(orig_cqe, &vlan_id, &sl)) { @@ -3231,7 +3231,7 @@ int bnxt_re_poll_cq(struct ib_cq *ib_cq, int num_entries, struct ib_wc *wc) continue; } wc->qp = &qp->ib_qp; - wc->ex.imm_data = cqe->immdata; + wc->ex.imm_data = cpu_to_be32(le32_to_cpu(cqe->immdata)); wc->src_qp = cqe->src_qp; memcpy(wc->smac, cqe->smac, ETH_ALEN); wc->port_num = 1; diff --git a/drivers/infiniband/hw/bnxt_re/qplib_fp.h b/drivers/infiniband/hw/bnxt_re/qplib_fp.h index 72352ca80ace..d0b24e961511 100644 --- a/drivers/infiniband/hw/bnxt_re/qplib_fp.h +++ b/drivers/infiniband/hw/bnxt_re/qplib_fp.h @@ -145,7 +145,7 @@ struct bnxt_qplib_swqe { /* Send, with imm, inval key */ struct { union { - __be32 imm_data; + u32 imm_data; u32 inv_key; }; u32 q_key; @@ -163,7 +163,7 @@ struct bnxt_qplib_swqe { /* RDMA write, with imm, read */ struct { union { - __be32 imm_data; + u32 imm_data; u32 inv_key; }; u64 remote_va; @@ -349,7 +349,7 @@ struct bnxt_qplib_cqe { u32 length; u64 wr_id; union { - __be32 immdata; + __le32 immdata; u32 invrkey; }; u64 qp_handle; diff --git a/drivers/infiniband/hw/mlx4/alias_GUID.c b/drivers/infiniband/hw/mlx4/alias_GUID.c index baab9afa9174..f2d975c2659d 100644 --- a/drivers/infiniband/hw/mlx4/alias_GUID.c +++ b/drivers/infiniband/hw/mlx4/alias_GUID.c @@ -832,7 +832,7 @@ void mlx4_ib_destroy_alias_guid_service(struct mlx4_ib_dev *dev) int mlx4_ib_init_alias_guid_service(struct mlx4_ib_dev *dev) { - char alias_wq_name[15]; + char alias_wq_name[22]; int ret = 0; int i, j; union ib_gid gid; diff --git a/drivers/infiniband/hw/mlx4/mad.c b/drivers/infiniband/hw/mlx4/mad.c index 418b9312fb2d..a034cb3fa7ca 100644 --- a/drivers/infiniband/hw/mlx4/mad.c +++ b/drivers/infiniband/hw/mlx4/mad.c @@ -2158,7 +2158,7 @@ static int mlx4_ib_alloc_demux_ctx(struct mlx4_ib_dev *dev, struct mlx4_ib_demux_ctx *ctx, int port) { - char name[12]; + char name[21]; int ret = 0; int i; diff --git a/drivers/infiniband/sw/rxe/rxe_req.c b/drivers/infiniband/sw/rxe/rxe_req.c index 4008ab2da052..aa57a9cb5388 100644 --- a/drivers/infiniband/sw/rxe/rxe_req.c +++ b/drivers/infiniband/sw/rxe/rxe_req.c @@ -390,7 +390,7 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp, int solicited; u16 pkey; u32 qp_num; - int ack_req; + int ack_req = 0; /* length from start of bth to end of icrc */ paylen = rxe_opcode[opcode].length + payload + pad + RXE_ICRC_SIZE; @@ -426,8 +426,9 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp, qp_num = (pkt->mask & RXE_DETH_MASK) ? ibwr->wr.ud.remote_qpn : qp->attr.dest_qp_num; - ack_req = ((pkt->mask & RXE_END_MASK) || - (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK)); + if (qp_type(qp) != IB_QPT_UD && qp_type(qp) != IB_QPT_UC) + ack_req = ((pkt->mask & RXE_END_MASK) || + (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK)); if (ack_req) qp->req.noack_pkts = 0; diff --git a/drivers/input/input-mt.c b/drivers/input/input-mt.c index 6c7326c93721..fd01c9306e66 100644 --- a/drivers/input/input-mt.c +++ b/drivers/input/input-mt.c @@ -48,6 +48,9 @@ int input_mt_init_slots(struct input_dev *dev, unsigned int num_slots, return 0; if (mt) return mt->num_slots != num_slots ? -EINVAL : 0; + /* Arbitrary limit for avoiding too large memory allocation. */ + if (num_slots > 1024) + return -EINVAL; mt = kzalloc(struct_size(mt, slots, num_slots), GFP_KERNEL); if (!mt) diff --git a/drivers/input/mouse/elan_i2c_core.c b/drivers/input/mouse/elan_i2c_core.c index cb0314acdfbd..c02be5bf4baf 100644 --- a/drivers/input/mouse/elan_i2c_core.c +++ b/drivers/input/mouse/elan_i2c_core.c @@ -1270,6 +1270,8 @@ static int __maybe_unused elan_suspend(struct device *dev) } err: + if (ret) + enable_irq(client->irq); mutex_unlock(&data->sysfs_mutex); return ret; } diff --git a/drivers/input/mouse/elantech.c b/drivers/input/mouse/elantech.c index 6759cab82a72..6f747c59cd65 100644 --- a/drivers/input/mouse/elantech.c +++ b/drivers/input/mouse/elantech.c @@ -1527,16 +1527,47 @@ static void elantech_disconnect(struct psmouse *psmouse) psmouse->private = NULL; } +/* + * Some hw_version 4 models fail to properly activate absolute mode on + * resume without going through disable/enable cycle. + */ +static const struct dmi_system_id elantech_needs_reenable[] = { +#if defined(CONFIG_DMI) && defined(CONFIG_X86) + { + /* Lenovo N24 */ + .matches = { + DMI_MATCH(DMI_SYS_VENDOR, "LENOVO"), + DMI_MATCH(DMI_PRODUCT_NAME, "81AF"), + }, + }, +#endif + { } +}; + /* * Put the touchpad back into absolute mode when reconnecting */ static int elantech_reconnect(struct psmouse *psmouse) { + int err; + psmouse_reset(psmouse); if (elantech_detect(psmouse, 0)) return -1; + if (dmi_check_system(elantech_needs_reenable)) { + err = ps2_command(&psmouse->ps2dev, NULL, PSMOUSE_CMD_DISABLE); + if (err) + psmouse_warn(psmouse, "failed to deactivate mouse on %s: %d\n", + psmouse->ps2dev.serio->phys, err); + + err = ps2_command(&psmouse->ps2dev, NULL, PSMOUSE_CMD_ENABLE); + if (err) + psmouse_warn(psmouse, "failed to reactivate mouse on %s: %d\n", + psmouse->ps2dev.serio->phys, err); + } + if (elantech_set_absolute_mode(psmouse)) { psmouse_err(psmouse, "failed to put touchpad back into absolute mode.\n"); diff --git a/drivers/input/touchscreen/silead.c b/drivers/input/touchscreen/silead.c index a787a6aefc69..78f08ca3f844 100644 --- a/drivers/input/touchscreen/silead.c +++ b/drivers/input/touchscreen/silead.c @@ -78,7 +78,6 @@ struct silead_ts_data { struct regulator_bulk_data regulators[2]; char fw_name[64]; struct touchscreen_properties prop; - u32 max_fingers; u32 chip_id; struct input_mt_pos pos[SILEAD_MAX_FINGERS]; int slots[SILEAD_MAX_FINGERS]; @@ -106,7 +105,7 @@ static int silead_ts_request_input_dev(struct silead_ts_data *data) input_set_abs_params(data->input, ABS_MT_POSITION_Y, 0, 4095, 0, 0); touchscreen_parse_properties(data->input, true, &data->prop); - input_mt_init_slots(data->input, data->max_fingers, + input_mt_init_slots(data->input, SILEAD_MAX_FINGERS, INPUT_MT_DIRECT | INPUT_MT_DROP_UNUSED | INPUT_MT_TRACK); @@ -153,10 +152,10 @@ static void silead_ts_read_data(struct i2c_client *client) return; } - if (buf[0] > data->max_fingers) { + if (buf[0] > SILEAD_MAX_FINGERS) { dev_warn(dev, "More touches reported then supported %d > %d\n", - buf[0], data->max_fingers); - buf[0] = data->max_fingers; + buf[0], SILEAD_MAX_FINGERS); + buf[0] = SILEAD_MAX_FINGERS; } touch_nr = 0; @@ -208,7 +207,6 @@ static void silead_ts_read_data(struct i2c_client *client) static int silead_ts_init(struct i2c_client *client) { - struct silead_ts_data *data = i2c_get_clientdata(client); int error; error = i2c_smbus_write_byte_data(client, SILEAD_REG_RESET, @@ -218,7 +216,7 @@ static int silead_ts_init(struct i2c_client *client) usleep_range(SILEAD_CMD_SLEEP_MIN, SILEAD_CMD_SLEEP_MAX); error = i2c_smbus_write_byte_data(client, SILEAD_REG_TOUCH_NR, - data->max_fingers); + SILEAD_MAX_FINGERS); if (error) goto i2c_write_err; usleep_range(SILEAD_CMD_SLEEP_MIN, SILEAD_CMD_SLEEP_MAX); @@ -445,13 +443,6 @@ static void silead_ts_read_props(struct i2c_client *client) const char *str; int error; - error = device_property_read_u32(dev, "silead,max-fingers", - &data->max_fingers); - if (error) { - dev_dbg(dev, "Max fingers read error %d\n", error); - data->max_fingers = 5; /* Most devices handle up-to 5 fingers */ - } - error = device_property_read_string(dev, "firmware-name", &str); if (!error) snprintf(data->fw_name, sizeof(data->fw_name), diff --git a/drivers/irqchip/irq-gic-v3-its.c b/drivers/irqchip/irq-gic-v3-its.c index 6b58194c1e34..2e0478e8be74 100644 --- a/drivers/irqchip/irq-gic-v3-its.c +++ b/drivers/irqchip/irq-gic-v3-its.c @@ -2958,8 +2958,6 @@ static int its_vpe_irq_domain_alloc(struct irq_domain *domain, unsigned int virq struct page *vprop_page; int base, nr_ids, i, err = 0; - BUG_ON(!vm); - bitmap = its_lpi_alloc(roundup_pow_of_two(nr_irqs), &base, &nr_ids); if (!bitmap) return -ENOMEM; diff --git a/drivers/irqchip/irq-mbigen.c b/drivers/irqchip/irq-mbigen.c index c98358be0bc8..19cf1239c7d3 100644 --- a/drivers/irqchip/irq-mbigen.c +++ b/drivers/irqchip/irq-mbigen.c @@ -75,6 +75,20 @@ struct mbigen_device { void __iomem *base; }; +static inline unsigned int get_mbigen_node_offset(unsigned int nid) +{ + unsigned int offset = nid * MBIGEN_NODE_OFFSET; + + /* + * To avoid touched clear register in unexpected way, we need to directly + * skip clear register when access to more than 10 mbigen nodes. + */ + if (nid >= (REG_MBIGEN_CLEAR_OFFSET / MBIGEN_NODE_OFFSET)) + offset += MBIGEN_NODE_OFFSET; + + return offset; +} + static inline unsigned int get_mbigen_vec_reg(irq_hw_number_t hwirq) { unsigned int nid, pin; @@ -83,8 +97,7 @@ static inline unsigned int get_mbigen_vec_reg(irq_hw_number_t hwirq) nid = hwirq / IRQS_PER_MBIGEN_NODE + 1; pin = hwirq % IRQS_PER_MBIGEN_NODE; - return pin * 4 + nid * MBIGEN_NODE_OFFSET - + REG_MBIGEN_VEC_OFFSET; + return pin * 4 + get_mbigen_node_offset(nid) + REG_MBIGEN_VEC_OFFSET; } static inline void get_mbigen_type_reg(irq_hw_number_t hwirq, @@ -99,8 +112,7 @@ static inline void get_mbigen_type_reg(irq_hw_number_t hwirq, *mask = 1 << (irq_ofst % 32); ofst = irq_ofst / 32 * 4; - *addr = ofst + nid * MBIGEN_NODE_OFFSET - + REG_MBIGEN_TYPE_OFFSET; + *addr = ofst + get_mbigen_node_offset(nid) + REG_MBIGEN_TYPE_OFFSET; } static inline void get_mbigen_clear_reg(irq_hw_number_t hwirq, diff --git a/drivers/isdn/hardware/mISDN/hfcmulti.c b/drivers/isdn/hardware/mISDN/hfcmulti.c index 60b3a4aabe6b..9010d5ca3cd5 100644 --- a/drivers/isdn/hardware/mISDN/hfcmulti.c +++ b/drivers/isdn/hardware/mISDN/hfcmulti.c @@ -1945,7 +1945,7 @@ hfcmulti_dtmf(struct hfc_multi *hc) static void hfcmulti_tx(struct hfc_multi *hc, int ch) { - int i, ii, temp, len = 0; + int i, ii, temp, tmp_len, len = 0; int Zspace, z1, z2; /* must be int for calculation */ int Fspace, f1, f2; u_char *d; @@ -2166,14 +2166,15 @@ next_frame: HFC_wait_nodebug(hc); } + tmp_len = (*sp)->len; dev_kfree_skb(*sp); /* check for next frame */ if (bch && get_next_bframe(bch)) { - len = (*sp)->len; + len = tmp_len; goto next_frame; } if (dch && get_next_dframe(dch)) { - len = (*sp)->len; + len = tmp_len; goto next_frame; } diff --git a/drivers/leds/led-triggers.c b/drivers/leds/led-triggers.c index 12e17a112044..f92865b00893 100644 --- a/drivers/leds/led-triggers.c +++ b/drivers/leds/led-triggers.c @@ -126,9 +126,9 @@ int led_trigger_set(struct led_classdev *led_cdev, struct led_trigger *trig) flags); cancel_work_sync(&led_cdev->set_brightness_work); led_stop_software_blink(led_cdev); + device_remove_groups(led_cdev->dev, led_cdev->trigger->groups); if (led_cdev->trigger->deactivate) led_cdev->trigger->deactivate(led_cdev); - device_remove_groups(led_cdev->dev, led_cdev->trigger->groups); led_cdev->trigger = NULL; led_cdev->trigger_data = NULL; led_cdev->activated = false; diff --git a/drivers/leds/leds-ss4200.c b/drivers/leds/leds-ss4200.c index a9db8674cd02..0e19fceb3769 100644 --- a/drivers/leds/leds-ss4200.c +++ b/drivers/leds/leds-ss4200.c @@ -368,8 +368,10 @@ static int ich7_lpc_probe(struct pci_dev *dev, nas_gpio_pci_dev = dev; status = pci_read_config_dword(dev, PMBASE, &g_pm_io_base); - if (status) + if (status) { + status = pcibios_err_to_errno(status); goto out; + } g_pm_io_base &= 0x00000ff80; status = pci_read_config_dword(dev, GPIO_CTRL, &gc); @@ -381,8 +383,9 @@ static int ich7_lpc_probe(struct pci_dev *dev, } status = pci_read_config_dword(dev, GPIO_BASE, &nas_gpio_io_base); - if (0 > status) { + if (status) { dev_info(&dev->dev, "Unable to read GPIOBASE.\n"); + status = pcibios_err_to_errno(status); goto out; } dev_dbg(&dev->dev, ": GPIOBASE = 0x%08x\n", nas_gpio_io_base); diff --git a/drivers/macintosh/therm_windtunnel.c b/drivers/macintosh/therm_windtunnel.c index a0d87ed9da69..63e99762a165 100644 --- a/drivers/macintosh/therm_windtunnel.c +++ b/drivers/macintosh/therm_windtunnel.c @@ -549,7 +549,7 @@ g4fan_exit( void ) platform_driver_unregister( &therm_of_driver ); if( x.of_dev ) - of_device_unregister( x.of_dev ); + of_platform_device_destroy(&x.of_dev->dev, NULL); } module_init(g4fan_init); diff --git a/drivers/md/dm-ioctl.c b/drivers/md/dm-ioctl.c index 9889cbc6478a..ca2b4f64c9ca 100644 --- a/drivers/md/dm-ioctl.c +++ b/drivers/md/dm-ioctl.c @@ -1039,8 +1039,26 @@ static int do_resume(struct dm_ioctl *param) suspend_flags &= ~DM_SUSPEND_LOCKFS_FLAG; if (param->flags & DM_NOFLUSH_FLAG) suspend_flags |= DM_SUSPEND_NOFLUSH_FLAG; - if (!dm_suspended_md(md)) - dm_suspend(md, suspend_flags); + if (!dm_suspended_md(md)) { + r = dm_suspend(md, suspend_flags); + if (r) { + down_write(&_hash_lock); + hc = dm_get_mdptr(md); + if (hc && !hc->new_map) { + hc->new_map = new_map; + new_map = NULL; + } else { + r = -ENXIO; + } + up_write(&_hash_lock); + if (new_map) { + dm_sync_table(md); + dm_table_destroy(new_map); + } + dm_put(md); + return r; + } + } old_map = dm_swap_table(md, new_map); if (IS_ERR(old_map)) { diff --git a/drivers/md/dm.c b/drivers/md/dm.c index b4291a9ae202..fb65d0fe9d32 100644 --- a/drivers/md/dm.c +++ b/drivers/md/dm.c @@ -2585,7 +2585,7 @@ static int dm_wait_for_completion(struct mapped_device *md, long task_state) break; if (signal_pending_state(task_state, current)) { - r = -EINTR; + r = -ERESTARTSYS; break; } diff --git a/drivers/md/md.c b/drivers/md/md.c index 68eb3220be1c..6f463eec60b4 100644 --- a/drivers/md/md.c +++ b/drivers/md/md.c @@ -7245,11 +7245,6 @@ static int md_ioctl(struct block_device *bdev, fmode_t mode, mddev = bdev->bd_disk->private_data; - if (!mddev) { - BUG(); - goto out; - } - /* Some actions do not requires the mutex */ switch (cmd) { case GET_ARRAY_INFO: diff --git a/drivers/md/persistent-data/dm-space-map-metadata.c b/drivers/md/persistent-data/dm-space-map-metadata.c index da439ac85796..25ce7fb7fd9d 100644 --- a/drivers/md/persistent-data/dm-space-map-metadata.c +++ b/drivers/md/persistent-data/dm-space-map-metadata.c @@ -275,7 +275,7 @@ static void sm_metadata_destroy(struct dm_space_map *sm) { struct sm_metadata *smm = container_of(sm, struct sm_metadata, sm); - kfree(smm); + kvfree(smm); } static int sm_metadata_get_nr_blocks(struct dm_space_map *sm, dm_block_t *count) @@ -759,7 +759,7 @@ struct dm_space_map *dm_sm_metadata_init(void) { struct sm_metadata *smm; - smm = kmalloc(sizeof(*smm), GFP_KERNEL); + smm = kvmalloc(sizeof(*smm), GFP_KERNEL); if (!smm) return ERR_PTR(-ENOMEM); diff --git a/drivers/md/raid5.c b/drivers/md/raid5.c index 4e125c84be49..0adcc67c1a12 100644 --- a/drivers/md/raid5.c +++ b/drivers/md/raid5.c @@ -5818,7 +5818,9 @@ static sector_t reshape_request(struct mddev *mddev, sector_t sector_nr, int *sk safepos = conf->reshape_safe; sector_div(safepos, data_disks); if (mddev->reshape_backwards) { - BUG_ON(writepos < reshape_sectors); + if (WARN_ON(writepos < reshape_sectors)) + return MaxSector; + writepos -= reshape_sectors; readpos += reshape_sectors; safepos += reshape_sectors; @@ -5836,14 +5838,18 @@ static sector_t reshape_request(struct mddev *mddev, sector_t sector_nr, int *sk * to set 'stripe_addr' which is where we will write to. */ if (mddev->reshape_backwards) { - BUG_ON(conf->reshape_progress == 0); + if (WARN_ON(conf->reshape_progress == 0)) + return MaxSector; + stripe_addr = writepos; - BUG_ON((mddev->dev_sectors & - ~((sector_t)reshape_sectors - 1)) - - reshape_sectors - stripe_addr - != sector_nr); + if (WARN_ON((mddev->dev_sectors & + ~((sector_t)reshape_sectors - 1)) - + reshape_sectors - stripe_addr != sector_nr)) + return MaxSector; } else { - BUG_ON(writepos != sector_nr + reshape_sectors); + if (WARN_ON(writepos != sector_nr + reshape_sectors)) + return MaxSector; + stripe_addr = sector_nr; } diff --git a/drivers/media/pci/cx23885/cx23885-video.c b/drivers/media/pci/cx23885/cx23885-video.c index 16564899f114..435a3c1c7e65 100644 --- a/drivers/media/pci/cx23885/cx23885-video.c +++ b/drivers/media/pci/cx23885/cx23885-video.c @@ -1297,6 +1297,10 @@ int cx23885_video_register(struct cx23885_dev *dev) /* register Video device */ dev->video_dev = cx23885_vdev_init(dev, dev->pci, &cx23885_video_template, "video"); + if (!dev->video_dev) { + err = -ENOMEM; + goto fail_unreg; + } dev->video_dev->queue = &dev->vb2_vidq; err = video_register_device(dev->video_dev, VFL_TYPE_GRABBER, video_nr[dev->nr]); @@ -1311,6 +1315,10 @@ int cx23885_video_register(struct cx23885_dev *dev) /* register VBI device */ dev->vbi_dev = cx23885_vdev_init(dev, dev->pci, &cx23885_vbi_template, "vbi"); + if (!dev->vbi_dev) { + err = -ENOMEM; + goto fail_unreg; + } dev->vbi_dev->queue = &dev->vb2_vbiq; err = video_register_device(dev->vbi_dev, VFL_TYPE_VBI, vbi_nr[dev->nr]); diff --git a/drivers/media/pci/saa7134/saa7134-dvb.c b/drivers/media/pci/saa7134/saa7134-dvb.c index 3025d38ddb2b..d710c00b4dc9 100644 --- a/drivers/media/pci/saa7134/saa7134-dvb.c +++ b/drivers/media/pci/saa7134/saa7134-dvb.c @@ -475,7 +475,9 @@ static int philips_europa_tuner_sleep(struct dvb_frontend *fe) /* switch the board to analog mode */ if (fe->ops.i2c_gate_ctrl) fe->ops.i2c_gate_ctrl(fe, 1); - i2c_transfer(&dev->i2c_adap, &analog_msg, 1); + if (i2c_transfer(&dev->i2c_adap, &analog_msg, 1) != 1) + return -EIO; + return 0; } @@ -1027,7 +1029,9 @@ static int md8800_set_voltage2(struct dvb_frontend *fe, else wbuf[1] = rbuf & 0xef; msg[0].len = 2; - i2c_transfer(&dev->i2c_adap, msg, 1); + if (i2c_transfer(&dev->i2c_adap, msg, 1) != 1) + return -EIO; + return 0; } diff --git a/drivers/media/platform/qcom/venus/vdec.c b/drivers/media/platform/qcom/venus/vdec.c index 177a1bf2b8e0..b156146676a3 100644 --- a/drivers/media/platform/qcom/venus/vdec.c +++ b/drivers/media/platform/qcom/venus/vdec.c @@ -1096,6 +1096,7 @@ static int vdec_close(struct file *file) { struct venus_inst *inst = to_inst(file); + cancel_work_sync(&inst->delayed_process_work); v4l2_m2m_ctx_release(inst->m2m_ctx); v4l2_m2m_release(inst->m2m_dev); vdec_ctrl_deinit(inst); diff --git a/drivers/media/platform/vsp1/vsp1_histo.c b/drivers/media/platform/vsp1/vsp1_histo.c index 5e15c8ff88d9..d1942163e650 100644 --- a/drivers/media/platform/vsp1/vsp1_histo.c +++ b/drivers/media/platform/vsp1/vsp1_histo.c @@ -36,9 +36,8 @@ struct vsp1_histogram_buffer * vsp1_histogram_buffer_get(struct vsp1_histogram *histo) { struct vsp1_histogram_buffer *buf = NULL; - unsigned long flags; - spin_lock_irqsave(&histo->irqlock, flags); + spin_lock(&histo->irqlock); if (list_empty(&histo->irqqueue)) goto done; @@ -49,7 +48,7 @@ vsp1_histogram_buffer_get(struct vsp1_histogram *histo) histo->readout = true; done: - spin_unlock_irqrestore(&histo->irqlock, flags); + spin_unlock(&histo->irqlock); return buf; } @@ -58,7 +57,6 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo, size_t size) { struct vsp1_pipeline *pipe = histo->entity.pipe; - unsigned long flags; /* * The pipeline pointer is guaranteed to be valid as this function is @@ -70,10 +68,10 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo, vb2_set_plane_payload(&buf->buf.vb2_buf, 0, size); vb2_buffer_done(&buf->buf.vb2_buf, VB2_BUF_STATE_DONE); - spin_lock_irqsave(&histo->irqlock, flags); + spin_lock(&histo->irqlock); histo->readout = false; wake_up(&histo->wait_queue); - spin_unlock_irqrestore(&histo->irqlock, flags); + spin_unlock(&histo->irqlock); } /* ----------------------------------------------------------------------------- @@ -124,11 +122,10 @@ static void histo_buffer_queue(struct vb2_buffer *vb) struct vb2_v4l2_buffer *vbuf = to_vb2_v4l2_buffer(vb); struct vsp1_histogram *histo = vb2_get_drv_priv(vb->vb2_queue); struct vsp1_histogram_buffer *buf = to_vsp1_histogram_buffer(vbuf); - unsigned long flags; - spin_lock_irqsave(&histo->irqlock, flags); + spin_lock_irq(&histo->irqlock); list_add_tail(&buf->queue, &histo->irqqueue); - spin_unlock_irqrestore(&histo->irqlock, flags); + spin_unlock_irq(&histo->irqlock); } static int histo_start_streaming(struct vb2_queue *vq, unsigned int count) @@ -140,9 +137,8 @@ static void histo_stop_streaming(struct vb2_queue *vq) { struct vsp1_histogram *histo = vb2_get_drv_priv(vq); struct vsp1_histogram_buffer *buffer; - unsigned long flags; - spin_lock_irqsave(&histo->irqlock, flags); + spin_lock_irq(&histo->irqlock); /* Remove all buffers from the IRQ queue. */ list_for_each_entry(buffer, &histo->irqqueue, queue) @@ -152,7 +148,7 @@ static void histo_stop_streaming(struct vb2_queue *vq) /* Wait for the buffer being read out (if any) to complete. */ wait_event_lock_irq(histo->wait_queue, !histo->readout, histo->irqlock); - spin_unlock_irqrestore(&histo->irqlock, flags); + spin_unlock_irq(&histo->irqlock); } static const struct vb2_ops histo_video_queue_qops = { diff --git a/drivers/media/platform/vsp1/vsp1_pipe.h b/drivers/media/platform/vsp1/vsp1_pipe.h index ae646c9ef337..15daf35bda21 100644 --- a/drivers/media/platform/vsp1/vsp1_pipe.h +++ b/drivers/media/platform/vsp1/vsp1_pipe.h @@ -73,7 +73,7 @@ struct vsp1_partition_window { * @wpf: The WPF partition window configuration */ struct vsp1_partition { - struct vsp1_partition_window rpf; + struct vsp1_partition_window rpf[VSP1_MAX_RPF]; struct vsp1_partition_window uds_sink; struct vsp1_partition_window uds_source; struct vsp1_partition_window sru; diff --git a/drivers/media/platform/vsp1/vsp1_rpf.c b/drivers/media/platform/vsp1/vsp1_rpf.c index abaf4dde3802..a61b86861c64 100644 --- a/drivers/media/platform/vsp1/vsp1_rpf.c +++ b/drivers/media/platform/vsp1/vsp1_rpf.c @@ -270,8 +270,8 @@ static void rpf_configure_partition(struct vsp1_entity *entity, * 'width' need to be adjusted. */ if (pipe->partitions > 1) { - crop.width = pipe->partition->rpf.width; - crop.left += pipe->partition->rpf.left; + crop.width = pipe->partition->rpf[rpf->entity.index].width; + crop.left += pipe->partition->rpf[rpf->entity.index].left; } if (pipe->interlaced) { @@ -326,7 +326,9 @@ static void rpf_partition(struct vsp1_entity *entity, unsigned int partition_idx, struct vsp1_partition_window *window) { - partition->rpf = *window; + struct vsp1_rwpf *rpf = to_rwpf(&entity->subdev); + + partition->rpf[rpf->entity.index] = *window; } static const struct vsp1_entity_operations rpf_entity_ops = { diff --git a/drivers/media/rc/imon.c b/drivers/media/rc/imon.c index 99bb7380ee0e..c78e1a4a10ec 100644 --- a/drivers/media/rc/imon.c +++ b/drivers/media/rc/imon.c @@ -1126,10 +1126,7 @@ static int imon_ir_change_protocol(struct rc_dev *rc, u64 *rc_proto) memcpy(ictx->usb_tx_buf, &ir_proto_packet, sizeof(ir_proto_packet)); - if (!mutex_is_locked(&ictx->lock)) { - unlock = true; - mutex_lock(&ictx->lock); - } + unlock = mutex_trylock(&ictx->lock); retval = send_packet(ictx); if (retval) diff --git a/drivers/media/usb/uvc/uvc_ctrl.c b/drivers/media/usb/uvc/uvc_ctrl.c index 138bdfa359b7..00adf89d5c0b 100644 --- a/drivers/media/usb/uvc/uvc_ctrl.c +++ b/drivers/media/usb/uvc/uvc_ctrl.c @@ -997,25 +997,55 @@ static s32 __uvc_ctrl_get_value(struct uvc_control_mapping *mapping, return value; } +static int __uvc_ctrl_load_cur(struct uvc_video_chain *chain, + struct uvc_control *ctrl) +{ + u8 *data; + int ret; + + if (ctrl->loaded) + return 0; + + data = uvc_ctrl_data(ctrl, UVC_CTRL_DATA_CURRENT); + + if ((ctrl->info.flags & UVC_CTRL_FLAG_GET_CUR) == 0) { + memset(data, 0, ctrl->info.size); + ctrl->loaded = 1; + + return 0; + } + + if (ctrl->entity->get_cur) + ret = ctrl->entity->get_cur(chain->dev, ctrl->entity, + ctrl->info.selector, data, + ctrl->info.size); + else + ret = uvc_query_ctrl(chain->dev, UVC_GET_CUR, + ctrl->entity->id, chain->dev->intfnum, + ctrl->info.selector, data, + ctrl->info.size); + + if (ret < 0) + return ret; + + ctrl->loaded = 1; + + return ret; +} + static int __uvc_ctrl_get(struct uvc_video_chain *chain, - struct uvc_control *ctrl, struct uvc_control_mapping *mapping, - s32 *value) + struct uvc_control *ctrl, + struct uvc_control_mapping *mapping, + s32 *value) { int ret; if ((ctrl->info.flags & UVC_CTRL_FLAG_GET_CUR) == 0) return -EACCES; - if (!ctrl->loaded) { - ret = uvc_query_ctrl(chain->dev, UVC_GET_CUR, ctrl->entity->id, - chain->dev->intfnum, ctrl->info.selector, - uvc_ctrl_data(ctrl, UVC_CTRL_DATA_CURRENT), - ctrl->info.size); - if (ret < 0) - return ret; - - ctrl->loaded = 1; - } + ret = __uvc_ctrl_load_cur(chain, ctrl); + if (ret < 0) + return ret; *value = __uvc_ctrl_get_value(mapping, uvc_ctrl_data(ctrl, UVC_CTRL_DATA_CURRENT)); @@ -1670,21 +1700,10 @@ int uvc_ctrl_set(struct uvc_fh *handle, * needs to be loaded from the device to perform the read-modify-write * operation. */ - if (!ctrl->loaded && (ctrl->info.size * 8) != mapping->size) { - if ((ctrl->info.flags & UVC_CTRL_FLAG_GET_CUR) == 0) { - memset(uvc_ctrl_data(ctrl, UVC_CTRL_DATA_CURRENT), - 0, ctrl->info.size); - } else { - ret = uvc_query_ctrl(chain->dev, UVC_GET_CUR, - ctrl->entity->id, chain->dev->intfnum, - ctrl->info.selector, - uvc_ctrl_data(ctrl, UVC_CTRL_DATA_CURRENT), - ctrl->info.size); - if (ret < 0) - return ret; - } - - ctrl->loaded = 1; + if ((ctrl->info.size * 8) != mapping->size) { + ret = __uvc_ctrl_load_cur(chain, ctrl); + if (ret < 0) + return ret; } /* Backup the current value in case we need to rollback later. */ @@ -1723,9 +1742,19 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev, if (data == NULL) return -ENOMEM; - ret = uvc_query_ctrl(dev, UVC_GET_INFO, ctrl->entity->id, dev->intfnum, - info->selector, data, 1); - if (!ret) + if (ctrl->entity->get_info) + ret = ctrl->entity->get_info(dev, ctrl->entity, + ctrl->info.selector, data); + else + ret = uvc_query_ctrl(dev, UVC_GET_INFO, ctrl->entity->id, + dev->intfnum, info->selector, data, 1); + + if (!ret) { + info->flags &= ~(UVC_CTRL_FLAG_GET_CUR | + UVC_CTRL_FLAG_SET_CUR | + UVC_CTRL_FLAG_AUTO_UPDATE | + UVC_CTRL_FLAG_ASYNCHRONOUS); + info->flags |= (data[0] & UVC_CONTROL_CAP_GET ? UVC_CTRL_FLAG_GET_CUR : 0) | (data[0] & UVC_CONTROL_CAP_SET ? @@ -1734,6 +1763,7 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev, UVC_CTRL_FLAG_AUTO_UPDATE : 0) | (data[0] & UVC_CONTROL_CAP_ASYNCHRONOUS ? UVC_CTRL_FLAG_ASYNCHRONOUS : 0); + } kfree(data); return ret; diff --git a/drivers/media/usb/uvc/uvc_video.c b/drivers/media/usb/uvc/uvc_video.c index 020d6272eae3..144356f5e61e 100644 --- a/drivers/media/usb/uvc/uvc_video.c +++ b/drivers/media/usb/uvc/uvc_video.c @@ -214,13 +214,13 @@ static void uvc_fixup_video_ctrl(struct uvc_streaming *stream, /* Compute a bandwidth estimation by multiplying the frame * size by the number of video frames per second, divide the * result by the number of USB frames (or micro-frames for - * high-speed devices) per second and add the UVC header size - * (assumed to be 12 bytes long). + * high- and super-speed devices) per second and add the UVC + * header size (assumed to be 12 bytes long). */ bandwidth = frame->wWidth * frame->wHeight / 8 * format->bpp; bandwidth *= 10000000 / interval + 1; bandwidth /= 1000; - if (stream->dev->udev->speed == USB_SPEED_HIGH) + if (stream->dev->udev->speed >= USB_SPEED_HIGH) bandwidth /= 8; bandwidth += 12; @@ -475,6 +475,7 @@ uvc_video_clock_decode(struct uvc_streaming *stream, struct uvc_buffer *buf, ktime_t time; u16 host_sof; u16 dev_sof; + u32 dev_stc; switch (data[1] & (UVC_STREAM_PTS | UVC_STREAM_SCR)) { case UVC_STREAM_PTS | UVC_STREAM_SCR: @@ -519,6 +520,34 @@ uvc_video_clock_decode(struct uvc_streaming *stream, struct uvc_buffer *buf, if (dev_sof == stream->clock.last_sof) return; + dev_stc = get_unaligned_le32(&data[header_size - 6]); + + /* + * STC (Source Time Clock) is the clock used by the camera. The UVC 1.5 + * standard states that it "must be captured when the first video data + * of a video frame is put on the USB bus". This is generally understood + * as requiring devices to clear the payload header's SCR bit before + * the first packet containing video data. + * + * Most vendors follow that interpretation, but some (namely SunplusIT + * on some devices) always set the `UVC_STREAM_SCR` bit, fill the SCR + * field with 0's,and expect that the driver only processes the SCR if + * there is data in the packet. + * + * Ignore all the hardware timestamp information if we haven't received + * any data for this frame yet, the packet contains no data, and both + * STC and SOF are zero. This heuristics should be safe on compliant + * devices. This should be safe with compliant devices, as in the very + * unlikely case where a UVC 1.1 device would send timing information + * only before the first packet containing data, and both STC and SOF + * happen to be zero for a particular frame, we would only miss one + * clock sample from many and the clock recovery algorithm wouldn't + * suffer from this condition. + */ + if (buf && buf->bytesused == 0 && len == header_size && + dev_stc == 0 && dev_sof == 0) + return; + stream->clock.last_sof = dev_sof; host_sof = usb_get_current_frame_number(stream->dev->udev); @@ -556,7 +585,7 @@ uvc_video_clock_decode(struct uvc_streaming *stream, struct uvc_buffer *buf, spin_lock_irqsave(&stream->clock.lock, flags); sample = &stream->clock.samples[stream->clock.head]; - sample->dev_stc = get_unaligned_le32(&data[header_size - 6]); + sample->dev_stc = dev_stc; sample->dev_sof = dev_sof; sample->host_sof = host_sof; sample->host_time = time; @@ -701,11 +730,11 @@ void uvc_video_clock_update(struct uvc_streaming *stream, unsigned long flags; u64 timestamp; u32 delta_stc; - u32 y1, y2; + u32 y1; u32 x1, x2; u32 mean; u32 sof; - u64 y; + u64 y, y2; if (!uvc_hw_timestamps_param) return; @@ -745,7 +774,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream, sof = y; uvc_trace(UVC_TRACE_CLOCK, "%s: PTS %u y %llu.%06llu SOF %u.%06llu " - "(x1 %u x2 %u y1 %u y2 %u SOF offset %u)\n", + "(x1 %u x2 %u y1 %u y2 %llu SOF offset %u)\n", stream->dev->name, buf->pts, y >> 16, div_u64((y & 0xffff) * 1000000, 65536), sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536), @@ -760,7 +789,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream, goto done; y1 = NSEC_PER_SEC; - y2 = (u32)ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1; + y2 = ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1; /* Interpolated and host SOF timestamps can wrap around at slightly * different times. Handle this by adding or removing 2048 to or from @@ -780,7 +809,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream, timestamp = ktime_to_ns(first->host_time) + y - y1; uvc_trace(UVC_TRACE_CLOCK, "%s: SOF %u.%06llu y %llu ts %llu " - "buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %u)\n", + "buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %llu)\n", stream->dev->name, sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536), y, timestamp, vbuf->vb2_buf.timestamp, diff --git a/drivers/media/usb/uvc/uvcvideo.h b/drivers/media/usb/uvc/uvcvideo.h index f335249c93da..cef621a73833 100644 --- a/drivers/media/usb/uvc/uvcvideo.h +++ b/drivers/media/usb/uvc/uvcvideo.h @@ -345,6 +345,11 @@ struct uvc_entity { u8 bNrInPins; u8 *baSourceID; + int (*get_info)(struct uvc_device *dev, struct uvc_entity *entity, + u8 cs, u8 *caps); + int (*get_cur)(struct uvc_device *dev, struct uvc_entity *entity, + u8 cs, void *data, u16 size); + unsigned int ncontrols; struct uvc_control *controls; }; diff --git a/drivers/mfd/omap-usb-tll.c b/drivers/mfd/omap-usb-tll.c index 446713dbee27..269eeccb963b 100644 --- a/drivers/mfd/omap-usb-tll.c +++ b/drivers/mfd/omap-usb-tll.c @@ -246,8 +246,7 @@ static int usbtll_omap_probe(struct platform_device *pdev) break; } - tll = devm_kzalloc(dev, sizeof(*tll) + sizeof(tll->ch_clk[nch]), - GFP_KERNEL); + tll = devm_kzalloc(dev, struct_size(tll, ch_clk, nch), GFP_KERNEL); if (!tll) { pm_runtime_put_sync(dev); pm_runtime_disable(dev); diff --git a/drivers/misc/mei/main.c b/drivers/misc/mei/main.c index 87281b3695e6..e87c2b13c381 100644 --- a/drivers/misc/mei/main.c +++ b/drivers/misc/mei/main.c @@ -271,7 +271,7 @@ static ssize_t mei_write(struct file *file, const char __user *ubuf, } if (!mei_cl_is_connected(cl)) { - cl_err(dev, cl, "is not connected"); + cl_dbg(dev, cl, "is not connected"); rets = -ENODEV; goto out; } diff --git a/drivers/mmc/core/mmc_test.c b/drivers/mmc/core/mmc_test.c index 4fd9ebf6d516..164b4e43050e 100644 --- a/drivers/mmc/core/mmc_test.c +++ b/drivers/mmc/core/mmc_test.c @@ -3101,21 +3101,21 @@ static ssize_t mtf_test_write(struct file *file, const char __user *buf, test->buffer = kzalloc(BUFFER_SIZE, GFP_KERNEL); #ifdef CONFIG_HIGHMEM test->highmem = alloc_pages(GFP_KERNEL | __GFP_HIGHMEM, BUFFER_ORDER); + if (!test->highmem) { + count = -ENOMEM; + goto free_test_buffer; + } #endif -#ifdef CONFIG_HIGHMEM - if (test->buffer && test->highmem) { -#else if (test->buffer) { -#endif mutex_lock(&mmc_test_lock); mmc_test_run(test, testcase); mutex_unlock(&mmc_test_lock); } #ifdef CONFIG_HIGHMEM - if (test->highmem) - __free_pages(test->highmem, BUFFER_ORDER); + __free_pages(test->highmem, BUFFER_ORDER); +free_test_buffer: #endif kfree(test->buffer); kfree(test); diff --git a/drivers/mmc/host/dw_mmc.c b/drivers/mmc/host/dw_mmc.c index 8570068c2be4..75355abe03c9 100644 --- a/drivers/mmc/host/dw_mmc.c +++ b/drivers/mmc/host/dw_mmc.c @@ -3205,6 +3205,10 @@ int dw_mci_probe(struct dw_mci *host) host->biu_clk = devm_clk_get(host->dev, "biu"); if (IS_ERR(host->biu_clk)) { dev_dbg(host->dev, "biu clock not available\n"); + ret = PTR_ERR(host->biu_clk); + if (ret == -EPROBE_DEFER) + return ret; + } else { ret = clk_prepare_enable(host->biu_clk); if (ret) { @@ -3216,6 +3220,10 @@ int dw_mci_probe(struct dw_mci *host) host->ciu_clk = devm_clk_get(host->dev, "ciu"); if (IS_ERR(host->ciu_clk)) { dev_dbg(host->dev, "ciu clock not available\n"); + ret = PTR_ERR(host->ciu_clk); + if (ret == -EPROBE_DEFER) + goto err_clk_biu; + host->bus_hz = host->pdata->bus_hz; } else { ret = clk_prepare_enable(host->ciu_clk); diff --git a/drivers/mtd/tests/Makefile b/drivers/mtd/tests/Makefile index 5de0378f90db..7dae831ee8b6 100644 --- a/drivers/mtd/tests/Makefile +++ b/drivers/mtd/tests/Makefile @@ -1,19 +1,19 @@ # SPDX-License-Identifier: GPL-2.0 -obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o -obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o -obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o -obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o -obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o -obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o -obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o -obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o -obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o +obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o mtd_test.o +obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o mtd_test.o -mtd_oobtest-objs := oobtest.o mtd_test.o -mtd_pagetest-objs := pagetest.o mtd_test.o -mtd_readtest-objs := readtest.o mtd_test.o -mtd_speedtest-objs := speedtest.o mtd_test.o -mtd_stresstest-objs := stresstest.o mtd_test.o -mtd_subpagetest-objs := subpagetest.o mtd_test.o -mtd_torturetest-objs := torturetest.o mtd_test.o -mtd_nandbiterrs-objs := nandbiterrs.o mtd_test.o +mtd_oobtest-objs := oobtest.o +mtd_pagetest-objs := pagetest.o +mtd_readtest-objs := readtest.o +mtd_speedtest-objs := speedtest.o +mtd_stresstest-objs := stresstest.o +mtd_subpagetest-objs := subpagetest.o +mtd_torturetest-objs := torturetest.o +mtd_nandbiterrs-objs := nandbiterrs.o diff --git a/drivers/mtd/tests/mtd_test.c b/drivers/mtd/tests/mtd_test.c index c84250beffdc..f391e0300cdc 100644 --- a/drivers/mtd/tests/mtd_test.c +++ b/drivers/mtd/tests/mtd_test.c @@ -25,6 +25,7 @@ int mtdtest_erase_eraseblock(struct mtd_info *mtd, unsigned int ebnum) return 0; } +EXPORT_SYMBOL_GPL(mtdtest_erase_eraseblock); static int is_block_bad(struct mtd_info *mtd, unsigned int ebnum) { @@ -57,6 +58,7 @@ int mtdtest_scan_for_bad_eraseblocks(struct mtd_info *mtd, unsigned char *bbt, return 0; } +EXPORT_SYMBOL_GPL(mtdtest_scan_for_bad_eraseblocks); int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt, unsigned int eb, int ebcnt) @@ -75,6 +77,7 @@ int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt, return 0; } +EXPORT_SYMBOL_GPL(mtdtest_erase_good_eraseblocks); int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf) { @@ -92,6 +95,7 @@ int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf) return err; } +EXPORT_SYMBOL_GPL(mtdtest_read); int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size, const void *buf) @@ -107,3 +111,8 @@ int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size, return err; } +EXPORT_SYMBOL_GPL(mtdtest_write); + +MODULE_LICENSE("GPL"); +MODULE_DESCRIPTION("MTD function test helpers"); +MODULE_AUTHOR("Akinobu Mita"); diff --git a/drivers/mtd/ubi/eba.c b/drivers/mtd/ubi/eba.c index fa6ff75459c6..655b87716586 100644 --- a/drivers/mtd/ubi/eba.c +++ b/drivers/mtd/ubi/eba.c @@ -1573,6 +1573,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap, GFP_KERNEL); if (!fm_eba[i]) { ret = -ENOMEM; + kfree(scan_eba[i]); goto out_free; } @@ -1608,7 +1609,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap, } out_free: - for (i = 0; i < num_volumes; i++) { + while (--i >= 0) { if (!ubi->volumes[i]) continue; diff --git a/drivers/net/bonding/bond_main.c b/drivers/net/bonding/bond_main.c index 79b36f1c50ae..f0c0da85ba4f 100644 --- a/drivers/net/bonding/bond_main.c +++ b/drivers/net/bonding/bond_main.c @@ -774,13 +774,10 @@ static struct slave *bond_find_best_slave(struct bonding *bond) return bestslave; } +/* must be called in RCU critical section or with RTNL held */ static bool bond_should_notify_peers(struct bonding *bond) { - struct slave *slave; - - rcu_read_lock(); - slave = rcu_dereference(bond->curr_active_slave); - rcu_read_unlock(); + struct slave *slave = rcu_dereference_rtnl(bond->curr_active_slave); if (!slave || !bond->send_peer_notif || !netif_carrier_ok(bond->dev) || diff --git a/drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c b/drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c index a8c7879095de..0d23d3c5624a 100644 --- a/drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c +++ b/drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c @@ -266,7 +266,7 @@ int kvaser_usb_send_cmd_async(struct kvaser_usb_net_priv *priv, void *cmd, } usb_free_urb(urb); - return 0; + return err; } int kvaser_usb_can_rx_over_error(struct net_device *netdev) diff --git a/drivers/net/dsa/vitesse-vsc73xx.c b/drivers/net/dsa/vitesse-vsc73xx.c index 34fefa015fd7..eaafb1c30c91 100644 --- a/drivers/net/dsa/vitesse-vsc73xx.c +++ b/drivers/net/dsa/vitesse-vsc73xx.c @@ -649,7 +649,7 @@ static int vsc73xx_phy_write(struct dsa_switch *ds, int phy, int regnum, return 0; } - cmd = (phy << 21) | (regnum << 16); + cmd = (phy << 21) | (regnum << 16) | val; ret = vsc73xx_write(vsc, VSC73XX_BLOCK_MII, 0, 1, cmd); if (ret) return ret; diff --git a/drivers/net/ethernet/brocade/bna/bna_types.h b/drivers/net/ethernet/brocade/bna/bna_types.h index c438d032e8bf..1af883c849ad 100644 --- a/drivers/net/ethernet/brocade/bna/bna_types.h +++ b/drivers/net/ethernet/brocade/bna/bna_types.h @@ -418,7 +418,7 @@ struct bna_ib { /* Tx object */ /* Tx datapath control structure */ -#define BNA_Q_NAME_SIZE 16 +#define BNA_Q_NAME_SIZE (IFNAMSIZ + 6) struct bna_tcb { /* Fast path */ void **sw_qpt; diff --git a/drivers/net/ethernet/brocade/bna/bnad.c b/drivers/net/ethernet/brocade/bna/bnad.c index 1e25c3b5f563..9773901ea690 100644 --- a/drivers/net/ethernet/brocade/bna/bnad.c +++ b/drivers/net/ethernet/brocade/bna/bnad.c @@ -1543,8 +1543,9 @@ bnad_tx_msix_register(struct bnad *bnad, struct bnad_tx_info *tx_info, for (i = 0; i < num_txqs; i++) { vector_num = tx_info->tcb[i]->intr_vector; - sprintf(tx_info->tcb[i]->name, "%s TXQ %d", bnad->netdev->name, - tx_id + tx_info->tcb[i]->id); + snprintf(tx_info->tcb[i]->name, BNA_Q_NAME_SIZE, "%s TXQ %d", + bnad->netdev->name, + tx_id + tx_info->tcb[i]->id); err = request_irq(bnad->msix_table[vector_num].vector, (irq_handler_t)bnad_msix_tx, 0, tx_info->tcb[i]->name, @@ -1594,9 +1595,9 @@ bnad_rx_msix_register(struct bnad *bnad, struct bnad_rx_info *rx_info, for (i = 0; i < num_rxps; i++) { vector_num = rx_info->rx_ctrl[i].ccb->intr_vector; - sprintf(rx_info->rx_ctrl[i].ccb->name, "%s CQ %d", - bnad->netdev->name, - rx_id + rx_info->rx_ctrl[i].ccb->id); + snprintf(rx_info->rx_ctrl[i].ccb->name, BNA_Q_NAME_SIZE, + "%s CQ %d", bnad->netdev->name, + rx_id + rx_info->rx_ctrl[i].ccb->id); err = request_irq(bnad->msix_table[vector_num].vector, (irq_handler_t)bnad_msix_rx, 0, rx_info->rx_ctrl[i].ccb->name, diff --git a/drivers/net/ethernet/chelsio/cxgb4/cxgb4_filter.c b/drivers/net/ethernet/chelsio/cxgb4/cxgb4_filter.c index 9160b44c68bb..8a845f316a45 100644 --- a/drivers/net/ethernet/chelsio/cxgb4/cxgb4_filter.c +++ b/drivers/net/ethernet/chelsio/cxgb4/cxgb4_filter.c @@ -940,7 +940,8 @@ static u64 hash_filter_ntuple(struct ch_filter_specification *fs, * in the Compressed Filter Tuple. */ if (tp->vlan_shift >= 0 && fs->mask.ivlan) - ntuple |= (FT_VLAN_VLD_F | fs->val.ivlan) << tp->vlan_shift; + ntuple |= (u64)(FT_VLAN_VLD_F | + fs->val.ivlan) << tp->vlan_shift; if (tp->port_shift >= 0 && fs->mask.iport) ntuple |= (u64)fs->val.iport << tp->port_shift; diff --git a/drivers/net/ethernet/freescale/fec_main.c b/drivers/net/ethernet/freescale/fec_main.c index 35593b41e6c1..29ef84b7c9cc 100644 --- a/drivers/net/ethernet/freescale/fec_main.c +++ b/drivers/net/ethernet/freescale/fec_main.c @@ -223,8 +223,8 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address"); #define PKT_MINBUF_SIZE 64 /* FEC receive acceleration */ -#define FEC_RACC_IPDIS (1 << 1) -#define FEC_RACC_PRODIS (1 << 2) +#define FEC_RACC_IPDIS BIT(1) +#define FEC_RACC_PRODIS BIT(2) #define FEC_RACC_SHIFT16 BIT(7) #define FEC_RACC_OPTIONS (FEC_RACC_IPDIS | FEC_RACC_PRODIS) @@ -253,8 +253,23 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address"); #define FEC_MMFR_TA (2 << 16) #define FEC_MMFR_DATA(v) (v & 0xffff) /* FEC ECR bits definition */ -#define FEC_ECR_MAGICEN (1 << 2) -#define FEC_ECR_SLEEP (1 << 3) +#define FEC_ECR_RESET BIT(0) +#define FEC_ECR_ETHEREN BIT(1) +#define FEC_ECR_MAGICEN BIT(2) +#define FEC_ECR_SLEEP BIT(3) +#define FEC_ECR_EN1588 BIT(4) +#define FEC_ECR_BYTESWP BIT(8) +/* FEC RCR bits definition */ +#define FEC_RCR_LOOP BIT(0) +#define FEC_RCR_HALFDPX BIT(1) +#define FEC_RCR_MII BIT(2) +#define FEC_RCR_PROMISC BIT(3) +#define FEC_RCR_BC_REJ BIT(4) +#define FEC_RCR_FLOWCTL BIT(5) +#define FEC_RCR_RMII BIT(8) +#define FEC_RCR_10BASET BIT(9) +/* TX WMARK bits */ +#define FEC_TXWMRK_STRFWD BIT(8) #define FEC_MII_TIMEOUT 30000 /* us */ @@ -950,7 +965,7 @@ fec_restart(struct net_device *ndev) u32 val; u32 temp_mac[2]; u32 rcntl = OPT_FRAME_SIZE | 0x04; - u32 ecntl = 0x2; /* ETHEREN */ + u32 ecntl = FEC_ECR_ETHEREN; /* Whack a reset. We should wait for this. * For i.MX6SX SOC, enet use AXI bus, we use disable MAC @@ -1026,18 +1041,18 @@ fec_restart(struct net_device *ndev) fep->phy_interface == PHY_INTERFACE_MODE_RGMII_TXID) rcntl |= (1 << 6); else if (fep->phy_interface == PHY_INTERFACE_MODE_RMII) - rcntl |= (1 << 8); + rcntl |= FEC_RCR_RMII; else - rcntl &= ~(1 << 8); + rcntl &= ~FEC_RCR_RMII; /* 1G, 100M or 10M */ if (ndev->phydev) { if (ndev->phydev->speed == SPEED_1000) ecntl |= (1 << 5); else if (ndev->phydev->speed == SPEED_100) - rcntl &= ~(1 << 9); + rcntl &= ~FEC_RCR_10BASET; else - rcntl |= (1 << 9); + rcntl |= FEC_RCR_10BASET; } } else { #ifdef FEC_MIIGSK_ENR @@ -1096,13 +1111,13 @@ fec_restart(struct net_device *ndev) if (fep->quirks & FEC_QUIRK_ENET_MAC) { /* enable ENET endian swap */ - ecntl |= (1 << 8); + ecntl |= FEC_ECR_BYTESWP; /* enable ENET store and forward mode */ - writel(1 << 8, fep->hwp + FEC_X_WMRK); + writel(FEC_TXWMRK_STRFWD, fep->hwp + FEC_X_WMRK); } if (fep->bufdesc_ex) - ecntl |= (1 << 4); + ecntl |= FEC_ECR_EN1588; #ifndef CONFIG_M5272 /* Enable the MIB statistic event counters */ @@ -1149,7 +1164,7 @@ static void fec_stop(struct net_device *ndev) { struct fec_enet_private *fep = netdev_priv(ndev); - u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & (1 << 8); + u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & FEC_RCR_RMII; u32 val; /* We cannot expect a graceful transmit stop without link !!! */ @@ -1168,7 +1183,7 @@ fec_stop(struct net_device *ndev) if (fep->quirks & FEC_QUIRK_HAS_AVB) { writel(0, fep->hwp + FEC_ECNTRL); } else { - writel(1, fep->hwp + FEC_ECNTRL); + writel(FEC_ECR_RESET, fep->hwp + FEC_ECNTRL); udelay(10); } writel(FEC_DEFAULT_IMASK, fep->hwp + FEC_IMASK); @@ -1184,11 +1199,16 @@ fec_stop(struct net_device *ndev) /* We have to keep ENET enabled to have MII interrupt stay working */ if (fep->quirks & FEC_QUIRK_ENET_MAC && !(fep->wol_flag & FEC_WOL_FLAG_SLEEP_ON)) { - writel(2, fep->hwp + FEC_ECNTRL); + writel(FEC_ECR_ETHEREN, fep->hwp + FEC_ECNTRL); writel(rmii_mode, fep->hwp + FEC_R_CNTRL); } -} + if (fep->bufdesc_ex) { + val = readl(fep->hwp + FEC_ECNTRL); + val |= FEC_ECR_EN1588; + writel(val, fep->hwp + FEC_ECNTRL); + } +} static void fec_timeout(struct net_device *ndev) diff --git a/drivers/net/ethernet/freescale/fec_ptp.c b/drivers/net/ethernet/freescale/fec_ptp.c index abf0b6cddf20..a5d693f51d2b 100644 --- a/drivers/net/ethernet/freescale/fec_ptp.c +++ b/drivers/net/ethernet/freescale/fec_ptp.c @@ -635,6 +635,9 @@ void fec_ptp_stop(struct platform_device *pdev) struct net_device *ndev = platform_get_drvdata(pdev); struct fec_enet_private *fep = netdev_priv(ndev); + if (fep->pps_enable) + fec_ptp_enable_pps(fep, 0); + cancel_delayed_work_sync(&fep->time_keep); if (fep->ptp_clock) ptp_clock_unregister(fep->ptp_clock); diff --git a/drivers/net/ethernet/i825xx/sun3_82586.c b/drivers/net/ethernet/i825xx/sun3_82586.c index 1a86184d44c0..e0c9fee4e1e6 100644 --- a/drivers/net/ethernet/i825xx/sun3_82586.c +++ b/drivers/net/ethernet/i825xx/sun3_82586.c @@ -990,7 +990,7 @@ static void sun3_82586_timeout(struct net_device *dev) { #ifdef DEBUG printk("%s: xmitter timed out, try to restart! stat: %02x\n",dev->name,p->scb->cus); - printk("%s: command-stats: %04x %04x\n",dev->name,swab16(p->xmit_cmds[0]->cmd_status),swab16(p->xmit_cmds[1]->cmd_status)); + printk("%s: command-stats: %04x\n", dev->name, swab16(p->xmit_cmds[0]->cmd_status)); printk("%s: check, whether you set the right interrupt number!\n",dev->name); #endif sun3_82586_close(dev); diff --git a/drivers/net/ethernet/intel/ice/ice_common.c b/drivers/net/ethernet/intel/ice/ice_common.c index f8d00263d901..72a6f22ee423 100644 --- a/drivers/net/ethernet/intel/ice/ice_common.c +++ b/drivers/net/ethernet/intel/ice/ice_common.c @@ -7,16 +7,16 @@ #define ICE_PF_RESET_WAIT_COUNT 200 -#define ICE_NIC_FLX_ENTRY(hw, mdid, idx) \ - wr32((hw), GLFLXP_RXDID_FLX_WRD_##idx(ICE_RXDID_FLEX_NIC), \ +#define ICE_PROG_FLEX_ENTRY(hw, rxdid, mdid, idx) \ + wr32((hw), GLFLXP_RXDID_FLX_WRD_##idx(rxdid), \ ((ICE_RX_OPC_MDID << \ GLFLXP_RXDID_FLX_WRD_##idx##_RXDID_OPCODE_S) & \ GLFLXP_RXDID_FLX_WRD_##idx##_RXDID_OPCODE_M) | \ (((mdid) << GLFLXP_RXDID_FLX_WRD_##idx##_PROT_MDID_S) & \ GLFLXP_RXDID_FLX_WRD_##idx##_PROT_MDID_M)) -#define ICE_NIC_FLX_FLG_ENTRY(hw, flg_0, flg_1, flg_2, flg_3, idx) \ - wr32((hw), GLFLXP_RXDID_FLAGS(ICE_RXDID_FLEX_NIC, idx), \ +#define ICE_PROG_FLG_ENTRY(hw, rxdid, flg_0, flg_1, flg_2, flg_3, idx) \ + wr32((hw), GLFLXP_RXDID_FLAGS(rxdid, idx), \ (((flg_0) << GLFLXP_RXDID_FLAGS_FLEXIFLAG_4N_S) & \ GLFLXP_RXDID_FLAGS_FLEXIFLAG_4N_M) | \ (((flg_1) << GLFLXP_RXDID_FLAGS_FLEXIFLAG_4N_1_S) & \ @@ -290,30 +290,85 @@ ice_aq_get_link_info(struct ice_port_info *pi, bool ena_lse, } /** - * ice_init_flex_parser - initialize rx flex parser + * ice_init_flex_flags * @hw: pointer to the hardware structure + * @prof_id: Rx Descriptor Builder profile ID * - * Function to initialize flex descriptors + * Function to initialize Rx flex flags */ -static void ice_init_flex_parser(struct ice_hw *hw) +static void ice_init_flex_flags(struct ice_hw *hw, enum ice_rxdid prof_id) { u8 idx = 0; - ICE_NIC_FLX_ENTRY(hw, ICE_RX_MDID_HASH_LOW, 0); - ICE_NIC_FLX_ENTRY(hw, ICE_RX_MDID_HASH_HIGH, 1); - ICE_NIC_FLX_ENTRY(hw, ICE_RX_MDID_FLOW_ID_LOWER, 2); - ICE_NIC_FLX_ENTRY(hw, ICE_RX_MDID_FLOW_ID_HIGH, 3); - ICE_NIC_FLX_FLG_ENTRY(hw, ICE_RXFLG_PKT_FRG, ICE_RXFLG_UDP_GRE, - ICE_RXFLG_PKT_DSI, ICE_RXFLG_FIN, idx++); - ICE_NIC_FLX_FLG_ENTRY(hw, ICE_RXFLG_SYN, ICE_RXFLG_RST, - ICE_RXFLG_PKT_DSI, ICE_RXFLG_PKT_DSI, idx++); - ICE_NIC_FLX_FLG_ENTRY(hw, ICE_RXFLG_PKT_DSI, ICE_RXFLG_PKT_DSI, - ICE_RXFLG_EVLAN_x8100, ICE_RXFLG_EVLAN_x9100, - idx++); - ICE_NIC_FLX_FLG_ENTRY(hw, ICE_RXFLG_VLAN_x8100, ICE_RXFLG_TNL_VLAN, - ICE_RXFLG_TNL_MAC, ICE_RXFLG_TNL0, idx++); - ICE_NIC_FLX_FLG_ENTRY(hw, ICE_RXFLG_TNL1, ICE_RXFLG_TNL2, - ICE_RXFLG_PKT_DSI, ICE_RXFLG_PKT_DSI, idx); + /* Flex-flag fields (0-2) are programmed with FLG64 bits with layout: + * flexiflags0[5:0] - TCP flags, is_packet_fragmented, is_packet_UDP_GRE + * flexiflags1[3:0] - Not used for flag programming + * flexiflags2[7:0] - Tunnel and VLAN types + * 2 invalid fields in last index + */ + switch (prof_id) { + /* Rx flex flags are currently programmed for the NIC profiles only. + * Different flag bit programming configurations can be added per + * profile as needed. + */ + case ICE_RXDID_FLEX_NIC: + case ICE_RXDID_FLEX_NIC_2: + ICE_PROG_FLG_ENTRY(hw, prof_id, ICE_RXFLG_PKT_FRG, + ICE_RXFLG_UDP_GRE, ICE_RXFLG_PKT_DSI, + ICE_RXFLG_FIN, idx++); + /* flex flag 1 is not used for flexi-flag programming, skipping + * these four FLG64 bits. + */ + ICE_PROG_FLG_ENTRY(hw, prof_id, ICE_RXFLG_SYN, ICE_RXFLG_RST, + ICE_RXFLG_PKT_DSI, ICE_RXFLG_PKT_DSI, idx++); + ICE_PROG_FLG_ENTRY(hw, prof_id, ICE_RXFLG_PKT_DSI, + ICE_RXFLG_PKT_DSI, ICE_RXFLG_EVLAN_x8100, + ICE_RXFLG_EVLAN_x9100, idx++); + ICE_PROG_FLG_ENTRY(hw, prof_id, ICE_RXFLG_VLAN_x8100, + ICE_RXFLG_TNL_VLAN, ICE_RXFLG_TNL_MAC, + ICE_RXFLG_TNL0, idx++); + ICE_PROG_FLG_ENTRY(hw, prof_id, ICE_RXFLG_TNL1, ICE_RXFLG_TNL2, + ICE_RXFLG_PKT_DSI, ICE_RXFLG_PKT_DSI, idx); + break; + + default: + ice_debug(hw, ICE_DBG_INIT, + "Flag programming for profile ID %d not supported\n", + prof_id); + } +} + +/** + * ice_init_flex_flds + * @hw: pointer to the hardware structure + * @prof_id: Rx Descriptor Builder profile ID + * + * Function to initialize flex descriptors + */ +static void ice_init_flex_flds(struct ice_hw *hw, enum ice_rxdid prof_id) +{ + enum ice_flex_rx_mdid mdid; + + switch (prof_id) { + case ICE_RXDID_FLEX_NIC: + case ICE_RXDID_FLEX_NIC_2: + ICE_PROG_FLEX_ENTRY(hw, prof_id, ICE_RX_MDID_HASH_LOW, 0); + ICE_PROG_FLEX_ENTRY(hw, prof_id, ICE_RX_MDID_HASH_HIGH, 1); + ICE_PROG_FLEX_ENTRY(hw, prof_id, ICE_RX_MDID_FLOW_ID_LOWER, 2); + + mdid = (prof_id == ICE_RXDID_FLEX_NIC_2) ? + ICE_RX_MDID_SRC_VSI : ICE_RX_MDID_FLOW_ID_HIGH; + + ICE_PROG_FLEX_ENTRY(hw, prof_id, mdid, 3); + + ice_init_flex_flags(hw, prof_id); + break; + + default: + ice_debug(hw, ICE_DBG_INIT, + "Field init for profile ID %d not supported\n", + prof_id); + } } /** @@ -494,7 +549,8 @@ enum ice_status ice_init_hw(struct ice_hw *hw) if (status) goto err_unroll_fltr_mgmt_struct; - ice_init_flex_parser(hw); + ice_init_flex_flds(hw, ICE_RXDID_FLEX_NIC); + ice_init_flex_flds(hw, ICE_RXDID_FLEX_NIC_2); return 0; diff --git a/drivers/net/ethernet/intel/ice/ice_lan_tx_rx.h b/drivers/net/ethernet/intel/ice/ice_lan_tx_rx.h index 068dbc740b76..94504023d86e 100644 --- a/drivers/net/ethernet/intel/ice/ice_lan_tx_rx.h +++ b/drivers/net/ethernet/intel/ice/ice_lan_tx_rx.h @@ -188,23 +188,25 @@ struct ice_32b_rx_flex_desc_nic { * with a specific metadata (profile 7 reserved for HW) */ enum ice_rxdid { - ICE_RXDID_START = 0, - ICE_RXDID_LEGACY_0 = ICE_RXDID_START, - ICE_RXDID_LEGACY_1, - ICE_RXDID_FLX_START, - ICE_RXDID_FLEX_NIC = ICE_RXDID_FLX_START, - ICE_RXDID_FLX_LAST = 63, - ICE_RXDID_LAST = ICE_RXDID_FLX_LAST + ICE_RXDID_LEGACY_0 = 0, + ICE_RXDID_LEGACY_1 = 1, + ICE_RXDID_FLEX_NIC = 2, + ICE_RXDID_FLEX_NIC_2 = 6, + ICE_RXDID_HW = 7, + ICE_RXDID_LAST = 63, }; /* Receive Flex Descriptor Rx opcode values */ #define ICE_RX_OPC_MDID 0x01 /* Receive Descriptor MDID values */ -#define ICE_RX_MDID_FLOW_ID_LOWER 5 -#define ICE_RX_MDID_FLOW_ID_HIGH 6 -#define ICE_RX_MDID_HASH_LOW 56 -#define ICE_RX_MDID_HASH_HIGH 57 +enum ice_flex_rx_mdid { + ICE_RX_MDID_FLOW_ID_LOWER = 5, + ICE_RX_MDID_FLOW_ID_HIGH, + ICE_RX_MDID_SRC_VSI = 19, + ICE_RX_MDID_HASH_LOW = 56, + ICE_RX_MDID_HASH_HIGH, +}; /* Rx Flag64 packet flag bits */ enum ice_rx_flg64_bits { diff --git a/drivers/net/ethernet/mellanox/mlx5/core/en_fs_ethtool.c b/drivers/net/ethernet/mellanox/mlx5/core/en_fs_ethtool.c index 41cde926cdab..48ae9c201af4 100644 --- a/drivers/net/ethernet/mellanox/mlx5/core/en_fs_ethtool.c +++ b/drivers/net/ethernet/mellanox/mlx5/core/en_fs_ethtool.c @@ -689,7 +689,7 @@ mlx5e_ethtool_flow_replace(struct mlx5e_priv *priv, if (num_tuples <= 0) { netdev_warn(priv->netdev, "%s: flow is not valid %d\n", __func__, num_tuples); - return num_tuples; + return num_tuples < 0 ? num_tuples : -EINVAL; } eth_ft = get_flow_table(priv, fs, num_tuples); diff --git a/drivers/net/ethernet/xilinx/xilinx_axienet_main.c b/drivers/net/ethernet/xilinx/xilinx_axienet_main.c index 299162a74939..71593b1a90e8 100644 --- a/drivers/net/ethernet/xilinx/xilinx_axienet_main.c +++ b/drivers/net/ethernet/xilinx/xilinx_axienet_main.c @@ -375,6 +375,10 @@ static void axienet_set_multicast_list(struct net_device *ndev) } else if (!netdev_mc_empty(ndev)) { struct netdev_hw_addr *ha; + reg = axienet_ior(lp, XAE_FMI_OFFSET); + reg &= ~XAE_FMI_PM_MASK; + axienet_iow(lp, XAE_FMI_OFFSET, reg); + i = 0; netdev_for_each_mc_addr(ha, ndev) { if (i >= XAE_MULTICAST_CAM_TABLE_NUM) diff --git a/drivers/net/gtp.c b/drivers/net/gtp.c index db97f2fa203c..733cafb0888f 100644 --- a/drivers/net/gtp.c +++ b/drivers/net/gtp.c @@ -577,6 +577,9 @@ static netdev_tx_t gtp_dev_xmit(struct sk_buff *skb, struct net_device *dev) if (skb_cow_head(skb, dev->needed_headroom)) goto tx_err; + if (!pskb_inet_may_pull(skb)) + goto tx_err; + skb_reset_inner_headers(skb); /* PDP context lookups in gtp_build_skb_*() need rcu read-side lock. */ @@ -809,7 +812,7 @@ static struct sock *gtp_encap_enable_socket(int fd, int type, sock = sockfd_lookup(fd, &err); if (!sock) { pr_debug("gtp socket fd=%d not found\n", fd); - return NULL; + return ERR_PTR(err); } sk = sock->sk; diff --git a/drivers/net/netconsole.c b/drivers/net/netconsole.c index be9aa368639f..dcfbe64c82bb 100644 --- a/drivers/net/netconsole.c +++ b/drivers/net/netconsole.c @@ -727,6 +727,7 @@ restart: /* rtnl_lock already held * we might sleep in __netpoll_cleanup() */ + nt->enabled = false; spin_unlock_irqrestore(&target_list_lock, flags); __netpoll_cleanup(&nt->np); @@ -734,7 +735,6 @@ restart: spin_lock_irqsave(&target_list_lock, flags); dev_put(nt->np.dev); nt->np.dev = NULL; - nt->enabled = false; stopped = true; netconsole_target_put(nt); goto restart; diff --git a/drivers/net/usb/qmi_wwan.c b/drivers/net/usb/qmi_wwan.c index 3e59b63b838f..881240d93956 100644 --- a/drivers/net/usb/qmi_wwan.c +++ b/drivers/net/usb/qmi_wwan.c @@ -241,6 +241,7 @@ static int qmimux_rx_fixup(struct usbnet *dev, struct sk_buff *skb) break; default: /* not ip - do not know what to do */ + kfree_skb(skbn); goto skip; } @@ -1337,6 +1338,8 @@ static const struct usb_device_id products[] = { {QMI_QUIRK_SET_DTR(0x1bc7, 0x1260, 2)}, /* Telit LE910Cx */ {QMI_QUIRK_SET_DTR(0x1bc7, 0x1261, 2)}, /* Telit LE910Cx */ {QMI_QUIRK_SET_DTR(0x1bc7, 0x1900, 1)}, /* Telit LN940 series */ + {QMI_QUIRK_SET_DTR(0x1bc7, 0x3000, 0)}, /* Telit FN912 series */ + {QMI_QUIRK_SET_DTR(0x1bc7, 0x3001, 0)}, /* Telit FN912 series */ {QMI_FIXED_INTF(0x1c9e, 0x9801, 3)}, /* Telewell TW-3G HSPA+ */ {QMI_FIXED_INTF(0x1c9e, 0x9803, 4)}, /* Telewell TW-3G HSPA+ */ {QMI_FIXED_INTF(0x1c9e, 0x9b01, 3)}, /* XS Stick W100-2 from 4G Systems */ diff --git a/drivers/net/usb/sr9700.c b/drivers/net/usb/sr9700.c index a0e5d066ac45..1f11c56ccd5c 100644 --- a/drivers/net/usb/sr9700.c +++ b/drivers/net/usb/sr9700.c @@ -178,6 +178,7 @@ static int sr_mdio_read(struct net_device *netdev, int phy_id, int loc) struct usbnet *dev = netdev_priv(netdev); __le16 res; int rc = 0; + int err; if (phy_id) { netdev_dbg(netdev, "Only internal phy supported\n"); @@ -188,11 +189,17 @@ static int sr_mdio_read(struct net_device *netdev, int phy_id, int loc) if (loc == MII_BMSR) { u8 value; - sr_read_reg(dev, SR_NSR, &value); + err = sr_read_reg(dev, SR_NSR, &value); + if (err < 0) + return err; + if (value & NSR_LINKST) rc = 1; } - sr_share_read_word(dev, 1, loc, &res); + err = sr_share_read_word(dev, 1, loc, &res); + if (err < 0) + return err; + if (rc == 1) res = le16_to_cpu(res) | BMSR_LSTATUS; else diff --git a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c index d532decc1538..071dee3c3ded 100644 --- a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c +++ b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c @@ -2638,7 +2638,6 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi, struct lcnphy_txgains cal_gains, temp_gains; u16 hash; - u8 band_idx; int j; u16 ncorr_override[5]; u16 syst_coeffs[] = { 0x0000, 0x0000, 0x0000, 0x0000, 0x0000, 0x0000, @@ -2670,6 +2669,9 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi, u16 *values_to_save; struct brcms_phy_lcnphy *pi_lcn = pi->u.pi_lcnphy; + if (WARN_ON(CHSPEC_IS5G(pi->radio_chanspec))) + return; + values_to_save = kmalloc_array(20, sizeof(u16), GFP_ATOMIC); if (NULL == values_to_save) return; @@ -2733,20 +2735,18 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi, hash = (target_gains->gm_gain << 8) | (target_gains->pga_gain << 4) | (target_gains->pad_gain); - band_idx = (CHSPEC_IS5G(pi->radio_chanspec) ? 1 : 0); - cal_gains = *target_gains; memset(ncorr_override, 0, sizeof(ncorr_override)); - for (j = 0; j < iqcal_gainparams_numgains_lcnphy[band_idx]; j++) { - if (hash == tbl_iqcal_gainparams_lcnphy[band_idx][j][0]) { + for (j = 0; j < iqcal_gainparams_numgains_lcnphy[0]; j++) { + if (hash == tbl_iqcal_gainparams_lcnphy[0][j][0]) { cal_gains.gm_gain = - tbl_iqcal_gainparams_lcnphy[band_idx][j][1]; + tbl_iqcal_gainparams_lcnphy[0][j][1]; cal_gains.pga_gain = - tbl_iqcal_gainparams_lcnphy[band_idx][j][2]; + tbl_iqcal_gainparams_lcnphy[0][j][2]; cal_gains.pad_gain = - tbl_iqcal_gainparams_lcnphy[band_idx][j][3]; + tbl_iqcal_gainparams_lcnphy[0][j][3]; memcpy(ncorr_override, - &tbl_iqcal_gainparams_lcnphy[band_idx][j][3], + &tbl_iqcal_gainparams_lcnphy[0][j][3], sizeof(ncorr_override)); break; } diff --git a/drivers/net/wireless/intel/iwlwifi/mvm/scan.c b/drivers/net/wireless/intel/iwlwifi/mvm/scan.c index 16b614cc16ab..eb2d235e9dc5 100644 --- a/drivers/net/wireless/intel/iwlwifi/mvm/scan.c +++ b/drivers/net/wireless/intel/iwlwifi/mvm/scan.c @@ -1993,7 +1993,7 @@ int iwl_mvm_scan_stop(struct iwl_mvm *mvm, int type, bool notify) if (!(mvm->scan_status & type)) return 0; - if (iwl_mvm_is_radio_killed(mvm)) { + if (!test_bit(STATUS_DEVICE_ENABLED, &mvm->trans->status)) { ret = 0; goto out; } diff --git a/drivers/net/wireless/marvell/mwifiex/cfg80211.c b/drivers/net/wireless/marvell/mwifiex/cfg80211.c index 1f660fce5ad0..0dbc0a14931f 100644 --- a/drivers/net/wireless/marvell/mwifiex/cfg80211.c +++ b/drivers/net/wireless/marvell/mwifiex/cfg80211.c @@ -934,6 +934,8 @@ mwifiex_init_new_priv_params(struct mwifiex_private *priv, return -EOPNOTSUPP; } + priv->bss_num = mwifiex_get_unused_bss_num(adapter, priv->bss_type); + spin_lock_irqsave(&adapter->main_proc_lock, flags); adapter->main_locked = false; spin_unlock_irqrestore(&adapter->main_proc_lock, flags); @@ -4292,11 +4294,27 @@ int mwifiex_register_cfg80211(struct mwifiex_adapter *adapter) if (ISSUPP_ADHOC_ENABLED(adapter->fw_cap_info)) wiphy->interface_modes |= BIT(NL80211_IFTYPE_ADHOC); - wiphy->bands[NL80211_BAND_2GHZ] = &mwifiex_band_2ghz; - if (adapter->config_bands & BAND_A) - wiphy->bands[NL80211_BAND_5GHZ] = &mwifiex_band_5ghz; - else + wiphy->bands[NL80211_BAND_2GHZ] = devm_kmemdup(adapter->dev, + &mwifiex_band_2ghz, + sizeof(mwifiex_band_2ghz), + GFP_KERNEL); + if (!wiphy->bands[NL80211_BAND_2GHZ]) { + ret = -ENOMEM; + goto err; + } + + if (adapter->config_bands & BAND_A) { + wiphy->bands[NL80211_BAND_5GHZ] = devm_kmemdup(adapter->dev, + &mwifiex_band_5ghz, + sizeof(mwifiex_band_5ghz), + GFP_KERNEL); + if (!wiphy->bands[NL80211_BAND_5GHZ]) { + ret = -ENOMEM; + goto err; + } + } else { wiphy->bands[NL80211_BAND_5GHZ] = NULL; + } if (adapter->drcs_enabled && ISSUPP_DRCS_ENABLED(adapter->fw_cap_info)) wiphy->iface_combinations = &mwifiex_iface_comb_ap_sta_drcs; @@ -4384,8 +4402,7 @@ int mwifiex_register_cfg80211(struct mwifiex_adapter *adapter) if (ret < 0) { mwifiex_dbg(adapter, ERROR, "%s: wiphy_register failed: %d\n", __func__, ret); - wiphy_free(wiphy); - return ret; + goto err; } if (!adapter->regd) { @@ -4427,4 +4444,9 @@ int mwifiex_register_cfg80211(struct mwifiex_adapter *adapter) adapter->wiphy = wiphy; return ret; + +err: + wiphy_free(wiphy); + + return ret; } diff --git a/drivers/net/wireless/st/cw1200/txrx.c b/drivers/net/wireless/st/cw1200/txrx.c index f7b1b0062db3..3ccb3a134599 100644 --- a/drivers/net/wireless/st/cw1200/txrx.c +++ b/drivers/net/wireless/st/cw1200/txrx.c @@ -1173,7 +1173,7 @@ void cw1200_rx_cb(struct cw1200_common *priv, size_t ies_len = skb->len - (ies - (u8 *)(skb->data)); tim_ie = cfg80211_find_ie(WLAN_EID_TIM, ies, ies_len); - if (tim_ie) { + if (tim_ie && tim_ie[1] >= sizeof(struct ieee80211_tim_ie)) { struct ieee80211_tim_ie *tim = (struct ieee80211_tim_ie *)&tim_ie[2]; diff --git a/drivers/nvme/host/pci.c b/drivers/nvme/host/pci.c index 163497ef48fd..a243c066d923 100644 --- a/drivers/nvme/host/pci.c +++ b/drivers/nvme/host/pci.c @@ -2481,6 +2481,13 @@ static unsigned long check_vendor_combination_bug(struct pci_dev *pdev) return NVME_QUIRK_NO_APST; } + /* + * NVMe SSD drops off the PCIe bus after system idle + * for 10 hours on a Lenovo N60z board. + */ + if (dmi_match(DMI_BOARD_NAME, "LXKT-ZXEG-N6")) + return NVME_QUIRK_NO_APST; + return 0; } diff --git a/drivers/nvme/target/rdma.c b/drivers/nvme/target/rdma.c index cfd26437aeae..7889a55156f4 100644 --- a/drivers/nvme/target/rdma.c +++ b/drivers/nvme/target/rdma.c @@ -435,12 +435,8 @@ nvmet_rdma_alloc_rsps(struct nvmet_rdma_queue *queue) return 0; out_free: - while (--i >= 0) { - struct nvmet_rdma_rsp *rsp = &queue->rsps[i]; - - list_del(&rsp->free_list); - nvmet_rdma_free_rsp(ndev, rsp); - } + while (--i >= 0) + nvmet_rdma_free_rsp(ndev, &queue->rsps[i]); kfree(queue->rsps); out: return ret; @@ -451,12 +447,8 @@ static void nvmet_rdma_free_rsps(struct nvmet_rdma_queue *queue) struct nvmet_rdma_device *ndev = queue->dev; int i, nr_rsps = queue->recv_queue_size * 2; - for (i = 0; i < nr_rsps; i++) { - struct nvmet_rdma_rsp *rsp = &queue->rsps[i]; - - list_del(&rsp->free_list); - nvmet_rdma_free_rsp(ndev, rsp); - } + for (i = 0; i < nr_rsps; i++) + nvmet_rdma_free_rsp(ndev, &queue->rsps[i]); kfree(queue->rsps); } diff --git a/drivers/parport/daisy.c b/drivers/parport/daisy.c index 5484a46dafda..465acebd6438 100644 --- a/drivers/parport/daisy.c +++ b/drivers/parport/daisy.c @@ -109,8 +109,7 @@ again: ((num_ports = num_mux_ports(port)) == 2 || num_ports == 4)) { /* Leave original as port zero. */ port->muxport = 0; - printk(KERN_INFO - "%s: 1st (default) port of %d-way multiplexor\n", + pr_info("%s: 1st (default) port of %d-way multiplexor\n", port->name, num_ports); for (i = 1; i < num_ports; i++) { /* Clone the port. */ @@ -123,8 +122,7 @@ again: continue; } - printk(KERN_INFO - "%s: %d%s port of %d-way multiplexor on %s\n", + pr_info("%s: %d%s port of %d-way multiplexor on %s\n", extra->name, i + 1, th[i + 1], num_ports, port->name); diff --git a/drivers/parport/ieee1284.c b/drivers/parport/ieee1284.c index f12b9da69255..d0d36c29ae56 100644 --- a/drivers/parport/ieee1284.c +++ b/drivers/parport/ieee1284.c @@ -329,7 +329,7 @@ int parport_negotiate (struct parport *port, int mode) #ifndef CONFIG_PARPORT_1284 if (mode == IEEE1284_MODE_COMPAT) return 0; - printk (KERN_ERR "parport: IEEE1284 not supported in this kernel\n"); + pr_err("parport: IEEE1284 not supported in this kernel\n"); return -1; #else int m = mode & ~IEEE1284_ADDR; @@ -694,7 +694,7 @@ ssize_t parport_write (struct parport *port, const void *buffer, size_t len) ssize_t parport_read (struct parport *port, void *buffer, size_t len) { #ifndef CONFIG_PARPORT_1284 - printk (KERN_ERR "parport: IEEE1284 not supported in this kernel\n"); + pr_err("parport: IEEE1284 not supported in this kernel\n"); return -ENODEV; #else int mode = port->physport->ieee1284.mode; diff --git a/drivers/parport/ieee1284_ops.c b/drivers/parport/ieee1284_ops.c index 75daa16f38b7..58ec484c7305 100644 --- a/drivers/parport/ieee1284_ops.c +++ b/drivers/parport/ieee1284_ops.c @@ -599,8 +599,7 @@ size_t parport_ieee1284_ecp_read_data (struct parport *port, DPRINTK (KERN_DEBUG "ECP read timed out at 45\n"); if (command) - printk (KERN_WARNING - "%s: command ignored (%02x)\n", + pr_warn("%s: command ignored (%02x)\n", port->name, byte); break; diff --git a/drivers/parport/parport_amiga.c b/drivers/parport/parport_amiga.c index 9c68f2aec4ff..75779725f638 100644 --- a/drivers/parport/parport_amiga.c +++ b/drivers/parport/parport_amiga.c @@ -211,7 +211,7 @@ static int __init amiga_parallel_probe(struct platform_device *pdev) if (err) goto out_irq; - printk(KERN_INFO "%s: Amiga built-in port using irq\n", p->name); + pr_info("%s: Amiga built-in port using irq\n", p->name); /* XXX: set operating mode */ parport_announce_port(p); diff --git a/drivers/parport/parport_atari.c b/drivers/parport/parport_atari.c index 9fbf6ccd54de..2f8c7f6617d7 100644 --- a/drivers/parport/parport_atari.c +++ b/drivers/parport/parport_atari.c @@ -199,7 +199,7 @@ static int __init parport_atari_init(void) } this_port = p; - printk(KERN_INFO "%s: Atari built-in port using irq\n", p->name); + pr_info("%s: Atari built-in port using irq\n", p->name); parport_announce_port (p); return 0; diff --git a/drivers/parport/parport_cs.c b/drivers/parport/parport_cs.c index e9b52e4a4648..755207ca155f 100644 --- a/drivers/parport/parport_cs.c +++ b/drivers/parport/parport_cs.c @@ -142,10 +142,8 @@ static int parport_config(struct pcmcia_device *link) link->irq, PARPORT_DMA_NONE, &link->dev, IRQF_SHARED); if (p == NULL) { - printk(KERN_NOTICE "parport_cs: parport_pc_probe_port() at " - "0x%3x, irq %u failed\n", - (unsigned int) link->resource[0]->start, - link->irq); + pr_notice("parport_cs: parport_pc_probe_port() at 0x%3x, irq %u failed\n", + (unsigned int)link->resource[0]->start, link->irq); goto failed; } diff --git a/drivers/parport/parport_gsc.c b/drivers/parport/parport_gsc.c index 190c0a7a1c52..467bc0ab95ec 100644 --- a/drivers/parport/parport_gsc.c +++ b/drivers/parport/parport_gsc.c @@ -287,7 +287,7 @@ struct parport *parport_gsc_probe_port(unsigned long base, p->size = (p->modes & PARPORT_MODE_EPP)?8:3; p->private_data = priv; - printk(KERN_INFO "%s: PC-style at 0x%lx", p->name, p->base); + pr_info("%s: PC-style at 0x%lx", p->name, p->base); p->irq = irq; if (p->irq == PARPORT_IRQ_AUTO) { p->irq = PARPORT_IRQ_NONE; @@ -304,12 +304,16 @@ struct parport *parport_gsc_probe_port(unsigned long base, p->dma = PARPORT_DMA_NONE; pr_cont(" ["); -#define printmode(x) {if(p->modes&PARPORT_MODE_##x){pr_cont("%s%s",f?",":"",#x);f++;}} +#define printmode(x) \ +do { \ + if (p->modes & PARPORT_MODE_##x) \ + pr_cont("%s%s", f++ ? "," : "", #x); \ +} while (0) { int f = 0; printmode(PCSPP); printmode(TRISTATE); - printmode(COMPAT) + printmode(COMPAT); printmode(EPP); // printmode(ECP); // printmode(DMA); @@ -320,8 +324,7 @@ struct parport *parport_gsc_probe_port(unsigned long base, if (p->irq != PARPORT_IRQ_NONE) { if (request_irq (p->irq, parport_irq_handler, 0, p->name, p)) { - printk (KERN_WARNING "%s: irq %d in use, " - "resorting to polled operation\n", + pr_warn("%s: irq %d in use, resorting to polled operation\n", p->name, p->irq); p->irq = PARPORT_IRQ_NONE; p->dma = PARPORT_DMA_NONE; @@ -352,7 +355,7 @@ static int __init parport_init_chip(struct parisc_device *dev) unsigned long port; if (!dev->irq) { - printk(KERN_WARNING "IRQ not found for parallel device at 0x%llx\n", + pr_warn("IRQ not found for parallel device at 0x%llx\n", (unsigned long long)dev->hpa.start); return -ENODEV; } diff --git a/drivers/parport/parport_ip32.c b/drivers/parport/parport_ip32.c index 62873070f988..c92523b6a3cb 100644 --- a/drivers/parport/parport_ip32.c +++ b/drivers/parport/parport_ip32.c @@ -1348,9 +1348,8 @@ static unsigned int parport_ip32_fwp_wait_interrupt(struct parport *p) ecr = parport_ip32_read_econtrol(p); if ((ecr & ECR_F_EMPTY) && !(ecr & ECR_SERVINTR) && !lost_interrupt) { - printk(KERN_WARNING PPIP32 - "%s: lost interrupt in %s\n", - p->name, __func__); + pr_warn(PPIP32 "%s: lost interrupt in %s\n", + p->name, __func__); lost_interrupt = 1; } } @@ -1654,8 +1653,8 @@ static size_t parport_ip32_compat_write_data(struct parport *p, DSR_nBUSY | DSR_nFAULT)) { /* Avoid to flood the logs */ if (ready_before) - printk(KERN_INFO PPIP32 "%s: not ready in %s\n", - p->name, __func__); + pr_info(PPIP32 "%s: not ready in %s\n", + p->name, __func__); ready_before = 0; goto stop; } @@ -1735,8 +1734,8 @@ static size_t parport_ip32_ecp_write_data(struct parport *p, DSR_nBUSY | DSR_nFAULT)) { /* Avoid to flood the logs */ if (ready_before) - printk(KERN_INFO PPIP32 "%s: not ready in %s\n", - p->name, __func__); + pr_info(PPIP32 "%s: not ready in %s\n", + p->name, __func__); ready_before = 0; goto stop; } @@ -2075,8 +2074,7 @@ static __init struct parport *parport_ip32_probe_port(void) p->modes |= PARPORT_MODE_TRISTATE; if (!parport_ip32_fifo_supported(p)) { - printk(KERN_WARNING PPIP32 - "%s: error: FIFO disabled\n", p->name); + pr_warn(PPIP32 "%s: error: FIFO disabled\n", p->name); /* Disable hardware modes depending on a working FIFO. */ features &= ~PARPORT_IP32_ENABLE_SPP; features &= ~PARPORT_IP32_ENABLE_ECP; @@ -2088,8 +2086,7 @@ static __init struct parport *parport_ip32_probe_port(void) if (features & PARPORT_IP32_ENABLE_IRQ) { int irq = MACEISA_PARALLEL_IRQ; if (request_irq(irq, parport_ip32_interrupt, 0, p->name, p)) { - printk(KERN_WARNING PPIP32 - "%s: error: IRQ disabled\n", p->name); + pr_warn(PPIP32 "%s: error: IRQ disabled\n", p->name); /* DMA cannot work without interrupts. */ features &= ~PARPORT_IP32_ENABLE_DMA; } else { @@ -2102,8 +2099,7 @@ static __init struct parport *parport_ip32_probe_port(void) /* Allocate DMA resources */ if (features & PARPORT_IP32_ENABLE_DMA) { if (parport_ip32_dma_register()) - printk(KERN_WARNING PPIP32 - "%s: error: DMA disabled\n", p->name); + pr_warn(PPIP32 "%s: error: DMA disabled\n", p->name); else { pr_probe(p, "DMA support enabled\n"); p->dma = 0; /* arbitrary value != PARPORT_DMA_NONE */ @@ -2145,8 +2141,7 @@ static __init struct parport *parport_ip32_probe_port(void) parport_ip32_dump_state(p, "end init", 0); /* Print out what we found */ - printk(KERN_INFO "%s: SGI IP32 at 0x%lx (0x%lx)", - p->name, p->base, p->base_hi); + pr_info("%s: SGI IP32 at 0x%lx (0x%lx)", p->name, p->base, p->base_hi); if (p->irq != PARPORT_IRQ_NONE) printk(", irq %d", p->irq); printk(" ["); diff --git a/drivers/parport/parport_mfc3.c b/drivers/parport/parport_mfc3.c index 7f4be0e484c7..378b6bce3ae7 100644 --- a/drivers/parport/parport_mfc3.c +++ b/drivers/parport/parport_mfc3.c @@ -324,7 +324,7 @@ static int __init parport_mfc3_init(void) p->dev = &z->dev; this_port[pias++] = p; - printk(KERN_INFO "%s: Multiface III port using irq\n", p->name); + pr_info("%s: Multiface III port using irq\n", p->name); /* XXX: set operating mode */ p->private_data = (void *)piabase; diff --git a/drivers/parport/parport_pc.c b/drivers/parport/parport_pc.c index c34ad5dd62e3..ad2acafb6850 100644 --- a/drivers/parport/parport_pc.c +++ b/drivers/parport/parport_pc.c @@ -981,28 +981,24 @@ static void show_parconfig_smsc37c669(int io, int key) outb(0xaa, io); if (verbose_probing) { - printk(KERN_INFO - "SMSC 37c669 LPT Config: cr_1=0x%02x, 4=0x%02x, " - "A=0x%2x, 23=0x%02x, 26=0x%02x, 27=0x%02x\n", + pr_info("SMSC 37c669 LPT Config: cr_1=0x%02x, 4=0x%02x, A=0x%2x, 23=0x%02x, 26=0x%02x, 27=0x%02x\n", cr1, cr4, cra, cr23, cr26, cr27); /* The documentation calls DMA and IRQ-Lines by letters, so the board maker can/will wire them appropriately/randomly... G=reserved H=IDE-irq, */ - printk(KERN_INFO - "SMSC LPT Config: io=0x%04x, irq=%c, dma=%c, fifo threshold=%d\n", - cr23 * 4, - (cr27 & 0x0f) ? 'A' - 1 + (cr27 & 0x0f) : '-', - (cr26 & 0x0f) ? 'A' - 1 + (cr26 & 0x0f) : '-', - cra & 0x0f); - printk(KERN_INFO "SMSC LPT Config: enabled=%s power=%s\n", - (cr23 * 4 >= 0x100) ? "yes" : "no", - (cr1 & 4) ? "yes" : "no"); - printk(KERN_INFO - "SMSC LPT Config: Port mode=%s, EPP version =%s\n", - (cr1 & 0x08) ? "Standard mode only (SPP)" - : modes[cr4 & 0x03], - (cr4 & 0x40) ? "1.7" : "1.9"); + pr_info("SMSC LPT Config: io=0x%04x, irq=%c, dma=%c, fifo threshold=%d\n", + cr23 * 4, + (cr27 & 0x0f) ? 'A' - 1 + (cr27 & 0x0f) : '-', + (cr26 & 0x0f) ? 'A' - 1 + (cr26 & 0x0f) : '-', + cra & 0x0f); + pr_info("SMSC LPT Config: enabled=%s power=%s\n", + (cr23 * 4 >= 0x100) ? "yes" : "no", + (cr1 & 4) ? "yes" : "no"); + pr_info("SMSC LPT Config: Port mode=%s, EPP version =%s\n", + (cr1 & 0x08) ? "Standard mode only (SPP)" + : modes[cr4 & 0x03], + (cr4 & 0x40) ? "1.7" : "1.9"); } /* Heuristics ! BIOS setup for this mainboard device limits @@ -1012,7 +1008,7 @@ static void show_parconfig_smsc37c669(int io, int key) if (cr23 * 4 >= 0x100) { /* if active */ s = find_free_superio(); if (s == NULL) - printk(KERN_INFO "Super-IO: too many chips!\n"); + pr_info("Super-IO: too many chips!\n"); else { int d; switch (cr23 * 4) { @@ -1077,26 +1073,24 @@ static void show_parconfig_winbond(int io, int key) outb(0xaa, io); if (verbose_probing) { - printk(KERN_INFO - "Winbond LPT Config: cr_30=%02x 60,61=%02x%02x 70=%02x 74=%02x, f0=%02x\n", - cr30, cr60, cr61, cr70, cr74, crf0); - printk(KERN_INFO "Winbond LPT Config: active=%s, io=0x%02x%02x irq=%d, ", - (cr30 & 0x01) ? "yes" : "no", cr60, cr61, cr70 & 0x0f); + pr_info("Winbond LPT Config: cr_30=%02x 60,61=%02x%02x 70=%02x 74=%02x, f0=%02x\n", + cr30, cr60, cr61, cr70, cr74, crf0); + pr_info("Winbond LPT Config: active=%s, io=0x%02x%02x irq=%d, ", + (cr30 & 0x01) ? "yes" : "no", cr60, cr61, cr70 & 0x0f); if ((cr74 & 0x07) > 3) pr_cont("dma=none\n"); else pr_cont("dma=%d\n", cr74 & 0x07); - printk(KERN_INFO - "Winbond LPT Config: irqtype=%s, ECP fifo threshold=%d\n", - irqtypes[crf0>>7], (crf0>>3)&0x0f); - printk(KERN_INFO "Winbond LPT Config: Port mode=%s\n", - modes[crf0 & 0x07]); + pr_info("Winbond LPT Config: irqtype=%s, ECP fifo threshold=%d\n", + irqtypes[crf0 >> 7], (crf0 >> 3) & 0x0f); + pr_info("Winbond LPT Config: Port mode=%s\n", + modes[crf0 & 0x07]); } if (cr30 & 0x01) { /* the settings can be interrogated later ... */ s = find_free_superio(); if (s == NULL) - printk(KERN_INFO "Super-IO: too many chips!\n"); + pr_info("Super-IO: too many chips!\n"); else { s->io = (cr60 << 8) | cr61; s->irq = cr70 & 0x0f; @@ -1150,9 +1144,8 @@ static void decode_winbond(int efer, int key, int devid, int devrev, int oldid) progif = 0; if (verbose_probing) - printk(KERN_INFO "Winbond chip at EFER=0x%x key=0x%02x " - "devid=%02x devrev=%02x oldid=%02x type=%s\n", - efer, key, devid, devrev, oldid, type); + pr_info("Winbond chip at EFER=0x%x key=0x%02x devid=%02x devrev=%02x oldid=%02x type=%s\n", + efer, key, devid, devrev, oldid, type); if (progif == 2) show_parconfig_winbond(efer, key); @@ -1183,9 +1176,8 @@ static void decode_smsc(int efer, int key, int devid, int devrev) type = "37c666GT"; if (verbose_probing) - printk(KERN_INFO "SMSC chip at EFER=0x%x " - "key=0x%02x devid=%02x devrev=%02x type=%s\n", - efer, key, devid, devrev, type); + pr_info("SMSC chip at EFER=0x%x key=0x%02x devid=%02x devrev=%02x type=%s\n", + efer, key, devid, devrev, type); if (func) func(efer, key); @@ -1357,7 +1349,7 @@ static void detect_and_report_it87(void) dev |= inb(0x2f); if (dev == 0x8712 || dev == 0x8705 || dev == 0x8715 || dev == 0x8716 || dev == 0x8718 || dev == 0x8726) { - printk(KERN_INFO "IT%04X SuperIO detected.\n", dev); + pr_info("IT%04X SuperIO detected\n", dev); outb(0x07, 0x2E); /* Parallel Port */ outb(0x03, 0x2F); outb(0xF0, 0x2E); /* BOOT 0x80 off */ @@ -1444,8 +1436,8 @@ static int parport_SPP_supported(struct parport *pb) if (user_specified) /* That didn't work, but the user thinks there's a * port here. */ - printk(KERN_INFO "parport 0x%lx (WARNING): CTR: " - "wrote 0x%02x, read 0x%02x\n", pb->base, w, r); + pr_info("parport 0x%lx (WARNING): CTR: wrote 0x%02x, read 0x%02x\n", + pb->base, w, r); /* Try the data register. The data lines aren't tri-stated at * this stage, so we expect back what we wrote. */ @@ -1463,10 +1455,9 @@ static int parport_SPP_supported(struct parport *pb) if (user_specified) { /* Didn't work, but the user is convinced this is the * place. */ - printk(KERN_INFO "parport 0x%lx (WARNING): DATA: " - "wrote 0x%02x, read 0x%02x\n", pb->base, w, r); - printk(KERN_INFO "parport 0x%lx: You gave this address, " - "but there is probably no parallel port there!\n", + pr_info("parport 0x%lx (WARNING): DATA: wrote 0x%02x, read 0x%02x\n", + pb->base, w, r); + pr_info("parport 0x%lx: You gave this address, but there is probably no parallel port there!\n", pb->base); } @@ -1641,7 +1632,7 @@ static int parport_ECP_supported(struct parport *pb) if (i <= priv->fifo_depth) { if (verbose_probing) - printk(KERN_INFO "0x%lx: readIntrThreshold is %d\n", + pr_info("0x%lx: readIntrThreshold is %d\n", pb->base, i); } else /* Number of bytes we can read if we get an interrupt. */ @@ -1656,18 +1647,15 @@ static int parport_ECP_supported(struct parport *pb) switch (pword) { case 0: pword = 2; - printk(KERN_WARNING "0x%lx: Unsupported pword size!\n", - pb->base); + pr_warn("0x%lx: Unsupported pword size!\n", pb->base); break; case 2: pword = 4; - printk(KERN_WARNING "0x%lx: Unsupported pword size!\n", - pb->base); + pr_warn("0x%lx: Unsupported pword size!\n", pb->base); break; default: - printk(KERN_WARNING "0x%lx: Unknown implementation ID\n", - pb->base); - /* Assume 1 */ + pr_warn("0x%lx: Unknown implementation ID\n", pb->base); + /* Fall through - Assume 1 */ case 1: pword = 1; } @@ -2106,9 +2094,9 @@ struct parport *parport_pc_probe_port(unsigned long int base, p->size = (p->modes & PARPORT_MODE_EPP) ? 8 : 3; - printk(KERN_INFO "%s: PC-style at 0x%lx", p->name, p->base); + pr_info("%s: PC-style at 0x%lx", p->name, p->base); if (p->base_hi && priv->ecr) - printk(KERN_CONT " (0x%lx)", p->base_hi); + pr_cont(" (0x%lx)", p->base_hi); if (p->irq == PARPORT_IRQ_AUTO) { p->irq = PARPORT_IRQ_NONE; parport_irq_probe(p); @@ -2119,7 +2107,7 @@ struct parport *parport_pc_probe_port(unsigned long int base, p->irq = PARPORT_IRQ_NONE; } if (p->irq != PARPORT_IRQ_NONE) { - printk(KERN_CONT ", irq %d", p->irq); + pr_cont(", irq %d", p->irq); priv->ctr_writable |= 0x10; if (p->dma == PARPORT_DMA_AUTO) { @@ -2143,41 +2131,39 @@ struct parport *parport_pc_probe_port(unsigned long int base, /* p->ops->ecp_read_data = parport_pc_ecp_read_block_pio; */ #endif /* IEEE 1284 support */ if (p->dma != PARPORT_DMA_NONE) { - printk(KERN_CONT ", dma %d", p->dma); + pr_cont(", dma %d", p->dma); p->modes |= PARPORT_MODE_DMA; } else - printk(KERN_CONT ", using FIFO"); + pr_cont(", using FIFO"); } else /* We can't use the DMA channel after all. */ p->dma = PARPORT_DMA_NONE; #endif /* Allowed to use FIFO/DMA */ - printk(KERN_CONT " ["); + pr_cont(" ["); -#define printmode(x) \ - {\ - if (p->modes & PARPORT_MODE_##x) {\ - printk(KERN_CONT "%s%s", f ? "," : "", #x);\ - f++;\ - } \ - } +#define printmode(x) \ +do { \ + if (p->modes & PARPORT_MODE_##x) \ + pr_cont("%s%s", f++ ? "," : "", #x); \ +} while (0) { int f = 0; printmode(PCSPP); printmode(TRISTATE); - printmode(COMPAT) + printmode(COMPAT); printmode(EPP); printmode(ECP); printmode(DMA); } #undef printmode #ifndef CONFIG_PARPORT_1284 - printk(KERN_CONT "(,...)"); + pr_cont("(,...)"); #endif /* CONFIG_PARPORT_1284 */ - printk(KERN_CONT "]\n"); + pr_cont("]\n"); if (probedirq != PARPORT_IRQ_NONE) - printk(KERN_INFO "%s: irq %d detected\n", p->name, probedirq); + pr_info("%s: irq %d detected\n", p->name, probedirq); /* If No ECP release the ports grabbed above. */ if (ECR_res && (p->modes & PARPORT_MODE_ECP) == 0) { @@ -2192,8 +2178,7 @@ struct parport *parport_pc_probe_port(unsigned long int base, if (p->irq != PARPORT_IRQ_NONE) { if (request_irq(p->irq, parport_irq_handler, irqflags, p->name, p)) { - printk(KERN_WARNING "%s: irq %d in use, " - "resorting to polled operation\n", + pr_warn("%s: irq %d in use, resorting to polled operation\n", p->name, p->irq); p->irq = PARPORT_IRQ_NONE; p->dma = PARPORT_DMA_NONE; @@ -2203,8 +2188,7 @@ struct parport *parport_pc_probe_port(unsigned long int base, #ifdef HAS_DMA if (p->dma != PARPORT_DMA_NONE) { if (request_dma(p->dma, p->name)) { - printk(KERN_WARNING "%s: dma %d in use, " - "resorting to PIO operation\n", + pr_warn("%s: dma %d in use, resorting to PIO operation\n", p->name, p->dma); p->dma = PARPORT_DMA_NONE; } else { @@ -2214,9 +2198,7 @@ struct parport *parport_pc_probe_port(unsigned long int base, &priv->dma_handle, GFP_KERNEL); if (!priv->dma_buf) { - printk(KERN_WARNING "%s: " - "cannot get buffer for DMA, " - "resorting to PIO operation\n", + pr_warn("%s: cannot get buffer for DMA, resorting to PIO operation\n", p->name); free_dma(p->dma); p->dma = PARPORT_DMA_NONE; @@ -2329,7 +2311,7 @@ static int sio_ite_8872_probe(struct pci_dev *pdev, int autoirq, int autodma, } } if (i >= 5) { - printk(KERN_INFO "parport_pc: cannot find ITE8872 INTA\n"); + pr_info("parport_pc: cannot find ITE8872 INTA\n"); return 0; } @@ -2338,29 +2320,28 @@ static int sio_ite_8872_probe(struct pci_dev *pdev, int autoirq, int autodma, switch (type) { case 0x2: - printk(KERN_INFO "parport_pc: ITE8871 found (1P)\n"); + pr_info("parport_pc: ITE8871 found (1P)\n"); ite8872set = 0x64200000; break; case 0xa: - printk(KERN_INFO "parport_pc: ITE8875 found (1P)\n"); + pr_info("parport_pc: ITE8875 found (1P)\n"); ite8872set = 0x64200000; break; case 0xe: - printk(KERN_INFO "parport_pc: ITE8872 found (2S1P)\n"); + pr_info("parport_pc: ITE8872 found (2S1P)\n"); ite8872set = 0x64e00000; break; case 0x6: - printk(KERN_INFO "parport_pc: ITE8873 found (1S)\n"); + pr_info("parport_pc: ITE8873 found (1S)\n"); release_region(inta_addr[i], 32); return 0; case 0x8: - printk(KERN_INFO "parport_pc: ITE8874 found (2S)\n"); + pr_info("parport_pc: ITE8874 found (2S)\n"); release_region(inta_addr[i], 32); return 0; default: - printk(KERN_INFO "parport_pc: unknown ITE887x\n"); - printk(KERN_INFO "parport_pc: please mail 'lspci -nvv' " - "output to Rich.Liu@ite.com.tw\n"); + pr_info("parport_pc: unknown ITE887x\n"); + pr_info("parport_pc: please mail 'lspci -nvv' output to Rich.Liu@ite.com.tw\n"); release_region(inta_addr[i], 32); return 0; } @@ -2395,9 +2376,8 @@ static int sio_ite_8872_probe(struct pci_dev *pdev, int autoirq, int autodma, release_region(inta_addr[i], 32); if (parport_pc_probe_port(ite8872_lpt, ite8872_lpthi, irq, PARPORT_DMA_NONE, &pdev->dev, 0)) { - printk(KERN_INFO - "parport_pc: ITE 8872 parallel port: io=0x%X", - ite8872_lpt); + pr_info("parport_pc: ITE 8872 parallel port: io=0x%X", + ite8872_lpt); if (irq != PARPORT_IRQ_NONE) pr_cont(", irq=%d", irq); pr_cont("\n"); @@ -2524,7 +2504,7 @@ static int sio_via_probe(struct pci_dev *pdev, int autoirq, int autodma, pci_write_config_byte(pdev, via->via_pci_superio_config_reg, tmp); if (siofunc == VIA_FUNCTION_PARPORT_DISABLE) { - printk(KERN_INFO "parport_pc: VIA parallel port disabled in BIOS\n"); + pr_info("parport_pc: VIA parallel port disabled in BIOS\n"); return 0; } @@ -2557,9 +2537,8 @@ static int sio_via_probe(struct pci_dev *pdev, int autoirq, int autodma, case 0x278: port2 = 0x678; break; default: - printk(KERN_INFO - "parport_pc: Weird VIA parport base 0x%X, ignoring\n", - port1); + pr_info("parport_pc: Weird VIA parport base 0x%X, ignoring\n", + port1); return 0; } @@ -2578,8 +2557,7 @@ static int sio_via_probe(struct pci_dev *pdev, int autoirq, int autodma, /* finally, do the probe with values obtained */ if (parport_pc_probe_port(port1, port2, irq, dma, &pdev->dev, 0)) { - printk(KERN_INFO - "parport_pc: VIA parallel port: io=0x%X", port1); + pr_info("parport_pc: VIA parallel port: io=0x%X", port1); if (irq != PARPORT_IRQ_NONE) pr_cont(", irq=%d", irq); if (dma != PARPORT_DMA_NONE) @@ -2588,7 +2566,7 @@ static int sio_via_probe(struct pci_dev *pdev, int autoirq, int autodma, return 1; } - printk(KERN_WARNING "parport_pc: Strange, can't probe VIA parallel port: io=0x%X, irq=%d, dma=%d\n", + pr_warn("parport_pc: Strange, can't probe VIA parallel port: io=0x%X, irq=%d, dma=%d\n", port1, irq, dma); return 0; } @@ -3131,7 +3109,7 @@ static int __init parport_parse_param(const char *s, int *val, if (ep != s) *val = r; else { - printk(KERN_ERR "parport: bad specifier `%s'\n", s); + pr_err("parport: bad specifier `%s'\n", s); return -1; } } @@ -3221,10 +3199,7 @@ static int __init parse_parport_params(void) irqval[0] = val; break; default: - printk(KERN_WARNING - "parport_pc: irq specified " - "without base address. Use 'io=' " - "to specify one\n"); + pr_warn("parport_pc: irq specified without base address. Use 'io=' to specify one\n"); } if (dma[0] && !parport_parse_dma(dma[0], &val)) @@ -3234,10 +3209,7 @@ static int __init parse_parport_params(void) dmaval[0] = val; break; default: - printk(KERN_WARNING - "parport_pc: dma specified " - "without base address. Use 'io=' " - "to specify one\n"); + pr_warn("parport_pc: dma specified without base address. Use 'io=' to specify one\n"); } } return 0; @@ -3276,12 +3248,12 @@ static int __init parport_setup(char *str) val = simple_strtoul(str, &endptr, 0); if (endptr == str) { - printk(KERN_WARNING "parport=%s not understood\n", str); + pr_warn("parport=%s not understood\n", str); return 1; } if (parport_setup_ptr == PARPORT_PC_MAX_PORTS) { - printk(KERN_ERR "parport=%s ignored, too many ports\n", str); + pr_err("parport=%s ignored, too many ports\n", str); return 1; } diff --git a/drivers/parport/parport_sunbpp.c b/drivers/parport/parport_sunbpp.c index 8de329546b82..77671b7ad421 100644 --- a/drivers/parport/parport_sunbpp.c +++ b/drivers/parport/parport_sunbpp.c @@ -313,7 +313,7 @@ static int bpp_probe(struct platform_device *op) value_tcr &= ~P_TCR_DIR; sbus_writeb(value_tcr, ®s->p_tcr); - printk(KERN_INFO "%s: sunbpp at 0x%lx\n", p->name, p->base); + pr_info("%s: sunbpp at 0x%lx\n", p->name, p->base); dev_set_drvdata(&op->dev, p); diff --git a/drivers/parport/probe.c b/drivers/parport/probe.c index e035174ba205..650206c71875 100644 --- a/drivers/parport/probe.c +++ b/drivers/parport/probe.c @@ -38,7 +38,7 @@ static void pretty_print(struct parport *port, int device) { struct parport_device_info *info = &port->probe_info[device + 1]; - printk(KERN_INFO "%s", port->name); + pr_info("%s", port->name); if (device >= 0) printk (" (addr %d)", device); @@ -58,7 +58,7 @@ static void parse_data(struct parport *port, int device, char *str) struct parport_device_info *info = &port->probe_info[device + 1]; if (!txt) { - printk(KERN_WARNING "%s probe: memory squeeze\n", port->name); + pr_warn("%s probe: memory squeeze\n", port->name); return; } strcpy(txt, str); @@ -98,7 +98,8 @@ static void parse_data(struct parport *port, int device, char *str) goto rock_on; } } - printk(KERN_WARNING "%s probe: warning, class '%s' not understood.\n", port->name, sep); + pr_warn("%s probe: warning, class '%s' not understood\n", + port->name, sep); info->class = PARPORT_CLASS_OTHER; } else if (!strcmp(p, "CMD") || !strcmp(p, "COMMAND SET")) { diff --git a/drivers/parport/procfs.c b/drivers/parport/procfs.c index 48804049d697..595e23e6859b 100644 --- a/drivers/parport/procfs.c +++ b/drivers/parport/procfs.c @@ -51,12 +51,12 @@ static int do_active_device(struct ctl_table *table, int write, for (dev = port->devices; dev ; dev = dev->next) { if(dev == port->cad) { - len += sprintf(buffer, "%s\n", dev->name); + len += snprintf(buffer, sizeof(buffer), "%s\n", dev->name); } } if(!len) { - len += sprintf(buffer, "%s\n", "none"); + len += snprintf(buffer, sizeof(buffer), "%s\n", "none"); } if (len > *lenp) @@ -87,19 +87,19 @@ static int do_autoprobe(struct ctl_table *table, int write, } if ((str = info->class_name) != NULL) - len += sprintf (buffer + len, "CLASS:%s;\n", str); + len += snprintf (buffer + len, sizeof(buffer) - len, "CLASS:%s;\n", str); if ((str = info->model) != NULL) - len += sprintf (buffer + len, "MODEL:%s;\n", str); + len += snprintf (buffer + len, sizeof(buffer) - len, "MODEL:%s;\n", str); if ((str = info->mfr) != NULL) - len += sprintf (buffer + len, "MANUFACTURER:%s;\n", str); + len += snprintf (buffer + len, sizeof(buffer) - len, "MANUFACTURER:%s;\n", str); if ((str = info->description) != NULL) - len += sprintf (buffer + len, "DESCRIPTION:%s;\n", str); + len += snprintf (buffer + len, sizeof(buffer) - len, "DESCRIPTION:%s;\n", str); if ((str = info->cmdset) != NULL) - len += sprintf (buffer + len, "COMMAND SET:%s;\n", str); + len += snprintf (buffer + len, sizeof(buffer) - len, "COMMAND SET:%s;\n", str); if (len > *lenp) len = *lenp; @@ -117,7 +117,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write, size_t *lenp, loff_t *ppos) { struct parport *port = (struct parport *)table->extra1; - char buffer[20]; + char buffer[64]; int len = 0; if (*ppos) { @@ -128,7 +128,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write, if (write) /* permissions prevent this anyway */ return -EACCES; - len += sprintf (buffer, "%lu\t%lu\n", port->base, port->base_hi); + len += snprintf (buffer, sizeof(buffer), "%lu\t%lu\n", port->base, port->base_hi); if (len > *lenp) len = *lenp; @@ -156,7 +156,7 @@ static int do_hardware_irq(struct ctl_table *table, int write, if (write) /* permissions prevent this anyway */ return -EACCES; - len += sprintf (buffer, "%d\n", port->irq); + len += snprintf (buffer, sizeof(buffer), "%d\n", port->irq); if (len > *lenp) len = *lenp; @@ -184,7 +184,7 @@ static int do_hardware_dma(struct ctl_table *table, int write, if (write) /* permissions prevent this anyway */ return -EACCES; - len += sprintf (buffer, "%d\n", port->dma); + len += snprintf (buffer, sizeof(buffer), "%d\n", port->dma); if (len > *lenp) len = *lenp; @@ -213,7 +213,11 @@ static int do_hardware_modes(struct ctl_table *table, int write, return -EACCES; { -#define printmode(x) {if(port->modes&PARPORT_MODE_##x){len+=sprintf(buffer+len,"%s%s",f?",":"",#x);f++;}} +#define printmode(x) \ +do { \ + if (port->modes & PARPORT_MODE_##x) \ + len += snprintf(buffer + len, sizeof(buffer) - len, "%s%s", f++ ? "," : "", #x); \ +} while (0) int f = 0; printmode(PCSPP); printmode(TRISTATE); diff --git a/drivers/parport/share.c b/drivers/parport/share.c index 15c81cffd2de..fc2930fb9bee 100644 --- a/drivers/parport/share.c +++ b/drivers/parport/share.c @@ -555,8 +555,8 @@ void parport_announce_port(struct parport *port) #endif if (!port->dev) - printk(KERN_WARNING "%s: fix this legacy no-device port driver!\n", - port->name); + pr_warn("%s: fix this legacy no-device port driver!\n", + port->name); parport_proc_register(port); mutex_lock(®istration_lock); @@ -728,7 +728,8 @@ parport_register_device(struct parport *port, const char *name, if (flags & PARPORT_DEV_LURK) { if (!pf || !kf) { - printk(KERN_INFO "%s: refused to register lurking device (%s) without callbacks\n", port->name, name); + pr_info("%s: refused to register lurking device (%s) without callbacks\n", + port->name, name); return NULL; } } @@ -997,7 +998,7 @@ void parport_unregister_device(struct pardevice *dev) #ifdef PARPORT_PARANOID if (!dev) { - printk(KERN_ERR "parport_unregister_device: passed NULL\n"); + pr_err("%s: passed NULL\n", __func__); return; } #endif @@ -1138,8 +1139,7 @@ int parport_claim(struct pardevice *dev) unsigned long flags; if (port->cad == dev) { - printk(KERN_INFO "%s: %s already owner\n", - dev->port->name,dev->name); + pr_info("%s: %s already owner\n", dev->port->name, dev->name); return 0; } @@ -1159,9 +1159,8 @@ int parport_claim(struct pardevice *dev) * I think we'll actually deadlock rather than * get here, but just in case.. */ - printk(KERN_WARNING - "%s: %s released port when preempted!\n", - port->name, oldcad->name); + pr_warn("%s: %s released port when preempted!\n", + port->name, oldcad->name); if (port->cad) goto blocked; } @@ -1321,8 +1320,8 @@ void parport_release(struct pardevice *dev) write_lock_irqsave(&port->cad_lock, flags); if (port->cad != dev) { write_unlock_irqrestore(&port->cad_lock, flags); - printk(KERN_WARNING "%s: %s tried to release parport when not owner\n", - port->name, dev->name); + pr_warn("%s: %s tried to release parport when not owner\n", + port->name, dev->name); return; } @@ -1362,7 +1361,8 @@ void parport_release(struct pardevice *dev) if (dev->port->cad) /* racy but no matter */ return; } else { - printk(KERN_ERR "%s: don't know how to wake %s\n", port->name, pd->name); + pr_err("%s: don't know how to wake %s\n", + port->name, pd->name); } } diff --git a/drivers/pci/controller/pci-hyperv.c b/drivers/pci/controller/pci-hyperv.c index f5f201bfc814..8adffefbee97 100644 --- a/drivers/pci/controller/pci-hyperv.c +++ b/drivers/pci/controller/pci-hyperv.c @@ -650,8 +650,8 @@ static void _hv_pcifront_read_config(struct hv_pci_dev *hpdev, int where, PCI_CAPABILITY_LIST) { /* ROM BARs are unimplemented */ *val = 0; - } else if (where >= PCI_INTERRUPT_LINE && where + size <= - PCI_INTERRUPT_PIN) { + } else if ((where >= PCI_INTERRUPT_LINE && where + size <= PCI_INTERRUPT_PIN) || + (where >= PCI_INTERRUPT_PIN && where + size <= PCI_MIN_GNT)) { /* * Interrupt Line and Interrupt PIN are hard-wired to zero * because this front-end only supports message-signaled diff --git a/drivers/pci/controller/pcie-rockchip.c b/drivers/pci/controller/pcie-rockchip.c index b047437605cb..6ab7ca0b9bf9 100644 --- a/drivers/pci/controller/pcie-rockchip.c +++ b/drivers/pci/controller/pcie-rockchip.c @@ -84,7 +84,7 @@ int rockchip_pcie_parse_dt(struct rockchip_pcie *rockchip) } rockchip->mgmt_sticky_rst = devm_reset_control_get_exclusive(dev, - "mgmt-sticky"); + "mgmt-sticky"); if (IS_ERR(rockchip->mgmt_sticky_rst)) { if (PTR_ERR(rockchip->mgmt_sticky_rst) != -EPROBE_DEFER) dev_err(dev, "missing mgmt-sticky reset property in node\n"); @@ -120,11 +120,11 @@ int rockchip_pcie_parse_dt(struct rockchip_pcie *rockchip) } if (rockchip->is_rc) { - rockchip->ep_gpio = devm_gpiod_get(dev, "ep", GPIOD_OUT_HIGH); - if (IS_ERR(rockchip->ep_gpio)) { - dev_err(dev, "missing ep-gpios property in node\n"); - return PTR_ERR(rockchip->ep_gpio); - } + rockchip->ep_gpio = devm_gpiod_get_optional(dev, "ep", + GPIOD_OUT_LOW); + if (IS_ERR(rockchip->ep_gpio)) + return dev_err_probe(dev, PTR_ERR(rockchip->ep_gpio), + "failed to get ep GPIO\n"); } rockchip->aclk_pcie = devm_clk_get(dev, "aclk"); diff --git a/drivers/pci/setup-bus.c b/drivers/pci/setup-bus.c index 8e5b00a420a5..07bae9b6af4f 100644 --- a/drivers/pci/setup-bus.c +++ b/drivers/pci/setup-bus.c @@ -811,6 +811,8 @@ static struct resource *find_free_bus_resource(struct pci_bus *bus, static resource_size_t calculate_iosize(resource_size_t size, resource_size_t min_size, resource_size_t size1, + resource_size_t add_size, + resource_size_t children_add_size, resource_size_t old_size, resource_size_t align) { @@ -823,15 +825,18 @@ static resource_size_t calculate_iosize(resource_size_t size, #if defined(CONFIG_ISA) || defined(CONFIG_EISA) size = (size & 0xff) + ((size & ~0xffUL) << 2); #endif - size = ALIGN(size + size1, align); + size = size + size1; if (size < old_size) size = old_size; + + size = ALIGN(max(size, add_size) + children_add_size, align); return size; } static resource_size_t calculate_memsize(resource_size_t size, resource_size_t min_size, - resource_size_t size1, + resource_size_t add_size, + resource_size_t children_add_size, resource_size_t old_size, resource_size_t align) { @@ -839,10 +844,9 @@ static resource_size_t calculate_memsize(resource_size_t size, size = min_size; if (old_size == 1) old_size = 0; - if (size < old_size) - size = old_size; - size = ALIGN(size + size1, align); - return size; + + size = max(size, add_size) + children_add_size; + return ALIGN(max(size, old_size), align); } resource_size_t __weak pcibios_window_alignment(struct pci_bus *bus, @@ -930,12 +934,10 @@ static void pbus_size_io(struct pci_bus *bus, resource_size_t min_size, } } - size0 = calculate_iosize(size, min_size, size1, + size0 = calculate_iosize(size, min_size, size1, 0, 0, resource_size(b_res), min_align); - if (children_add_size > add_size) - add_size = children_add_size; - size1 = (!realloc_head || (realloc_head && !add_size)) ? size0 : - calculate_iosize(size, min_size, add_size + size1, + size1 = (!realloc_head || (realloc_head && !add_size && !children_add_size)) ? size0 : + calculate_iosize(size, min_size, size1, add_size, children_add_size, resource_size(b_res), min_align); if (!size0 && !size1) { if (b_res->start || b_res->end) @@ -1079,12 +1081,10 @@ static int pbus_size_mem(struct pci_bus *bus, unsigned long mask, min_align = calculate_mem_align(aligns, max_order); min_align = max(min_align, window_alignment(bus, b_res->flags)); - size0 = calculate_memsize(size, min_size, 0, resource_size(b_res), min_align); + size0 = calculate_memsize(size, min_size, 0, 0, resource_size(b_res), min_align); add_align = max(min_align, add_align); - if (children_add_size > add_size) - add_size = children_add_size; - size1 = (!realloc_head || (realloc_head && !add_size)) ? size0 : - calculate_memsize(size, min_size, add_size, + size1 = (!realloc_head || (realloc_head && !add_size && !children_add_size)) ? size0 : + calculate_memsize(size, min_size, add_size, children_add_size, resource_size(b_res), add_align); if (!size0 && !size1) { if (b_res->start || b_res->end) diff --git a/drivers/pinctrl/core.c b/drivers/pinctrl/core.c index 97b1fa3a5e78..8c52bfac1cc2 100644 --- a/drivers/pinctrl/core.c +++ b/drivers/pinctrl/core.c @@ -1992,6 +1992,14 @@ out_err: return ERR_PTR(ret); } +static void pinctrl_uninit_controller(struct pinctrl_dev *pctldev, struct pinctrl_desc *pctldesc) +{ + pinctrl_free_pindescs(pctldev, pctldesc->pins, + pctldesc->npins); + mutex_destroy(&pctldev->mutex); + kfree(pctldev); +} + static int pinctrl_claim_hogs(struct pinctrl_dev *pctldev) { pctldev->p = create_pinctrl(pctldev->dev, pctldev); @@ -2072,8 +2080,10 @@ struct pinctrl_dev *pinctrl_register(struct pinctrl_desc *pctldesc, return pctldev; error = pinctrl_enable(pctldev); - if (error) + if (error) { + pinctrl_uninit_controller(pctldev, pctldesc); return ERR_PTR(error); + } return pctldev; diff --git a/drivers/pinctrl/freescale/pinctrl-mxs.c b/drivers/pinctrl/freescale/pinctrl-mxs.c index a612e46ca51c..c48b6fb5e8fe 100644 --- a/drivers/pinctrl/freescale/pinctrl-mxs.c +++ b/drivers/pinctrl/freescale/pinctrl-mxs.c @@ -405,8 +405,8 @@ static int mxs_pinctrl_probe_dt(struct platform_device *pdev, int ret; u32 val; - child = of_get_next_child(np, NULL); - if (!child) { + val = of_get_child_count(np); + if (val == 0) { dev_err(&pdev->dev, "no group is defined\n"); return -ENOENT; } diff --git a/drivers/pinctrl/pinctrl-single.c b/drivers/pinctrl/pinctrl-single.c index 4143cafbf7e7..86691841efc0 100644 --- a/drivers/pinctrl/pinctrl-single.c +++ b/drivers/pinctrl/pinctrl-single.c @@ -323,6 +323,8 @@ static int pcs_get_function(struct pinctrl_dev *pctldev, unsigned pin, return -ENOTSUPP; fselector = setting->func; function = pinmux_generic_get_function(pctldev, fselector); + if (!function) + return -EINVAL; *func = function->data; if (!(*func)) { dev_err(pcs->dev, "%s could not find function%i\n", @@ -1311,7 +1313,6 @@ static void pcs_irq_free(struct pcs_device *pcs) static void pcs_free_resources(struct pcs_device *pcs) { pcs_irq_free(pcs); - pinctrl_unregister(pcs->pctl); #if IS_BUILTIN(CONFIG_PINCTRL_SINGLE) if (pcs->missing_nr_pinctrl_cells) @@ -1864,7 +1865,7 @@ static int pcs_probe(struct platform_device *pdev) if (ret < 0) goto free; - ret = pinctrl_register_and_init(&pcs->desc, pcs->dev, pcs, &pcs->pctl); + ret = devm_pinctrl_register_and_init(pcs->dev, &pcs->desc, pcs, &pcs->pctl); if (ret) { dev_err(pcs->dev, "could not register single pinctrl driver\n"); goto free; @@ -1897,8 +1898,10 @@ static int pcs_probe(struct platform_device *pdev) dev_info(pcs->dev, "%i pins, size %u\n", pcs->desc.npins, pcs->size); - return pinctrl_enable(pcs->pctl); + if (pinctrl_enable(pcs->pctl)) + goto free; + return 0; free: pcs_free_resources(pcs); diff --git a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c index 4eda888b4d04..e86b765141a6 100644 --- a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c +++ b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c @@ -881,7 +881,7 @@ static int ti_iodelay_probe(struct platform_device *pdev) iod->desc.name = dev_name(dev); iod->desc.owner = THIS_MODULE; - ret = pinctrl_register_and_init(&iod->desc, dev, iod, &iod->pctl); + ret = devm_pinctrl_register_and_init(dev, &iod->desc, iod, &iod->pctl); if (ret) { dev_err(dev, "Failed to register pinctrl\n"); goto exit_out; @@ -889,7 +889,11 @@ static int ti_iodelay_probe(struct platform_device *pdev) platform_set_drvdata(pdev, iod); - return pinctrl_enable(iod->pctl); + ret = pinctrl_enable(iod->pctl); + if (ret) + goto exit_out; + + return 0; exit_out: of_node_put(np); @@ -906,12 +910,6 @@ static int ti_iodelay_remove(struct platform_device *pdev) { struct ti_iodelay_device *iod = platform_get_drvdata(pdev); - if (!iod) - return 0; - - if (iod->pctl) - pinctrl_unregister(iod->pctl); - ti_iodelay_pinconf_deinit_dev(iod); /* Expect other allocations to be freed by devm */ diff --git a/drivers/platform/chrome/cros_ec_debugfs.c b/drivers/platform/chrome/cros_ec_debugfs.c index c62ee8e610a0..5aed088371a7 100644 --- a/drivers/platform/chrome/cros_ec_debugfs.c +++ b/drivers/platform/chrome/cros_ec_debugfs.c @@ -292,6 +292,7 @@ static int ec_read_version_supported(struct cros_ec_dev *ec) if (!msg) return 0; + msg->version = 1; msg->command = EC_CMD_GET_CMD_VERSIONS + ec->cmd_offset; msg->outsize = sizeof(*params); msg->insize = sizeof(*response); diff --git a/drivers/platform/mips/cpu_hwmon.c b/drivers/platform/mips/cpu_hwmon.c index 98128374d710..7e8cb7d550da 100644 --- a/drivers/platform/mips/cpu_hwmon.c +++ b/drivers/platform/mips/cpu_hwmon.c @@ -164,6 +164,9 @@ static int __init loongson_hwmon_init(void) goto fail_hwmon_device_register; } + if (!csr_temp_enable && !loongson_chiptemp[0]) + return -ENODEV; + nr_packages = loongson_sysconf.nr_cpus / loongson_sysconf.cores_per_package; diff --git a/drivers/power/supply/axp288_charger.c b/drivers/power/supply/axp288_charger.c index 84106a9836c8..f6644afcbe86 100644 --- a/drivers/power/supply/axp288_charger.c +++ b/drivers/power/supply/axp288_charger.c @@ -175,18 +175,18 @@ static inline int axp288_charger_set_cv(struct axp288_chrg_info *info, int cv) u8 reg_val; int ret; - if (cv <= CV_4100MV) { - reg_val = CHRG_CCCV_CV_4100MV; - cv = CV_4100MV; - } else if (cv <= CV_4150MV) { - reg_val = CHRG_CCCV_CV_4150MV; - cv = CV_4150MV; - } else if (cv <= CV_4200MV) { - reg_val = CHRG_CCCV_CV_4200MV; - cv = CV_4200MV; - } else { + if (cv >= CV_4350MV) { reg_val = CHRG_CCCV_CV_4350MV; cv = CV_4350MV; + } else if (cv >= CV_4200MV) { + reg_val = CHRG_CCCV_CV_4200MV; + cv = CV_4200MV; + } else if (cv >= CV_4150MV) { + reg_val = CHRG_CCCV_CV_4150MV; + cv = CV_4150MV; + } else { + reg_val = CHRG_CCCV_CV_4100MV; + cv = CV_4100MV; } reg_val = reg_val << CHRG_CCCV_CV_BIT_POS; @@ -378,8 +378,8 @@ static int axp288_charger_usb_set_property(struct power_supply *psy, dev_warn(&info->pdev->dev, "set charge current failed\n"); break; case POWER_SUPPLY_PROP_CONSTANT_CHARGE_VOLTAGE: - scaled_val = min(val->intval, info->max_cv); - scaled_val = DIV_ROUND_CLOSEST(scaled_val, 1000); + scaled_val = DIV_ROUND_CLOSEST(val->intval, 1000); + scaled_val = min(scaled_val, info->max_cv); ret = axp288_charger_set_cv(info, scaled_val); if (ret < 0) dev_warn(&info->pdev->dev, "set charge voltage failed\n"); diff --git a/drivers/pwm/pwm-stm32.c b/drivers/pwm/pwm-stm32.c index ee7197b8e4ef..5325e804ca24 100644 --- a/drivers/pwm/pwm-stm32.c +++ b/drivers/pwm/pwm-stm32.c @@ -451,8 +451,9 @@ static int stm32_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm, enabled = pwm->state.enabled; - if (enabled && !state->enabled) { - stm32_pwm_disable(priv, pwm->hwpwm); + if (!state->enabled) { + if (enabled) + stm32_pwm_disable(priv, pwm->hwpwm); return 0; } diff --git a/drivers/remoteproc/imx_rproc.c b/drivers/remoteproc/imx_rproc.c index 54c07fd3f204..7597f09a3455 100644 --- a/drivers/remoteproc/imx_rproc.c +++ b/drivers/remoteproc/imx_rproc.c @@ -289,6 +289,11 @@ static int imx_rproc_addr_init(struct imx_rproc *priv, struct resource res; node = of_parse_phandle(np, "memory-region", a); + if (!node) + continue; + /* Not map vdevbuffer, vdevring region */ + if (!strncmp(node->name, "vdev", strlen("vdev"))) + continue; err = of_address_to_resource(node, 0, &res); if (err) { dev_err(dev, "unable to resolve memory region\n"); diff --git a/drivers/rtc/rtc-cmos.c b/drivers/rtc/rtc-cmos.c index 8545f0da57fe..245220c77188 100644 --- a/drivers/rtc/rtc-cmos.c +++ b/drivers/rtc/rtc-cmos.c @@ -601,11 +601,10 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val, size_t count) { unsigned char *buf = val; - int retval; off += NVRAM_OFFSET; spin_lock_irq(&rtc_lock); - for (retval = 0; count; count--, off++, retval++) { + for (; count; count--, off++) { if (off < 128) *buf++ = CMOS_READ(off); else if (can_bank2) @@ -615,7 +614,7 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val, } spin_unlock_irq(&rtc_lock); - return retval; + return count ? -EIO : 0; } static int cmos_nvram_write(void *priv, unsigned int off, void *val, @@ -623,7 +622,6 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val, { struct cmos_rtc *cmos = priv; unsigned char *buf = val; - int retval; /* NOTE: on at least PCs and Ataris, the boot firmware uses a * checksum on part of the NVRAM data. That's currently ignored @@ -632,7 +630,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val, */ off += NVRAM_OFFSET; spin_lock_irq(&rtc_lock); - for (retval = 0; count; count--, off++, retval++) { + for (; count; count--, off++) { /* don't trash RTC registers */ if (off == cmos->day_alrm || off == cmos->mon_alrm @@ -647,7 +645,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val, } spin_unlock_irq(&rtc_lock); - return retval; + return count ? -EIO : 0; } /*----------------------------------------------------------------*/ diff --git a/drivers/s390/char/sclp.c b/drivers/s390/char/sclp.c index e9aa71cdfc44..74df353d2244 100644 --- a/drivers/s390/char/sclp.c +++ b/drivers/s390/char/sclp.c @@ -1206,6 +1206,7 @@ sclp_init(void) fail_unregister_reboot_notifier: unregister_reboot_notifier(&sclp_reboot_notifier); fail_init_state_uninitialized: + list_del(&sclp_state_change_event.list); sclp_init_state = sclp_init_state_uninitialized; fail_unlock: spin_unlock_irqrestore(&sclp_lock, flags); diff --git a/drivers/s390/char/sclp_sd.c b/drivers/s390/char/sclp_sd.c index 1e244f78f192..64581433c334 100644 --- a/drivers/s390/char/sclp_sd.c +++ b/drivers/s390/char/sclp_sd.c @@ -319,8 +319,14 @@ static int sclp_sd_store_data(struct sclp_sd_data *result, u8 di) &esize); if (rc) { /* Cancel running request if interrupted */ - if (rc == -ERESTARTSYS) - sclp_sd_sync(page, SD_EQ_HALT, di, 0, 0, NULL, NULL); + if (rc == -ERESTARTSYS) { + if (sclp_sd_sync(page, SD_EQ_HALT, di, 0, 0, NULL, NULL)) { + pr_warn("Could not stop Store Data request - leaking at least %zu bytes\n", + (size_t)dsize * PAGE_SIZE); + data = NULL; + asce = 0; + } + } vfree(data); goto out; } diff --git a/drivers/s390/cio/idset.c b/drivers/s390/cio/idset.c index 835de44dbbcc..b98526d3ddfd 100644 --- a/drivers/s390/cio/idset.c +++ b/drivers/s390/cio/idset.c @@ -16,20 +16,21 @@ struct idset { unsigned long bitmap[0]; }; -static inline unsigned long bitmap_size(int num_ssid, int num_id) +static inline unsigned long idset_bitmap_size(int num_ssid, int num_id) { - return BITS_TO_LONGS(num_ssid * num_id) * sizeof(unsigned long); + return bitmap_size(size_mul(num_ssid, num_id)); } static struct idset *idset_new(int num_ssid, int num_id) { struct idset *set; - set = vmalloc(sizeof(struct idset) + bitmap_size(num_ssid, num_id)); + set = vmalloc(sizeof(struct idset) + + idset_bitmap_size(num_ssid, num_id)); if (set) { set->num_ssid = num_ssid; set->num_id = num_id; - memset(set->bitmap, 0, bitmap_size(num_ssid, num_id)); + memset(set->bitmap, 0, idset_bitmap_size(num_ssid, num_id)); } return set; } @@ -41,7 +42,8 @@ void idset_free(struct idset *set) void idset_fill(struct idset *set) { - memset(set->bitmap, 0xff, bitmap_size(set->num_ssid, set->num_id)); + memset(set->bitmap, 0xff, + idset_bitmap_size(set->num_ssid, set->num_id)); } static inline void idset_add(struct idset *set, int ssid, int id) diff --git a/drivers/scsi/aacraid/comminit.c b/drivers/scsi/aacraid/comminit.c index 0dc7b5a4fea2..0378fd3eb039 100644 --- a/drivers/scsi/aacraid/comminit.c +++ b/drivers/scsi/aacraid/comminit.c @@ -652,6 +652,7 @@ struct aac_dev *aac_init_adapter(struct aac_dev *dev) if (aac_comm_init(dev)<0){ kfree(dev->queues); + dev->queues = NULL; return NULL; } /* @@ -659,6 +660,7 @@ struct aac_dev *aac_init_adapter(struct aac_dev *dev) */ if (aac_fib_setup(dev) < 0) { kfree(dev->queues); + dev->queues = NULL; return NULL; } diff --git a/drivers/scsi/lpfc/lpfc_sli.c b/drivers/scsi/lpfc/lpfc_sli.c index e72fc88aeb40..9da9d5ee0b8e 100644 --- a/drivers/scsi/lpfc/lpfc_sli.c +++ b/drivers/scsi/lpfc/lpfc_sli.c @@ -6597,7 +6597,7 @@ lpfc_sli4_repost_sgl_list(struct lpfc_hba *phba, struct lpfc_sglq *sglq_entry = NULL; struct lpfc_sglq *sglq_entry_next = NULL; struct lpfc_sglq *sglq_entry_first = NULL; - int status, total_cnt; + int status = 0, total_cnt; int post_cnt = 0, num_posted = 0, block_cnt = 0; int last_xritag = NO_XRI; LIST_HEAD(prep_sgl_list); diff --git a/drivers/scsi/mpt3sas/mpt3sas_base.c b/drivers/scsi/mpt3sas/mpt3sas_base.c index b4495023edb7..cbe10d9a8ae1 100644 --- a/drivers/scsi/mpt3sas/mpt3sas_base.c +++ b/drivers/scsi/mpt3sas/mpt3sas_base.c @@ -2221,6 +2221,22 @@ _base_build_zero_len_sge_ieee(struct MPT3SAS_ADAPTER *ioc, void *paddr) _base_add_sg_single_ieee(paddr, sgl_flags, 0, 0, -1); } +static inline int _base_scsi_dma_map(struct scsi_cmnd *cmd) +{ + /* + * Some firmware versions byte-swap the REPORT ZONES command reply from + * ATA-ZAC devices by directly accessing in the host buffer. This does + * not respect the default command DMA direction and causes IOMMU page + * faults on some architectures with an IOMMU enforcing write mappings + * (e.g. AMD hosts). Avoid such issue by making the report zones buffer + * mapping bi-directional. + */ + if (cmd->cmnd[0] == ZBC_IN && cmd->cmnd[1] == ZI_REPORT_ZONES) + cmd->sc_data_direction = DMA_BIDIRECTIONAL; + + return scsi_dma_map(cmd); +} + /** * _base_build_sg_scmd - main sg creation routine * pcie_device is unused here! @@ -2267,7 +2283,7 @@ _base_build_sg_scmd(struct MPT3SAS_ADAPTER *ioc, sgl_flags = sgl_flags << MPI2_SGE_FLAGS_SHIFT; sg_scmd = scsi_sglist(scmd); - sges_left = scsi_dma_map(scmd); + sges_left = _base_scsi_dma_map(scmd); if (sges_left < 0) { sdev_printk(KERN_ERR, scmd->device, "pci_map_sg failed: request for %d bytes!\n", @@ -2415,7 +2431,7 @@ _base_build_sg_scmd_ieee(struct MPT3SAS_ADAPTER *ioc, } sg_scmd = scsi_sglist(scmd); - sges_left = scsi_dma_map(scmd); + sges_left = _base_scsi_dma_map(scmd); if (sges_left < 0) { sdev_printk(KERN_ERR, scmd->device, "pci_map_sg failed: request for %d bytes!\n", diff --git a/drivers/scsi/qedf/qedf_main.c b/drivers/scsi/qedf/qedf_main.c index 01e27285b26b..33fb0e192683 100644 --- a/drivers/scsi/qedf/qedf_main.c +++ b/drivers/scsi/qedf/qedf_main.c @@ -3101,6 +3101,7 @@ static int __qedf_probe(struct pci_dev *pdev, int mode) } /* Start the Slowpath-process */ + memset(&slowpath_params, 0, sizeof(struct qed_slowpath_params)); slowpath_params.int_mode = QED_INT_MODE_MSIX; slowpath_params.drv_major = QEDF_DRIVER_MAJOR_VER; slowpath_params.drv_minor = QEDF_DRIVER_MINOR_VER; diff --git a/drivers/scsi/qla2xxx/qla_bsg.c b/drivers/scsi/qla2xxx/qla_bsg.c index 430dfe3d5416..10b763738064 100644 --- a/drivers/scsi/qla2xxx/qla_bsg.c +++ b/drivers/scsi/qla2xxx/qla_bsg.c @@ -302,7 +302,7 @@ qla2x00_process_els(struct bsg_job *bsg_job) "request_sg_cnt=%x reply_sg_cnt=%x.\n", bsg_job->request_payload.sg_cnt, bsg_job->reply_payload.sg_cnt); - rval = -EPERM; + rval = -ENOBUFS; goto done; } diff --git a/drivers/scsi/qla2xxx/qla_mid.c b/drivers/scsi/qla2xxx/qla_mid.c index 516fccdbcebd..7b53a6f104f5 100644 --- a/drivers/scsi/qla2xxx/qla_mid.c +++ b/drivers/scsi/qla2xxx/qla_mid.c @@ -161,7 +161,7 @@ qla24xx_disable_vp(scsi_qla_host_t *vha) atomic_set(&vha->loop_state, LOOP_DOWN); atomic_set(&vha->loop_down_timer, LOOP_DOWN_TIME); list_for_each_entry(fcport, &vha->vp_fcports, list) - fcport->logout_on_delete = 0; + fcport->logout_on_delete = 1; qla2x00_mark_all_devices_lost(vha, 0); diff --git a/drivers/scsi/qla2xxx/qla_nvme.c b/drivers/scsi/qla2xxx/qla_nvme.c index 35762d29b04b..fb42d9ff9bb1 100644 --- a/drivers/scsi/qla2xxx/qla_nvme.c +++ b/drivers/scsi/qla2xxx/qla_nvme.c @@ -30,7 +30,10 @@ int qla_nvme_register_remote(struct scsi_qla_host *vha, struct fc_port *fcport) return 0; } - if (!vha->nvme_local_port && qla_nvme_register_hba(vha)) + if (qla_nvme_register_hba(vha)) + return 0; + + if (!vha->nvme_local_port) return 0; if (!(fcport->nvme_prli_service_param & diff --git a/drivers/scsi/scsi_transport_spi.c b/drivers/scsi/scsi_transport_spi.c index efb9c3d90213..adbe9b07f3d0 100644 --- a/drivers/scsi/scsi_transport_spi.c +++ b/drivers/scsi/scsi_transport_spi.c @@ -690,10 +690,10 @@ spi_dv_device_echo_buffer(struct scsi_device *sdev, u8 *buffer, for (r = 0; r < retries; r++) { result = spi_execute(sdev, spi_write_buffer, DMA_TO_DEVICE, buffer, len, &sshdr); - if(result || !scsi_device_online(sdev)) { + if (result || !scsi_device_online(sdev)) { scsi_device_set_state(sdev, SDEV_QUIESCE); - if (scsi_sense_valid(&sshdr) + if (result > 0 && scsi_sense_valid(&sshdr) && sshdr.sense_key == ILLEGAL_REQUEST /* INVALID FIELD IN CDB */ && sshdr.asc == 0x24 && sshdr.ascq == 0x00) diff --git a/drivers/scsi/ufs/ufshcd.c b/drivers/scsi/ufs/ufshcd.c index 030db45d4eff..a1c7b1d05a6d 100644 --- a/drivers/scsi/ufs/ufshcd.c +++ b/drivers/scsi/ufs/ufshcd.c @@ -4967,11 +4967,16 @@ static inline void ufshcd_add_delay_before_dme_cmd(struct ufs_hba *hba) min_sleep_time_us = MIN_DELAY_BEFORE_DME_CMDS_US - delta; else - return; /* no more delay required */ + min_sleep_time_us = 0; /* no more delay required */ } - /* allow sleep for extra 50us if needed */ - usleep_range(min_sleep_time_us, min_sleep_time_us + 50); + if (min_sleep_time_us > 0) { + /* allow sleep for extra 50us if needed */ + usleep_range(min_sleep_time_us, min_sleep_time_us + 50); + } + + /* update the last_dme_cmd_tstamp */ + hba->last_dme_cmd_tstamp = ktime_get(); } static inline void ufshcd_save_tstamp_of_last_dme_cmd( diff --git a/drivers/soundwire/stream.c b/drivers/soundwire/stream.c index 42bc701e2304..7c08385acab1 100644 --- a/drivers/soundwire/stream.c +++ b/drivers/soundwire/stream.c @@ -1232,18 +1232,18 @@ struct sdw_dpn_prop *sdw_get_slave_dpn_prop(struct sdw_slave *slave, unsigned int port_num) { struct sdw_dpn_prop *dpn_prop; - u8 num_ports; + unsigned long mask; int i; if (direction == SDW_DATA_DIR_TX) { - num_ports = hweight32(slave->prop.source_ports); + mask = slave->prop.source_ports; dpn_prop = slave->prop.src_dpn_prop; } else { - num_ports = hweight32(slave->prop.sink_ports); + mask = slave->prop.sink_ports; dpn_prop = slave->prop.sink_dpn_prop; } - for (i = 0; i < num_ports; i++) { + for_each_set_bit(i, &mask, 32) { if (dpn_prop[i].num == port_num) return &dpn_prop[i]; } diff --git a/drivers/spi/spi-fsl-lpspi.c b/drivers/spi/spi-fsl-lpspi.c index 51670976faa3..695034e076c5 100644 --- a/drivers/spi/spi-fsl-lpspi.c +++ b/drivers/spi/spi-fsl-lpspi.c @@ -3,6 +3,7 @@ // Freescale i.MX7ULP LPSPI driver // // Copyright 2016 Freescale Semiconductor, Inc. +// Copyright 2018 NXP Semiconductors #include #include @@ -54,6 +55,7 @@ #define IER_RDIE BIT(1) #define IER_TDIE BIT(0) #define CFGR1_PCSCFG BIT(27) +#define CFGR1_PINCFG (BIT(24)|BIT(25)) #define CFGR1_PCSPOL BIT(8) #define CFGR1_NOSTALL BIT(3) #define CFGR1_MASTER BIT(0) @@ -65,8 +67,6 @@ #define TCR_RXMSK BIT(19) #define TCR_TXMSK BIT(18) -static int clkdivs[] = {1, 2, 4, 8, 16, 32, 64, 128}; - struct lpspi_config { u8 bpw; u8 chip_select; @@ -78,7 +78,9 @@ struct lpspi_config { struct fsl_lpspi_data { struct device *dev; void __iomem *base; - struct clk *clk; + struct clk *clk_ipg; + struct clk *clk_per; + bool is_slave; void *rx_buf; const void *tx_buf; @@ -86,11 +88,14 @@ struct fsl_lpspi_data { void (*rx)(struct fsl_lpspi_data *); u32 remain; + u8 watermark; u8 txfifosize; u8 rxfifosize; struct lpspi_config config; struct completion xfer_done; + + bool slave_aborted; }; static const struct of_device_id fsl_lpspi_dt_ids[] = { @@ -137,18 +142,32 @@ static void fsl_lpspi_intctrl(struct fsl_lpspi_data *fsl_lpspi, writel(enable, fsl_lpspi->base + IMX7ULP_IER); } -static int lpspi_prepare_xfer_hardware(struct spi_master *master) +static int lpspi_prepare_xfer_hardware(struct spi_controller *controller) { - struct fsl_lpspi_data *fsl_lpspi = spi_master_get_devdata(master); + struct fsl_lpspi_data *fsl_lpspi = + spi_controller_get_devdata(controller); + int ret; - return clk_prepare_enable(fsl_lpspi->clk); + ret = clk_prepare_enable(fsl_lpspi->clk_ipg); + if (ret) + return ret; + + ret = clk_prepare_enable(fsl_lpspi->clk_per); + if (ret) { + clk_disable_unprepare(fsl_lpspi->clk_ipg); + return ret; + } + + return 0; } -static int lpspi_unprepare_xfer_hardware(struct spi_master *master) +static int lpspi_unprepare_xfer_hardware(struct spi_controller *controller) { - struct fsl_lpspi_data *fsl_lpspi = spi_master_get_devdata(master); + struct fsl_lpspi_data *fsl_lpspi = + spi_controller_get_devdata(controller); - clk_disable_unprepare(fsl_lpspi->clk); + clk_disable_unprepare(fsl_lpspi->clk_ipg); + clk_disable_unprepare(fsl_lpspi->clk_per); return 0; } @@ -203,21 +222,22 @@ static void fsl_lpspi_set_cmd(struct fsl_lpspi_data *fsl_lpspi, u32 temp = 0; temp |= fsl_lpspi->config.bpw - 1; - temp |= fsl_lpspi->config.prescale << 27; temp |= (fsl_lpspi->config.mode & 0x3) << 30; - temp |= (fsl_lpspi->config.chip_select & 0x3) << 24; - - /* - * Set TCR_CONT will keep SS asserted after current transfer. - * For the first transfer, clear TCR_CONTC to assert SS. - * For subsequent transfer, set TCR_CONTC to keep SS asserted. - */ - temp |= TCR_CONT; - if (is_first_xfer) - temp &= ~TCR_CONTC; - else - temp |= TCR_CONTC; + if (!fsl_lpspi->is_slave) { + temp |= fsl_lpspi->config.prescale << 27; + temp |= (fsl_lpspi->config.chip_select & 0x3) << 24; + /* + * Set TCR_CONT will keep SS asserted after current transfer. + * For the first transfer, clear TCR_CONTC to assert SS. + * For subsequent transfer, set TCR_CONTC to keep SS asserted. + */ + temp |= TCR_CONT; + if (is_first_xfer) + temp &= ~TCR_CONTC; + else + temp |= TCR_CONTC; + } writel(temp, fsl_lpspi->base + IMX7ULP_TCR); dev_dbg(fsl_lpspi->dev, "TCR=0x%x\n", temp); @@ -227,7 +247,7 @@ static void fsl_lpspi_set_watermark(struct fsl_lpspi_data *fsl_lpspi) { u32 temp; - temp = fsl_lpspi->txfifosize >> 1 | (fsl_lpspi->rxfifosize >> 1) << 16; + temp = fsl_lpspi->watermark >> 1 | (fsl_lpspi->watermark >> 1) << 16; writel(temp, fsl_lpspi->base + IMX7ULP_FCR); @@ -237,23 +257,32 @@ static void fsl_lpspi_set_watermark(struct fsl_lpspi_data *fsl_lpspi) static int fsl_lpspi_set_bitrate(struct fsl_lpspi_data *fsl_lpspi) { struct lpspi_config config = fsl_lpspi->config; - unsigned int perclk_rate, scldiv; + unsigned int perclk_rate, scldiv, div; u8 prescale; - perclk_rate = clk_get_rate(fsl_lpspi->clk); + perclk_rate = clk_get_rate(fsl_lpspi->clk_per); + + if (config.speed_hz > perclk_rate / 2) { + dev_err(fsl_lpspi->dev, + "per-clk should be at least two times of transfer speed"); + return -EINVAL; + } + + div = DIV_ROUND_UP(perclk_rate, config.speed_hz); + for (prescale = 0; prescale < 8; prescale++) { - scldiv = perclk_rate / - (clkdivs[prescale] * config.speed_hz) - 2; + scldiv = div / (1 << prescale) - 2; if (scldiv < 256) { fsl_lpspi->config.prescale = prescale; break; } } - if (prescale == 8 && scldiv >= 256) + if (scldiv >= 256) return -EINVAL; - writel(scldiv, fsl_lpspi->base + IMX7ULP_CCR); + writel(scldiv | (scldiv << 8) | ((scldiv >> 1) << 16), + fsl_lpspi->base + IMX7ULP_CCR); dev_dbg(fsl_lpspi->dev, "perclk=%d, speed=%d, prescale =%d, scldiv=%d\n", perclk_rate, config.speed_hz, prescale, scldiv); @@ -270,13 +299,18 @@ static int fsl_lpspi_config(struct fsl_lpspi_data *fsl_lpspi) writel(temp, fsl_lpspi->base + IMX7ULP_CR); writel(0, fsl_lpspi->base + IMX7ULP_CR); - ret = fsl_lpspi_set_bitrate(fsl_lpspi); - if (ret) - return ret; + if (!fsl_lpspi->is_slave) { + ret = fsl_lpspi_set_bitrate(fsl_lpspi); + if (ret) + return ret; + } fsl_lpspi_set_watermark(fsl_lpspi); - temp = CFGR1_PCSCFG | CFGR1_MASTER; + if (!fsl_lpspi->is_slave) + temp = CFGR1_MASTER; + else + temp = CFGR1_PINCFG; if (fsl_lpspi->config.mode & SPI_CS_HIGH) temp |= CFGR1_PCSPOL; writel(temp, fsl_lpspi->base + IMX7ULP_CFGR1); @@ -288,10 +322,11 @@ static int fsl_lpspi_config(struct fsl_lpspi_data *fsl_lpspi) return 0; } -static void fsl_lpspi_setup_transfer(struct spi_device *spi, +static int fsl_lpspi_setup_transfer(struct spi_device *spi, struct spi_transfer *t) { - struct fsl_lpspi_data *fsl_lpspi = spi_master_get_devdata(spi->master); + struct fsl_lpspi_data *fsl_lpspi = + spi_controller_get_devdata(spi->controller); fsl_lpspi->config.mode = spi->mode; fsl_lpspi->config.bpw = t ? t->bits_per_word : spi->bits_per_word; @@ -315,14 +350,51 @@ static void fsl_lpspi_setup_transfer(struct spi_device *spi, fsl_lpspi->tx = fsl_lpspi_buf_tx_u32; } - fsl_lpspi_config(fsl_lpspi); + if (t->len <= fsl_lpspi->txfifosize) + fsl_lpspi->watermark = t->len; + else + fsl_lpspi->watermark = fsl_lpspi->txfifosize; + + return fsl_lpspi_config(fsl_lpspi); } -static int fsl_lpspi_transfer_one(struct spi_master *master, +static int fsl_lpspi_slave_abort(struct spi_controller *controller) +{ + struct fsl_lpspi_data *fsl_lpspi = + spi_controller_get_devdata(controller); + + fsl_lpspi->slave_aborted = true; + complete(&fsl_lpspi->xfer_done); + return 0; +} + +static int fsl_lpspi_wait_for_completion(struct spi_controller *controller) +{ + struct fsl_lpspi_data *fsl_lpspi = + spi_controller_get_devdata(controller); + + if (fsl_lpspi->is_slave) { + if (wait_for_completion_interruptible(&fsl_lpspi->xfer_done) || + fsl_lpspi->slave_aborted) { + dev_dbg(fsl_lpspi->dev, "interrupted\n"); + return -EINTR; + } + } else { + if (!wait_for_completion_timeout(&fsl_lpspi->xfer_done, HZ)) { + dev_dbg(fsl_lpspi->dev, "wait for completion timeout\n"); + return -ETIMEDOUT; + } + } + + return 0; +} + +static int fsl_lpspi_transfer_one(struct spi_controller *controller, struct spi_device *spi, struct spi_transfer *t) { - struct fsl_lpspi_data *fsl_lpspi = spi_master_get_devdata(master); + struct fsl_lpspi_data *fsl_lpspi = + spi_controller_get_devdata(controller); int ret; fsl_lpspi->tx_buf = t->tx_buf; @@ -330,13 +402,13 @@ static int fsl_lpspi_transfer_one(struct spi_master *master, fsl_lpspi->remain = t->len; reinit_completion(&fsl_lpspi->xfer_done); + fsl_lpspi->slave_aborted = false; + fsl_lpspi_write_tx_fifo(fsl_lpspi); - ret = wait_for_completion_timeout(&fsl_lpspi->xfer_done, HZ); - if (!ret) { - dev_dbg(fsl_lpspi->dev, "wait for completion timeout\n"); - return -ETIMEDOUT; - } + ret = fsl_lpspi_wait_for_completion(controller); + if (ret) + return ret; ret = fsl_lpspi_txfifo_empty(fsl_lpspi); if (ret) @@ -347,10 +419,11 @@ static int fsl_lpspi_transfer_one(struct spi_master *master, return 0; } -static int fsl_lpspi_transfer_one_msg(struct spi_master *master, +static int fsl_lpspi_transfer_one_msg(struct spi_controller *controller, struct spi_message *msg) { - struct fsl_lpspi_data *fsl_lpspi = spi_master_get_devdata(master); + struct fsl_lpspi_data *fsl_lpspi = + spi_controller_get_devdata(controller); struct spi_device *spi = msg->spi; struct spi_transfer *xfer; bool is_first_xfer = true; @@ -361,12 +434,15 @@ static int fsl_lpspi_transfer_one_msg(struct spi_master *master, msg->actual_length = 0; list_for_each_entry(xfer, &msg->transfers, transfer_list) { - fsl_lpspi_setup_transfer(spi, xfer); + ret = fsl_lpspi_setup_transfer(spi, xfer); + if (ret < 0) + goto complete; + fsl_lpspi_set_cmd(fsl_lpspi, is_first_xfer); is_first_xfer = false; - ret = fsl_lpspi_transfer_one(master, spi, xfer); + ret = fsl_lpspi_transfer_one(controller, spi, xfer); if (ret < 0) goto complete; @@ -374,13 +450,15 @@ static int fsl_lpspi_transfer_one_msg(struct spi_master *master, } complete: - /* de-assert SS, then finalize current message */ - temp = readl(fsl_lpspi->base + IMX7ULP_TCR); - temp &= ~TCR_CONTC; - writel(temp, fsl_lpspi->base + IMX7ULP_TCR); + if (!fsl_lpspi->is_slave) { + /* de-assert SS, then finalize current message */ + temp = readl(fsl_lpspi->base + IMX7ULP_TCR); + temp &= ~TCR_CONTC; + writel(temp, fsl_lpspi->base + IMX7ULP_TCR); + } msg->status = ret; - spi_finalize_current_message(master); + spi_finalize_current_message(controller); return ret; } @@ -410,30 +488,39 @@ static irqreturn_t fsl_lpspi_isr(int irq, void *dev_id) static int fsl_lpspi_probe(struct platform_device *pdev) { struct fsl_lpspi_data *fsl_lpspi; - struct spi_master *master; + struct spi_controller *controller; struct resource *res; int ret, irq; u32 temp; - master = spi_alloc_master(&pdev->dev, sizeof(struct fsl_lpspi_data)); - if (!master) + if (of_property_read_bool((&pdev->dev)->of_node, "spi-slave")) + controller = spi_alloc_slave(&pdev->dev, + sizeof(struct fsl_lpspi_data)); + else + controller = spi_alloc_master(&pdev->dev, + sizeof(struct fsl_lpspi_data)); + + if (!controller) return -ENOMEM; - platform_set_drvdata(pdev, master); + platform_set_drvdata(pdev, controller); - master->bits_per_word_mask = SPI_BPW_RANGE_MASK(8, 32); - master->bus_num = pdev->id; + controller->bits_per_word_mask = SPI_BPW_RANGE_MASK(8, 32); + controller->bus_num = pdev->id; - fsl_lpspi = spi_master_get_devdata(master); + fsl_lpspi = spi_controller_get_devdata(controller); fsl_lpspi->dev = &pdev->dev; + fsl_lpspi->is_slave = of_property_read_bool((&pdev->dev)->of_node, + "spi-slave"); - master->transfer_one_message = fsl_lpspi_transfer_one_msg; - master->prepare_transfer_hardware = lpspi_prepare_xfer_hardware; - master->unprepare_transfer_hardware = lpspi_unprepare_xfer_hardware; - master->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH; - master->flags = SPI_MASTER_MUST_RX | SPI_MASTER_MUST_TX; - master->dev.of_node = pdev->dev.of_node; - master->bus_num = pdev->id; + controller->transfer_one_message = fsl_lpspi_transfer_one_msg; + controller->prepare_transfer_hardware = lpspi_prepare_xfer_hardware; + controller->unprepare_transfer_hardware = lpspi_unprepare_xfer_hardware; + controller->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH; + controller->flags = SPI_MASTER_MUST_RX | SPI_MASTER_MUST_TX; + controller->dev.of_node = pdev->dev.of_node; + controller->bus_num = pdev->id; + controller->slave_abort = fsl_lpspi_slave_abort; init_completion(&fsl_lpspi->xfer_done); @@ -441,60 +528,78 @@ static int fsl_lpspi_probe(struct platform_device *pdev) fsl_lpspi->base = devm_ioremap_resource(&pdev->dev, res); if (IS_ERR(fsl_lpspi->base)) { ret = PTR_ERR(fsl_lpspi->base); - goto out_master_put; + goto out_controller_put; } irq = platform_get_irq(pdev, 0); if (irq < 0) { ret = irq; - goto out_master_put; + goto out_controller_put; } ret = devm_request_irq(&pdev->dev, irq, fsl_lpspi_isr, 0, dev_name(&pdev->dev), fsl_lpspi); if (ret) { dev_err(&pdev->dev, "can't get irq%d: %d\n", irq, ret); - goto out_master_put; + goto out_controller_put; } - fsl_lpspi->clk = devm_clk_get(&pdev->dev, "ipg"); - if (IS_ERR(fsl_lpspi->clk)) { - ret = PTR_ERR(fsl_lpspi->clk); - goto out_master_put; + fsl_lpspi->clk_per = devm_clk_get(&pdev->dev, "per"); + if (IS_ERR(fsl_lpspi->clk_per)) { + ret = PTR_ERR(fsl_lpspi->clk_per); + goto out_controller_put; } - ret = clk_prepare_enable(fsl_lpspi->clk); + fsl_lpspi->clk_ipg = devm_clk_get(&pdev->dev, "ipg"); + if (IS_ERR(fsl_lpspi->clk_ipg)) { + ret = PTR_ERR(fsl_lpspi->clk_ipg); + goto out_controller_put; + } + + ret = clk_prepare_enable(fsl_lpspi->clk_ipg); if (ret) { - dev_err(&pdev->dev, "can't enable lpspi clock, ret=%d\n", ret); - goto out_master_put; + dev_err(&pdev->dev, + "can't enable lpspi ipg clock, ret=%d\n", ret); + goto out_controller_put; + } + + ret = clk_prepare_enable(fsl_lpspi->clk_per); + if (ret) { + dev_err(&pdev->dev, + "can't enable lpspi per clock, ret=%d\n", ret); + clk_disable_unprepare(fsl_lpspi->clk_ipg); + goto out_controller_put; } temp = readl(fsl_lpspi->base + IMX7ULP_PARAM); fsl_lpspi->txfifosize = 1 << (temp & 0x0f); fsl_lpspi->rxfifosize = 1 << ((temp >> 8) & 0x0f); - clk_disable_unprepare(fsl_lpspi->clk); + clk_disable_unprepare(fsl_lpspi->clk_per); + clk_disable_unprepare(fsl_lpspi->clk_ipg); - ret = devm_spi_register_master(&pdev->dev, master); + ret = devm_spi_register_controller(&pdev->dev, controller); if (ret < 0) { - dev_err(&pdev->dev, "spi_register_master error.\n"); - goto out_master_put; + dev_err(&pdev->dev, "spi_register_controller error.\n"); + goto out_controller_put; } return 0; -out_master_put: - spi_master_put(master); +out_controller_put: + spi_controller_put(controller); return ret; } static int fsl_lpspi_remove(struct platform_device *pdev) { - struct spi_master *master = platform_get_drvdata(pdev); - struct fsl_lpspi_data *fsl_lpspi = spi_master_get_devdata(master); + struct spi_controller *controller = platform_get_drvdata(pdev); + struct fsl_lpspi_data *fsl_lpspi = + spi_controller_get_devdata(controller); - clk_disable_unprepare(fsl_lpspi->clk); + clk_disable_unprepare(fsl_lpspi->clk_per); + clk_disable_unprepare(fsl_lpspi->clk_ipg); return 0; } @@ -509,6 +614,6 @@ static struct platform_driver fsl_lpspi_driver = { }; module_platform_driver(fsl_lpspi_driver); -MODULE_DESCRIPTION("LPSPI Master Controller driver"); +MODULE_DESCRIPTION("LPSPI Controller driver"); MODULE_AUTHOR("Gao Pan "); MODULE_LICENSE("GPL"); diff --git a/drivers/spi/spi-imx.c b/drivers/spi/spi-imx.c index 0078cb365d8c..adcd519c70b1 100644 --- a/drivers/spi/spi-imx.c +++ b/drivers/spi/spi-imx.c @@ -968,7 +968,7 @@ static struct spi_imx_devtype_data imx35_cspi_devtype_data = { .rx_available = mx31_rx_available, .reset = mx31_reset, .fifo_size = 8, - .has_dmamode = true, + .has_dmamode = false, .dynamic_burst = false, .has_slavemode = false, .devtype = IMX35_CSPI, diff --git a/drivers/ssb/main.c b/drivers/ssb/main.c index 0a26984acb2c..9e54bc7eec66 100644 --- a/drivers/ssb/main.c +++ b/drivers/ssb/main.c @@ -835,7 +835,7 @@ static u32 clkfactor_f6_resolve(u32 v) case SSB_CHIPCO_CLK_F6_7: return 7; } - return 0; + return 1; } /* Calculate the speed the backplane would run at a given set of clockcontrol values */ diff --git a/drivers/staging/ks7010/ks7010_sdio.c b/drivers/staging/ks7010/ks7010_sdio.c index 79d0513bd282..85c4e27f571b 100644 --- a/drivers/staging/ks7010/ks7010_sdio.c +++ b/drivers/staging/ks7010/ks7010_sdio.c @@ -395,9 +395,9 @@ int ks_wlan_hw_tx(struct ks_wlan_private *priv, void *p, unsigned long size, priv->hostt.buff[priv->hostt.qtail] = le16_to_cpu(hdr->event); priv->hostt.qtail = (priv->hostt.qtail + 1) % SME_EVENT_BUFF_SIZE; - spin_lock(&priv->tx_dev.tx_dev_lock); + spin_lock_bh(&priv->tx_dev.tx_dev_lock); result = enqueue_txdev(priv, p, size, complete_handler, skb); - spin_unlock(&priv->tx_dev.tx_dev_lock); + spin_unlock_bh(&priv->tx_dev.tx_dev_lock); if (txq_has_space(priv)) queue_delayed_work(priv->wq, &priv->rw_dwork, 0); diff --git a/drivers/tty/serial/serial_core.c b/drivers/tty/serial/serial_core.c index fc1c7d5f10e1..13dcb9f5d91c 100644 --- a/drivers/tty/serial/serial_core.c +++ b/drivers/tty/serial/serial_core.c @@ -850,6 +850,14 @@ static int uart_set_info(struct tty_struct *tty, struct tty_port *port, new_flags = (__force upf_t)new_info->flags; old_custom_divisor = uport->custom_divisor; + if (!(uport->flags & UPF_FIXED_PORT)) { + unsigned int uartclk = new_info->baud_base * 16; + /* check needs to be done here before other settings made */ + if (uartclk == 0) { + retval = -EINVAL; + goto exit; + } + } if (!capable(CAP_SYS_ADMIN)) { retval = -EPERM; if (change_irq || change_port || diff --git a/drivers/usb/class/cdc-acm.c b/drivers/usb/class/cdc-acm.c index e927631c79c6..544d4647d918 100644 --- a/drivers/usb/class/cdc-acm.c +++ b/drivers/usb/class/cdc-acm.c @@ -1807,6 +1807,9 @@ static const struct usb_device_id acm_ids[] = { { USB_DEVICE(0x11ca, 0x0201), /* VeriFone Mx870 Gadget Serial */ .driver_info = SINGLE_RX_URB, }, + { USB_DEVICE(0x1901, 0x0006), /* GE Healthcare Patient Monitor UI Controller */ + .driver_info = DISABLE_ECHO, /* DISABLE ECHO in termios flag */ + }, { USB_DEVICE(0x1965, 0x0018), /* Uniden UBC125XLT */ .driver_info = NO_UNION_NORMAL, /* has no union descriptor */ }, diff --git a/drivers/usb/core/sysfs.c b/drivers/usb/core/sysfs.c index 314f2d996c56..01fa04d470fd 100644 --- a/drivers/usb/core/sysfs.c +++ b/drivers/usb/core/sysfs.c @@ -689,6 +689,7 @@ static int add_power_attributes(struct device *dev) static void remove_power_attributes(struct device *dev) { + sysfs_unmerge_group(&dev->kobj, &usb3_hardware_lpm_attr_group); sysfs_unmerge_group(&dev->kobj, &usb2_hardware_lpm_attr_group); sysfs_unmerge_group(&dev->kobj, &power_attr_group); } diff --git a/drivers/usb/dwc3/core.c b/drivers/usb/dwc3/core.c index 9f142779f2fb..09b37ae60ac6 100644 --- a/drivers/usb/dwc3/core.c +++ b/drivers/usb/dwc3/core.c @@ -374,6 +374,13 @@ static void dwc3_free_event_buffers(struct dwc3 *dwc) static int dwc3_alloc_event_buffers(struct dwc3 *dwc, unsigned length) { struct dwc3_event_buffer *evt; + unsigned int hw_mode; + + hw_mode = DWC3_GHWPARAMS0_MODE(dwc->hwparams.hwparams0); + if (hw_mode == DWC3_GHWPARAMS0_MODE_HOST) { + dwc->ev_buf = NULL; + return 0; + } evt = dwc3_alloc_one_event_buffer(dwc, length); if (IS_ERR(evt)) { @@ -397,6 +404,9 @@ int dwc3_event_buffers_setup(struct dwc3 *dwc) { struct dwc3_event_buffer *evt; + if (!dwc->ev_buf) + return 0; + evt = dwc->ev_buf; evt->lpos = 0; dwc3_writel(dwc->regs, DWC3_GEVNTADRLO(0), @@ -415,6 +425,17 @@ int dwc3_event_buffers_setup(struct dwc3 *dwc) void dwc3_event_buffers_cleanup(struct dwc3 *dwc) { struct dwc3_event_buffer *evt; + u32 reg; + + if (!dwc->ev_buf) + return; + /* + * Exynos platforms may not be able to access event buffer if the + * controller failed to halt on dwc3_core_exit(). + */ + reg = dwc3_readl(dwc->regs, DWC3_DSTS); + if (!(reg & DWC3_DSTS_DEVCTRLHLT)) + return; evt = dwc->ev_buf; diff --git a/drivers/usb/dwc3/dwc3-omap.c b/drivers/usb/dwc3/dwc3-omap.c index 0b800bc6150d..340868fabaff 100644 --- a/drivers/usb/dwc3/dwc3-omap.c +++ b/drivers/usb/dwc3/dwc3-omap.c @@ -526,11 +526,13 @@ static int dwc3_omap_probe(struct platform_device *pdev) if (ret) { dev_err(dev, "failed to request IRQ #%d --> %d\n", omap->irq, ret); - goto err1; + goto err2; } dwc3_omap_enable_irqs(omap); return 0; +err2: + of_platform_depopulate(dev); err1: pm_runtime_put_sync(dev); pm_runtime_disable(dev); diff --git a/drivers/usb/dwc3/dwc3-st.c b/drivers/usb/dwc3/dwc3-st.c index 16081383c401..6127505770ce 100644 --- a/drivers/usb/dwc3/dwc3-st.c +++ b/drivers/usb/dwc3/dwc3-st.c @@ -219,10 +219,8 @@ static int st_dwc3_probe(struct platform_device *pdev) dwc3_data->regmap = regmap; res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "syscfg-reg"); - if (!res) { - ret = -ENXIO; - goto undo_platform_dev_alloc; - } + if (!res) + return -ENXIO; dwc3_data->syscfg_reg_off = res->start; @@ -233,8 +231,7 @@ static int st_dwc3_probe(struct platform_device *pdev) devm_reset_control_get_exclusive(dev, "powerdown"); if (IS_ERR(dwc3_data->rstc_pwrdn)) { dev_err(&pdev->dev, "could not get power controller\n"); - ret = PTR_ERR(dwc3_data->rstc_pwrdn); - goto undo_platform_dev_alloc; + return PTR_ERR(dwc3_data->rstc_pwrdn); } /* Manage PowerDown */ @@ -296,8 +293,6 @@ undo_softreset: reset_control_assert(dwc3_data->rstc_rst); undo_powerdown: reset_control_assert(dwc3_data->rstc_pwrdn); -undo_platform_dev_alloc: - platform_device_put(pdev); return ret; } diff --git a/drivers/usb/gadget/udc/core.c b/drivers/usb/gadget/udc/core.c index da18056cefc6..ef117a23f818 100644 --- a/drivers/usb/gadget/udc/core.c +++ b/drivers/usb/gadget/udc/core.c @@ -99,12 +99,10 @@ int usb_ep_enable(struct usb_ep *ep) goto out; /* UDC drivers can't handle endpoints with maxpacket size 0 */ - if (usb_endpoint_maxp(ep->desc) == 0) { - /* - * We should log an error message here, but we can't call - * dev_err() because there's no way to find the gadget - * given only ep. - */ + if (!ep->desc || usb_endpoint_maxp(ep->desc) == 0) { + WARN_ONCE(1, "%s: ep%d (%s) has %s\n", __func__, ep->address, ep->name, + (!ep->desc) ? "NULL descriptor" : "maxpacket 0"); + ret = -EINVAL; goto out; } diff --git a/drivers/usb/gadget/udc/fsl_udc_core.c b/drivers/usb/gadget/udc/fsl_udc_core.c index 367697144cda..b86f86902f55 100644 --- a/drivers/usb/gadget/udc/fsl_udc_core.c +++ b/drivers/usb/gadget/udc/fsl_udc_core.c @@ -2501,7 +2501,7 @@ static int fsl_udc_probe(struct platform_device *pdev) /* setup the udc->eps[] for non-control endpoints and link * to gadget.ep_list */ for (i = 1; i < (int)(udc_controller->max_ep / 2); i++) { - char name[14]; + char name[16]; sprintf(name, "ep%dout", i); struct_ep_setup(udc_controller, i * 2, name, 1); diff --git a/drivers/usb/host/xhci.c b/drivers/usb/host/xhci.c index b57fac08bcc1..36cff3d7cc16 100644 --- a/drivers/usb/host/xhci.c +++ b/drivers/usb/host/xhci.c @@ -2824,7 +2824,7 @@ static int xhci_configure_endpoint(struct xhci_hcd *xhci, xhci->num_active_eps); return -ENOMEM; } - if ((xhci->quirks & XHCI_SW_BW_CHECKING) && + if ((xhci->quirks & XHCI_SW_BW_CHECKING) && !ctx_change && xhci_reserve_bandwidth(xhci, virt_dev, command->in_ctx)) { if ((xhci->quirks & XHCI_EP_LIMIT_QUIRK)) xhci_free_host_resources(xhci, ctrl_ctx); @@ -4179,8 +4179,10 @@ static int xhci_setup_device(struct usb_hcd *hcd, struct usb_device *udev, mutex_unlock(&xhci->mutex); ret = xhci_disable_slot(xhci, udev->slot_id); xhci_free_virt_device(xhci, udev->slot_id); - if (!ret) - xhci_alloc_dev(hcd, udev); + if (!ret) { + if (xhci_alloc_dev(hcd, udev) == 1) + xhci_setup_addressable_virt_dev(xhci, udev); + } kfree(command->completion); kfree(command); return -EPROTO; diff --git a/drivers/usb/serial/option.c b/drivers/usb/serial/option.c index 1263c82259ec..0a284bf9f0dc 100644 --- a/drivers/usb/serial/option.c +++ b/drivers/usb/serial/option.c @@ -619,6 +619,8 @@ static void option_instat_callback(struct urb *urb); /* MeiG Smart Technology products */ #define MEIGSMART_VENDOR_ID 0x2dee +/* MeiG Smart SRM825L based on Qualcomm 315 */ +#define MEIGSMART_PRODUCT_SRM825L 0x4d22 /* MeiG Smart SLM320 based on UNISOC UIS8910 */ #define MEIGSMART_PRODUCT_SLM320 0x4d41 @@ -2366,6 +2368,9 @@ static const struct usb_device_id option_ids[] = { { USB_DEVICE_AND_INTERFACE_INFO(UNISOC_VENDOR_ID, TOZED_PRODUCT_LT70C, 0xff, 0, 0) }, { USB_DEVICE_AND_INTERFACE_INFO(UNISOC_VENDOR_ID, LUAT_PRODUCT_AIR720U, 0xff, 0, 0) }, { USB_DEVICE_AND_INTERFACE_INFO(MEIGSMART_VENDOR_ID, MEIGSMART_PRODUCT_SLM320, 0xff, 0, 0) }, + { USB_DEVICE_AND_INTERFACE_INFO(MEIGSMART_VENDOR_ID, MEIGSMART_PRODUCT_SRM825L, 0xff, 0xff, 0x30) }, + { USB_DEVICE_AND_INTERFACE_INFO(MEIGSMART_VENDOR_ID, MEIGSMART_PRODUCT_SRM825L, 0xff, 0xff, 0x40) }, + { USB_DEVICE_AND_INTERFACE_INFO(MEIGSMART_VENDOR_ID, MEIGSMART_PRODUCT_SRM825L, 0xff, 0xff, 0x60) }, { } /* Terminating entry */ }; MODULE_DEVICE_TABLE(usb, option_ids); diff --git a/drivers/usb/serial/usb_debug.c b/drivers/usb/serial/usb_debug.c index aaf4813e4971..406cb326e812 100644 --- a/drivers/usb/serial/usb_debug.c +++ b/drivers/usb/serial/usb_debug.c @@ -69,6 +69,11 @@ static void usb_debug_process_read_urb(struct urb *urb) usb_serial_generic_process_read_urb(urb); } +static void usb_debug_init_termios(struct tty_struct *tty) +{ + tty->termios.c_lflag &= ~(ECHO | ECHONL); +} + static struct usb_serial_driver debug_device = { .driver = { .owner = THIS_MODULE, @@ -78,6 +83,7 @@ static struct usb_serial_driver debug_device = { .num_ports = 1, .bulk_out_size = USB_DEBUG_MAX_PACKET_SIZE, .break_ctl = usb_debug_break_ctl, + .init_termios = usb_debug_init_termios, .process_read_urb = usb_debug_process_read_urb, }; @@ -89,6 +95,7 @@ static struct usb_serial_driver dbc_device = { .id_table = dbc_id_table, .num_ports = 1, .break_ctl = usb_debug_break_ctl, + .init_termios = usb_debug_init_termios, .process_read_urb = usb_debug_process_read_urb, }; diff --git a/drivers/usb/usbip/vhci_hcd.c b/drivers/usb/usbip/vhci_hcd.c index 202dc76f7beb..b774fc4aef04 100644 --- a/drivers/usb/usbip/vhci_hcd.c +++ b/drivers/usb/usbip/vhci_hcd.c @@ -751,6 +751,7 @@ static int vhci_urb_enqueue(struct usb_hcd *hcd, struct urb *urb, gfp_t mem_flag * */ if (usb_pipedevice(urb->pipe) == 0) { + struct usb_device *old; __u8 type = usb_pipetype(urb->pipe); struct usb_ctrlrequest *ctrlreq = (struct usb_ctrlrequest *) urb->setup_packet; @@ -761,14 +762,15 @@ static int vhci_urb_enqueue(struct usb_hcd *hcd, struct urb *urb, gfp_t mem_flag goto no_need_xmit; } + old = vdev->udev; switch (ctrlreq->bRequest) { case USB_REQ_SET_ADDRESS: /* set_address may come when a device is reset */ dev_info(dev, "SetAddress Request (%d) to port %d\n", ctrlreq->wValue, vdev->rhport); - usb_put_dev(vdev->udev); vdev->udev = usb_get_dev(urb->dev); + usb_put_dev(old); spin_lock(&vdev->ud.lock); vdev->ud.status = VDEV_ST_USED; @@ -787,8 +789,8 @@ static int vhci_urb_enqueue(struct usb_hcd *hcd, struct urb *urb, gfp_t mem_flag usbip_dbg_vhci_hc( "Not yet?:Get_Descriptor to device 0 (get max pipe size)\n"); - usb_put_dev(vdev->udev); vdev->udev = usb_get_dev(urb->dev); + usb_put_dev(old); goto out; default: @@ -1095,6 +1097,7 @@ static void vhci_shutdown_connection(struct usbip_device *ud) static void vhci_device_reset(struct usbip_device *ud) { struct vhci_device *vdev = container_of(ud, struct vhci_device, ud); + struct usb_device *old = vdev->udev; unsigned long flags; spin_lock_irqsave(&ud->lock, flags); @@ -1102,8 +1105,8 @@ static void vhci_device_reset(struct usbip_device *ud) vdev->speed = 0; vdev->devid = 0; - usb_put_dev(vdev->udev); vdev->udev = NULL; + usb_put_dev(old); if (ud->tcp_socket) { sockfd_put(ud->tcp_socket); diff --git a/drivers/video/fbdev/core/fbcon.c b/drivers/video/fbdev/core/fbcon.c index dea5275254ef..402020776a3c 100644 --- a/drivers/video/fbdev/core/fbcon.c +++ b/drivers/video/fbdev/core/fbcon.c @@ -2734,6 +2734,34 @@ static void fbcon_set_all_vcs(struct fb_info *info) fbcon_modechanged(info); } +/* let fbcon check if it supports a new screen resolution */ +int fbcon_modechange_possible(struct fb_info *info, struct fb_var_screeninfo *var) +{ + struct fbcon_ops *ops = info->fbcon_par; + struct vc_data *vc; + unsigned int i; + + WARN_CONSOLE_UNLOCKED(); + + if (!ops) + return 0; + + /* prevent setting a screen size which is smaller than font size */ + for (i = first_fb_vc; i <= last_fb_vc; i++) { + vc = vc_cons[i].d; + if (!vc || vc->vc_mode != KD_TEXT || + registered_fb[con2fb_map[i]] != info) + continue; + + if (vc->vc_font.width > FBCON_SWAP(var->rotate, var->xres, var->yres) || + vc->vc_font.height > FBCON_SWAP(var->rotate, var->yres, var->xres)) + return -EINVAL; + } + + return 0; +} +EXPORT_SYMBOL_GPL(fbcon_modechange_possible); + static int fbcon_mode_deleted(struct fb_info *info, struct fb_videomode *mode) { diff --git a/drivers/video/fbdev/core/fbmem.c b/drivers/video/fbdev/core/fbmem.c index 4a0642dd5b37..8e1963b9504e 100644 --- a/drivers/video/fbdev/core/fbmem.c +++ b/drivers/video/fbdev/core/fbmem.c @@ -1006,6 +1006,17 @@ fb_set_var(struct fb_info *info, struct fb_var_screeninfo *var) if (ret) goto done; + /* verify that virtual resolution >= physical resolution */ + if (var->xres_virtual < var->xres || + var->yres_virtual < var->yres) { + pr_warn("WARNING: fbcon: Driver '%s' missed to adjust virtual screen size (%ux%u vs. %ux%u)\n", + info->fix.id, + var->xres_virtual, var->yres_virtual, + var->xres, var->yres); + ret = -EINVAL; + goto done; + } + if ((var->activate & FB_ACTIVATE_MASK) == FB_ACTIVATE_NOW) { struct fb_var_screeninfo old_var; struct fb_videomode mode; @@ -1128,9 +1139,12 @@ static long do_fb_ioctl(struct fb_info *info, unsigned int cmd, console_unlock(); return -ENODEV; } - info->flags |= FBINFO_MISC_USEREVENT; - ret = fb_set_var(info, &var); - info->flags &= ~FBINFO_MISC_USEREVENT; + ret = fbcon_modechange_possible(info, &var); + if (!ret) { + info->flags |= FBINFO_MISC_USEREVENT; + ret = fb_set_var(info, &var); + info->flags &= ~FBINFO_MISC_USEREVENT; + } unlock_fb_info(info); console_unlock(); if (!ret && copy_to_user(argp, &var, sizeof(var))) diff --git a/fs/binfmt_elf_fdpic.c b/fs/binfmt_elf_fdpic.c index a7c2efcd0a4a..0dbbb3a21e6c 100644 --- a/fs/binfmt_elf_fdpic.c +++ b/fs/binfmt_elf_fdpic.c @@ -324,7 +324,7 @@ static int load_elf_fdpic_binary(struct linux_binprm *bprm) else executable_stack = EXSTACK_DEFAULT; - if (stack_size == 0) { + if (stack_size == 0 && interp_params.flags & ELF_FDPIC_FLAG_PRESENT) { stack_size = interp_params.stack_size; if (interp_params.flags & ELF_FDPIC_FLAG_EXEC_STACK) executable_stack = EXSTACK_ENABLE_X; diff --git a/fs/binfmt_misc.c b/fs/binfmt_misc.c index 8fe7edd2b001..2df8d2bd1153 100644 --- a/fs/binfmt_misc.c +++ b/fs/binfmt_misc.c @@ -58,12 +58,11 @@ typedef struct { char *name; struct dentry *dentry; struct file *interp_file; + refcount_t users; /* sync removal with load_misc_binary() */ } Node; static DEFINE_RWLOCK(entries_lock); static struct file_system_type bm_fs_type; -static struct vfsmount *bm_mnt; -static int entry_count; /* * Max length of the register string. Determined by: @@ -80,19 +79,23 @@ static int entry_count; */ #define MAX_REGISTER_LENGTH 1920 -/* - * Check if we support the binfmt - * if we do, return the node, else NULL - * locking is done in load_misc_binary +/** + * search_binfmt_handler - search for a binary handler for @bprm + * @misc: handle to binfmt_misc instance + * @bprm: binary for which we are looking for a handler + * + * Search for a binary type handler for @bprm in the list of registered binary + * type handlers. + * + * Return: binary type list entry on success, NULL on failure */ -static Node *check_file(struct linux_binprm *bprm) +static Node *search_binfmt_handler(struct linux_binprm *bprm) { char *p = strrchr(bprm->interp, '.'); - struct list_head *l; + Node *e; /* Walk all the registered handlers. */ - list_for_each(l, &entries) { - Node *e = list_entry(l, Node, list); + list_for_each_entry(e, &entries, list) { char *s; int j; @@ -121,9 +124,49 @@ static Node *check_file(struct linux_binprm *bprm) if (j == e->size) return e; } + return NULL; } +/** + * get_binfmt_handler - try to find a binary type handler + * @misc: handle to binfmt_misc instance + * @bprm: binary for which we are looking for a handler + * + * Try to find a binfmt handler for the binary type. If one is found take a + * reference to protect against removal via bm_{entry,status}_write(). + * + * Return: binary type list entry on success, NULL on failure + */ +static Node *get_binfmt_handler(struct linux_binprm *bprm) +{ + Node *e; + + read_lock(&entries_lock); + e = search_binfmt_handler(bprm); + if (e) + refcount_inc(&e->users); + read_unlock(&entries_lock); + return e; +} + +/** + * put_binfmt_handler - put binary handler node + * @e: node to put + * + * Free node syncing with load_misc_binary() and defer final free to + * load_misc_binary() in case it is using the binary type handler we were + * requested to remove. + */ +static void put_binfmt_handler(Node *e) +{ + if (refcount_dec_and_test(&e->users)) { + if (e->flags & MISC_FMT_OPEN_FILE) + filp_close(e->interp_file, NULL); + kfree(e); + } +} + /* * the loader itself */ @@ -138,12 +181,7 @@ static int load_misc_binary(struct linux_binprm *bprm) if (!enabled) return retval; - /* to keep locking time low, we copy the interpreter string */ - read_lock(&entries_lock); - fmt = check_file(bprm); - if (fmt) - dget(fmt->dentry); - read_unlock(&entries_lock); + fmt = get_binfmt_handler(bprm); if (!fmt) return retval; @@ -237,7 +275,16 @@ static int load_misc_binary(struct linux_binprm *bprm) goto error; ret: - dput(fmt->dentry); + + /* + * If we actually put the node here all concurrent calls to + * load_misc_binary() will have finished. We also know + * that for the refcount to be zero ->evict_inode() must have removed + * the node to be deleted from the list. All that is left for us is to + * close and free. + */ + put_binfmt_handler(fmt); + return retval; error: if (fd_binary > 0) @@ -598,30 +645,90 @@ static struct inode *bm_get_inode(struct super_block *sb, int mode) return inode; } +/** + * bm_evict_inode - cleanup data associated with @inode + * @inode: inode to which the data is attached + * + * Cleanup the binary type handler data associated with @inode if a binary type + * entry is removed or the filesystem is unmounted and the super block is + * shutdown. + * + * If the ->evict call was not caused by a super block shutdown but by a write + * to remove the entry or all entries via bm_{entry,status}_write() the entry + * will have already been removed from the list. We keep the list_empty() check + * to make that explicit. +*/ static void bm_evict_inode(struct inode *inode) { Node *e = inode->i_private; - if (e && e->flags & MISC_FMT_OPEN_FILE) - filp_close(e->interp_file, NULL); - clear_inode(inode); - kfree(e); + + if (e) { + write_lock(&entries_lock); + if (!list_empty(&e->list)) + list_del_init(&e->list); + write_unlock(&entries_lock); + put_binfmt_handler(e); + } } -static void kill_node(Node *e) +/** + * unlink_binfmt_dentry - remove the dentry for the binary type handler + * @dentry: dentry associated with the binary type handler + * + * Do the actual filesystem work to remove a dentry for a registered binary + * type handler. Since binfmt_misc only allows simple files to be created + * directly under the root dentry of the filesystem we ensure that we are + * indeed passed a dentry directly beneath the root dentry, that the inode + * associated with the root dentry is locked, and that it is a regular file we + * are asked to remove. + */ +static void unlink_binfmt_dentry(struct dentry *dentry) { - struct dentry *dentry; + struct dentry *parent = dentry->d_parent; + struct inode *inode, *parent_inode; + /* All entries are immediate descendants of the root dentry. */ + if (WARN_ON_ONCE(dentry->d_sb->s_root != parent)) + return; + + /* We only expect to be called on regular files. */ + inode = d_inode(dentry); + if (WARN_ON_ONCE(!S_ISREG(inode->i_mode))) + return; + + /* The parent inode must be locked. */ + parent_inode = d_inode(parent); + if (WARN_ON_ONCE(!inode_is_locked(parent_inode))) + return; + + if (simple_positive(dentry)) { + dget(dentry); + simple_unlink(parent_inode, dentry); + d_delete(dentry); + dput(dentry); + } +} + +/** + * remove_binfmt_handler - remove a binary type handler + * @misc: handle to binfmt_misc instance + * @e: binary type handler to remove + * + * Remove a binary type handler from the list of binary type handlers and + * remove its associated dentry. This is called from + * binfmt_{entry,status}_write(). In the future, we might want to think about + * adding a proper ->unlink() method to binfmt_misc instead of forcing caller's + * to use writes to files in order to delete binary type handlers. But it has + * worked for so long that it's not a pressing issue. + */ +static void remove_binfmt_handler(Node *e) +{ write_lock(&entries_lock); list_del_init(&e->list); write_unlock(&entries_lock); - - dentry = e->dentry; - drop_nlink(d_inode(dentry)); - d_drop(dentry); - dput(dentry); - simple_release_fs(&bm_mnt, &entry_count); + unlink_binfmt_dentry(e->dentry); } /* / */ @@ -648,8 +755,8 @@ bm_entry_read(struct file *file, char __user *buf, size_t nbytes, loff_t *ppos) static ssize_t bm_entry_write(struct file *file, const char __user *buffer, size_t count, loff_t *ppos) { - struct dentry *root; - Node *e = file_inode(file)->i_private; + struct inode *inode = file_inode(file); + Node *e = inode->i_private; int res = parse_command(buffer, count); switch (res) { @@ -663,13 +770,22 @@ static ssize_t bm_entry_write(struct file *file, const char __user *buffer, break; case 3: /* Delete this handler. */ - root = file_inode(file)->i_sb->s_root; - inode_lock(d_inode(root)); + inode = d_inode(inode->i_sb->s_root); + inode_lock(inode); + /* + * In order to add new element or remove elements from the list + * via bm_{entry,register,status}_write() inode_lock() on the + * root inode must be held. + * The lock is exclusive ensuring that the list can't be + * modified. Only load_misc_binary() can access but does so + * read-only. So we only need to take the write lock when we + * actually remove the entry from the list. + */ if (!list_empty(&e->list)) - kill_node(e); + remove_binfmt_handler(e); - inode_unlock(d_inode(root)); + inode_unlock(inode); break; default: return res; @@ -728,13 +844,7 @@ static ssize_t bm_register_write(struct file *file, const char __user *buffer, if (!inode) goto out2; - err = simple_pin_fs(&bm_fs_type, &bm_mnt, &entry_count); - if (err) { - iput(inode); - inode = NULL; - goto out2; - } - + refcount_set(&e->users, 1); e->dentry = dget(dentry); inode->i_private = e; inode->i_fop = &bm_entry_operations; @@ -778,7 +888,8 @@ static ssize_t bm_status_write(struct file *file, const char __user *buffer, size_t count, loff_t *ppos) { int res = parse_command(buffer, count); - struct dentry *root; + Node *e, *next; + struct inode *inode; switch (res) { case 1: @@ -791,13 +902,22 @@ static ssize_t bm_status_write(struct file *file, const char __user *buffer, break; case 3: /* Delete all handlers. */ - root = file_inode(file)->i_sb->s_root; - inode_lock(d_inode(root)); + inode = d_inode(file_inode(file)->i_sb->s_root); + inode_lock(inode); - while (!list_empty(&entries)) - kill_node(list_first_entry(&entries, Node, list)); + /* + * In order to add new element or remove elements from the list + * via bm_{entry,register,status}_write() inode_lock() on the + * root inode must be held. + * The lock is exclusive ensuring that the list can't be + * modified. Only load_misc_binary() can access but does so + * read-only. So we only need to take the write lock when we + * actually remove the entry from the list. + */ + list_for_each_entry_safe(e, next, &entries, list) + remove_binfmt_handler(e); - inode_unlock(d_inode(root)); + inode_unlock(inode); break; default: return res; diff --git a/fs/btrfs/delayed-inode.c b/fs/btrfs/delayed-inode.c index fec62782fc86..fa8f359d8999 100644 --- a/fs/btrfs/delayed-inode.c +++ b/fs/btrfs/delayed-inode.c @@ -984,7 +984,7 @@ static void btrfs_release_delayed_inode(struct btrfs_delayed_node *delayed_node) if (delayed_node && test_bit(BTRFS_DELAYED_NODE_INODE_DIRTY, &delayed_node->flags)) { - BUG_ON(!delayed_node->root); + ASSERT(delayed_node->root); clear_bit(BTRFS_DELAYED_NODE_INODE_DIRTY, &delayed_node->flags); delayed_node->count--; diff --git a/fs/btrfs/free-space-cache.c b/fs/btrfs/free-space-cache.c index b623e9f3b4c4..e383c75b67a6 100644 --- a/fs/btrfs/free-space-cache.c +++ b/fs/btrfs/free-space-cache.c @@ -787,6 +787,7 @@ static int __load_free_space_cache(struct btrfs_root *root, struct inode *inode, spin_unlock(&ctl->tree_lock); btrfs_err(fs_info, "Duplicate entries in free space cache, dumping"); + kmem_cache_free(btrfs_free_space_bitmap_cachep, e->bitmap); kmem_cache_free(btrfs_free_space_cachep, e); goto free_cache; } @@ -1731,9 +1732,9 @@ static void bitmap_clear_bits(struct btrfs_free_space_ctl *ctl, ctl->free_space -= bytes; } -static void bitmap_set_bits(struct btrfs_free_space_ctl *ctl, - struct btrfs_free_space *info, u64 offset, - u64 bytes) +static void btrfs_bitmap_set_bits(struct btrfs_free_space_ctl *ctl, + struct btrfs_free_space *info, u64 offset, + u64 bytes) { unsigned long start, count; @@ -1990,7 +1991,7 @@ static u64 add_bytes_to_bitmap(struct btrfs_free_space_ctl *ctl, bytes_to_set = min(end - offset, bytes); - bitmap_set_bits(ctl, info, offset, bytes_to_set); + btrfs_bitmap_set_bits(ctl, info, offset, bytes_to_set); /* * We set some bytes, we have no idea what the max extent size is diff --git a/fs/btrfs/inode.c b/fs/btrfs/inode.c index 7f675862ffb0..15ebebed4005 100644 --- a/fs/btrfs/inode.c +++ b/fs/btrfs/inode.c @@ -4296,7 +4296,14 @@ static noinline int may_destroy_subvol(struct btrfs_root *root) ret = btrfs_search_slot(NULL, fs_info->tree_root, &key, path, 0, 0); if (ret < 0) goto out; - BUG_ON(ret == 0); + if (ret == 0) { + /* + * Key with offset -1 found, there would have to exist a root + * with such id, but this is out of valid range. + */ + ret = -EUCLEAN; + goto out; + } ret = 0; if (path->slots[0] > 0) { diff --git a/fs/btrfs/qgroup.c b/fs/btrfs/qgroup.c index ef95525fa6cd..770e6f652a1e 100644 --- a/fs/btrfs/qgroup.c +++ b/fs/btrfs/qgroup.c @@ -2095,8 +2095,6 @@ int btrfs_qgroup_account_extent(struct btrfs_trans_handle *trans, u64 bytenr, if (nr_old_roots == 0 && nr_new_roots == 0) goto out_free; - BUG_ON(!fs_info->quota_root); - trace_btrfs_qgroup_account_extent(fs_info, trans->transid, bytenr, num_bytes, nr_old_roots, nr_new_roots); diff --git a/fs/btrfs/send.c b/fs/btrfs/send.c index e3b6ca9176af..2840abf2037b 100644 --- a/fs/btrfs/send.c +++ b/fs/btrfs/send.c @@ -677,7 +677,12 @@ static int begin_cmd(struct send_ctx *sctx, int cmd) if (WARN_ON(!sctx->send_buf)) return -EINVAL; - BUG_ON(sctx->send_size); + if (unlikely(sctx->send_size != 0)) { + btrfs_err(sctx->send_root->fs_info, + "send: command header buffer not empty cmd %d offset %llu", + cmd, sctx->send_off); + return -EINVAL; + } sctx->send_size += sizeof(*hdr); hdr = (struct btrfs_cmd_header *)sctx->send_buf; diff --git a/fs/dcache.c b/fs/dcache.c index 682526c61358..247442141ddf 100644 --- a/fs/dcache.c +++ b/fs/dcache.c @@ -2970,28 +2970,25 @@ EXPORT_SYMBOL(d_splice_alias); bool is_subdir(struct dentry *new_dentry, struct dentry *old_dentry) { - bool result; + bool subdir; unsigned seq; if (new_dentry == old_dentry) return true; - do { - /* for restarting inner loop in case of seq retry */ - seq = read_seqbegin(&rename_lock); - /* - * Need rcu_readlock to protect against the d_parent trashing - * due to d_move - */ - rcu_read_lock(); - if (d_ancestor(old_dentry, new_dentry)) - result = true; - else - result = false; - rcu_read_unlock(); - } while (read_seqretry(&rename_lock, seq)); - - return result; + /* Access d_parent under rcu as d_move() may change it. */ + rcu_read_lock(); + seq = read_seqbegin(&rename_lock); + subdir = d_ancestor(old_dentry, new_dentry); + /* Try lockless once... */ + if (read_seqretry(&rename_lock, seq)) { + /* ...else acquire lock for progress even on deep chains. */ + read_seqlock_excl(&rename_lock); + subdir = d_ancestor(old_dentry, new_dentry); + read_sequnlock_excl(&rename_lock); + } + rcu_read_unlock(); + return subdir; } EXPORT_SYMBOL(is_subdir); diff --git a/fs/exec.c b/fs/exec.c index ff7ae4c2c5e1..b91811b0f3f9 100644 --- a/fs/exec.c +++ b/fs/exec.c @@ -1528,6 +1528,7 @@ static void bprm_fill_uid(struct linux_binprm *bprm) unsigned int mode; kuid_t uid; kgid_t gid; + int err; /* * Since this can be called multiple times (via prepare_binprm), @@ -1552,12 +1553,17 @@ static void bprm_fill_uid(struct linux_binprm *bprm) /* Be careful if suid/sgid is set */ inode_lock(inode); - /* reload atomically mode/uid/gid now that lock held */ + /* Atomically reload and check mode/uid/gid now that lock held. */ mode = inode->i_mode; uid = inode->i_uid; gid = inode->i_gid; + err = inode_permission(inode, MAY_EXEC); inode_unlock(inode); + /* Did the exec bit vanish out from under us? Give up. */ + if (err) + return; + /* We ignore suid/sgid if there are no mappings for them in the ns */ if (!kuid_has_mapping(bprm->cred->user_ns, uid) || !kgid_has_mapping(bprm->cred->user_ns, gid)) diff --git a/fs/ext4/extents.c b/fs/ext4/extents.c index fd63fb42df09..b4a91836607d 100644 --- a/fs/ext4/extents.c +++ b/fs/ext4/extents.c @@ -3445,9 +3445,10 @@ static int ext4_ext_convert_to_initialized(handle_t *handle, struct ext4_extent *ex, *abut_ex; ext4_lblk_t ee_block, eof_block; unsigned int ee_len, depth, map_len = map->m_len; - int allocated = 0, max_zeroout = 0; int err = 0; int split_flag = EXT4_EXT_DATA_VALID2; + int allocated = 0; + unsigned int max_zeroout = 0; ext_debug("ext4_ext_convert_to_initialized: inode %lu, logical" "block %llu, max_blocks %u\n", inode->i_ino, diff --git a/fs/ext4/mballoc.c b/fs/ext4/mballoc.c index 5af5ad53e0ad..75dbe40ed8f7 100644 --- a/fs/ext4/mballoc.c +++ b/fs/ext4/mballoc.c @@ -1850,8 +1850,7 @@ int ext4_mb_find_by_goal(struct ext4_allocation_context *ac, if (max >= ac->ac_g_ex.fe_len && ac->ac_g_ex.fe_len == sbi->s_stripe) { ext4_fsblk_t start; - start = ext4_group_first_block_no(ac->ac_sb, e4b->bd_group) + - ex.fe_start; + start = ext4_grp_offs_to_block(ac->ac_sb, &ex); /* use do_div to get remainder (would be 64-bit modulo) */ if (do_div(start, sbi->s_stripe) == 0) { ac->ac_found++; @@ -5220,6 +5219,9 @@ static int ext4_try_to_trim_range(struct super_block *sb, bool set_trimmed = false; void *bitmap; + if (unlikely(EXT4_MB_GRP_BBITMAP_CORRUPT(e4b->bd_info))) + return 0; + last = ext4_last_grp_cluster(sb, e4b->bd_group); bitmap = e4b->bd_bitmap; if (start == 0 && max >= last) diff --git a/fs/ext4/namei.c b/fs/ext4/namei.c index 1bb433d22a7c..172e5bdbe591 100644 --- a/fs/ext4/namei.c +++ b/fs/ext4/namei.c @@ -135,10 +135,11 @@ static struct buffer_head *__ext4_read_dirblock(struct inode *inode, return bh; } - if (!bh && (type == INDEX || type == DIRENT_HTREE)) { + /* The first directory block must not be a hole. */ + if (!bh && (type == INDEX || type == DIRENT_HTREE || block == 0)) { ext4_error_inode(inode, func, line, block, - "Directory hole found for htree %s block", - (type == INDEX) ? "index" : "leaf"); + "Directory hole found for htree %s block %u", + (type == INDEX) ? "index" : "leaf", block); return ERR_PTR(-EFSCORRUPTED); } if (!bh) @@ -2179,6 +2180,52 @@ static int add_dirent_to_buf(handle_t *handle, struct ext4_filename *fname, return 0; } +static bool ext4_check_dx_root(struct inode *dir, struct dx_root *root) +{ + struct fake_dirent *fde; + const char *error_msg; + unsigned int rlen; + unsigned int blocksize = dir->i_sb->s_blocksize; + char *blockend = (char *)root + dir->i_sb->s_blocksize; + + fde = &root->dot; + if (unlikely(fde->name_len != 1)) { + error_msg = "invalid name_len for '.'"; + goto corrupted; + } + if (unlikely(strncmp(root->dot_name, ".", fde->name_len))) { + error_msg = "invalid name for '.'"; + goto corrupted; + } + rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize); + if (unlikely((char *)fde + rlen >= blockend)) { + error_msg = "invalid rec_len for '.'"; + goto corrupted; + } + + fde = &root->dotdot; + if (unlikely(fde->name_len != 2)) { + error_msg = "invalid name_len for '..'"; + goto corrupted; + } + if (unlikely(strncmp(root->dotdot_name, "..", fde->name_len))) { + error_msg = "invalid name for '..'"; + goto corrupted; + } + rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize); + if (unlikely((char *)fde + rlen >= blockend)) { + error_msg = "invalid rec_len for '..'"; + goto corrupted; + } + + return true; + +corrupted: + EXT4_ERROR_INODE(dir, "Corrupt dir, %s, running e2fsck is recommended", + error_msg); + return false; +} + /* * This converts a one block unindexed directory to a 3 block indexed * directory, and adds the dentry to the indexed directory. @@ -2213,17 +2260,17 @@ static int make_indexed_dir(handle_t *handle, struct ext4_filename *fname, brelse(bh); return retval; } + root = (struct dx_root *) bh->b_data; + if (!ext4_check_dx_root(dir, root)) { + brelse(bh); + return -EFSCORRUPTED; + } /* The 0th block becomes the root, move the dirents out */ fde = &root->dotdot; de = (struct ext4_dir_entry_2 *)((char *)fde + ext4_rec_len_from_disk(fde->rec_len, blocksize)); - if ((char *) de >= (((char *) root) + blocksize)) { - EXT4_ERROR_INODE(dir, "invalid rec_len for '..'"); - brelse(bh); - return -EFSCORRUPTED; - } len = ((char *) root) + (blocksize - csum_size) - (char *) de; /* Allocate new block for the 0th block's dirents */ @@ -3003,10 +3050,7 @@ bool ext4_empty_dir(struct inode *inode) EXT4_ERROR_INODE(inode, "invalid size"); return true; } - /* The first directory block must not be a hole, - * so treat it as DIRENT_HTREE - */ - bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE); + bh = ext4_read_dirblock(inode, 0, EITHER); if (IS_ERR(bh)) return true; @@ -3600,10 +3644,7 @@ static struct buffer_head *ext4_get_first_dir_block(handle_t *handle, struct ext4_dir_entry_2 *de; unsigned int offset; - /* The first directory block must not be a hole, so - * treat it as DIRENT_HTREE - */ - bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE); + bh = ext4_read_dirblock(inode, 0, EITHER); if (IS_ERR(bh)) { *retval = PTR_ERR(bh); return NULL; diff --git a/fs/ext4/xattr.c b/fs/ext4/xattr.c index dc42a8fba0d2..e9299f769dbf 100644 --- a/fs/ext4/xattr.c +++ b/fs/ext4/xattr.c @@ -1420,6 +1420,12 @@ retry: goto out; memcpy(bh->b_data, buf, csize); + /* + * Zero out block tail to avoid writing uninitialized memory + * to disk. + */ + if (csize < blocksize) + memset(bh->b_data + csize, 0, blocksize - csize); set_buffer_uptodate(bh); ext4_handle_dirty_metadata(handle, ea_inode, bh); diff --git a/fs/f2fs/inode.c b/fs/f2fs/inode.c index 00c8f74c65d0..cc99adf19dbf 100644 --- a/fs/f2fs/inode.c +++ b/fs/f2fs/inode.c @@ -23,6 +23,9 @@ void f2fs_mark_inode_dirty_sync(struct inode *inode, bool sync) if (is_inode_flag_set(inode, FI_NEW_INODE)) return; + if (f2fs_readonly(F2FS_I_SB(inode)->sb)) + return; + if (f2fs_inode_dirtied(inode, sync)) return; diff --git a/fs/f2fs/segment.c b/fs/f2fs/segment.c index 03658c7dc5d9..293f18f764cb 100644 --- a/fs/f2fs/segment.c +++ b/fs/f2fs/segment.c @@ -2145,6 +2145,8 @@ static void update_sit_entry(struct f2fs_sb_info *sbi, block_t blkaddr, int del) #endif segno = GET_SEGNO(sbi, blkaddr); + if (segno == NULL_SEGNO) + return; se = get_seg_entry(sbi, segno); new_vblocks = se->valid_blocks + del; @@ -3150,8 +3152,7 @@ void f2fs_allocate_data_block(struct f2fs_sb_info *sbi, struct page *page, * since SSR needs latest valid block information. */ update_sit_entry(sbi, *new_blkaddr, 1); - if (GET_SEGNO(sbi, old_blkaddr) != NULL_SEGNO) - update_sit_entry(sbi, old_blkaddr, -1); + update_sit_entry(sbi, old_blkaddr, -1); if (!__has_curseg_space(sbi, type)) sit_i->s_ops->allocate_segment(sbi, type, false); diff --git a/fs/file.c b/fs/file.c index 928ba7b8df1e..64faefe4e082 100644 --- a/fs/file.c +++ b/fs/file.c @@ -41,27 +41,23 @@ static void free_fdtable_rcu(struct rcu_head *rcu) #define BITBIT_NR(nr) BITS_TO_LONGS(BITS_TO_LONGS(nr)) #define BITBIT_SIZE(nr) (BITBIT_NR(nr) * sizeof(long)) +#define fdt_words(fdt) ((fdt)->max_fds / BITS_PER_LONG) // words in ->open_fds /* * Copy 'count' fd bits from the old table to the new table and clear the extra * space if any. This does not copy the file pointers. Called with the files * spinlock held for write. */ -static void copy_fd_bitmaps(struct fdtable *nfdt, struct fdtable *ofdt, - unsigned int count) +static inline void copy_fd_bitmaps(struct fdtable *nfdt, struct fdtable *ofdt, + unsigned int copy_words) { - unsigned int cpy, set; + unsigned int nwords = fdt_words(nfdt); - cpy = count / BITS_PER_BYTE; - set = (nfdt->max_fds - count) / BITS_PER_BYTE; - memcpy(nfdt->open_fds, ofdt->open_fds, cpy); - memset((char *)nfdt->open_fds + cpy, 0, set); - memcpy(nfdt->close_on_exec, ofdt->close_on_exec, cpy); - memset((char *)nfdt->close_on_exec + cpy, 0, set); - - cpy = BITBIT_SIZE(count); - set = BITBIT_SIZE(nfdt->max_fds) - cpy; - memcpy(nfdt->full_fds_bits, ofdt->full_fds_bits, cpy); - memset((char *)nfdt->full_fds_bits + cpy, 0, set); + bitmap_copy_and_extend(nfdt->open_fds, ofdt->open_fds, + copy_words * BITS_PER_LONG, nwords * BITS_PER_LONG); + bitmap_copy_and_extend(nfdt->close_on_exec, ofdt->close_on_exec, + copy_words * BITS_PER_LONG, nwords * BITS_PER_LONG); + bitmap_copy_and_extend(nfdt->full_fds_bits, ofdt->full_fds_bits, + copy_words, nwords); } /* @@ -79,7 +75,7 @@ static void copy_fdtable(struct fdtable *nfdt, struct fdtable *ofdt) memcpy(nfdt->fd, ofdt->fd, cpy); memset((char *)nfdt->fd + cpy, 0, set); - copy_fd_bitmaps(nfdt, ofdt, ofdt->max_fds); + copy_fd_bitmaps(nfdt, ofdt, fdt_words(ofdt)); } static struct fdtable * alloc_fdtable(unsigned int nr) @@ -330,7 +326,7 @@ struct files_struct *dup_fd(struct files_struct *oldf, int *errorp) open_files = count_open_files(old_fdt); } - copy_fd_bitmaps(new_fdt, old_fdt, open_files); + copy_fd_bitmaps(new_fdt, old_fdt, open_files / BITS_PER_LONG); old_fds = old_fdt->fd; new_fds = new_fdt->fd; @@ -462,12 +458,12 @@ struct files_struct init_files = { static unsigned int find_next_fd(struct fdtable *fdt, unsigned int start) { - unsigned int maxfd = fdt->max_fds; + unsigned int maxfd = fdt->max_fds; /* always multiple of BITS_PER_LONG */ unsigned int maxbit = maxfd / BITS_PER_LONG; unsigned int bitbit = start / BITS_PER_LONG; bitbit = find_next_zero_bit(fdt->full_fds_bits, maxbit, bitbit) * BITS_PER_LONG; - if (bitbit > maxfd) + if (bitbit >= maxfd) return maxfd; if (bitbit > start) start = bitbit; @@ -879,6 +875,7 @@ __releases(&files->file_lock) * tables and this condition does not arise without those. */ fdt = files_fdtable(files); + fd = array_index_nospec(fd, fdt->max_fds); tofree = fdt->fd[fd]; if (!tofree && fd_is_open(fd, fdt)) goto Ebusy; diff --git a/fs/fuse/dev.c b/fs/fuse/dev.c index a047a7f62f8f..5ecaa8cc02dc 100644 --- a/fs/fuse/dev.c +++ b/fs/fuse/dev.c @@ -1681,9 +1681,11 @@ static int fuse_notify_store(struct fuse_conn *fc, unsigned int size, this_num = min_t(unsigned, num, PAGE_SIZE - offset); err = fuse_copy_page(cs, &page, offset, this_num, 0); - if (!err && offset == 0 && - (this_num == PAGE_SIZE || file_size == end)) + if (!PageUptodate(page) && !err && offset == 0 && + (this_num == PAGE_SIZE || file_size == end)) { + zero_user_segment(page, this_num, PAGE_SIZE); SetPageUptodate(page); + } unlock_page(page); put_page(page); diff --git a/fs/gfs2/inode.c b/fs/gfs2/inode.c index a52b8b0dceeb..16febedaa4a5 100644 --- a/fs/gfs2/inode.c +++ b/fs/gfs2/inode.c @@ -1847,7 +1847,7 @@ static int setattr_chown(struct inode *inode, struct iattr *attr) kuid_t ouid, nuid; kgid_t ogid, ngid; int error; - struct gfs2_alloc_parms ap; + struct gfs2_alloc_parms ap = {}; ouid = inode->i_uid; ogid = inode->i_gid; diff --git a/fs/hfs/inode.c b/fs/hfs/inode.c index ee2ea5532e69..c58792cab2be 100644 --- a/fs/hfs/inode.c +++ b/fs/hfs/inode.c @@ -199,6 +199,7 @@ struct inode *hfs_new_inode(struct inode *dir, const struct qstr *name, umode_t HFS_I(inode)->flags = 0; HFS_I(inode)->rsrc_inode = NULL; HFS_I(inode)->fs_blocks = 0; + HFS_I(inode)->tz_secondswest = sys_tz.tz_minuteswest * 60; if (S_ISDIR(mode)) { inode->i_size = 2; HFS_SB(sb)->folder_count++; @@ -274,6 +275,8 @@ void hfs_inode_read_fork(struct inode *inode, struct hfs_extent *ext, for (count = 0, i = 0; i < 3; i++) count += be16_to_cpu(ext[i].count); HFS_I(inode)->first_blocks = count; + HFS_I(inode)->cached_start = 0; + HFS_I(inode)->cached_blocks = 0; inode->i_size = HFS_I(inode)->phys_size = log_size; HFS_I(inode)->fs_blocks = (log_size + sb->s_blocksize - 1) >> sb->s_blocksize_bits; diff --git a/fs/hfsplus/bfind.c b/fs/hfsplus/bfind.c index ca2ba8c9f82e..901e83d65d20 100644 --- a/fs/hfsplus/bfind.c +++ b/fs/hfsplus/bfind.c @@ -25,19 +25,8 @@ int hfs_find_init(struct hfs_btree *tree, struct hfs_find_data *fd) fd->key = ptr + tree->max_key_len + 2; hfs_dbg(BNODE_REFS, "find_init: %d (%p)\n", tree->cnid, __builtin_return_address(0)); - switch (tree->cnid) { - case HFSPLUS_CAT_CNID: - mutex_lock_nested(&tree->tree_lock, CATALOG_BTREE_MUTEX); - break; - case HFSPLUS_EXT_CNID: - mutex_lock_nested(&tree->tree_lock, EXTENTS_BTREE_MUTEX); - break; - case HFSPLUS_ATTR_CNID: - mutex_lock_nested(&tree->tree_lock, ATTR_BTREE_MUTEX); - break; - default: - BUG(); - } + mutex_lock_nested(&tree->tree_lock, + hfsplus_btree_lock_class(tree)); return 0; } diff --git a/fs/hfsplus/extents.c b/fs/hfsplus/extents.c index 7054a542689f..c95a2f0ed4a7 100644 --- a/fs/hfsplus/extents.c +++ b/fs/hfsplus/extents.c @@ -430,7 +430,8 @@ int hfsplus_free_fork(struct super_block *sb, u32 cnid, hfsplus_free_extents(sb, ext_entry, total_blocks - start, total_blocks); total_blocks = start; - mutex_lock(&fd.tree->tree_lock); + mutex_lock_nested(&fd.tree->tree_lock, + hfsplus_btree_lock_class(fd.tree)); } while (total_blocks > blocks); hfs_find_exit(&fd); @@ -592,7 +593,8 @@ void hfsplus_file_truncate(struct inode *inode) alloc_cnt, alloc_cnt - blk_cnt); hfsplus_dump_extent(hip->first_extents); hip->first_blocks = blk_cnt; - mutex_lock(&fd.tree->tree_lock); + mutex_lock_nested(&fd.tree->tree_lock, + hfsplus_btree_lock_class(fd.tree)); break; } res = __hfsplus_ext_cache_extent(&fd, inode, alloc_cnt); @@ -606,7 +608,8 @@ void hfsplus_file_truncate(struct inode *inode) hfsplus_free_extents(sb, hip->cached_extents, alloc_cnt - start, alloc_cnt - blk_cnt); hfsplus_dump_extent(hip->cached_extents); - mutex_lock(&fd.tree->tree_lock); + mutex_lock_nested(&fd.tree->tree_lock, + hfsplus_btree_lock_class(fd.tree)); if (blk_cnt > start) { hip->extent_state |= HFSPLUS_EXT_DIRTY; break; diff --git a/fs/hfsplus/hfsplus_fs.h b/fs/hfsplus/hfsplus_fs.h index db2e1c750199..e9b13f771990 100644 --- a/fs/hfsplus/hfsplus_fs.h +++ b/fs/hfsplus/hfsplus_fs.h @@ -537,6 +537,27 @@ int hfsplus_read_wrapper(struct super_block *sb); #define __hfsp_mt2ut(t) (be32_to_cpu(t) - 2082844800U) #define __hfsp_ut2mt(t) (cpu_to_be32(t + 2082844800U)) +static inline enum hfsplus_btree_mutex_classes +hfsplus_btree_lock_class(struct hfs_btree *tree) +{ + enum hfsplus_btree_mutex_classes class; + + switch (tree->cnid) { + case HFSPLUS_CAT_CNID: + class = CATALOG_BTREE_MUTEX; + break; + case HFSPLUS_EXT_CNID: + class = EXTENTS_BTREE_MUTEX; + break; + case HFSPLUS_ATTR_CNID: + class = ATTR_BTREE_MUTEX; + break; + default: + BUG(); + } + return class; +} + /* compatibility */ #define hfsp_mt2ut(t) (struct timespec){ .tv_sec = __hfsp_mt2ut(t) } #define hfsp_ut2mt(t) __hfsp_ut2mt((t).tv_sec) diff --git a/fs/hfsplus/xattr.c b/fs/hfsplus/xattr.c index d5403b4004c9..cf8647a4c35b 100644 --- a/fs/hfsplus/xattr.c +++ b/fs/hfsplus/xattr.c @@ -700,7 +700,7 @@ ssize_t hfsplus_listxattr(struct dentry *dentry, char *buffer, size_t size) return err; } - strbuf = kmalloc(NLS_MAX_CHARSET_SIZE * HFSPLUS_ATTR_MAX_STRLEN + + strbuf = kzalloc(NLS_MAX_CHARSET_SIZE * HFSPLUS_ATTR_MAX_STRLEN + XATTR_MAC_OSX_PREFIX_LEN + 1, GFP_KERNEL); if (!strbuf) { res = -ENOMEM; diff --git a/fs/jbd2/journal.c b/fs/jbd2/journal.c index 629928b19e48..08cff80f8c29 100644 --- a/fs/jbd2/journal.c +++ b/fs/jbd2/journal.c @@ -430,6 +430,7 @@ repeat: tmp = jbd2_alloc(bh_in->b_size, GFP_NOFS); if (!tmp) { brelse(new_bh); + free_buffer_head(new_bh); return -ENOMEM; } jbd_lock_bh_state(bh_in); diff --git a/fs/jfs/jfs_imap.c b/fs/jfs/jfs_imap.c index 00800c8c6f07..9893cb6b8a75 100644 --- a/fs/jfs/jfs_imap.c +++ b/fs/jfs/jfs_imap.c @@ -305,7 +305,7 @@ int diSync(struct inode *ipimap) int diRead(struct inode *ip) { struct jfs_sb_info *sbi = JFS_SBI(ip->i_sb); - int iagno, ino, extno, rc; + int iagno, ino, extno, rc, agno; struct inode *ipimap; struct dinode *dp; struct iag *iagp; @@ -354,8 +354,11 @@ int diRead(struct inode *ip) /* get the ag for the iag */ agstart = le64_to_cpu(iagp->agstart); + agno = BLKTOAG(agstart, JFS_SBI(ip->i_sb)); release_metapage(mp); + if (agno >= MAXAG || agno < 0) + return -EIO; rel_inode = (ino & (INOSPERPAGE - 1)); pageno = blkno >> sbi->l2nbperpage; diff --git a/fs/jfs/xattr.c b/fs/jfs/xattr.c index e8b12e708428..37b984692ca9 100644 --- a/fs/jfs/xattr.c +++ b/fs/jfs/xattr.c @@ -810,7 +810,7 @@ ssize_t __jfs_getxattr(struct inode *inode, const char *name, void *data, size_t buf_size) { struct jfs_ea_list *ealist; - struct jfs_ea *ea; + struct jfs_ea *ea, *ealist_end; struct ea_buffer ea_buf; int xattr_size; ssize_t size; @@ -830,9 +830,16 @@ ssize_t __jfs_getxattr(struct inode *inode, const char *name, void *data, goto not_found; ealist = (struct jfs_ea_list *) ea_buf.xattr; + ealist_end = END_EALIST(ealist); /* Find the named attribute */ - for (ea = FIRST_EA(ealist); ea < END_EALIST(ealist); ea = NEXT_EA(ea)) + for (ea = FIRST_EA(ealist); ea < ealist_end; ea = NEXT_EA(ea)) { + if (unlikely(ea + 1 > ealist_end) || + unlikely(NEXT_EA(ea) > ealist_end)) { + size = -EUCLEAN; + goto release; + } + if ((namelen == ea->namelen) && memcmp(name, ea->name, namelen) == 0) { /* Found it */ @@ -847,6 +854,7 @@ ssize_t __jfs_getxattr(struct inode *inode, const char *name, void *data, memcpy(data, value, size); goto release; } + } not_found: size = -ENODATA; release: @@ -874,7 +882,7 @@ ssize_t jfs_listxattr(struct dentry * dentry, char *data, size_t buf_size) ssize_t size = 0; int xattr_size; struct jfs_ea_list *ealist; - struct jfs_ea *ea; + struct jfs_ea *ea, *ealist_end; struct ea_buffer ea_buf; down_read(&JFS_IP(inode)->xattr_sem); @@ -889,9 +897,16 @@ ssize_t jfs_listxattr(struct dentry * dentry, char *data, size_t buf_size) goto release; ealist = (struct jfs_ea_list *) ea_buf.xattr; + ealist_end = END_EALIST(ealist); /* compute required size of list */ - for (ea = FIRST_EA(ealist); ea < END_EALIST(ealist); ea = NEXT_EA(ea)) { + for (ea = FIRST_EA(ealist); ea < ealist_end; ea = NEXT_EA(ea)) { + if (unlikely(ea + 1 > ealist_end) || + unlikely(NEXT_EA(ea) > ealist_end)) { + size = -EUCLEAN; + goto release; + } + if (can_list(ea)) size += name_size(ea) + 1; } diff --git a/fs/locks.c b/fs/locks.c index 28270e74be34..b1201b01867a 100644 --- a/fs/locks.c +++ b/fs/locks.c @@ -2297,8 +2297,9 @@ int fcntl_setlk(unsigned int fd, struct file *filp, unsigned int cmd, error = do_lock_file_wait(filp, cmd, file_lock); /* - * Attempt to detect a close/fcntl race and recover by releasing the - * lock that was just acquired. There is no need to do that when we're + * Detect close/fcntl races and recover by zapping all POSIX locks + * associated with this file and our files_struct, just like on + * filp_flush(). There is no need to do that when we're * unlocking though, or for OFD locks. */ if (!error && file_lock->fl_type != F_UNLCK && @@ -2312,9 +2313,7 @@ int fcntl_setlk(unsigned int fd, struct file *filp, unsigned int cmd, f = fcheck(fd); spin_unlock(¤t->files->file_lock); if (f != filp) { - file_lock->fl_type = F_UNLCK; - error = do_lock_file_wait(filp, cmd, file_lock); - WARN_ON_ONCE(error); + locks_remove_posix(filp, current->files); error = -EBADF; } } @@ -2428,8 +2427,9 @@ int fcntl_setlk64(unsigned int fd, struct file *filp, unsigned int cmd, error = do_lock_file_wait(filp, cmd, file_lock); /* - * Attempt to detect a close/fcntl race and recover by releasing the - * lock that was just acquired. There is no need to do that when we're + * Detect close/fcntl races and recover by zapping all POSIX locks + * associated with this file and our files_struct, just like on + * filp_flush(). There is no need to do that when we're * unlocking though, or for OFD locks. */ if (!error && file_lock->fl_type != F_UNLCK && @@ -2443,9 +2443,7 @@ int fcntl_setlk64(unsigned int fd, struct file *filp, unsigned int cmd, f = fcheck(fd); spin_unlock(¤t->files->file_lock); if (f != filp) { - file_lock->fl_type = F_UNLCK; - error = do_lock_file_wait(filp, cmd, file_lock); - WARN_ON_ONCE(error); + locks_remove_posix(filp, current->files); error = -EBADF; } } diff --git a/fs/nfs/pnfs.c b/fs/nfs/pnfs.c index cfb1fe5dfb1e..7a0d9a1e6d13 100644 --- a/fs/nfs/pnfs.c +++ b/fs/nfs/pnfs.c @@ -1889,6 +1889,14 @@ pnfs_update_layout(struct inode *ino, } lookup_again: + if (!nfs4_valid_open_stateid(ctx->state)) { + trace_pnfs_update_layout(ino, pos, count, + iomode, lo, lseg, + PNFS_UPDATE_LAYOUT_INVALID_OPEN); + lseg = ERR_PTR(-EIO); + goto out; + } + lseg = ERR_PTR(nfs4_client_recover_expired_lease(clp)); if (IS_ERR(lseg)) goto out; diff --git a/fs/nilfs2/btnode.c b/fs/nilfs2/btnode.c index 677ff78d54fb..eb195c33c9a9 100644 --- a/fs/nilfs2/btnode.c +++ b/fs/nilfs2/btnode.c @@ -51,12 +51,21 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr) bh = nilfs_grab_buffer(inode, btnc, blocknr, BIT(BH_NILFS_Node)); if (unlikely(!bh)) - return NULL; + return ERR_PTR(-ENOMEM); if (unlikely(buffer_mapped(bh) || buffer_uptodate(bh) || buffer_dirty(bh))) { - brelse(bh); - BUG(); + /* + * The block buffer at the specified new address was already + * in use. This can happen if it is a virtual block number + * and has been reallocated due to corruption of the bitmap + * used to manage its allocation state (if not, the buffer + * clearing of an abandoned b-tree node is missing somewhere). + */ + nilfs_error(inode->i_sb, + "state inconsistency probably due to duplicate use of b-tree node block address %llu (ino=%lu)", + (unsigned long long)blocknr, inode->i_ino); + goto failed; } memset(bh->b_data, 0, i_blocksize(inode)); bh->b_bdev = inode->i_sb->s_bdev; @@ -67,6 +76,12 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr) unlock_page(bh->b_page); put_page(bh->b_page); return bh; + +failed: + unlock_page(bh->b_page); + put_page(bh->b_page); + brelse(bh); + return ERR_PTR(-EIO); } int nilfs_btnode_submit_block(struct address_space *btnc, __u64 blocknr, @@ -224,8 +239,8 @@ retry: } nbh = nilfs_btnode_create_block(btnc, newkey); - if (!nbh) - return -ENOMEM; + if (IS_ERR(nbh)) + return PTR_ERR(nbh); BUG_ON(nbh == obh); ctxt->newbh = nbh; diff --git a/fs/nilfs2/btree.c b/fs/nilfs2/btree.c index 4905b7cd7bf3..a426e4e2acda 100644 --- a/fs/nilfs2/btree.c +++ b/fs/nilfs2/btree.c @@ -63,8 +63,8 @@ static int nilfs_btree_get_new_block(const struct nilfs_bmap *btree, struct buffer_head *bh; bh = nilfs_btnode_create_block(btnc, ptr); - if (!bh) - return -ENOMEM; + if (IS_ERR(bh)) + return PTR_ERR(bh); set_buffer_nilfs_volatile(bh); *bhp = bh; diff --git a/fs/nilfs2/segment.c b/fs/nilfs2/segment.c index 23b24ec79527..3c4272762779 100644 --- a/fs/nilfs2/segment.c +++ b/fs/nilfs2/segment.c @@ -134,14 +134,9 @@ static void nilfs_segctor_do_flush(struct nilfs_sc_info *, int); static void nilfs_segctor_do_immediate_flush(struct nilfs_sc_info *); static void nilfs_dispose_list(struct the_nilfs *, struct list_head *, int); -#define nilfs_cnt32_gt(a, b) \ - (typecheck(__u32, a) && typecheck(__u32, b) && \ - ((__s32)(b) - (__s32)(a) < 0)) #define nilfs_cnt32_ge(a, b) \ (typecheck(__u32, a) && typecheck(__u32, b) && \ - ((__s32)(a) - (__s32)(b) >= 0)) -#define nilfs_cnt32_lt(a, b) nilfs_cnt32_gt(b, a) -#define nilfs_cnt32_le(a, b) nilfs_cnt32_ge(b, a) + ((__s32)((a) - (b)) >= 0)) static int nilfs_prepare_segment_lock(struct super_block *sb, struct nilfs_transaction_info *ti) diff --git a/fs/ocfs2/dir.c b/fs/ocfs2/dir.c index 13f4bb4e174c..b57d5343db1d 100644 --- a/fs/ocfs2/dir.c +++ b/fs/ocfs2/dir.c @@ -314,13 +314,16 @@ out: * bh passed here can be an inode block or a dir data block, depending * on the inode inline data flag. */ -static int ocfs2_check_dir_entry(struct inode * dir, - struct ocfs2_dir_entry * de, - struct buffer_head * bh, +static int ocfs2_check_dir_entry(struct inode *dir, + struct ocfs2_dir_entry *de, + struct buffer_head *bh, + char *buf, + unsigned int size, unsigned long offset) { const char *error_msg = NULL; const int rlen = le16_to_cpu(de->rec_len); + const unsigned long next_offset = ((char *) de - buf) + rlen; if (unlikely(rlen < OCFS2_DIR_REC_LEN(1))) error_msg = "rec_len is smaller than minimal"; @@ -328,9 +331,11 @@ static int ocfs2_check_dir_entry(struct inode * dir, error_msg = "rec_len % 4 != 0"; else if (unlikely(rlen < OCFS2_DIR_REC_LEN(de->name_len))) error_msg = "rec_len is too small for name_len"; - else if (unlikely( - ((char *) de - bh->b_data) + rlen > dir->i_sb->s_blocksize)) - error_msg = "directory entry across blocks"; + else if (unlikely(next_offset > size)) + error_msg = "directory entry overrun"; + else if (unlikely(next_offset > size - OCFS2_DIR_REC_LEN(1)) && + next_offset != size) + error_msg = "directory entry too close to end"; if (unlikely(error_msg != NULL)) mlog(ML_ERROR, "bad entry in directory #%llu: %s - " @@ -372,16 +377,17 @@ static inline int ocfs2_search_dirblock(struct buffer_head *bh, de_buf = first_de; dlimit = de_buf + bytes; - while (de_buf < dlimit) { + while (de_buf < dlimit - OCFS2_DIR_MEMBER_LEN) { /* this code is executed quadratically often */ /* do minimal checking `by hand' */ de = (struct ocfs2_dir_entry *) de_buf; - if (de_buf + namelen <= dlimit && + if (de->name + namelen <= dlimit && ocfs2_match(namelen, name, de)) { /* found a match - just to be sure, do a full check */ - if (!ocfs2_check_dir_entry(dir, de, bh, offset)) { + if (!ocfs2_check_dir_entry(dir, de, bh, first_de, + bytes, offset)) { ret = -1; goto bail; } @@ -1158,7 +1164,7 @@ static int __ocfs2_delete_entry(handle_t *handle, struct inode *dir, pde = NULL; de = (struct ocfs2_dir_entry *) first_de; while (i < bytes) { - if (!ocfs2_check_dir_entry(dir, de, bh, i)) { + if (!ocfs2_check_dir_entry(dir, de, bh, first_de, bytes, i)) { status = -EIO; mlog_errno(status); goto bail; @@ -1658,7 +1664,8 @@ int __ocfs2_add_entry(handle_t *handle, /* These checks should've already been passed by the * prepare function, but I guess we can leave them * here anyway. */ - if (!ocfs2_check_dir_entry(dir, de, insert_bh, offset)) { + if (!ocfs2_check_dir_entry(dir, de, insert_bh, data_start, + size, offset)) { retval = -ENOENT; goto bail; } @@ -1796,7 +1803,8 @@ static int ocfs2_dir_foreach_blk_id(struct inode *inode, } de = (struct ocfs2_dir_entry *) (data->id_data + ctx->pos); - if (!ocfs2_check_dir_entry(inode, de, di_bh, ctx->pos)) { + if (!ocfs2_check_dir_entry(inode, de, di_bh, (char *)data->id_data, + i_size_read(inode), ctx->pos)) { /* On error, skip the f_pos to the end. */ ctx->pos = i_size_read(inode); break; @@ -1893,7 +1901,8 @@ static int ocfs2_dir_foreach_blk_el(struct inode *inode, while (ctx->pos < i_size_read(inode) && offset < sb->s_blocksize) { de = (struct ocfs2_dir_entry *) (bh->b_data + offset); - if (!ocfs2_check_dir_entry(inode, de, bh, offset)) { + if (!ocfs2_check_dir_entry(inode, de, bh, bh->b_data, + sb->s_blocksize, offset)) { /* On error, skip the f_pos to the next block. */ ctx->pos = (ctx->pos | (sb->s_blocksize - 1)) + 1; @@ -3369,7 +3378,7 @@ static int ocfs2_find_dir_space_id(struct inode *dir, struct buffer_head *di_bh, struct super_block *sb = dir->i_sb; struct ocfs2_dinode *di = (struct ocfs2_dinode *)di_bh->b_data; struct ocfs2_dir_entry *de, *last_de = NULL; - char *de_buf, *limit; + char *first_de, *de_buf, *limit; unsigned long offset = 0; unsigned int rec_len, new_rec_len, free_space = dir->i_sb->s_blocksize; @@ -3382,14 +3391,16 @@ static int ocfs2_find_dir_space_id(struct inode *dir, struct buffer_head *di_bh, else free_space = dir->i_sb->s_blocksize - i_size_read(dir); - de_buf = di->id2.i_data.id_data; + first_de = di->id2.i_data.id_data; + de_buf = first_de; limit = de_buf + i_size_read(dir); rec_len = OCFS2_DIR_REC_LEN(namelen); while (de_buf < limit) { de = (struct ocfs2_dir_entry *)de_buf; - if (!ocfs2_check_dir_entry(dir, de, di_bh, offset)) { + if (!ocfs2_check_dir_entry(dir, de, di_bh, first_de, + i_size_read(dir), offset)) { ret = -ENOENT; goto out; } @@ -3471,7 +3482,8 @@ static int ocfs2_find_dir_space_el(struct inode *dir, const char *name, /* move to next block */ de = (struct ocfs2_dir_entry *) bh->b_data; } - if (!ocfs2_check_dir_entry(dir, de, bh, offset)) { + if (!ocfs2_check_dir_entry(dir, de, bh, bh->b_data, blocksize, + offset)) { status = -ENOENT; goto bail; } diff --git a/fs/quota/dquot.c b/fs/quota/dquot.c index 6bdb44fb07a7..a470bb4e00f1 100644 --- a/fs/quota/dquot.c +++ b/fs/quota/dquot.c @@ -985,9 +985,8 @@ we_slept: * smp_mb__before_atomic() in dquot_acquire(). */ smp_rmb(); -#ifdef CONFIG_QUOTA_DEBUG - BUG_ON(!dquot->dq_sb); /* Has somebody invalidated entry under us? */ -#endif + /* Has somebody invalidated entry under us? */ + WARN_ON_ONCE(hlist_unhashed(&dquot->dq_hash)); out: if (empty) do_destroy_dquot(empty); diff --git a/fs/udf/balloc.c b/fs/udf/balloc.c index 0dc98bbad9c4..ac45f25bf40c 100644 --- a/fs/udf/balloc.c +++ b/fs/udf/balloc.c @@ -22,6 +22,7 @@ #include "udfdecl.h" #include +#include #include "udf_i.h" #include "udf_sb.h" @@ -133,7 +134,6 @@ static void udf_bitmap_free_blocks(struct super_block *sb, { struct udf_sb_info *sbi = UDF_SB(sb); struct buffer_head *bh = NULL; - struct udf_part_map *partmap; unsigned long block; unsigned long block_group; unsigned long bit; @@ -142,19 +142,9 @@ static void udf_bitmap_free_blocks(struct super_block *sb, unsigned long overflow; mutex_lock(&sbi->s_alloc_mutex); - partmap = &sbi->s_partmaps[bloc->partitionReferenceNum]; - if (bloc->logicalBlockNum + count < count || - (bloc->logicalBlockNum + count) > partmap->s_partition_len) { - udf_debug("%u < %d || %u + %u > %u\n", - bloc->logicalBlockNum, 0, - bloc->logicalBlockNum, count, - partmap->s_partition_len); - goto error_return; - } - + /* We make sure this cannot overflow when mounting the filesystem */ block = bloc->logicalBlockNum + offset + (sizeof(struct spaceBitmapDesc) << 3); - do { overflow = 0; block_group = block >> (sb->s_blocksize_bits + 3); @@ -375,7 +365,6 @@ static void udf_table_free_blocks(struct super_block *sb, uint32_t count) { struct udf_sb_info *sbi = UDF_SB(sb); - struct udf_part_map *partmap; uint32_t start, end; uint32_t elen; struct kernel_lb_addr eloc; @@ -384,16 +373,6 @@ static void udf_table_free_blocks(struct super_block *sb, struct udf_inode_info *iinfo; mutex_lock(&sbi->s_alloc_mutex); - partmap = &sbi->s_partmaps[bloc->partitionReferenceNum]; - if (bloc->logicalBlockNum + count < count || - (bloc->logicalBlockNum + count) > partmap->s_partition_len) { - udf_debug("%u < %d || %u + %u > %u\n", - bloc->logicalBlockNum, 0, - bloc->logicalBlockNum, count, - partmap->s_partition_len); - goto error_return; - } - iinfo = UDF_I(table); udf_add_free_space(sb, sbi->s_partition, count); @@ -668,6 +647,17 @@ void udf_free_blocks(struct super_block *sb, struct inode *inode, { uint16_t partition = bloc->partitionReferenceNum; struct udf_part_map *map = &UDF_SB(sb)->s_partmaps[partition]; + uint32_t blk; + + if (check_add_overflow(bloc->logicalBlockNum, offset, &blk) || + check_add_overflow(blk, count, &blk) || + bloc->logicalBlockNum + count > map->s_partition_len) { + udf_debug("Invalid request to free blocks: (%d, %u), off %u, " + "len %u, partition len %u\n", + partition, bloc->logicalBlockNum, offset, count, + map->s_partition_len); + return; + } if (map->s_partition_flags & UDF_PART_FLAG_UNALLOC_BITMAP) { udf_bitmap_free_blocks(sb, map->s_uspace.s_bitmap, diff --git a/include/linux/bitmap.h b/include/linux/bitmap.h index b71a033c781e..3c942d9a8639 100644 --- a/include/linux/bitmap.h +++ b/include/linux/bitmap.h @@ -212,12 +212,14 @@ extern int bitmap_print_to_pagebuf(bool list, char *buf, #define small_const_nbits(nbits) \ (__builtin_constant_p(nbits) && (nbits) <= BITS_PER_LONG && (nbits) > 0) +#define bitmap_size(nbits) (ALIGN(nbits, BITS_PER_LONG) / BITS_PER_BYTE) + static inline void bitmap_zero(unsigned long *dst, unsigned int nbits) { if (small_const_nbits(nbits)) *dst = 0UL; else { - unsigned int len = BITS_TO_LONGS(nbits) * sizeof(unsigned long); + unsigned int len = bitmap_size(nbits); memset(dst, 0, len); } } @@ -227,7 +229,7 @@ static inline void bitmap_fill(unsigned long *dst, unsigned int nbits) if (small_const_nbits(nbits)) *dst = ~0UL; else { - unsigned int len = BITS_TO_LONGS(nbits) * sizeof(unsigned long); + unsigned int len = bitmap_size(nbits); memset(dst, 0xff, len); } } @@ -238,7 +240,7 @@ static inline void bitmap_copy(unsigned long *dst, const unsigned long *src, if (small_const_nbits(nbits)) *dst = *src; else { - unsigned int len = BITS_TO_LONGS(nbits) * sizeof(unsigned long); + unsigned int len = bitmap_size(nbits); memcpy(dst, src, len); } } @@ -254,6 +256,18 @@ static inline void bitmap_copy_clear_tail(unsigned long *dst, dst[nbits / BITS_PER_LONG] &= BITMAP_LAST_WORD_MASK(nbits); } +static inline void bitmap_copy_and_extend(unsigned long *to, + const unsigned long *from, + unsigned int count, unsigned int size) +{ + unsigned int copy = BITS_TO_LONGS(count); + + memcpy(to, from, copy * sizeof(long)); + if (count % BITS_PER_LONG) + to[copy - 1] &= BITMAP_LAST_WORD_MASK(count); + memset(to + copy, 0, bitmap_size(size) - copy * sizeof(long)); +} + /* * On 32-bit systems bitmaps are represented as u32 arrays internally, and * therefore conversion is not needed when copying data from/to arrays of u32. diff --git a/include/linux/blkdev.h b/include/linux/blkdev.h index 44e7a0d2cf0a..0913849691f5 100644 --- a/include/linux/blkdev.h +++ b/include/linux/blkdev.h @@ -57,7 +57,7 @@ struct keyslot_manager; */ #define BLKCG_MAX_POLS 5 -static inline int blk_validate_block_size(unsigned int bsize) +static inline int blk_validate_block_size(unsigned long bsize) { if (bsize < 512 || bsize > PAGE_SIZE || !is_power_of_2(bsize)) return -EINVAL; diff --git a/include/linux/cpumask.h b/include/linux/cpumask.h index e5d963c571ae..46089bfc1c4e 100644 --- a/include/linux/cpumask.h +++ b/include/linux/cpumask.h @@ -671,7 +671,7 @@ static inline int cpulist_parse(const char *buf, struct cpumask *dstp) */ static inline unsigned int cpumask_size(void) { - return BITS_TO_LONGS(nr_cpumask_bits) * sizeof(long); + return bitmap_size(nr_cpumask_bits); } /* diff --git a/include/linux/fbcon.h b/include/linux/fbcon.h index f68a7db14165..39939d55c834 100644 --- a/include/linux/fbcon.h +++ b/include/linux/fbcon.h @@ -4,9 +4,13 @@ #ifdef CONFIG_FRAMEBUFFER_CONSOLE void __init fb_console_init(void); void __exit fb_console_exit(void); +int fbcon_modechange_possible(struct fb_info *info, + struct fb_var_screeninfo *var); #else static inline void fb_console_init(void) {} static inline void fb_console_exit(void) {} +static inline int fbcon_modechange_possible(struct fb_info *info, + struct fb_var_screeninfo *var) { return 0; } #endif #endif /* _LINUX_FBCON_H */ diff --git a/include/linux/hwmon-sysfs.h b/include/linux/hwmon-sysfs.h index 1c7b89ae6bdc..473897bbd898 100644 --- a/include/linux/hwmon-sysfs.h +++ b/include/linux/hwmon-sysfs.h @@ -33,10 +33,28 @@ struct sensor_device_attribute{ { .dev_attr = __ATTR(_name, _mode, _show, _store), \ .index = _index } +#define SENSOR_ATTR_RO(_name, _func, _index) \ + SENSOR_ATTR(_name, 0444, _func##_show, NULL, _index) + +#define SENSOR_ATTR_RW(_name, _func, _index) \ + SENSOR_ATTR(_name, 0644, _func##_show, _func##_store, _index) + +#define SENSOR_ATTR_WO(_name, _func, _index) \ + SENSOR_ATTR(_name, 0200, NULL, _func##_store, _index) + #define SENSOR_DEVICE_ATTR(_name, _mode, _show, _store, _index) \ struct sensor_device_attribute sensor_dev_attr_##_name \ = SENSOR_ATTR(_name, _mode, _show, _store, _index) +#define SENSOR_DEVICE_ATTR_RO(_name, _func, _index) \ + SENSOR_DEVICE_ATTR(_name, 0444, _func##_show, NULL, _index) + +#define SENSOR_DEVICE_ATTR_RW(_name, _func, _index) \ + SENSOR_DEVICE_ATTR(_name, 0644, _func##_show, _func##_store, _index) + +#define SENSOR_DEVICE_ATTR_WO(_name, _func, _index) \ + SENSOR_DEVICE_ATTR(_name, 0200, NULL, _func##_store, _index) + struct sensor_device_attribute_2 { struct device_attribute dev_attr; u8 index; @@ -50,8 +68,29 @@ struct sensor_device_attribute_2 { .index = _index, \ .nr = _nr } +#define SENSOR_ATTR_2_RO(_name, _func, _nr, _index) \ + SENSOR_ATTR_2(_name, 0444, _func##_show, NULL, _nr, _index) + +#define SENSOR_ATTR_2_RW(_name, _func, _nr, _index) \ + SENSOR_ATTR_2(_name, 0644, _func##_show, _func##_store, _nr, _index) + +#define SENSOR_ATTR_2_WO(_name, _func, _nr, _index) \ + SENSOR_ATTR_2(_name, 0200, NULL, _func##_store, _nr, _index) + #define SENSOR_DEVICE_ATTR_2(_name,_mode,_show,_store,_nr,_index) \ struct sensor_device_attribute_2 sensor_dev_attr_##_name \ = SENSOR_ATTR_2(_name, _mode, _show, _store, _nr, _index) +#define SENSOR_DEVICE_ATTR_2_RO(_name, _func, _nr, _index) \ + SENSOR_DEVICE_ATTR_2(_name, 0444, _func##_show, NULL, \ + _nr, _index) + +#define SENSOR_DEVICE_ATTR_2_RW(_name, _func, _nr, _index) \ + SENSOR_DEVICE_ATTR_2(_name, 0644, _func##_show, _func##_store, \ + _nr, _index) + +#define SENSOR_DEVICE_ATTR_2_WO(_name, _func, _nr, _index) \ + SENSOR_DEVICE_ATTR_2(_name, 0200, NULL, _func##_store, \ + _nr, _index) + #endif /* _LINUX_HWMON_SYSFS_H */ diff --git a/include/linux/overflow.h b/include/linux/overflow.h index 4564a175e681..63e7c77ba942 100644 --- a/include/linux/overflow.h +++ b/include/linux/overflow.h @@ -240,6 +240,69 @@ (*_d >> _to_shift) != _a); \ }) +/** + * size_mul() - Calculate size_t multiplication with saturation at SIZE_MAX + * + * @factor1: first factor + * @factor2: second factor + * + * Returns: calculate @factor1 * @factor2, both promoted to size_t, + * with any overflow causing the return value to be SIZE_MAX. The + * lvalue must be size_t to avoid implicit type conversion. + */ +static inline size_t __must_check size_mul(size_t factor1, size_t factor2) +{ + size_t bytes; + + if (check_mul_overflow(factor1, factor2, &bytes)) + return SIZE_MAX; + + return bytes; +} + +/** + * size_add() - Calculate size_t addition with saturation at SIZE_MAX + * + * @addend1: first addend + * @addend2: second addend + * + * Returns: calculate @addend1 + @addend2, both promoted to size_t, + * with any overflow causing the return value to be SIZE_MAX. The + * lvalue must be size_t to avoid implicit type conversion. + */ +static inline size_t __must_check size_add(size_t addend1, size_t addend2) +{ + size_t bytes; + + if (check_add_overflow(addend1, addend2, &bytes)) + return SIZE_MAX; + + return bytes; +} + +/** + * size_sub() - Calculate size_t subtraction with saturation at SIZE_MAX + * + * @minuend: value to subtract from + * @subtrahend: value to subtract from @minuend + * + * Returns: calculate @minuend - @subtrahend, both promoted to size_t, + * with any overflow causing the return value to be SIZE_MAX. For + * composition with the size_add() and size_mul() helpers, neither + * argument may be SIZE_MAX (or the result with be forced to SIZE_MAX). + * The lvalue must be size_t to avoid implicit type conversion. + */ +static inline size_t __must_check size_sub(size_t minuend, size_t subtrahend) +{ + size_t bytes; + + if (minuend == SIZE_MAX || subtrahend == SIZE_MAX || + check_sub_overflow(minuend, subtrahend, &bytes)) + return SIZE_MAX; + + return bytes; +} + /** * array_size() - Calculate size of 2-dimensional array. * @@ -251,15 +314,7 @@ * Returns: number of bytes needed to represent the array or SIZE_MAX on * overflow. */ -static inline __must_check size_t array_size(size_t a, size_t b) -{ - size_t bytes; - - if (check_mul_overflow(a, b, &bytes)) - return SIZE_MAX; - - return bytes; -} +#define array_size(a, b) size_mul(a, b) /** * array3_size() - Calculate size of 3-dimensional array. @@ -273,44 +328,38 @@ static inline __must_check size_t array_size(size_t a, size_t b) * Returns: number of bytes needed to represent the array or SIZE_MAX on * overflow. */ -static inline __must_check size_t array3_size(size_t a, size_t b, size_t c) -{ - size_t bytes; - - if (check_mul_overflow(a, b, &bytes)) - return SIZE_MAX; - if (check_mul_overflow(bytes, c, &bytes)) - return SIZE_MAX; - - return bytes; -} - -static inline __must_check size_t __ab_c_size(size_t n, size_t size, size_t c) -{ - size_t bytes; - - if (check_mul_overflow(n, size, &bytes)) - return SIZE_MAX; - if (check_add_overflow(bytes, c, &bytes)) - return SIZE_MAX; - - return bytes; -} +#define array3_size(a, b, c) size_mul(size_mul(a, b), c) /** - * struct_size() - Calculate size of structure with trailing array. - * @p: Pointer to the structure. - * @member: Name of the array member. - * @n: Number of elements in the array. + * flex_array_size() - Calculate size of a flexible array member + * within an enclosing structure. * - * Calculates size of memory needed for structure @p followed by an - * array of @n @member elements. + * @p: Pointer to the structure. + * @member: Name of the flexible array member. + * @count: Number of elements in the array. + * + * Calculates size of a flexible array of @count number of @member + * elements, at the end of structure @p. * * Return: number of bytes needed or SIZE_MAX on overflow. */ -#define struct_size(p, member, n) \ - __ab_c_size(n, \ - sizeof(*(p)->member) + __must_be_array((p)->member),\ - sizeof(*(p))) +#define flex_array_size(p, member, count) \ + size_mul(count, \ + sizeof(*(p)->member) + __must_be_array((p)->member)) + +/** + * struct_size() - Calculate size of structure with trailing flexible array. + * + * @p: Pointer to the structure. + * @member: Name of the array member. + * @count: Number of elements in the array. + * + * Calculates size of memory needed for structure @p followed by an + * array of @count number of @member elements. + * + * Return: number of bytes needed or SIZE_MAX on overflow. + */ +#define struct_size(p, member, count) \ + size_add(sizeof(*(p)), flex_array_size(p, member, count)) #endif /* __LINUX_OVERFLOW_H */ diff --git a/include/linux/pci_ids.h b/include/linux/pci_ids.h index 3ac7b92b35b9..91193284710f 100644 --- a/include/linux/pci_ids.h +++ b/include/linux/pci_ids.h @@ -2136,6 +2136,8 @@ #define PCI_VENDOR_ID_CHELSIO 0x1425 +#define PCI_VENDOR_ID_EDIMAX 0x1432 + #define PCI_VENDOR_ID_ADLINK 0x144a #define PCI_VENDOR_ID_SAMSUNG 0x144d diff --git a/include/linux/trace_events.h b/include/linux/trace_events.h index 883476980b8e..769da64c1f07 100644 --- a/include/linux/trace_events.h +++ b/include/linux/trace_events.h @@ -562,7 +562,6 @@ do { \ struct perf_event; DECLARE_PER_CPU(struct pt_regs, perf_trace_regs); -DECLARE_PER_CPU(int, bpf_kprobe_override); extern int perf_trace_init(struct perf_event *event); extern void perf_trace_destroy(struct perf_event *event); diff --git a/include/net/busy_poll.h b/include/net/busy_poll.h index 8f42f6f3af86..c45253ee08c9 100644 --- a/include/net/busy_poll.h +++ b/include/net/busy_poll.h @@ -73,7 +73,7 @@ static inline bool sk_can_busy_loop(struct sock *sk) static inline unsigned long busy_loop_current_time(void) { #ifdef CONFIG_NET_RX_BUSY_POLL - return (unsigned long)(local_clock() >> 10); + return (unsigned long)(ktime_get_ns() >> 10); #else return 0; #endif diff --git a/include/net/kcm.h b/include/net/kcm.h index 2a8965819db0..2dc5e926dd3f 100644 --- a/include/net/kcm.h +++ b/include/net/kcm.h @@ -73,6 +73,7 @@ struct kcm_sock { struct work_struct tx_work; struct list_head wait_psock_list; struct sk_buff *seq_skb; + struct mutex tx_mutex; u32 tx_stopped : 1; /* Don't use bit fields here, these are set under different locks */ diff --git a/include/net/netfilter/nf_tables.h b/include/net/netfilter/nf_tables.h index 4a0f51c2b3b9..9eb7d7de590f 100644 --- a/include/net/netfilter/nf_tables.h +++ b/include/net/netfilter/nf_tables.h @@ -12,6 +12,7 @@ #include #include #include +#include #define NFT_JUMP_STACK_SIZE 16 @@ -636,10 +637,16 @@ static inline struct nft_expr *nft_set_ext_expr(const struct nft_set_ext *ext) return nft_set_ext(ext, NFT_SET_EXT_EXPR); } -static inline bool nft_set_elem_expired(const struct nft_set_ext *ext) +static inline bool __nft_set_elem_expired(const struct nft_set_ext *ext, + u64 tstamp) { return nft_set_ext_exists(ext, NFT_SET_EXT_EXPIRATION) && - time_is_before_eq_jiffies64(*nft_set_ext_expiration(ext)); + time_after_eq64(tstamp, *nft_set_ext_expiration(ext)); +} + +static inline bool nft_set_elem_expired(const struct nft_set_ext *ext) +{ + return __nft_set_elem_expired(ext, get_jiffies_64()); } static inline struct nft_set_ext *nft_set_elem_ext(const struct nft_set *set, @@ -1423,11 +1430,21 @@ struct nftables_pernet { struct list_head module_list; struct list_head notify_list; struct mutex commit_mutex; + u64 tstamp; unsigned int base_seq; u8 validate_state; unsigned int gc_seq; }; +extern unsigned int nf_tables_net_id; + +static inline u64 nft_net_tstamp(const struct net *net) +{ + struct nftables_pernet *nft_net = net_generic(net, nf_tables_net_id); + + return nft_net->tstamp; +} + int nf_msecs_to_jiffies64(const struct nlattr *nla, u64 *result); __be64 nf_jiffies64_to_msecs(u64 input); diff --git a/include/uapi/linux/zorro_ids.h b/include/uapi/linux/zorro_ids.h index 6e574d7b7d79..393f2ee9c042 100644 --- a/include/uapi/linux/zorro_ids.h +++ b/include/uapi/linux/zorro_ids.h @@ -449,6 +449,9 @@ #define ZORRO_PROD_VMC_ISDN_BLASTER_Z2 ZORRO_ID(VMC, 0x01, 0) #define ZORRO_PROD_VMC_HYPERCOM_4 ZORRO_ID(VMC, 0x02, 0) +#define ZORRO_MANUF_CSLAB 0x1400 +#define ZORRO_PROD_CSLAB_WARP_1260 ZORRO_ID(CSLAB, 0x65, 0) + #define ZORRO_MANUF_INFORMATION 0x157C #define ZORRO_PROD_INFORMATION_ISDN_ENGINE_I ZORRO_ID(INFORMATION, 0x64, 0) diff --git a/ipc/msg.c b/ipc/msg.c index ac4de3f67261..9a1ff5669cfb 100644 --- a/ipc/msg.c +++ b/ipc/msg.c @@ -137,7 +137,7 @@ static int newque(struct ipc_namespace *ns, struct ipc_params *params) key_t key = params->key; int msgflg = params->flg; - msq = kvmalloc(sizeof(*msq), GFP_KERNEL); + msq = kvmalloc(sizeof(*msq), GFP_KERNEL_ACCOUNT); if (unlikely(!msq)) return -ENOMEM; diff --git a/ipc/sem.c b/ipc/sem.c index cc6af85d1b15..d84f42196e52 100644 --- a/ipc/sem.c +++ b/ipc/sem.c @@ -494,7 +494,7 @@ static struct sem_array *sem_alloc(size_t nsems) return NULL; size = sizeof(*sma) + nsems * sizeof(sma->sems[0]); - sma = kvmalloc(size, GFP_KERNEL); + sma = kvmalloc(size, GFP_KERNEL_ACCOUNT); if (unlikely(!sma)) return NULL; @@ -1813,7 +1813,7 @@ static inline int get_undo_list(struct sem_undo_list **undo_listp) undo_list = current->sysvsem.undo_list; if (!undo_list) { - undo_list = kzalloc(sizeof(*undo_list), GFP_KERNEL); + undo_list = kzalloc(sizeof(*undo_list), GFP_KERNEL_ACCOUNT); if (undo_list == NULL) return -ENOMEM; spin_lock_init(&undo_list->lock); @@ -1897,7 +1897,8 @@ static struct sem_undo *find_alloc_undo(struct ipc_namespace *ns, int semid) rcu_read_unlock(); /* step 2: allocate new undo structure */ - new = kzalloc(sizeof(struct sem_undo) + sizeof(short)*nsems, GFP_KERNEL); + new = kzalloc(sizeof(struct sem_undo) + sizeof(short)*nsems, + GFP_KERNEL_ACCOUNT); if (!new) { ipc_rcu_putref(&sma->sem_perm, sem_rcu_free); return ERR_PTR(-ENOMEM); diff --git a/ipc/shm.c b/ipc/shm.c index ba99f48c6e2b..0a5053f5726f 100644 --- a/ipc/shm.c +++ b/ipc/shm.c @@ -711,7 +711,7 @@ static int newseg(struct ipc_namespace *ns, struct ipc_params *params) ns->shm_tot + numpages > ns->shm_ctlall) return -ENOSPC; - shp = kvmalloc(sizeof(*shp), GFP_KERNEL); + shp = kvmalloc(sizeof(*shp), GFP_KERNEL_ACCOUNT); if (unlikely(!shp)) return -ENOMEM; diff --git a/kernel/cgroup/cpuset.c b/kernel/cgroup/cpuset.c index fc5a24c0482e..4fafbd9a6b0b 100644 --- a/kernel/cgroup/cpuset.c +++ b/kernel/cgroup/cpuset.c @@ -22,6 +22,7 @@ * distribution for more details. */ +#include "cgroup-internal.h" #include #include #include @@ -2791,10 +2792,14 @@ int proc_cpuset_show(struct seq_file *m, struct pid_namespace *ns, if (!buf) goto out; - css = task_get_css(tsk, cpuset_cgrp_id); - retval = cgroup_path_ns(css->cgroup, buf, PATH_MAX, - current->nsproxy->cgroup_ns); - css_put(css); + rcu_read_lock(); + spin_lock_irq(&css_set_lock); + css = task_css(tsk, cpuset_cgrp_id); + retval = cgroup_path_ns_locked(css->cgroup, buf, PATH_MAX, + current->nsproxy->cgroup_ns); + spin_unlock_irq(&css_set_lock); + rcu_read_unlock(); + if (retval >= PATH_MAX) retval = -ENAMETOOLONG; if (retval < 0) diff --git a/kernel/debug/kdb/kdb_io.c b/kernel/debug/kdb/kdb_io.c index f54ca27f34e4..91cc93515422 100644 --- a/kernel/debug/kdb/kdb_io.c +++ b/kernel/debug/kdb/kdb_io.c @@ -192,7 +192,7 @@ static int kdb_read_get_key(char *buffer, size_t bufsize) */ static void kdb_position_cursor(char *prompt, char *buffer, char *cp) { - kdb_printf("\r%s", kdb_prompt_str); + kdb_printf("\r%s", prompt); if (cp > buffer) kdb_printf("%.*s", (int)(cp - buffer), buffer); } @@ -377,7 +377,7 @@ poll_again: if (i >= dtab_count) kdb_printf("..."); kdb_printf("\n"); - kdb_printf(kdb_prompt_str); + kdb_printf("%s", kdb_prompt_str); kdb_printf("%s", buffer); if (cp != lastchar) kdb_position_cursor(kdb_prompt_str, buffer, cp); @@ -468,8 +468,8 @@ poll_again: char *kdb_getstr(char *buffer, size_t bufsize, const char *prompt) { if (prompt && kdb_prompt_str != prompt) - strncpy(kdb_prompt_str, prompt, CMD_BUFLEN); - kdb_printf(kdb_prompt_str); + strscpy(kdb_prompt_str, prompt, CMD_BUFLEN); + kdb_printf("%s", kdb_prompt_str); kdb_nextline = 1; /* Prompt and input resets line number */ return kdb_read(buffer, bufsize); } diff --git a/kernel/dma/mapping.c b/kernel/dma/mapping.c index 7d8c622375a2..d0f9389a7de0 100644 --- a/kernel/dma/mapping.c +++ b/kernel/dma/mapping.c @@ -97,8 +97,8 @@ void dmam_free_coherent(struct device *dev, size_t size, void *vaddr, { struct dma_devres match_data = { size, vaddr, dma_handle }; - dma_free_coherent(dev, size, vaddr, dma_handle); WARN_ON(devres_destroy(dev, dmam_release, dmam_match, &match_data)); + dma_free_coherent(dev, size, vaddr, dma_handle); } EXPORT_SYMBOL(dmam_free_coherent); diff --git a/kernel/events/core.c b/kernel/events/core.c index 3b5f323bf0cb..333777144d01 100644 --- a/kernel/events/core.c +++ b/kernel/events/core.c @@ -5872,6 +5872,8 @@ static int perf_mmap(struct file *file, struct vm_area_struct *vma) return -EINVAL; nr_pages = vma_size / PAGE_SIZE; + if (nr_pages > INT_MAX) + return -ENOMEM; mutex_lock(&event->mmap_mutex); ret = -EINVAL; diff --git a/kernel/events/internal.h b/kernel/events/internal.h index 8fc0ddc38cb6..a99713a883e9 100644 --- a/kernel/events/internal.h +++ b/kernel/events/internal.h @@ -121,7 +121,7 @@ static inline unsigned long perf_data_size(struct ring_buffer *rb) static inline unsigned long perf_aux_size(struct ring_buffer *rb) { - return rb->aux_nr_pages << PAGE_SHIFT; + return (unsigned long)rb->aux_nr_pages << PAGE_SHIFT; } #define __DEFINE_OUTPUT_COPY_BODY(advance_buf, memcpy_func, ...) \ diff --git a/kernel/time/hrtimer.c b/kernel/time/hrtimer.c index 0a8bd8e5ee7b..5d887c2716c0 100644 --- a/kernel/time/hrtimer.c +++ b/kernel/time/hrtimer.c @@ -1188,6 +1188,8 @@ void hrtimer_start_range_ns(struct hrtimer *timer, ktime_t tim, struct hrtimer_clock_base *base; unsigned long flags; + if (WARN_ON_ONCE(!timer->function)) + return; /* * Check whether the HRTIMER_MODE_SOFT bit and hrtimer.is_soft * match. diff --git a/kernel/time/ntp.c b/kernel/time/ntp.c index e1110a7bd3e6..58aba0a3484d 100644 --- a/kernel/time/ntp.c +++ b/kernel/time/ntp.c @@ -686,17 +686,16 @@ static inline void process_adjtimex_modes(const struct timex *txc, s32 *time_tai } if (txc->modes & ADJ_MAXERROR) - time_maxerror = txc->maxerror; + time_maxerror = clamp(txc->maxerror, (__kernel_long_t)0, (__kernel_long_t)NTP_PHASE_LIMIT); if (txc->modes & ADJ_ESTERROR) - time_esterror = txc->esterror; + time_esterror = clamp(txc->esterror, (__kernel_long_t)0, (__kernel_long_t)NTP_PHASE_LIMIT); if (txc->modes & ADJ_TIMECONST) { - time_constant = txc->constant; + time_constant = clamp(txc->constant, (__kernel_long_t)0, (__kernel_long_t)MAXTC); if (!(time_status & STA_NANO)) time_constant += 4; - time_constant = min(time_constant, (long)MAXTC); - time_constant = max(time_constant, 0l); + time_constant = clamp(time_constant, (long)0, (long)MAXTC); } if (txc->modes & ADJ_TAI && diff --git a/kernel/time/tick-broadcast.c b/kernel/time/tick-broadcast.c index aa2094d5dd27..e1ce02931b38 100644 --- a/kernel/time/tick-broadcast.c +++ b/kernel/time/tick-broadcast.c @@ -948,6 +948,30 @@ void hotplug_cpu__broadcast_tick_pull(int deadcpu) bc = tick_broadcast_device.evtdev; if (bc && broadcast_needs_cpu(bc, deadcpu)) { + /* + * If the broadcast force bit of the current CPU is set, + * then the current CPU has not yet reprogrammed the local + * timer device to avoid a ping-pong race. See + * ___tick_broadcast_oneshot_control(). + * + * If the broadcast device is hrtimer based then + * programming the broadcast event below does not have any + * effect because the local clockevent device is not + * running and not programmed because the broadcast event + * is not earlier than the pending event of the local clock + * event device. As a consequence all CPUs waiting for a + * broadcast event are stuck forever. + * + * Detect this condition and reprogram the cpu local timer + * device to avoid the starvation. + */ + if (tick_check_broadcast_expired()) { + struct tick_device *td = this_cpu_ptr(&tick_cpu_device); + + cpumask_clear_cpu(smp_processor_id(), tick_broadcast_force_mask); + tick_program_event(td->evtdev->next_event, 1); + } + /* This moves the broadcast assignment to this CPU: */ clockevents_program_event(bc, bc->next_event, 1); } diff --git a/kernel/trace/tracing_map.c b/kernel/trace/tracing_map.c index 33c463967bb3..208cfe24c547 100644 --- a/kernel/trace/tracing_map.c +++ b/kernel/trace/tracing_map.c @@ -454,7 +454,7 @@ static struct tracing_map_elt *get_free_elt(struct tracing_map *map) struct tracing_map_elt *elt = NULL; int idx; - idx = atomic_inc_return(&map->next_elt); + idx = atomic_fetch_add_unless(&map->next_elt, 1, map->max_elts); if (idx < map->max_elts) { elt = *(TRACING_MAP_ELT(map->elts, idx)); if (map->ops && map->ops->elt_init) @@ -699,7 +699,7 @@ void tracing_map_clear(struct tracing_map *map) { unsigned int i; - atomic_set(&map->next_elt, -1); + atomic_set(&map->next_elt, 0); atomic64_set(&map->hits, 0); atomic64_set(&map->drops, 0); @@ -783,7 +783,7 @@ struct tracing_map *tracing_map_create(unsigned int map_bits, map->map_bits = map_bits; map->max_elts = (1 << map_bits); - atomic_set(&map->next_elt, -1); + atomic_set(&map->next_elt, 0); map->map_size = (1 << (map_bits + 1)); map->ops = ops; diff --git a/kernel/watchdog_hld.c b/kernel/watchdog_hld.c index f8e460b4a59d..4f0aeeb8cd0c 100644 --- a/kernel/watchdog_hld.c +++ b/kernel/watchdog_hld.c @@ -91,11 +91,15 @@ static bool watchdog_check_timestamp(void) __this_cpu_write(last_timestamp, now); return true; } -#else -static inline bool watchdog_check_timestamp(void) + +static void watchdog_init_timestamp(void) { - return true; + __this_cpu_write(nmi_rearmed, 0); + __this_cpu_write(last_timestamp, ktime_get_mono_fast_ns()); } +#else +static inline bool watchdog_check_timestamp(void) { return true; } +static inline void watchdog_init_timestamp(void) { } #endif static struct perf_event_attr wd_hw_attr = { @@ -195,6 +199,7 @@ void hardlockup_detector_perf_enable(void) if (!atomic_fetch_inc(&watchdog_cpus)) pr_info("Enabled. Permanently consumes one hw-PMU counter.\n"); + watchdog_init_timestamp(); perf_event_enable(this_cpu_read(watchdog_ev)); } diff --git a/lib/decompress_bunzip2.c b/lib/decompress_bunzip2.c index 7c4932eed748..b16236747b55 100644 --- a/lib/decompress_bunzip2.c +++ b/lib/decompress_bunzip2.c @@ -232,7 +232,8 @@ static int INIT get_next_block(struct bunzip_data *bd) RUNB) */ symCount = symTotal+2; for (j = 0; j < groupCount; j++) { - unsigned char length[MAX_SYMBOLS], temp[MAX_HUFCODE_BITS+1]; + unsigned char length[MAX_SYMBOLS]; + unsigned short temp[MAX_HUFCODE_BITS+1]; int minLen, maxLen, pp; /* Read Huffman code lengths for each symbol. They're stored in a way similar to mtf; record a starting diff --git a/lib/idr.c b/lib/idr.c index 432a985bf772..3e4035fa89dd 100644 --- a/lib/idr.c +++ b/lib/idr.c @@ -471,7 +471,7 @@ static void ida_remove(struct ida *ida, int id) } else { btmp = bitmap->bitmap; } - if (!test_bit(offset, btmp)) + if (!bitmap || !test_bit(offset, btmp)) goto err; __clear_bit(offset, btmp); diff --git a/lib/kobject_uevent.c b/lib/kobject_uevent.c index 26d21339bef2..eda78da3c023 100644 --- a/lib/kobject_uevent.c +++ b/lib/kobject_uevent.c @@ -430,8 +430,23 @@ static void zap_modalias_env(struct kobj_uevent_env *env) len = strlen(env->envp[i]) + 1; if (i != env->envp_idx - 1) { + /* @env->envp[] contains pointers to @env->buf[] + * with @env->buflen chars, and we are removing + * variable MODALIAS here pointed by @env->envp[i] + * with length @len as shown below: + * + * 0 @env->buf[] @env->buflen + * --------------------------------------------- + * ^ ^ ^ ^ + * | |-> @len <-| target block | + * @env->envp[0] @env->envp[i] @env->envp[i + 1] + * + * so the "target block" indicated above is moved + * backward by @len, and its right size is + * @env->buflen - (@env->envp[i + 1] - @env->envp[0]). + */ memmove(env->envp[i], env->envp[i + 1], - env->buflen - len); + env->buflen - (env->envp[i + 1] - env->envp[0])); for (j = i; j < env->envp_idx - 1; j++) env->envp[j] = env->envp[j + 1] - len; diff --git a/lib/test_ida.c b/lib/test_ida.c index b06880625961..55105baa19da 100644 --- a/lib/test_ida.c +++ b/lib/test_ida.c @@ -150,6 +150,45 @@ static void ida_check_conv(struct ida *ida) IDA_BUG_ON(ida, !ida_is_empty(ida)); } +/* + * Check various situations where we attempt to free an ID we don't own. + */ +static void ida_check_bad_free(struct ida *ida) +{ + unsigned long i; + + printk("vvv Ignore \"not allocated\" warnings\n"); + /* IDA is empty; all of these will fail */ + ida_free(ida, 0); + for (i = 0; i < 31; i++) + ida_free(ida, 1 << i); + + /* IDA contains a single value entry */ + IDA_BUG_ON(ida, ida_alloc_min(ida, 3, GFP_KERNEL) != 3); + ida_free(ida, 0); + for (i = 0; i < 31; i++) + ida_free(ida, 1 << i); + + /* IDA contains a single bitmap */ + IDA_BUG_ON(ida, ida_alloc_min(ida, 1023, GFP_KERNEL) != 1023); + ida_free(ida, 0); + for (i = 0; i < 31; i++) + ida_free(ida, 1 << i); + + /* IDA contains a tree */ + IDA_BUG_ON(ida, ida_alloc_min(ida, (1 << 20) - 1, GFP_KERNEL) != (1 << 20) - 1); + ida_free(ida, 0); + for (i = 0; i < 31; i++) + ida_free(ida, 1 << i); + printk("^^^ \"not allocated\" warnings over\n"); + + ida_free(ida, 3); + ida_free(ida, 1023); + ida_free(ida, (1 << 20) - 1); + + IDA_BUG_ON(ida, !ida_is_empty(ida)); +} + static DEFINE_IDA(ida); static int ida_checks(void) @@ -162,6 +201,7 @@ static int ida_checks(void) ida_check_leaf(&ida, 1024 * 64); ida_check_max(&ida); ida_check_conv(&ida); + ida_check_bad_free(&ida); printk("IDA: %u of %u tests passed\n", tests_passed, tests_run); return (tests_run != tests_passed) ? 0 : -EINVAL; diff --git a/lib/test_overflow.c b/lib/test_overflow.c index 7a4b6f6c5473..7a5a5738d2d2 100644 --- a/lib/test_overflow.c +++ b/lib/test_overflow.c @@ -588,12 +588,110 @@ static int __init test_overflow_allocation(void) return err; } +struct __test_flex_array { + unsigned long flags; + size_t count; + unsigned long data[]; +}; + +static int __init test_overflow_size_helpers(void) +{ + struct __test_flex_array *obj; + int count = 0; + int err = 0; + int var; + +#define check_one_size_helper(expected, func, args...) ({ \ + bool __failure = false; \ + size_t _r; \ + \ + _r = func(args); \ + if (_r != (expected)) { \ + pr_warn("expected " #func "(" #args ") " \ + "to return %zu but got %zu instead\n", \ + (size_t)(expected), _r); \ + __failure = true; \ + } \ + count++; \ + __failure; \ +}) + + var = 4; + err |= check_one_size_helper(20, size_mul, var++, 5); + err |= check_one_size_helper(20, size_mul, 4, var++); + err |= check_one_size_helper(0, size_mul, 0, 3); + err |= check_one_size_helper(0, size_mul, 3, 0); + err |= check_one_size_helper(6, size_mul, 2, 3); + err |= check_one_size_helper(SIZE_MAX, size_mul, SIZE_MAX, 1); + err |= check_one_size_helper(SIZE_MAX, size_mul, SIZE_MAX, 3); + err |= check_one_size_helper(SIZE_MAX, size_mul, SIZE_MAX, -3); + + var = 4; + err |= check_one_size_helper(9, size_add, var++, 5); + err |= check_one_size_helper(9, size_add, 4, var++); + err |= check_one_size_helper(9, size_add, 9, 0); + err |= check_one_size_helper(9, size_add, 0, 9); + err |= check_one_size_helper(5, size_add, 2, 3); + err |= check_one_size_helper(SIZE_MAX, size_add, SIZE_MAX, 1); + err |= check_one_size_helper(SIZE_MAX, size_add, SIZE_MAX, 3); + err |= check_one_size_helper(SIZE_MAX, size_add, SIZE_MAX, -3); + + var = 4; + err |= check_one_size_helper(1, size_sub, var--, 3); + err |= check_one_size_helper(1, size_sub, 4, var--); + err |= check_one_size_helper(1, size_sub, 3, 2); + err |= check_one_size_helper(9, size_sub, 9, 0); + err |= check_one_size_helper(SIZE_MAX, size_sub, 9, -3); + err |= check_one_size_helper(SIZE_MAX, size_sub, 0, 9); + err |= check_one_size_helper(SIZE_MAX, size_sub, 2, 3); + err |= check_one_size_helper(SIZE_MAX, size_sub, SIZE_MAX, 0); + err |= check_one_size_helper(SIZE_MAX, size_sub, SIZE_MAX, 10); + err |= check_one_size_helper(SIZE_MAX, size_sub, 0, SIZE_MAX); + err |= check_one_size_helper(SIZE_MAX, size_sub, 14, SIZE_MAX); + err |= check_one_size_helper(SIZE_MAX - 2, size_sub, SIZE_MAX - 1, 1); + err |= check_one_size_helper(SIZE_MAX - 4, size_sub, SIZE_MAX - 1, 3); + err |= check_one_size_helper(1, size_sub, SIZE_MAX - 1, -3); + + var = 4; + err |= check_one_size_helper(4 * sizeof(*obj->data), + flex_array_size, obj, data, var++); + err |= check_one_size_helper(5 * sizeof(*obj->data), + flex_array_size, obj, data, var++); + err |= check_one_size_helper(0, flex_array_size, obj, data, 0); + err |= check_one_size_helper(sizeof(*obj->data), + flex_array_size, obj, data, 1); + err |= check_one_size_helper(7 * sizeof(*obj->data), + flex_array_size, obj, data, 7); + err |= check_one_size_helper(SIZE_MAX, + flex_array_size, obj, data, -1); + err |= check_one_size_helper(SIZE_MAX, + flex_array_size, obj, data, SIZE_MAX - 4); + + var = 4; + err |= check_one_size_helper(sizeof(*obj) + (4 * sizeof(*obj->data)), + struct_size, obj, data, var++); + err |= check_one_size_helper(sizeof(*obj) + (5 * sizeof(*obj->data)), + struct_size, obj, data, var++); + err |= check_one_size_helper(sizeof(*obj), struct_size, obj, data, 0); + err |= check_one_size_helper(sizeof(*obj) + sizeof(*obj->data), + struct_size, obj, data, 1); + err |= check_one_size_helper(SIZE_MAX, + struct_size, obj, data, -3); + err |= check_one_size_helper(SIZE_MAX, + struct_size, obj, data, SIZE_MAX - 3); + + pr_info("%d overflow size helper tests finished\n", count); + + return err; +} + static int __init test_module_init(void) { int err = 0; err |= test_overflow_calculation(); err |= test_overflow_shift(); + err |= test_overflow_size_helpers(); err |= test_overflow_allocation(); if (err) { diff --git a/mm/memcontrol.c b/mm/memcontrol.c index d187bfb43b1f..e53d57990691 100644 --- a/mm/memcontrol.c +++ b/mm/memcontrol.c @@ -4140,9 +4140,12 @@ static ssize_t memcg_write_event_control(struct kernfs_open_file *of, buf = endp + 1; cfd = simple_strtoul(buf, &endp, 10); - if ((*endp != ' ') && (*endp != '\0')) + if (*endp == '\0') + buf = endp; + else if (*endp == ' ') + buf = endp + 1; + else return -EINVAL; - buf = endp + 1; event = kzalloc(sizeof(*event), GFP_KERNEL); if (!event) diff --git a/mm/page-writeback.c b/mm/page-writeback.c index 078f1461e074..ed19e580144a 100644 --- a/mm/page-writeback.c +++ b/mm/page-writeback.c @@ -432,13 +432,20 @@ static void domain_dirty_limits(struct dirty_throttle_control *dtc) else bg_thresh = (bg_ratio * available_memory) / PAGE_SIZE; - if (bg_thresh >= thresh) - bg_thresh = thresh / 2; tsk = current; if (tsk->flags & PF_LESS_THROTTLE || rt_task(tsk)) { bg_thresh += bg_thresh / 4 + global_wb_domain.dirty_limit / 32; thresh += thresh / 4 + global_wb_domain.dirty_limit / 32; } + /* + * Dirty throttling logic assumes the limits in page units fit into + * 32-bits. This gives 16TB dirty limits max which is hopefully enough. + */ + if (thresh > UINT_MAX) + thresh = UINT_MAX; + /* This makes sure bg_thresh is within 32-bits as well */ + if (bg_thresh >= thresh) + bg_thresh = thresh / 2; dtc->thresh = thresh; dtc->bg_thresh = bg_thresh; @@ -488,7 +495,11 @@ static unsigned long node_dirty_limit(struct pglist_data *pgdat) if (tsk->flags & PF_LESS_THROTTLE || rt_task(tsk)) dirty += dirty / 4; - return dirty; + /* + * Dirty throttling logic assumes the limits in page units fit into + * 32-bits. This gives 16TB dirty limits max which is hopefully enough. + */ + return min_t(unsigned long, dirty, UINT_MAX); } /** @@ -527,10 +538,17 @@ int dirty_background_bytes_handler(struct ctl_table *table, int write, loff_t *ppos) { int ret; + unsigned long old_bytes = dirty_background_bytes; ret = proc_doulongvec_minmax(table, write, buffer, lenp, ppos); - if (ret == 0 && write) + if (ret == 0 && write) { + if (DIV_ROUND_UP(dirty_background_bytes, PAGE_SIZE) > + UINT_MAX) { + dirty_background_bytes = old_bytes; + return -ERANGE; + } dirty_background_ratio = 0; + } return ret; } @@ -558,6 +576,10 @@ int dirty_bytes_handler(struct ctl_table *table, int write, ret = proc_doulongvec_minmax(table, write, buffer, lenp, ppos); if (ret == 0 && write && vm_dirty_bytes != old_bytes) { + if (DIV_ROUND_UP(vm_dirty_bytes, PAGE_SIZE) > UINT_MAX) { + vm_dirty_bytes = old_bytes; + return -ERANGE; + } writeback_set_ratelimit(); vm_dirty_ratio = 0; } diff --git a/net/bluetooth/bnep/core.c b/net/bluetooth/bnep/core.c index 7b3965861013..a16d584a6c0d 100644 --- a/net/bluetooth/bnep/core.c +++ b/net/bluetooth/bnep/core.c @@ -385,7 +385,8 @@ static int bnep_rx_frame(struct bnep_session *s, struct sk_buff *skb) case BNEP_COMPRESSED_DST_ONLY: __skb_put_data(nskb, skb_mac_header(skb), ETH_ALEN); - __skb_put_data(nskb, s->eh.h_source, ETH_ALEN + 2); + __skb_put_data(nskb, s->eh.h_source, ETH_ALEN); + put_unaligned(s->eh.h_proto, (__be16 *)__skb_put(nskb, 2)); break; case BNEP_GENERAL: diff --git a/net/bluetooth/hci_core.c b/net/bluetooth/hci_core.c index 581ce8b3342b..f089b5a8d529 100644 --- a/net/bluetooth/hci_core.c +++ b/net/bluetooth/hci_core.c @@ -3286,7 +3286,11 @@ void hci_unregister_dev(struct hci_dev *hdev) list_del(&hdev->list); write_unlock(&hci_dev_list_lock); + cancel_work_sync(&hdev->rx_work); + cancel_work_sync(&hdev->cmd_work); + cancel_work_sync(&hdev->tx_work); cancel_work_sync(&hdev->power_on); + cancel_work_sync(&hdev->error_reset); hci_dev_do_close(hdev); @@ -3925,15 +3929,27 @@ static inline int __get_blocks(struct hci_dev *hdev, struct sk_buff *skb) return DIV_ROUND_UP(skb->len - HCI_ACL_HDR_SIZE, hdev->block_len); } -static void __check_timeout(struct hci_dev *hdev, unsigned int cnt) +static void __check_timeout(struct hci_dev *hdev, unsigned int cnt, u8 type) { - if (!hci_dev_test_flag(hdev, HCI_UNCONFIGURED)) { - /* ACL tx timeout must be longer than maximum - * link supervision timeout (40.9 seconds) */ - if (!cnt && time_after(jiffies, hdev->acl_last_tx + - HCI_ACL_TX_TIMEOUT)) - hci_link_tx_to(hdev, ACL_LINK); + unsigned long last_tx; + + if (hci_dev_test_flag(hdev, HCI_UNCONFIGURED)) + return; + + switch (type) { + case LE_LINK: + last_tx = hdev->le_last_tx; + break; + default: + last_tx = hdev->acl_last_tx; + break; } + + /* tx timeout must be longer than maximum link supervision timeout + * (40.9 seconds) + */ + if (!cnt && time_after(jiffies, last_tx + HCI_ACL_TX_TIMEOUT)) + hci_link_tx_to(hdev, type); } static void hci_sched_acl_pkt(struct hci_dev *hdev) @@ -3943,7 +3959,7 @@ static void hci_sched_acl_pkt(struct hci_dev *hdev) struct sk_buff *skb; int quote; - __check_timeout(hdev, cnt); + __check_timeout(hdev, cnt, ACL_LINK); while (hdev->acl_cnt && (chan = hci_chan_sent(hdev, ACL_LINK, "e))) { @@ -3982,8 +3998,6 @@ static void hci_sched_acl_blk(struct hci_dev *hdev) int quote; u8 type; - __check_timeout(hdev, cnt); - BT_DBG("%s", hdev->name); if (hdev->dev_type == HCI_AMP) @@ -3991,6 +4005,8 @@ static void hci_sched_acl_blk(struct hci_dev *hdev) else type = ACL_LINK; + __check_timeout(hdev, cnt, type); + while (hdev->block_cnt > 0 && (chan = hci_chan_sent(hdev, type, "e))) { u32 priority = (skb_peek(&chan->data_q))->priority; @@ -4103,24 +4119,19 @@ static void hci_sched_le(struct hci_dev *hdev) { struct hci_chan *chan; struct sk_buff *skb; - int quote, cnt, tmp; + int quote, *cnt, tmp; BT_DBG("%s", hdev->name); if (!hci_conn_num(hdev, LE_LINK)) return; - if (!hci_dev_test_flag(hdev, HCI_UNCONFIGURED)) { - /* LE tx timeout must be longer than maximum - * link supervision timeout (40.9 seconds) */ - if (!hdev->le_cnt && hdev->le_pkts && - time_after(jiffies, hdev->le_last_tx + HZ * 45)) - hci_link_tx_to(hdev, LE_LINK); - } + cnt = hdev->le_pkts ? &hdev->le_cnt : &hdev->acl_cnt; - cnt = hdev->le_pkts ? hdev->le_cnt : hdev->acl_cnt; - tmp = cnt; - while (cnt && (chan = hci_chan_sent(hdev, LE_LINK, "e))) { + __check_timeout(hdev, *cnt, LE_LINK); + + tmp = *cnt; + while (*cnt && (chan = hci_chan_sent(hdev, LE_LINK, "e))) { u32 priority = (skb_peek(&chan->data_q))->priority; while (quote-- && (skb = skb_peek(&chan->data_q))) { BT_DBG("chan %p skb %p len %d priority %u", chan, skb, @@ -4135,18 +4146,13 @@ static void hci_sched_le(struct hci_dev *hdev) hci_send_frame(hdev, skb); hdev->le_last_tx = jiffies; - cnt--; + (*cnt)--; chan->sent++; chan->conn->sent++; } } - if (hdev->le_pkts) - hdev->le_cnt = cnt; - else - hdev->acl_cnt = cnt; - - if (cnt != tmp) + if (*cnt != tmp) hci_prio_recalculate(hdev, LE_LINK); } diff --git a/net/bluetooth/l2cap_core.c b/net/bluetooth/l2cap_core.c index 3f9b2b4a62ff..ca225c132523 100644 --- a/net/bluetooth/l2cap_core.c +++ b/net/bluetooth/l2cap_core.c @@ -7055,6 +7055,7 @@ static void l2cap_conless_channel(struct l2cap_conn *conn, __le16 psm, bt_cb(skb)->l2cap.psm = psm; if (!chan->ops->recv(chan, skb)) { + l2cap_chan_unlock(chan); l2cap_chan_put(chan); return; } diff --git a/net/bluetooth/mgmt.c b/net/bluetooth/mgmt.c index d0ec0e336909..6473c0cd6da8 100644 --- a/net/bluetooth/mgmt.c +++ b/net/bluetooth/mgmt.c @@ -2913,6 +2913,10 @@ static int pair_device(struct sock *sk, struct hci_dev *hdev, void *data, * will be kept and this function does nothing. */ p = hci_conn_params_add(hdev, &cp->addr.bdaddr, addr_type); + if (!p) { + err = -EIO; + goto unlock; + } if (p->auto_connect == HCI_AUTO_CONN_EXPLICIT) p->auto_connect = HCI_AUTO_CONN_DISABLED; diff --git a/net/core/link_watch.c b/net/core/link_watch.c index e38e641e98d5..320be467b785 100644 --- a/net/core/link_watch.c +++ b/net/core/link_watch.c @@ -135,9 +135,9 @@ static void linkwatch_schedule_work(int urgent) * override the existing timer. */ if (test_bit(LW_URGENT, &linkwatch_flags)) - mod_delayed_work(system_wq, &linkwatch_work, 0); + mod_delayed_work(system_unbound_wq, &linkwatch_work, 0); else - schedule_delayed_work(&linkwatch_work, delay); + queue_delayed_work(system_unbound_wq, &linkwatch_work, delay); } diff --git a/net/core/skbuff.c b/net/core/skbuff.c index c190eb4c48f7..d9d8736365e4 100644 --- a/net/core/skbuff.c +++ b/net/core/skbuff.c @@ -3628,8 +3628,9 @@ struct sk_buff *skb_segment(struct sk_buff *head_skb, /* GSO partial only requires that we trim off any excess that * doesn't fit into an MSS sized block, so take care of that * now. + * Cap len to not accidentally hit GSO_BY_FRAGS. */ - partial_segs = len / mss; + partial_segs = min(len, (unsigned int)(GSO_BY_FRAGS - 1)) / mss; if (partial_segs > 1) mss *= partial_segs; else diff --git a/net/ipv4/af_inet.c b/net/ipv4/af_inet.c index a9159c49dc24..2ab3f29b00da 100644 --- a/net/ipv4/af_inet.c +++ b/net/ipv4/af_inet.c @@ -749,7 +749,9 @@ int inet_accept(struct socket *sock, struct socket *newsock, int flags, sock_rps_record_flow(sk2); WARN_ON(!((1 << sk2->sk_state) & (TCPF_ESTABLISHED | TCPF_SYN_RECV | - TCPF_CLOSE_WAIT | TCPF_CLOSE))); + TCPF_FIN_WAIT1 | TCPF_FIN_WAIT2 | + TCPF_CLOSING | TCPF_CLOSE_WAIT | + TCPF_CLOSE))); sock_graft(sk2, newsock); diff --git a/net/ipv4/route.c b/net/ipv4/route.c index 3c5401dafdee..437960825ec2 100644 --- a/net/ipv4/route.c +++ b/net/ipv4/route.c @@ -1273,18 +1273,15 @@ void ip_rt_get_source(u8 *addr, struct sk_buff *skb, struct rtable *rt) src = ip_hdr(skb)->saddr; else { struct fib_result res; - struct flowi4 fl4; - struct iphdr *iph; - - iph = ip_hdr(skb); - - memset(&fl4, 0, sizeof(fl4)); - fl4.daddr = iph->daddr; - fl4.saddr = iph->saddr; - fl4.flowi4_tos = RT_TOS(iph->tos); - fl4.flowi4_oif = rt->dst.dev->ifindex; - fl4.flowi4_iif = skb->dev->ifindex; - fl4.flowi4_mark = skb->mark; + struct iphdr *iph = ip_hdr(skb); + struct flowi4 fl4 = { + .daddr = iph->daddr, + .saddr = iph->saddr, + .flowi4_tos = iph->tos & IPTOS_RT_MASK, + .flowi4_oif = rt->dst.dev->ifindex, + .flowi4_iif = skb->dev->ifindex, + .flowi4_mark = skb->mark, + }; rcu_read_lock(); if (fib_lookup(dev_net(rt->dst.dev), &fl4, &res, 0) == 0) diff --git a/net/ipv6/addrconf.c b/net/ipv6/addrconf.c index 32ac4de7bc49..28c43e4ae611 100644 --- a/net/ipv6/addrconf.c +++ b/net/ipv6/addrconf.c @@ -1770,7 +1770,8 @@ int ipv6_dev_get_saddr(struct net *net, const struct net_device *dst_dev, master, &dst, scores, hiscore_idx); - if (scores[hiscore_idx].ifa) + if (scores[hiscore_idx].ifa && + scores[hiscore_idx].scopedist >= 0) goto out; } diff --git a/net/ipv6/ila/ila_lwt.c b/net/ipv6/ila/ila_lwt.c index 3d56a2fb6f86..c7630776bd8e 100644 --- a/net/ipv6/ila/ila_lwt.c +++ b/net/ipv6/ila/ila_lwt.c @@ -58,7 +58,9 @@ static int ila_output(struct net *net, struct sock *sk, struct sk_buff *skb) return orig_dst->lwtstate->orig_output(net, sk, skb); } + local_bh_disable(); dst = dst_cache_get(&ilwt->dst_cache); + local_bh_enable(); if (unlikely(!dst)) { struct ipv6hdr *ip6h = ipv6_hdr(skb); struct flowi6 fl6; @@ -86,8 +88,11 @@ static int ila_output(struct net *net, struct sock *sk, struct sk_buff *skb) goto drop; } - if (ilwt->connected) + if (ilwt->connected) { + local_bh_disable(); dst_cache_set_ip6(&ilwt->dst_cache, dst, &fl6.saddr); + local_bh_enable(); + } } skb_dst_set(skb, dst); diff --git a/net/ipv6/ip6_output.c b/net/ipv6/ip6_output.c index 0872df066a4e..52f0ddb3835b 100644 --- a/net/ipv6/ip6_output.c +++ b/net/ipv6/ip6_output.c @@ -1757,6 +1757,7 @@ int ip6_send_skb(struct sk_buff *skb) struct rt6_info *rt = (struct rt6_info *)skb_dst(skb); int err; + rcu_read_lock(); err = ip6_local_out(net, skb->sk, skb); if (err) { if (err > 0) @@ -1766,6 +1767,7 @@ int ip6_send_skb(struct sk_buff *skb) IPSTATS_MIB_OUTDISCARDS); } + rcu_read_unlock(); return err; } diff --git a/net/ipv6/ndisc.c b/net/ipv6/ndisc.c index 9bbbfb29b71b..a9fb7ab472e3 100644 --- a/net/ipv6/ndisc.c +++ b/net/ipv6/ndisc.c @@ -225,6 +225,7 @@ struct ndisc_options *ndisc_parse_options(const struct net_device *dev, return NULL; memset(ndopts, 0, sizeof(*ndopts)); while (opt_len) { + bool unknown = false; int l; if (opt_len < sizeof(struct nd_opt_hdr)) return NULL; @@ -260,22 +261,23 @@ struct ndisc_options *ndisc_parse_options(const struct net_device *dev, break; #endif default: - if (ndisc_is_useropt(dev, nd_opt)) { - ndopts->nd_useropts_end = nd_opt; - if (!ndopts->nd_useropts) - ndopts->nd_useropts = nd_opt; - } else { - /* - * Unknown options must be silently ignored, - * to accommodate future extension to the - * protocol. - */ - ND_PRINTK(2, notice, - "%s: ignored unsupported option; type=%d, len=%d\n", - __func__, - nd_opt->nd_opt_type, - nd_opt->nd_opt_len); - } + unknown = true; + } + if (ndisc_is_useropt(dev, nd_opt)) { + ndopts->nd_useropts_end = nd_opt; + if (!ndopts->nd_useropts) + ndopts->nd_useropts = nd_opt; + } else if (unknown) { + /* + * Unknown options must be silently ignored, + * to accommodate future extension to the + * protocol. + */ + ND_PRINTK(2, notice, + "%s: ignored unsupported option; type=%d, len=%d\n", + __func__, + nd_opt->nd_opt_type, + nd_opt->nd_opt_len); } next_opt: opt_len -= l; diff --git a/net/iucv/af_iucv.c b/net/iucv/af_iucv.c index 1ff2860dd3ff..50725e2198f4 100644 --- a/net/iucv/af_iucv.c +++ b/net/iucv/af_iucv.c @@ -456,8 +456,8 @@ static void iucv_sever_path(struct sock *sk, int with_user_data) struct iucv_sock *iucv = iucv_sk(sk); struct iucv_path *path = iucv->path; - if (iucv->path) { - iucv->path = NULL; + /* Whoever resets the path pointer, must sever and free it. */ + if (xchg(&iucv->path, NULL)) { if (with_user_data) { low_nmcpy(user_data, iucv->src_name); high_nmcpy(user_data, iucv->dst_name); diff --git a/net/iucv/iucv.c b/net/iucv/iucv.c index 2f82a6f0992e..b1ecf008fa50 100644 --- a/net/iucv/iucv.c +++ b/net/iucv/iucv.c @@ -1149,8 +1149,7 @@ static int iucv_message_receive_iprmdata(struct iucv_path *path, size = (size < 8) ? size : 8; for (array = buffer; size > 0; array++) { copy = min_t(size_t, size, array->length); - memcpy((u8 *)(addr_t) array->address, - rmmsg, copy); + memcpy(phys_to_virt(array->address), rmmsg, copy); rmmsg += copy; size -= copy; } diff --git a/net/kcm/kcmsock.c b/net/kcm/kcmsock.c index 9e6121f6e48a..85db24309d26 100644 --- a/net/kcm/kcmsock.c +++ b/net/kcm/kcmsock.c @@ -916,6 +916,7 @@ static int kcm_sendmsg(struct socket *sock, struct msghdr *msg, size_t len) !(msg->msg_flags & MSG_MORE) : !!(msg->msg_flags & MSG_EOR); int err = -EPIPE; + mutex_lock(&kcm->tx_mutex); lock_sock(sk); /* Per tcp_sendmsg this should be in poll */ @@ -1064,6 +1065,7 @@ partial_message: KCM_STATS_ADD(kcm->stats.tx_bytes, copied); release_sock(sk); + mutex_unlock(&kcm->tx_mutex); return copied; out_error: @@ -1089,6 +1091,7 @@ out_error: sk->sk_write_space(sk); release_sock(sk); + mutex_unlock(&kcm->tx_mutex); return err; } @@ -1331,6 +1334,7 @@ static void init_kcm_sock(struct kcm_sock *kcm, struct kcm_mux *mux) spin_unlock_bh(&mux->lock); INIT_WORK(&kcm->tx_work, kcm_tx_work); + mutex_init(&kcm->tx_mutex); spin_lock_bh(&mux->rx_lock); kcm_rcv_ready(kcm); diff --git a/net/mac80211/mesh.c b/net/mac80211/mesh.c index 3162f955f3ae..c9a5271d9b59 100644 --- a/net/mac80211/mesh.c +++ b/net/mac80211/mesh.c @@ -1454,6 +1454,7 @@ void ieee80211_mesh_init_sdata(struct ieee80211_sub_if_data *sdata) ifmsh->last_preq = jiffies; ifmsh->next_perr = jiffies; ifmsh->csa_role = IEEE80211_MESH_CSA_ROLE_NONE; + ifmsh->nonpeer_pm = NL80211_MESH_POWER_ACTIVE; /* Allocate all mesh structures when creating the first mesh interface. */ if (!mesh_allocated) ieee80211s_init(); diff --git a/net/mac80211/scan.c b/net/mac80211/scan.c index e3d8be4feea5..76fb858dc890 100644 --- a/net/mac80211/scan.c +++ b/net/mac80211/scan.c @@ -652,15 +652,21 @@ static int __ieee80211_start_scan(struct ieee80211_sub_if_data *sdata, local->hw_scan_ies_bufsize *= n_bands; } - local->hw_scan_req = kmalloc( - sizeof(*local->hw_scan_req) + - req->n_channels * sizeof(req->channels[0]) + - local->hw_scan_ies_bufsize, GFP_KERNEL); + local->hw_scan_req = kmalloc(struct_size(local->hw_scan_req, + req.channels, + req->n_channels) + + local->hw_scan_ies_bufsize, + GFP_KERNEL); if (!local->hw_scan_req) return -ENOMEM; local->hw_scan_req->req.ssids = req->ssids; local->hw_scan_req->req.n_ssids = req->n_ssids; + /* None of the channels are actually set + * up but let UBSAN know the boundaries. + */ + local->hw_scan_req->req.n_channels = req->n_channels; + ies = (u8 *)local->hw_scan_req + sizeof(*local->hw_scan_req) + req->n_channels * sizeof(req->channels[0]); diff --git a/net/netfilter/ipvs/ip_vs_proto_sctp.c b/net/netfilter/ipvs/ip_vs_proto_sctp.c index 18e2e489d0e5..5005469c1732 100644 --- a/net/netfilter/ipvs/ip_vs_proto_sctp.c +++ b/net/netfilter/ipvs/ip_vs_proto_sctp.c @@ -123,7 +123,7 @@ sctp_snat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp, if (sctph->source != cp->vport || payload_csum || skb->ip_summed == CHECKSUM_PARTIAL) { sctph->source = cp->vport; - if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb)) + if (!skb_is_gso(skb)) sctp_nat_csum(skb, sctph, sctphoff); } else { skb->ip_summed = CHECKSUM_UNNECESSARY; @@ -172,7 +172,7 @@ sctp_dnat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp, (skb->ip_summed == CHECKSUM_PARTIAL && !(skb_dst(skb)->dev->features & NETIF_F_SCTP_CRC))) { sctph->dest = cp->dport; - if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb)) + if (!skb_is_gso(skb)) sctp_nat_csum(skb, sctph, sctphoff); } else if (skb->ip_summed != CHECKSUM_PARTIAL) { skb->ip_summed = CHECKSUM_UNNECESSARY; diff --git a/net/netfilter/nf_conntrack_netlink.c b/net/netfilter/nf_conntrack_netlink.c index 83e8566ec3f0..bcb72ad2c178 100644 --- a/net/netfilter/nf_conntrack_netlink.c +++ b/net/netfilter/nf_conntrack_netlink.c @@ -3106,7 +3106,8 @@ static int ctnetlink_del_expect(struct net *net, struct sock *ctnl, if (cda[CTA_EXPECT_ID]) { __be32 id = nla_get_be32(cda[CTA_EXPECT_ID]); - if (ntohl(id) != (u32)(unsigned long)exp) { + + if (id != nf_expect_get_id(exp)) { nf_ct_expect_put(exp); return -ENOENT; } diff --git a/net/netfilter/nf_tables_api.c b/net/netfilter/nf_tables_api.c index f2611406af14..a033c9baf58a 100644 --- a/net/netfilter/nf_tables_api.c +++ b/net/netfilter/nf_tables_api.c @@ -2698,6 +2698,15 @@ static void nf_tables_rule_release(const struct nft_ctx *ctx, nf_tables_rule_destroy(ctx, rule); } +/** nft_chain_validate - loop detection and hook validation + * + * @ctx: context containing call depth and base chain + * @chain: chain to validate + * + * Walk through the rules of the given chain and chase all jumps/gotos + * and set lookups until either the jump limit is hit or all reachable + * chains have been validated. + */ int nft_chain_validate(const struct nft_ctx *ctx, const struct nft_chain *chain) { struct nft_expr *expr, *last; @@ -2716,6 +2725,9 @@ int nft_chain_validate(const struct nft_ctx *ctx, const struct nft_chain *chain) if (!expr->ops->validate) continue; + /* This may call nft_chain_validate() recursively, + * callers that do so must increment ctx->level. + */ err = expr->ops->validate(ctx, expr, &data); if (err < 0) return err; @@ -4523,8 +4535,10 @@ static int nf_tables_getsetelem(struct net *net, struct sock *nlsk, nla_for_each_nested(attr, nla[NFTA_SET_ELEM_LIST_ELEMENTS], rem) { err = nft_get_set_elem(&ctx, set, attr); - if (err < 0) + if (err < 0) { + NL_SET_BAD_ATTR(extack, attr); break; + } } return err; @@ -4902,8 +4916,10 @@ static int nf_tables_newsetelem(struct net *net, struct sock *nlsk, nla_for_each_nested(attr, nla[NFTA_SET_ELEM_LIST_ELEMENTS], rem) { err = nft_add_set_elem(&ctx, set, attr, nlh->nlmsg_flags); - if (err < 0) + if (err < 0) { + NL_SET_BAD_ATTR(extack, attr); return err; + } } if (nft_net->validate_state == NFT_VALIDATE_DO) @@ -5103,9 +5119,10 @@ static int nf_tables_delsetelem(struct net *net, struct sock *nlsk, nla_for_each_nested(attr, nla[NFTA_SET_ELEM_LIST_ELEMENTS], rem) { err = nft_del_setelem(&ctx, set, attr); - if (err < 0) + if (err < 0) { + NL_SET_BAD_ATTR(extack, attr); break; - + } set->ndeact++; } return err; @@ -7360,6 +7377,7 @@ static bool nf_tables_valid_genid(struct net *net, u32 genid) bool genid_ok; mutex_lock(&nft_net->commit_mutex); + nft_net->tstamp = get_jiffies_64(); genid_ok = genid == 0 || nft_net->base_seq == genid; if (!genid_ok) @@ -7412,106 +7430,6 @@ int nft_chain_validate_hooks(const struct nft_chain *chain, } EXPORT_SYMBOL_GPL(nft_chain_validate_hooks); -/* - * Loop detection - walk through the ruleset beginning at the destination chain - * of a new jump until either the source chain is reached (loop) or all - * reachable chains have been traversed. - * - * The loop check is performed whenever a new jump verdict is added to an - * expression or verdict map or a verdict map is bound to a new chain. - */ - -static int nf_tables_check_loops(const struct nft_ctx *ctx, - const struct nft_chain *chain); - -static int nf_tables_loop_check_setelem(const struct nft_ctx *ctx, - struct nft_set *set, - const struct nft_set_iter *iter, - struct nft_set_elem *elem) -{ - const struct nft_set_ext *ext = nft_set_elem_ext(set, elem->priv); - const struct nft_data *data; - - if (nft_set_ext_exists(ext, NFT_SET_EXT_FLAGS) && - *nft_set_ext_flags(ext) & NFT_SET_ELEM_INTERVAL_END) - return 0; - - data = nft_set_ext_data(ext); - switch (data->verdict.code) { - case NFT_JUMP: - case NFT_GOTO: - return nf_tables_check_loops(ctx, data->verdict.chain); - default: - return 0; - } -} - -static int nf_tables_check_loops(const struct nft_ctx *ctx, - const struct nft_chain *chain) -{ - const struct nft_rule *rule; - const struct nft_expr *expr, *last; - struct nft_set *set; - struct nft_set_binding *binding; - struct nft_set_iter iter; - - if (ctx->chain == chain) - return -ELOOP; - - list_for_each_entry(rule, &chain->rules, list) { - nft_rule_for_each_expr(expr, last, rule) { - struct nft_immediate_expr *priv; - const struct nft_data *data; - int err; - - if (strcmp(expr->ops->type->name, "immediate")) - continue; - - priv = nft_expr_priv(expr); - if (priv->dreg != NFT_REG_VERDICT) - continue; - - data = &priv->data; - switch (data->verdict.code) { - case NFT_JUMP: - case NFT_GOTO: - err = nf_tables_check_loops(ctx, - data->verdict.chain); - if (err < 0) - return err; - default: - break; - } - } - } - - list_for_each_entry(set, &ctx->table->sets, list) { - if (!nft_is_active_next(ctx->net, set)) - continue; - if (!(set->flags & NFT_SET_MAP) || - set->dtype != NFT_DATA_VERDICT) - continue; - - list_for_each_entry(binding, &set->bindings, list) { - if (!(binding->flags & NFT_SET_MAP) || - binding->chain != chain) - continue; - - iter.genmask = nft_genmask_next(ctx->net); - iter.skip = 0; - iter.count = 0; - iter.err = 0; - iter.fn = nf_tables_loop_check_setelem; - - set->ops->walk(ctx, set, &iter); - if (iter.err < 0) - return iter.err; - } - } - - return 0; -} - /** * nft_parse_u32_check - fetch u32 attribute and check for maximum value * @@ -7647,7 +7565,7 @@ static int nft_validate_register_store(const struct nft_ctx *ctx, if (data != NULL && (data->verdict.code == NFT_GOTO || data->verdict.code == NFT_JUMP)) { - err = nf_tables_check_loops(ctx, data->verdict.chain); + err = nft_chain_validate(ctx, data->verdict.chain); if (err < 0) return err; } diff --git a/net/netfilter/nft_counter.c b/net/netfilter/nft_counter.c index a61d7edfc290..b4a4ed00506f 100644 --- a/net/netfilter/nft_counter.c +++ b/net/netfilter/nft_counter.c @@ -108,11 +108,16 @@ static void nft_counter_reset(struct nft_counter_percpu_priv __percpu *priv, struct nft_counter *total) { struct nft_counter *this_cpu; + seqcount_t *myseq; local_bh_disable(); this_cpu = this_cpu_ptr(priv->counter); + myseq = this_cpu_ptr(&nft_counter_seq); + + write_seqcount_begin(myseq); this_cpu->packets -= total->packets; this_cpu->bytes -= total->bytes; + write_seqcount_end(myseq); local_bh_enable(); } diff --git a/net/netfilter/nft_set_hash.c b/net/netfilter/nft_set_hash.c index 5e562e7cd470..8e249e98aeea 100644 --- a/net/netfilter/nft_set_hash.c +++ b/net/netfilter/nft_set_hash.c @@ -41,6 +41,7 @@ struct nft_rhash_cmp_arg { const struct nft_set *set; const u32 *key; u8 genmask; + u64 tstamp; }; static inline u32 nft_rhash_key(const void *data, u32 len, u32 seed) @@ -67,7 +68,7 @@ static inline int nft_rhash_cmp(struct rhashtable_compare_arg *arg, return 1; if (nft_set_elem_is_dead(&he->ext)) return 1; - if (nft_set_elem_expired(&he->ext)) + if (__nft_set_elem_expired(&he->ext, x->tstamp)) return 1; if (!nft_set_elem_active(&he->ext, x->genmask)) return 1; @@ -91,6 +92,7 @@ static bool nft_rhash_lookup(const struct net *net, const struct nft_set *set, .genmask = nft_genmask_cur(net), .set = set, .key = key, + .tstamp = get_jiffies_64(), }; he = rhashtable_lookup_fast(&priv->ht, &arg, nft_rhash_params); @@ -109,6 +111,7 @@ static void *nft_rhash_get(const struct net *net, const struct nft_set *set, .genmask = nft_genmask_cur(net), .set = set, .key = elem->key.val.data, + .tstamp = get_jiffies_64(), }; he = rhashtable_lookup_fast(&priv->ht, &arg, nft_rhash_params); @@ -132,6 +135,7 @@ static bool nft_rhash_update(struct nft_set *set, const u32 *key, .genmask = NFT_GENMASK_ANY, .set = set, .key = key, + .tstamp = get_jiffies_64(), }; he = rhashtable_lookup_fast(&priv->ht, &arg, nft_rhash_params); @@ -175,6 +179,7 @@ static int nft_rhash_insert(const struct net *net, const struct nft_set *set, .genmask = nft_genmask_next(net), .set = set, .key = elem->key.val.data, + .tstamp = nft_net_tstamp(net), }; struct nft_rhash_elem *prev; @@ -217,6 +222,7 @@ static void *nft_rhash_deactivate(const struct net *net, .genmask = nft_genmask_next(net), .set = set, .key = elem->key.val.data, + .tstamp = nft_net_tstamp(net), }; rcu_read_lock(); diff --git a/net/netfilter/nft_set_rbtree.c b/net/netfilter/nft_set_rbtree.c index caddacc1d446..f5bec0e37c0d 100644 --- a/net/netfilter/nft_set_rbtree.c +++ b/net/netfilter/nft_set_rbtree.c @@ -318,6 +318,7 @@ static int __nft_rbtree_insert(const struct net *net, const struct nft_set *set, struct nft_rbtree *priv = nft_set_priv(set); u8 cur_genmask = nft_genmask_cur(net); u8 genmask = nft_genmask_next(net); + u64 tstamp = nft_net_tstamp(net); int d, err; /* Descend the tree to search for an existing element greater than the @@ -365,7 +366,7 @@ static int __nft_rbtree_insert(const struct net *net, const struct nft_set *set, /* perform garbage collection to avoid bogus overlap reports * but skip new elements in this transaction. */ - if (nft_set_elem_expired(&rbe->ext) && + if (__nft_set_elem_expired(&rbe->ext, tstamp) && nft_set_elem_active(&rbe->ext, cur_genmask)) { err = nft_rbtree_gc_elem(set, priv, rbe); if (err < 0) @@ -540,6 +541,7 @@ static void *nft_rbtree_deactivate(const struct net *net, const struct rb_node *parent = priv->root.rb_node; struct nft_rbtree_elem *rbe, *this = elem->priv; u8 genmask = nft_genmask_next(net); + u64 tstamp = nft_net_tstamp(net); int d; while (parent != NULL) { @@ -560,7 +562,7 @@ static void *nft_rbtree_deactivate(const struct net *net, nft_rbtree_interval_end(this)) { parent = parent->rb_right; continue; - } else if (nft_set_elem_expired(&rbe->ext)) { + } else if (__nft_set_elem_expired(&rbe->ext, tstamp)) { break; } else if (!nft_set_elem_active(&rbe->ext, genmask)) { parent = parent->rb_left; diff --git a/net/packet/af_packet.c b/net/packet/af_packet.c index 09a89def57fb..89f557645b7e 100644 --- a/net/packet/af_packet.c +++ b/net/packet/af_packet.c @@ -499,6 +499,61 @@ static void *packet_current_frame(struct packet_sock *po, return packet_lookup_frame(po, rb, rb->head, status); } +static u16 vlan_get_tci(struct sk_buff *skb, struct net_device *dev) +{ + u8 *skb_orig_data = skb->data; + int skb_orig_len = skb->len; + struct vlan_hdr vhdr, *vh; + unsigned int header_len; + + if (!dev) + return 0; + + /* In the SOCK_DGRAM scenario, skb data starts at the network + * protocol, which is after the VLAN headers. The outer VLAN + * header is at the hard_header_len offset in non-variable + * length link layer headers. If it's a VLAN device, the + * min_header_len should be used to exclude the VLAN header + * size. + */ + if (dev->min_header_len == dev->hard_header_len) + header_len = dev->hard_header_len; + else if (is_vlan_dev(dev)) + header_len = dev->min_header_len; + else + return 0; + + skb_push(skb, skb->data - skb_mac_header(skb)); + vh = skb_header_pointer(skb, header_len, sizeof(vhdr), &vhdr); + if (skb_orig_data != skb->data) { + skb->data = skb_orig_data; + skb->len = skb_orig_len; + } + if (unlikely(!vh)) + return 0; + + return ntohs(vh->h_vlan_TCI); +} + +static __be16 vlan_get_protocol_dgram(struct sk_buff *skb) +{ + __be16 proto = skb->protocol; + + if (unlikely(eth_type_vlan(proto))) { + u8 *skb_orig_data = skb->data; + int skb_orig_len = skb->len; + + skb_push(skb, skb->data - skb_mac_header(skb)); + proto = __vlan_get_protocol(skb, proto, NULL); + if (skb_orig_data != skb->data) { + skb->data = skb_orig_data; + skb->len = skb_orig_len; + } + } + + return proto; +} + static void prb_del_retire_blk_timer(struct tpacket_kbdq_core *pkc) { del_timer_sync(&pkc->retire_blk_timer); @@ -974,10 +1029,16 @@ static void prb_clear_rxhash(struct tpacket_kbdq_core *pkc, static void prb_fill_vlan_info(struct tpacket_kbdq_core *pkc, struct tpacket3_hdr *ppd) { + struct packet_sock *po = container_of(pkc, struct packet_sock, rx_ring.prb_bdqc); + if (skb_vlan_tag_present(pkc->skb)) { ppd->hv1.tp_vlan_tci = skb_vlan_tag_get(pkc->skb); ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->vlan_proto); ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; + } else if (unlikely(po->sk.sk_type == SOCK_DGRAM && eth_type_vlan(pkc->skb->protocol))) { + ppd->hv1.tp_vlan_tci = vlan_get_tci(pkc->skb, pkc->skb->dev); + ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->protocol); + ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; } else { ppd->hv1.tp_vlan_tci = 0; ppd->hv1.tp_vlan_tpid = 0; @@ -2344,6 +2405,10 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev, h.h2->tp_vlan_tci = skb_vlan_tag_get(skb); h.h2->tp_vlan_tpid = ntohs(skb->vlan_proto); status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; + } else if (unlikely(sk->sk_type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) { + h.h2->tp_vlan_tci = vlan_get_tci(skb, skb->dev); + h.h2->tp_vlan_tpid = ntohs(skb->protocol); + status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; } else { h.h2->tp_vlan_tci = 0; h.h2->tp_vlan_tpid = 0; @@ -2373,7 +2438,8 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev, sll->sll_halen = dev_parse_header(skb, sll->sll_addr); sll->sll_family = AF_PACKET; sll->sll_hatype = dev->type; - sll->sll_protocol = skb->protocol; + sll->sll_protocol = (sk->sk_type == SOCK_DGRAM) ? + vlan_get_protocol_dgram(skb) : skb->protocol; sll->sll_pkttype = skb->pkt_type; if (unlikely(packet_sock_flag(po, PACKET_SOCK_ORIGDEV))) sll->sll_ifindex = orig_dev->ifindex; @@ -3412,7 +3478,8 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len, /* Original length was stored in sockaddr_ll fields */ origlen = PACKET_SKB_CB(skb)->sa.origlen; sll->sll_family = AF_PACKET; - sll->sll_protocol = skb->protocol; + sll->sll_protocol = (sock->type == SOCK_DGRAM) ? + vlan_get_protocol_dgram(skb) : skb->protocol; } sock_recv_ts_and_drops(msg, sk, skb); @@ -3467,6 +3534,21 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len, aux.tp_vlan_tci = skb_vlan_tag_get(skb); aux.tp_vlan_tpid = ntohs(skb->vlan_proto); aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; + } else if (unlikely(sock->type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) { + struct sockaddr_ll *sll = &PACKET_SKB_CB(skb)->sa.ll; + struct net_device *dev; + + rcu_read_lock(); + dev = dev_get_by_index_rcu(sock_net(sk), sll->sll_ifindex); + if (dev) { + aux.tp_vlan_tci = vlan_get_tci(skb, dev); + aux.tp_vlan_tpid = ntohs(skb->protocol); + aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID; + } else { + aux.tp_vlan_tci = 0; + aux.tp_vlan_tpid = 0; + } + rcu_read_unlock(); } else { aux.tp_vlan_tci = 0; aux.tp_vlan_tpid = 0; diff --git a/net/rds/recv.c b/net/rds/recv.c index ccf0bf283002..0b35a11fcf46 100644 --- a/net/rds/recv.c +++ b/net/rds/recv.c @@ -429,6 +429,7 @@ static int rds_still_queued(struct rds_sock *rs, struct rds_incoming *inc, struct sock *sk = rds_rs_to_sk(rs); int ret = 0; unsigned long flags; + struct rds_incoming *to_drop = NULL; write_lock_irqsave(&rs->rs_recv_lock, flags); if (!list_empty(&inc->i_item)) { @@ -439,11 +440,14 @@ static int rds_still_queued(struct rds_sock *rs, struct rds_incoming *inc, -be32_to_cpu(inc->i_hdr.h_len), inc->i_hdr.h_dport); list_del_init(&inc->i_item); - rds_inc_put(inc); + to_drop = inc; } } write_unlock_irqrestore(&rs->rs_recv_lock, flags); + if (to_drop) + rds_inc_put(to_drop); + rdsdebug("inc %p rs %p still %d dropped %d\n", inc, rs, ret, drop); return ret; } @@ -752,16 +756,21 @@ void rds_clear_recv_queue(struct rds_sock *rs) struct sock *sk = rds_rs_to_sk(rs); struct rds_incoming *inc, *tmp; unsigned long flags; + LIST_HEAD(to_drop); write_lock_irqsave(&rs->rs_recv_lock, flags); list_for_each_entry_safe(inc, tmp, &rs->rs_recv_queue, i_item) { rds_recv_rcvbuf_delta(rs, sk, inc->i_conn->c_lcong, -be32_to_cpu(inc->i_hdr.h_len), inc->i_hdr.h_dport); + list_move(&inc->i_item, &to_drop); + } + write_unlock_irqrestore(&rs->rs_recv_lock, flags); + + list_for_each_entry_safe(inc, tmp, &to_drop, i_item) { list_del_init(&inc->i_item); rds_inc_put(inc); } - write_unlock_irqrestore(&rs->rs_recv_lock, flags); } /* diff --git a/net/smc/smc_core.c b/net/smc/smc_core.c index 4d421407d6fc..6c19cc805abc 100644 --- a/net/smc/smc_core.c +++ b/net/smc/smc_core.c @@ -656,21 +656,31 @@ out: return rc ? rc : local_contact; } -/* convert the RMB size into the compressed notation - minimum 16K. +#define SMCD_DMBE_SIZES 6 /* 0 -> 16KB, 1 -> 32KB, .. 6 -> 1MB */ +#define SMCR_RMBE_SIZES 5 /* 0 -> 16KB, 1 -> 32KB, .. 5 -> 512KB */ + +/* convert the RMB size into the compressed notation (minimum 16K, see + * SMCD/R_DMBE_SIZES. * In contrast to plain ilog2, this rounds towards the next power of 2, * so the socket application gets at least its desired sndbuf / rcvbuf size. */ -static u8 smc_compress_bufsize(int size) +static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb) { u8 compressed; if (size <= SMC_BUF_MIN_SIZE) return 0; - size = (size - 1) >> 14; - compressed = ilog2(size) + 1; - if (compressed >= SMC_RMBE_SIZES) - compressed = SMC_RMBE_SIZES - 1; + size = (size - 1) >> 14; /* convert to 16K multiple */ + compressed = min_t(u8, ilog2(size) + 1, + is_smcd ? SMCD_DMBE_SIZES : SMCR_RMBE_SIZES); + +#ifdef CONFIG_ARCH_NO_SG_CHAIN + if (!is_smcd && is_rmb) + /* RMBs are backed by & limited to max size of scatterlists */ + compressed = min_t(u8, compressed, ilog2((SG_MAX_SINGLE_ALLOC * PAGE_SIZE) >> 14)); +#endif + return compressed; } @@ -771,17 +781,12 @@ static struct smc_buf_desc *smcr_new_buf_create(struct smc_link_group *lgr, return buf_desc; } -#define SMCD_DMBE_SIZES 6 /* 0 -> 16KB, 1 -> 32KB, .. 6 -> 1MB */ - static struct smc_buf_desc *smcd_new_buf_create(struct smc_link_group *lgr, bool is_dmb, int bufsize) { struct smc_buf_desc *buf_desc; int rc; - if (smc_compress_bufsize(bufsize) > SMCD_DMBE_SIZES) - return ERR_PTR(-EAGAIN); - /* try to alloc a new DMB */ buf_desc = kzalloc(sizeof(*buf_desc), GFP_KERNEL); if (!buf_desc) @@ -825,9 +830,8 @@ static int __smc_buf_create(struct smc_sock *smc, bool is_smcd, bool is_rmb) /* use socket send buffer size (w/o overhead) as start value */ sk_buf_size = smc->sk.sk_sndbuf / 2; - for (bufsize_short = smc_compress_bufsize(sk_buf_size); + for (bufsize_short = smc_compress_bufsize(sk_buf_size, is_smcd, is_rmb); bufsize_short >= 0; bufsize_short--) { - if (is_rmb) { lock = &lgr->rmbs_lock; buf_list = &lgr->rmbs[bufsize_short]; @@ -836,8 +840,6 @@ static int __smc_buf_create(struct smc_sock *smc, bool is_smcd, bool is_rmb) buf_list = &lgr->sndbufs[bufsize_short]; } bufsize = smc_uncompress_bufsize(bufsize_short); - if ((1 << get_order(bufsize)) > SG_MAX_SINGLE_ALLOC) - continue; /* check for reusable slot in the link group */ buf_desc = smc_buf_get_slot(bufsize_short, lock, buf_list); diff --git a/net/sunrpc/sched.c b/net/sunrpc/sched.c index 9af919364a00..92d88aa62085 100644 --- a/net/sunrpc/sched.c +++ b/net/sunrpc/sched.c @@ -349,8 +349,10 @@ static void rpc_make_runnable(struct workqueue_struct *wq, if (RPC_IS_ASYNC(task)) { INIT_WORK(&task->u.tk_work, rpc_async_schedule); queue_work(wq, &task->u.tk_work); - } else + } else { + smp_mb__after_atomic(); wake_up_bit(&task->tk_runstate, RPC_TASK_QUEUED); + } } /* diff --git a/net/tipc/udp_media.c b/net/tipc/udp_media.c index 1d6235479706..796309b50bb6 100644 --- a/net/tipc/udp_media.c +++ b/net/tipc/udp_media.c @@ -127,8 +127,11 @@ static int tipc_udp_addr2str(struct tipc_media_addr *a, char *buf, int size) snprintf(buf, size, "%pI4:%u", &ua->ipv4, ntohs(ua->port)); else if (ntohs(ua->proto) == ETH_P_IPV6) snprintf(buf, size, "%pI6:%u", &ua->ipv6, ntohs(ua->port)); - else + else { pr_err("Invalid UDP media address\n"); + return 1; + } + return 0; } diff --git a/net/wireless/nl80211.c b/net/wireless/nl80211.c index a1ececec947b..4321fff1ef61 100644 --- a/net/wireless/nl80211.c +++ b/net/wireless/nl80211.c @@ -3491,10 +3491,7 @@ static void get_key_callback(void *c, struct key_params *params) struct nlattr *key; struct get_key_cookie *cookie = c; - if ((params->key && - nla_put(cookie->msg, NL80211_ATTR_KEY_DATA, - params->key_len, params->key)) || - (params->seq && + if ((params->seq && nla_put(cookie->msg, NL80211_ATTR_KEY_SEQ, params->seq_len, params->seq)) || (params->cipher && @@ -3506,10 +3503,7 @@ static void get_key_callback(void *c, struct key_params *params) if (!key) goto nla_put_failure; - if ((params->key && - nla_put(cookie->msg, NL80211_KEY_DATA, - params->key_len, params->key)) || - (params->seq && + if ((params->seq && nla_put(cookie->msg, NL80211_KEY_SEQ, params->seq_len, params->seq)) || (params->cipher && diff --git a/net/wireless/scan.c b/net/wireless/scan.c index 9c0f1b9ef1ae..6a8b4d331281 100644 --- a/net/wireless/scan.c +++ b/net/wireless/scan.c @@ -1888,10 +1888,14 @@ int cfg80211_wext_siwscan(struct net_device *dev, wiphy = &rdev->wiphy; /* Determine number of channels, needed to allocate creq */ - if (wreq && wreq->num_channels) + if (wreq && wreq->num_channels) { + /* Passed from userspace so should be checked */ + if (unlikely(wreq->num_channels > IW_MAX_FREQUENCIES)) + return -EINVAL; n_channels = wreq->num_channels; - else + } else { n_channels = ieee80211_get_num_supported_channels(wiphy); + } creq = kzalloc(sizeof(*creq) + sizeof(struct cfg80211_ssid) + n_channels * sizeof(void *), diff --git a/net/wireless/util.c b/net/wireless/util.c index 1049466aff9f..31afb9d22b83 100644 --- a/net/wireless/util.c +++ b/net/wireless/util.c @@ -1262,7 +1262,7 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate) 2048, /* 1.000000... */ }; u32 rates_160M[3] = { 960777777, 907400000, 816666666 }; - u32 rates_969[3] = { 480388888, 453700000, 408333333 }; + u32 rates_996[3] = { 480388888, 453700000, 408333333 }; u32 rates_484[3] = { 229411111, 216666666, 195000000 }; u32 rates_242[3] = { 114711111, 108333333, 97500000 }; u32 rates_106[3] = { 40000000, 37777777, 34000000 }; @@ -1282,12 +1282,14 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate) if (WARN_ON_ONCE(rate->nss < 1 || rate->nss > 8)) return 0; - if (rate->bw == RATE_INFO_BW_160) + if (rate->bw == RATE_INFO_BW_160 || + (rate->bw == RATE_INFO_BW_HE_RU && + rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_2x996)) result = rates_160M[rate->he_gi]; else if (rate->bw == RATE_INFO_BW_80 || (rate->bw == RATE_INFO_BW_HE_RU && rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_996)) - result = rates_969[rate->he_gi]; + result = rates_996[rate->he_gi]; else if (rate->bw == RATE_INFO_BW_40 || (rate->bw == RATE_INFO_BW_HE_RU && rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_484)) diff --git a/scripts/gcc-plugins/gcc-common.h b/scripts/gcc-plugins/gcc-common.h index 9ad76b7f3f10..0907ab19202a 100644 --- a/scripts/gcc-plugins/gcc-common.h +++ b/scripts/gcc-plugins/gcc-common.h @@ -977,4 +977,8 @@ static inline void debug_gimple_stmt(const_gimple s) #define SET_DECL_MODE(decl, mode) DECL_MODE(decl) = (mode) #endif +#if BUILDING_GCC_VERSION >= 14000 +#define last_stmt(x) last_nondebug_stmt(x) +#endif + #endif diff --git a/scripts/gcc-x86_32-has-stack-protector.sh b/scripts/gcc-x86_32-has-stack-protector.sh index f5c119495254..e05020116b37 100755 --- a/scripts/gcc-x86_32-has-stack-protector.sh +++ b/scripts/gcc-x86_32-has-stack-protector.sh @@ -1,4 +1,4 @@ #!/bin/sh # SPDX-License-Identifier: GPL-2.0 -echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m32 -O0 -fstack-protector - -o - 2> /dev/null | grep -q "%gs" +echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m32 -O0 -fstack-protector - -o - 2> /dev/null | grep -q "%gs" diff --git a/scripts/gcc-x86_64-has-stack-protector.sh b/scripts/gcc-x86_64-has-stack-protector.sh index 75e4e22b986a..f680bb01aeeb 100755 --- a/scripts/gcc-x86_64-has-stack-protector.sh +++ b/scripts/gcc-x86_64-has-stack-protector.sh @@ -1,4 +1,4 @@ #!/bin/sh # SPDX-License-Identifier: GPL-2.0 -echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs" +echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs" diff --git a/scripts/kconfig/expr.c b/scripts/kconfig/expr.c index 7e38070ee523..1c69de8cacf6 100644 --- a/scripts/kconfig/expr.c +++ b/scripts/kconfig/expr.c @@ -395,35 +395,6 @@ static struct expr *expr_eliminate_yn(struct expr *e) return e; } -/* - * bool FOO!=n => FOO - */ -struct expr *expr_trans_bool(struct expr *e) -{ - if (!e) - return NULL; - switch (e->type) { - case E_AND: - case E_OR: - case E_NOT: - e->left.expr = expr_trans_bool(e->left.expr); - e->right.expr = expr_trans_bool(e->right.expr); - break; - case E_UNEQUAL: - // FOO!=n -> FOO - if (e->left.sym->type == S_TRISTATE) { - if (e->right.sym == &symbol_no) { - e->type = E_SYMBOL; - e->right.sym = NULL; - } - } - break; - default: - ; - } - return e; -} - /* * e1 || e2 -> ? */ diff --git a/scripts/kconfig/expr.h b/scripts/kconfig/expr.h index 43a87f8ea738..968219750244 100644 --- a/scripts/kconfig/expr.h +++ b/scripts/kconfig/expr.h @@ -302,7 +302,6 @@ struct expr *expr_copy(const struct expr *org); void expr_free(struct expr *e); void expr_eliminate_eq(struct expr **ep1, struct expr **ep2); tristate expr_calc_value(struct expr *e); -struct expr *expr_trans_bool(struct expr *e); struct expr *expr_eliminate_dups(struct expr *e); struct expr *expr_transform(struct expr *e); int expr_contains_symbol(struct expr *dep, struct symbol *sym); diff --git a/scripts/kconfig/gconf.c b/scripts/kconfig/gconf.c index 36f578415c4a..5e0ea015394e 100644 --- a/scripts/kconfig/gconf.c +++ b/scripts/kconfig/gconf.c @@ -1485,7 +1485,6 @@ int main(int ac, char *av[]) conf_parse(name); fixup_rootmenu(&rootmenu); - conf_read(NULL); /* Load the interface and connect signals */ init_main_window(glade_file); @@ -1493,6 +1492,8 @@ int main(int ac, char *av[]) init_left_tree(); init_right_tree(); + conf_read(NULL); + switch (view_mode) { case SINGLE_VIEW: display_tree_part(); diff --git a/scripts/kconfig/menu.c b/scripts/kconfig/menu.c index 4cf15d449c05..4d48ff3083bd 100644 --- a/scripts/kconfig/menu.c +++ b/scripts/kconfig/menu.c @@ -390,8 +390,6 @@ void menu_finalize(struct menu *parent) dep = expr_transform(dep); dep = expr_alloc_and(expr_copy(basedep), dep); dep = expr_eliminate_dups(dep); - if (menu->sym && menu->sym->type != S_TRISTATE) - dep = expr_trans_bool(dep); prop->visible.expr = dep; /* diff --git a/security/selinux/avc.c b/security/selinux/avc.c index b1b74431d351..74ab8890c1ae 100644 --- a/security/selinux/avc.c +++ b/security/selinux/avc.c @@ -401,12 +401,12 @@ static int avc_add_xperms_decision(struct avc_node *node, { struct avc_xperms_decision_node *dest_xpd; - node->ae.xp_node->xp.len++; dest_xpd = avc_xperms_decision_alloc(src->used); if (!dest_xpd) return -ENOMEM; avc_copy_xperms_decision(&dest_xpd->xpd, src); list_add(&dest_xpd->xpd_list, &node->ae.xp_node->xpd_head); + node->ae.xp_node->xp.len++; return 0; } diff --git a/sound/core/pcm_dmaengine.c b/sound/core/pcm_dmaengine.c index 6f6da1128edc..80188d5c1118 100644 --- a/sound/core/pcm_dmaengine.c +++ b/sound/core/pcm_dmaengine.c @@ -354,6 +354,12 @@ EXPORT_SYMBOL_GPL(snd_dmaengine_pcm_open_request_chan); int snd_dmaengine_pcm_close(struct snd_pcm_substream *substream) { struct dmaengine_pcm_runtime_data *prtd = substream_to_prtd(substream); + struct dma_tx_state state; + enum dma_status status; + + status = dmaengine_tx_status(prtd->dma_chan, prtd->cookie, &state); + if (status == DMA_PAUSED) + dmaengine_terminate_async(prtd->dma_chan); dmaengine_synchronize(prtd->dma_chan); kfree(prtd); @@ -371,6 +377,12 @@ EXPORT_SYMBOL_GPL(snd_dmaengine_pcm_close); int snd_dmaengine_pcm_close_release_chan(struct snd_pcm_substream *substream) { struct dmaengine_pcm_runtime_data *prtd = substream_to_prtd(substream); + struct dma_tx_state state; + enum dma_status status; + + status = dmaengine_tx_status(prtd->dma_chan, prtd->cookie, &state); + if (status == DMA_PAUSED) + dmaengine_terminate_async(prtd->dma_chan); dmaengine_synchronize(prtd->dma_chan); dma_release_channel(prtd->dma_chan); diff --git a/sound/core/timer.c b/sound/core/timer.c index 8069ca4deeda..5f63e6096b88 100644 --- a/sound/core/timer.c +++ b/sound/core/timer.c @@ -532,7 +532,7 @@ static int snd_timer_start1(struct snd_timer_instance *timeri, /* check the actual time for the start tick; * bail out as error if it's way too low (< 100us) */ - if (start) { + if (start && !(timer->hw.flags & SNDRV_TIMER_HW_SLAVE)) { if ((u64)snd_timer_hw_resolution(timer) * ticks < 100000) { result = -EINVAL; goto unlock; diff --git a/sound/soc/intel/boards/bytcr_rt5640.c b/sound/soc/intel/boards/bytcr_rt5640.c index 19f425eb4a40..16e2ab290375 100644 --- a/sound/soc/intel/boards/bytcr_rt5640.c +++ b/sound/soc/intel/boards/bytcr_rt5640.c @@ -474,6 +474,17 @@ static const struct dmi_system_id byt_rt5640_quirk_table[] = { BYT_RT5640_SSP0_AIF1 | BYT_RT5640_MCLK_EN), }, + { + .matches = { + DMI_EXACT_MATCH(DMI_SYS_VENDOR, "ARCHOS"), + DMI_EXACT_MATCH(DMI_PRODUCT_NAME, "ARCHOS 101 CESIUM"), + }, + .driver_data = (void *)(BYTCR_INPUT_DEFAULTS | + BYT_RT5640_JD_NOT_INV | + BYT_RT5640_DIFF_MIC | + BYT_RT5640_SSP0_AIF1 | + BYT_RT5640_MCLK_EN), + }, { .matches = { DMI_EXACT_MATCH(DMI_SYS_VENDOR, "ARCHOS"), diff --git a/sound/usb/line6/driver.c b/sound/usb/line6/driver.c index 8970d4b3b42c..cff8714cde2e 100644 --- a/sound/usb/line6/driver.c +++ b/sound/usb/line6/driver.c @@ -300,12 +300,14 @@ static void line6_data_received(struct urb *urb) { struct usb_line6 *line6 = (struct usb_line6 *)urb->context; struct midi_buffer *mb = &line6->line6midi->midibuf_in; + unsigned long flags; int done; if (urb->status == -ESHUTDOWN) return; if (line6->properties->capabilities & LINE6_CAP_CONTROL_MIDI) { + spin_lock_irqsave(&line6->line6midi->lock, flags); done = line6_midibuf_write(mb, urb->transfer_buffer, urb->actual_length); @@ -314,12 +316,15 @@ static void line6_data_received(struct urb *urb) dev_dbg(line6->ifcdev, "%d %d buffer overflow - message skipped\n", done, urb->actual_length); } + spin_unlock_irqrestore(&line6->line6midi->lock, flags); for (;;) { + spin_lock_irqsave(&line6->line6midi->lock, flags); done = line6_midibuf_read(mb, line6->buffer_message, LINE6_MIDI_MESSAGE_MAXLEN, LINE6_MIDIBUF_READ_RX); + spin_unlock_irqrestore(&line6->line6midi->lock, flags); if (done <= 0) break; diff --git a/sound/usb/quirks-table.h b/sound/usb/quirks-table.h index 6c546f520f99..50fddefbd3cc 100644 --- a/sound/usb/quirks-table.h +++ b/sound/usb/quirks-table.h @@ -352,6 +352,7 @@ YAMAHA_DEVICE(0x105a, NULL), YAMAHA_DEVICE(0x105b, NULL), YAMAHA_DEVICE(0x105c, NULL), YAMAHA_DEVICE(0x105d, NULL), +YAMAHA_DEVICE(0x1718, "P-125"), { USB_DEVICE(0x0499, 0x1503), .driver_info = (unsigned long) & (const struct snd_usb_audio_quirk) { diff --git a/sound/usb/stream.c b/sound/usb/stream.c index 63885209aebb..4d8b9a0bf458 100644 --- a/sound/usb/stream.c +++ b/sound/usb/stream.c @@ -254,8 +254,8 @@ static struct snd_pcm_chmap_elem *convert_chmap(int channels, unsigned int bits, SNDRV_CHMAP_FR, /* right front */ SNDRV_CHMAP_FC, /* center front */ SNDRV_CHMAP_LFE, /* LFE */ - SNDRV_CHMAP_SL, /* left surround */ - SNDRV_CHMAP_SR, /* right surround */ + SNDRV_CHMAP_RL, /* left surround */ + SNDRV_CHMAP_RR, /* right surround */ SNDRV_CHMAP_FLC, /* left of center */ SNDRV_CHMAP_FRC, /* right of center */ SNDRV_CHMAP_RC, /* surround */ diff --git a/tools/include/linux/align.h b/tools/include/linux/align.h new file mode 100644 index 000000000000..a27bc1edf6e5 --- /dev/null +++ b/tools/include/linux/align.h @@ -0,0 +1,12 @@ +/* SPDX-License-Identifier: GPL-2.0-only */ + +#ifndef _TOOLS_LINUX_ALIGN_H +#define _TOOLS_LINUX_ALIGN_H + +#include + +#define ALIGN(x, a) __ALIGN_KERNEL((x), (a)) +#define ALIGN_DOWN(x, a) __ALIGN_KERNEL((x) - ((a) - 1), (a)) +#define IS_ALIGNED(x, a) (((x) & ((typeof(x))(a) - 1)) == 0) + +#endif /* _TOOLS_LINUX_ALIGN_H */ diff --git a/tools/include/linux/bitmap.h b/tools/include/linux/bitmap.h index e63662db131b..b5abe59bad40 100644 --- a/tools/include/linux/bitmap.h +++ b/tools/include/linux/bitmap.h @@ -3,6 +3,7 @@ #define _PERF_BITOPS_H #include +#include #include #include #include @@ -27,13 +28,14 @@ int __bitmap_and(unsigned long *dst, const unsigned long *bitmap1, #define small_const_nbits(nbits) \ (__builtin_constant_p(nbits) && (nbits) <= BITS_PER_LONG) +#define bitmap_size(nbits) (ALIGN(nbits, BITS_PER_LONG) / BITS_PER_BYTE) + static inline void bitmap_zero(unsigned long *dst, int nbits) { if (small_const_nbits(nbits)) *dst = 0UL; else { - int len = BITS_TO_LONGS(nbits) * sizeof(unsigned long); - memset(dst, 0, len); + memset(dst, 0, bitmap_size(nbits)); } } @@ -119,7 +121,7 @@ static inline int test_and_clear_bit(int nr, unsigned long *addr) */ static inline unsigned long *bitmap_alloc(int nbits) { - return calloc(1, BITS_TO_LONGS(nbits) * sizeof(unsigned long)); + return calloc(1, bitmap_size(nbits)); } /* diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat index 305ded17e741..8c952e1b0f23 100644 --- a/tools/memory-model/lock.cat +++ b/tools/memory-model/lock.cat @@ -105,19 +105,19 @@ let rf-lf = rfe-lf | rfi-lf * within one of the lock's critical sections returns False. *) -(* rfi for RU events: an RU may read from the last po-previous UL *) -let rfi-ru = ([UL] ; po-loc ; [RU]) \ ([UL] ; po-loc ; [LKW] ; po-loc) - -(* rfe for RU events: an RU may read from an external UL or the initial write *) -let all-possible-rfe-ru = - let possible-rfe-ru r = +(* + * rf for RU events: an RU may read from an external UL or the initial write, + * or from the last po-previous UL + *) +let all-possible-rf-ru = + let possible-rf-ru r = let pair-to-relation p = p ++ 0 - in map pair-to-relation (((UL | IW) * {r}) & loc & ext) - in map possible-rfe-ru RU + in map pair-to-relation ((((UL | IW) * {r}) & loc & ext) | + (((UL * {r}) & po-loc) \ ([UL] ; po-loc ; [LKW] ; po-loc))) + in map possible-rf-ru RU (* Generate all rf relations for RU events *) -with rfe-ru from cross(all-possible-rfe-ru) -let rf-ru = rfe-ru | rfi-ru +with rf-ru from cross(all-possible-rf-ru) (* Final rf relation *) let rf = rf | rf-lf | rf-ru diff --git a/tools/perf/util/sort.c b/tools/perf/util/sort.c index 66e11e6bb719..a9a10cba8957 100644 --- a/tools/perf/util/sort.c +++ b/tools/perf/util/sort.c @@ -256,7 +256,7 @@ sort__sym_cmp(struct hist_entry *left, struct hist_entry *right) * comparing symbol address alone is not enough since it's a * relative address within a dso. */ - if (!hists__has(left->hists, dso) || hists__has(right->hists, dso)) { + if (!hists__has(left->hists, dso)) { ret = sort__dso_cmp(left, right); if (ret != 0) return ret; diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c index a7fc91bb9119..b9deed81656b 100644 --- a/tools/testing/selftests/bpf/test_sockmap.c +++ b/tools/testing/selftests/bpf/test_sockmap.c @@ -395,7 +395,8 @@ static int msg_loop(int fd, int iov_count, int iov_length, int cnt, } } - s->bytes_recvd += recv; + if (recv > 0) + s->bytes_recvd += recv; if (data_test) { int j; diff --git a/tools/testing/selftests/net/forwarding/devlink_lib.sh b/tools/testing/selftests/net/forwarding/devlink_lib.sh index 5ab1e5f43022..ea708b6c1e00 100644 --- a/tools/testing/selftests/net/forwarding/devlink_lib.sh +++ b/tools/testing/selftests/net/forwarding/devlink_lib.sh @@ -105,4 +105,6 @@ devlink_reload() still_pending=$(devlink resource show "$DEVLINK_DEV" | \ grep -c "size_new") check_err $still_pending "Failed reload - There are still unset sizes" + + udevadm settle } diff --git a/tools/testing/selftests/sigaltstack/current_stack_pointer.h b/tools/testing/selftests/sigaltstack/current_stack_pointer.h index ea9bdf3a90b1..09da8f1011ce 100644 --- a/tools/testing/selftests/sigaltstack/current_stack_pointer.h +++ b/tools/testing/selftests/sigaltstack/current_stack_pointer.h @@ -8,7 +8,7 @@ register unsigned long sp asm("sp"); register unsigned long sp asm("esp"); #elif __loongarch64 register unsigned long sp asm("$sp"); -#elif __ppc__ +#elif __powerpc__ register unsigned long sp asm("r1"); #elif __s390x__ register unsigned long sp asm("%15"); diff --git a/tools/testing/selftests/vDSO/parse_vdso.c b/tools/testing/selftests/vDSO/parse_vdso.c index 1dbb4b87268f..9ef3ad3789c1 100644 --- a/tools/testing/selftests/vDSO/parse_vdso.c +++ b/tools/testing/selftests/vDSO/parse_vdso.c @@ -77,14 +77,20 @@ static struct vdso_info ELF(Verdef) *verdef; } vdso_info; -/* Straight from the ELF specification. */ -static unsigned long elf_hash(const unsigned char *name) +/* + * Straight from the ELF specification...and then tweaked slightly, in order to + * avoid a few clang warnings. + */ +static unsigned long elf_hash(const char *name) { unsigned long h = 0, g; - while (*name) + const unsigned char *uch_name = (const unsigned char *)name; + + while (*uch_name) { - h = (h << 4) + *name++; - if (g = h & 0xf0000000) + h = (h << 4) + *uch_name++; + g = h & 0xf0000000; + if (g) h ^= g >> 24; h &= ~g; } diff --git a/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c b/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c index 93b0ebf8cc38..805e8c189276 100644 --- a/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c +++ b/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c @@ -20,7 +20,7 @@ extern void *vdso_sym(const char *version, const char *name); extern void vdso_init_from_sysinfo_ehdr(uintptr_t base); extern void vdso_init_from_auxv(void *auxv); -/* We need a libc functions... */ +/* We need some libc functions... */ int strcmp(const char *a, const char *b) { /* This implementation is buggy: it never returns -1. */ @@ -36,6 +36,20 @@ int strcmp(const char *a, const char *b) return 0; } +/* + * The clang build needs this, although gcc does not. + * Stolen from lib/string.c. + */ +void *memcpy(void *dest, const void *src, size_t count) +{ + char *tmp = dest; + const char *s = src; + + while (count--) + *tmp++ = *s++; + return dest; +} + /* ...and two syscalls. This is x86-specific. */ static inline long x86_syscall3(long nr, long a0, long a1, long a2) { @@ -72,7 +86,7 @@ void to_base10(char *lastdig, time_t n) } } -__attribute__((externally_visible)) void c_main(void **stack) +void c_main(void **stack) { /* Parse the stack */ long argc = (long)*stack;